about summary refs log tree commit diff
path: root/third_party/abseil_cpp/absl/time
diff options
context:
space:
mode:
Diffstat (limited to '')
-rw-r--r--third_party/abseil_cpp/absl/time/BUILD.bazel124
-rw-r--r--third_party/abseil_cpp/absl/time/CMakeLists.txt127
-rw-r--r--third_party/abseil_cpp/absl/time/civil_time.cc175
-rw-r--r--third_party/abseil_cpp/absl/time/civil_time.h538
-rw-r--r--third_party/abseil_cpp/absl/time/civil_time_benchmark.cc127
-rw-r--r--third_party/abseil_cpp/absl/time/civil_time_test.cc1243
-rw-r--r--third_party/abseil_cpp/absl/time/clock.cc569
-rw-r--r--third_party/abseil_cpp/absl/time/clock.h74
-rw-r--r--third_party/abseil_cpp/absl/time/clock_benchmark.cc74
-rw-r--r--third_party/abseil_cpp/absl/time/clock_test.cc118
-rw-r--r--third_party/abseil_cpp/absl/time/duration.cc951
-rw-r--r--third_party/abseil_cpp/absl/time/duration_benchmark.cc428
-rw-r--r--third_party/abseil_cpp/absl/time/duration_test.cc1808
-rw-r--r--third_party/abseil_cpp/absl/time/format.cc163
-rw-r--r--third_party/abseil_cpp/absl/time/format_benchmark.cc64
-rw-r--r--third_party/abseil_cpp/absl/time/format_test.cc441
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/BUILD.bazel166
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/civil_time.h332
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/civil_time_detail.h622
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/time_zone.h384
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/zone_info_source.h102
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/cctz_benchmark.cc1030
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/civil_time_detail.cc94
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/civil_time_test.cc1056
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_fixed.cc140
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_fixed.h52
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_format.cc922
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_format_test.cc1500
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_if.cc45
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_if.h76
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_impl.cc121
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_impl.h93
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_info.cc958
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_info.h138
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_libc.cc308
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_libc.h55
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_lookup.cc187
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_lookup_test.cc1438
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_posix.cc159
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_posix.h132
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/tzfile.h122
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/src/zone_info_source.cc115
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/README.zoneinfo37
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/version1
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Abidjanbin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Accrabin0 -> 816 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Addis_Abababin0 -> 251 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Algiersbin0 -> 735 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmarabin0 -> 251 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmerabin0 -> 251 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bamakobin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Banguibin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Banjulbin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bissaubin0 -> 194 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Blantyrebin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Brazzavillebin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bujumburabin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Cairobin0 -> 1955 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Casablancabin0 -> 2429 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ceutabin0 -> 2036 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Conakrybin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dakarbin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dar_es_Salaambin0 -> 251 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Djiboutibin0 -> 251 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Doualabin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/El_Aaiunbin0 -> 2295 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Freetownbin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Gaboronebin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Hararebin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Johannesburgbin0 -> 246 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Jubabin0 -> 653 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kampalabin0 -> 251 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Khartoumbin0 -> 679 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kigalibin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kinshasabin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lagosbin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Librevillebin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lomebin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Luandabin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lubumbashibin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lusakabin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Malabobin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maputobin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maserubin0 -> 246 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mbabanebin0 -> 246 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mogadishubin0 -> 251 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Monroviabin0 -> 208 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nairobibin0 -> 251 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ndjamenabin0 -> 199 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Niameybin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nouakchottbin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ouagadougoubin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Porto-Novobin0 -> 149 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Sao_Tomebin0 -> 254 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Timbuktubin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tripolibin0 -> 625 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tunisbin0 -> 689 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Windhoekbin0 -> 955 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Adakbin0 -> 2356 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anchoragebin0 -> 2371 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anguillabin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Antiguabin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Araguainabin0 -> 884 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Buenos_Airesbin0 -> 1076 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Catamarcabin0 -> 1076 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/ComodRivadaviabin0 -> 1076 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Cordobabin0 -> 1076 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Jujuybin0 -> 1048 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/La_Riojabin0 -> 1090 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Mendozabin0 -> 1076 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Rio_Gallegosbin0 -> 1076 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Saltabin0 -> 1048 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Juanbin0 -> 1090 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Luisbin0 -> 1102 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Tucumanbin0 -> 1104 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Ushuaiabin0 -> 1076 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Arubabin0 -> 186 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Asuncionbin0 -> 2044 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atikokanbin0 -> 336 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atkabin0 -> 2356 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahiabin0 -> 1024 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia_Banderasbin0 -> 1546 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Barbadosbin0 -> 314 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belembin0 -> 576 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belizebin0 -> 948 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Blanc-Sablonbin0 -> 298 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boa_Vistabin0 -> 632 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bogotabin0 -> 246 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boisebin0 -> 2394 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Buenos_Airesbin0 -> 1076 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cambridge_Baybin0 -> 2084 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Campo_Grandebin0 -> 1444 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cancunbin0 -> 782 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Caracasbin0 -> 264 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Catamarcabin0 -> 1076 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cayennebin0 -> 198 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Caymanbin0 -> 182 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chicagobin0 -> 3576 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chihuahuabin0 -> 1484 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Coral_Harbourbin0 -> 336 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cordobabin0 -> 1076 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Costa_Ricabin0 -> 316 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Crestonbin0 -> 208 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cuiababin0 -> 1416 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Curacaobin0 -> 186 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Danmarkshavnbin0 -> 698 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawsonbin0 -> 1600 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson_Creekbin0 -> 1050 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Denverbin0 -> 2444 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Detroitbin0 -> 2230 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dominicabin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Edmontonbin0 -> 2332 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Eirunepebin0 -> 656 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/El_Salvadorbin0 -> 224 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ensenadabin0 -> 2342 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Nelsonbin0 -> 2240 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Waynebin0 -> 1666 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fortalezabin0 -> 716 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Glace_Baybin0 -> 2192 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Godthabbin0 -> 1878 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Goose_Baybin0 -> 3210 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grand_Turkbin0 -> 1848 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grenadabin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guadeloupebin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guatemalabin0 -> 280 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guayaquilbin0 -> 246 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guyanabin0 -> 236 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Halifaxbin0 -> 3424 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Havanabin0 -> 2416 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Hermosillobin0 -> 416 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Indianapolisbin0 -> 1666 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Knoxbin0 -> 2428 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Marengobin0 -> 1722 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Petersburgbin0 -> 1904 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Tell_Citybin0 -> 1684 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vevaybin0 -> 1414 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vincennesbin0 -> 1694 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Winamacbin0 -> 1778 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indianapolisbin0 -> 1666 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Inuvikbin0 -> 1894 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Iqaluitbin0 -> 2032 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jamaicabin0 -> 482 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jujuybin0 -> 1048 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Juneaubin0 -> 2353 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Louisvillebin0 -> 2772 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Monticellobin0 -> 2352 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Knox_INbin0 -> 2428 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kralendijkbin0 -> 186 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/La_Pazbin0 -> 232 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Limabin0 -> 406 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Los_Angelesbin0 -> 2836 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Louisvillebin0 -> 2772 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Lower_Princesbin0 -> 186 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Maceiobin0 -> 744 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Managuabin0 -> 430 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Manausbin0 -> 604 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Marigotbin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Martiniquebin0 -> 232 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Matamorosbin0 -> 1390 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mazatlanbin0 -> 1526 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mendozabin0 -> 1076 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Menomineebin0 -> 2274 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Meridabin0 -> 1422 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Metlakatlabin0 -> 1423 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mexico_Citybin0 -> 1584 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Miquelonbin0 -> 1666 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Monctonbin0 -> 3154 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Monterreybin0 -> 1390 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montevideobin0 -> 1510 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montrealbin0 -> 3494 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montserratbin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nassaubin0 -> 2258 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/New_Yorkbin0 -> 3536 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nipigonbin0 -> 2122 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nomebin0 -> 2367 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Noronhabin0 -> 716 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Beulahbin0 -> 2380 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Centerbin0 -> 2380 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/New_Salembin0 -> 2380 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nuukbin0 -> 1878 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ojinagabin0 -> 1484 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Panamabin0 -> 182 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Pangnirtungbin0 -> 2094 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Paramaribobin0 -> 262 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Phoenixbin0 -> 328 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port-au-Princebin0 -> 1434 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port_of_Spainbin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Acrebin0 -> 628 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Velhobin0 -> 576 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Puerto_Ricobin0 -> 246 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Punta_Arenasbin0 -> 1902 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rainy_Riverbin0 -> 2122 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rankin_Inletbin0 -> 1892 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Recifebin0 -> 716 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Reginabin0 -> 980 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Resolutebin0 -> 1892 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rio_Brancobin0 -> 628 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rosariobin0 -> 1076 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santa_Isabelbin0 -> 2342 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santarembin0 -> 602 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santiagobin0 -> 2529 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santo_Domingobin0 -> 458 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sao_Paulobin0 -> 1444 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Scoresbysundbin0 -> 1916 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Shiprockbin0 -> 2444 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sitkabin0 -> 2329 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Barthelemybin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Johnsbin0 -> 3655 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Kittsbin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Luciabin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Thomasbin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Vincentbin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Swift_Currentbin0 -> 560 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tegucigalpabin0 -> 252 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thulebin0 -> 1502 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thunder_Baybin0 -> 2202 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tijuanabin0 -> 2342 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Torontobin0 -> 3494 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tortolabin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Vancouverbin0 -> 2892 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Virginbin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Whitehorsebin0 -> 1600 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Winnipegbin0 -> 2868 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yakutatbin0 -> 2305 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yellowknifebin0 -> 1966 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Caseybin0 -> 297 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Davisbin0 -> 297 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/DumontDUrvillebin0 -> 194 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Macquariebin0 -> 1520 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Mawsonbin0 -> 199 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/McMurdobin0 -> 2437 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Palmerbin0 -> 1418 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Rotherabin0 -> 164 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/South_Polebin0 -> 2437 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Syowabin0 -> 165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Trollbin0 -> 1162 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Vostokbin0 -> 165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Arctic/Longyearbyenbin0 -> 2228 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Adenbin0 -> 165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Almatybin0 -> 997 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ammanbin0 -> 1853 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Anadyrbin0 -> 1188 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtaubin0 -> 983 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtobebin0 -> 1011 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashgabatbin0 -> 619 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashkhabadbin0 -> 619 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Atyraubin0 -> 991 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baghdadbin0 -> 983 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bahrainbin0 -> 199 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bakubin0 -> 1227 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bangkokbin0 -> 199 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Barnaulbin0 -> 1221 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Beirutbin0 -> 2154 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bishkekbin0 -> 983 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bruneibin0 -> 203 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Calcuttabin0 -> 285 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chitabin0 -> 1221 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Choibalsanbin0 -> 949 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chongqingbin0 -> 561 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chungkingbin0 -> 561 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Colombobin0 -> 372 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Daccabin0 -> 337 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Damascusbin0 -> 2294 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dhakabin0 -> 337 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dilibin0 -> 227 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dubaibin0 -> 165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dushanbebin0 -> 591 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Famagustabin0 -> 2028 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Gazabin0 -> 2316 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Harbinbin0 -> 561 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hebronbin0 -> 2344 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ho_Chi_Minhbin0 -> 351 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hong_Kongbin0 -> 1203 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hovdbin0 -> 891 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Irkutskbin0 -> 1243 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Istanbulbin0 -> 1947 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jakartabin0 -> 355 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jayapurabin0 -> 221 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jerusalembin0 -> 2288 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kabulbin0 -> 208 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kamchatkabin0 -> 1166 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Karachibin0 -> 379 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kashgarbin0 -> 165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kathmandubin0 -> 212 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Katmandubin0 -> 212 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Khandygabin0 -> 1271 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kolkatabin0 -> 285 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Krasnoyarskbin0 -> 1207 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuala_Lumpurbin0 -> 383 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuchingbin0 -> 483 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuwaitbin0 -> 165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macaobin0 -> 1227 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macaubin0 -> 1227 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Magadanbin0 -> 1222 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Makassarbin0 -> 254 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Manilabin0 -> 328 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Muscatbin0 -> 165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Nicosiabin0 -> 2002 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novokuznetskbin0 -> 1165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novosibirskbin0 -> 1221 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Omskbin0 -> 1207 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Oralbin0 -> 1005 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Phnom_Penhbin0 -> 199 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pontianakbin0 -> 353 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pyongyangbin0 -> 237 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qatarbin0 -> 199 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qostanaybin0 -> 1011 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qyzylordabin0 -> 1025 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Rangoonbin0 -> 268 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Riyadhbin0 -> 165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Saigonbin0 -> 351 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Sakhalinbin0 -> 1202 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Samarkandbin0 -> 577 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Seoulbin0 -> 617 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Shanghaibin0 -> 561 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Singaporebin0 -> 383 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Srednekolymskbin0 -> 1208 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Taipeibin0 -> 761 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tashkentbin0 -> 591 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tbilisibin0 -> 1035 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tehranbin0 -> 2582 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tel_Avivbin0 -> 2288 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimbubin0 -> 203 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimphubin0 -> 203 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tokyobin0 -> 309 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tomskbin0 -> 1221 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ujung_Pandangbin0 -> 254 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulaanbaatarbin0 -> 891 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulan_Batorbin0 -> 891 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Urumqibin0 -> 165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ust-Nerabin0 -> 1252 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vientianebin0 -> 199 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vladivostokbin0 -> 1208 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yakutskbin0 -> 1207 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yangonbin0 -> 268 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yekaterinburgbin0 -> 1243 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yerevanbin0 -> 1151 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Azoresbin0 -> 3484 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Bermudabin0 -> 1978 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Canarybin0 -> 1897 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Cape_Verdebin0 -> 270 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faeroebin0 -> 1815 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faroebin0 -> 1815 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Jan_Mayenbin0 -> 2228 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Madeirabin0 -> 3475 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Reykjavikbin0 -> 1162 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/South_Georgiabin0 -> 164 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/St_Helenabin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Stanleybin0 -> 1214 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/ACTbin0 -> 2204 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Adelaidebin0 -> 2222 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Brisbanebin0 -> 433 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Broken_Hillbin0 -> 2243 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Canberrabin0 -> 2204 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Curriebin0 -> 2204 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Darwinbin0 -> 304 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Euclabin0 -> 484 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Hobartbin0 -> 2316 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/LHIbin0 -> 1860 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lindemanbin0 -> 489 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lord_Howebin0 -> 1860 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Melbournebin0 -> 2204 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/NSWbin0 -> 2204 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Northbin0 -> 304 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Perthbin0 -> 460 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Queenslandbin0 -> 433 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Southbin0 -> 2222 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Sydneybin0 -> 2204 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Tasmaniabin0 -> 2316 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Victoriabin0 -> 2204 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Westbin0 -> 460 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Yancowinnabin0 -> 2243 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/Acrebin0 -> 628 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/DeNoronhabin0 -> 716 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/Eastbin0 -> 1444 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/Westbin0 -> 604 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/CETbin0 -> 2094 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/CST6CDTbin0 -> 2310 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Atlanticbin0 -> 3424 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Centralbin0 -> 2868 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Easternbin0 -> 3494 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Mountainbin0 -> 2332 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Newfoundlandbin0 -> 3655 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Pacificbin0 -> 2892 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Saskatchewanbin0 -> 980 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Yukonbin0 -> 1600 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/Continentalbin0 -> 2529 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/EasterIslandbin0 -> 2233 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Cubabin0 -> 2416 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/EETbin0 -> 1908 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/ESTbin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/EST5EDTbin0 -> 2310 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Egyptbin0 -> 1955 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Eirebin0 -> 3492 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMTbin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+0bin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+1bin0 -> 116 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+10bin0 -> 117 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+11bin0 -> 117 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+12bin0 -> 117 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+2bin0 -> 116 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+3bin0 -> 116 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+4bin0 -> 116 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+5bin0 -> 116 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+6bin0 -> 116 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+7bin0 -> 116 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+8bin0 -> 116 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+9bin0 -> 116 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-0bin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-1bin0 -> 117 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-10bin0 -> 118 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-11bin0 -> 118 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-12bin0 -> 118 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-13bin0 -> 118 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-14bin0 -> 118 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-2bin0 -> 117 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-3bin0 -> 117 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-4bin0 -> 117 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-5bin0 -> 117 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-6bin0 -> 117 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-7bin0 -> 117 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-8bin0 -> 117 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-9bin0 -> 117 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT0bin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Greenwichbin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UCTbin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UTCbin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Universalbin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Zulubin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Amsterdambin0 -> 2910 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Andorrabin0 -> 1742 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Astrakhanbin0 -> 1165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Athensbin0 -> 2262 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belfastbin0 -> 3648 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belgradebin0 -> 1920 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Berlinbin0 -> 2298 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bratislavabin0 -> 2301 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Brusselsbin0 -> 2933 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bucharestbin0 -> 2184 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Budapestbin0 -> 2368 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Busingenbin0 -> 1909 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Chisinaubin0 -> 2390 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Copenhagenbin0 -> 2137 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Dublinbin0 -> 3492 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Gibraltarbin0 -> 3052 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Guernseybin0 -> 3648 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Helsinkibin0 -> 1900 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Isle_of_Manbin0 -> 3648 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Istanbulbin0 -> 1947 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Jerseybin0 -> 3648 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kaliningradbin0 -> 1493 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kievbin0 -> 2088 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kirovbin0 -> 1153 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Lisbonbin0 -> 3469 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ljubljanabin0 -> 1920 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Londonbin0 -> 3648 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Luxembourgbin0 -> 2946 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Madridbin0 -> 2614 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Maltabin0 -> 2620 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Mariehamnbin0 -> 1900 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Minskbin0 -> 1321 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Monacobin0 -> 2944 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Moscowbin0 -> 1535 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Nicosiabin0 -> 2002 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Oslobin0 -> 2228 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Parisbin0 -> 2962 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Podgoricabin0 -> 1920 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Praguebin0 -> 2301 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Rigabin0 -> 2198 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Romebin0 -> 2641 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Samarabin0 -> 1215 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/San_Marinobin0 -> 2641 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sarajevobin0 -> 1920 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Saratovbin0 -> 1183 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Simferopolbin0 -> 1453 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Skopjebin0 -> 1920 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sofiabin0 -> 2077 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Stockholmbin0 -> 1909 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tallinnbin0 -> 2148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tiranebin0 -> 2084 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tiraspolbin0 -> 2390 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ulyanovskbin0 -> 1267 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Uzhgorodbin0 -> 2050 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vaduzbin0 -> 1909 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vaticanbin0 -> 2641 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Viennabin0 -> 2200 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vilniusbin0 -> 2162 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Volgogradbin0 -> 1165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Warsawbin0 -> 2654 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zagrebbin0 -> 1920 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zaporozhyebin0 -> 2106 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zurichbin0 -> 1909 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Factorybin0 -> 116 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GBbin0 -> 3648 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GB-Eirebin0 -> 3648 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMTbin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT+0bin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT-0bin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT0bin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Greenwichbin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/HSTbin0 -> 115 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Hongkongbin0 -> 1203 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Icelandbin0 -> 1162 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Antananarivobin0 -> 251 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Chagosbin0 -> 199 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Christmasbin0 -> 165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Cocosbin0 -> 174 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Comorobin0 -> 251 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Kerguelenbin0 -> 165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mahebin0 -> 165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Maldivesbin0 -> 199 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mauritiusbin0 -> 241 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mayottebin0 -> 251 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Reunionbin0 -> 165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Iranbin0 -> 2582 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Israelbin0 -> 2288 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Jamaicabin0 -> 482 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Japanbin0 -> 309 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Kwajaleinbin0 -> 316 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Libyabin0 -> 625 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/METbin0 -> 2094 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/MSTbin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/MST7MDTbin0 -> 2310 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaNortebin0 -> 2342 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaSurbin0 -> 1526 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/Generalbin0 -> 1584 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/NZbin0 -> 2437 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/NZ-CHATbin0 -> 2068 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Navajobin0 -> 2444 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/PRCbin0 -> 561 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/PST8PDTbin0 -> 2310 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Apiabin0 -> 1097 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Aucklandbin0 -> 2437 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Bougainvillebin0 -> 268 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chathambin0 -> 2068 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chuukbin0 -> 269 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Easterbin0 -> 2233 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Efatebin0 -> 466 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Enderburybin0 -> 234 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fakaofobin0 -> 200 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fijibin0 -> 1077 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Funafutibin0 -> 166 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Galapagosbin0 -> 238 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Gambierbin0 -> 164 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guadalcanalbin0 -> 166 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guambin0 -> 494 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Honolulubin0 -> 329 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Johnstonbin0 -> 329 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kiritimatibin0 -> 238 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kosraebin0 -> 351 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kwajaleinbin0 -> 316 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Majurobin0 -> 310 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Marquesasbin0 -> 173 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Midwaybin0 -> 175 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Naurubin0 -> 252 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Niuebin0 -> 241 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Norfolkbin0 -> 880 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Noumeabin0 -> 304 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pago_Pagobin0 -> 175 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Palaubin0 -> 180 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pitcairnbin0 -> 202 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pohnpeibin0 -> 303 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Ponapebin0 -> 303 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Port_Moresbybin0 -> 186 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Rarotongabin0 -> 577 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Saipanbin0 -> 494 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Samoabin0 -> 175 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tahitibin0 -> 165 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tarawabin0 -> 166 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tongatapubin0 -> 372 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Trukbin0 -> 269 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wakebin0 -> 166 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wallisbin0 -> 166 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Yapbin0 -> 269 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Polandbin0 -> 2654 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Portugalbin0 -> 3469 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/ROCbin0 -> 761 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/ROKbin0 -> 617 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Singaporebin0 -> 383 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Turkeybin0 -> 1947 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/UCTbin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Alaskabin0 -> 2371 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Aleutianbin0 -> 2356 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Arizonabin0 -> 328 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Centralbin0 -> 3576 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/East-Indianabin0 -> 1666 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Easternbin0 -> 3536 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Hawaiibin0 -> 329 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Indiana-Starkebin0 -> 2428 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Michiganbin0 -> 2230 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Mountainbin0 -> 2444 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Pacificbin0 -> 2836 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Samoabin0 -> 175 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/UTCbin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Universalbin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/W-SUbin0 -> 1535 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/WETbin0 -> 1905 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Zulubin0 -> 114 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/iso3166.tab274
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/localtimebin0 -> 148 bytes
-rw-r--r--third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/zone1970.tab384
-rw-r--r--third_party/abseil_cpp/absl/time/internal/get_current_time_chrono.inc31
-rw-r--r--third_party/abseil_cpp/absl/time/internal/get_current_time_posix.inc24
-rw-r--r--third_party/abseil_cpp/absl/time/internal/test_util.cc130
-rw-r--r--third_party/abseil_cpp/absl/time/internal/test_util.h33
-rw-r--r--third_party/abseil_cpp/absl/time/internal/zoneinfo.inc729
-rw-r--r--third_party/abseil_cpp/absl/time/time.cc499
-rw-r--r--third_party/abseil_cpp/absl/time/time.h1584
-rw-r--r--third_party/abseil_cpp/absl/time/time_benchmark.cc316
-rw-r--r--third_party/abseil_cpp/absl/time/time_test.cc1274
-rw-r--r--third_party/abseil_cpp/absl/time/time_zone_test.cc97
651 files changed, 22784 insertions, 0 deletions
diff --git a/third_party/abseil_cpp/absl/time/BUILD.bazel b/third_party/abseil_cpp/absl/time/BUILD.bazel
new file mode 100644
index 0000000000..9ab2adb886
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/BUILD.bazel
@@ -0,0 +1,124 @@
+#
+# Copyright 2017 The Abseil Authors.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      https://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+load("@rules_cc//cc:defs.bzl", "cc_library", "cc_test")
+load(
+    "//absl:copts/configure_copts.bzl",
+    "ABSL_DEFAULT_COPTS",
+    "ABSL_DEFAULT_LINKOPTS",
+    "ABSL_TEST_COPTS",
+)
+
+package(default_visibility = ["//visibility:public"])
+
+licenses(["notice"])  # Apache 2.0
+
+cc_library(
+    name = "time",
+    srcs = [
+        "civil_time.cc",
+        "clock.cc",
+        "duration.cc",
+        "format.cc",
+        "internal/get_current_time_chrono.inc",
+        "internal/get_current_time_posix.inc",
+        "time.cc",
+    ],
+    hdrs = [
+        "civil_time.h",
+        "clock.h",
+        "time.h",
+    ],
+    copts = ABSL_DEFAULT_COPTS,
+    linkopts = ABSL_DEFAULT_LINKOPTS,
+    deps = [
+        "//absl/base",
+        "//absl/base:core_headers",
+        "//absl/base:raw_logging_internal",
+        "//absl/numeric:int128",
+        "//absl/strings",
+        "//absl/time/internal/cctz:civil_time",
+        "//absl/time/internal/cctz:time_zone",
+    ],
+)
+
+cc_library(
+    name = "test_util",
+    testonly = 1,
+    srcs = [
+        "internal/test_util.cc",
+        "internal/zoneinfo.inc",
+    ],
+    hdrs = ["internal/test_util.h"],
+    copts = ABSL_DEFAULT_COPTS,
+    linkopts = ABSL_DEFAULT_LINKOPTS,
+    visibility = [
+        "//absl/time:__pkg__",
+    ],
+    deps = [
+        ":time",
+        "//absl/base:raw_logging_internal",
+        "//absl/time/internal/cctz:time_zone",
+        "@com_google_googletest//:gtest",
+    ],
+)
+
+cc_test(
+    name = "time_test",
+    srcs = [
+        "civil_time_test.cc",
+        "clock_test.cc",
+        "duration_test.cc",
+        "format_test.cc",
+        "time_test.cc",
+        "time_zone_test.cc",
+    ],
+    copts = ABSL_TEST_COPTS,
+    linkopts = ABSL_DEFAULT_LINKOPTS,
+    deps = [
+        ":test_util",
+        ":time",
+        "//absl/base:config",
+        "//absl/base:core_headers",
+        "//absl/numeric:int128",
+        "//absl/time/internal/cctz:time_zone",
+        "@com_google_googletest//:gtest_main",
+    ],
+)
+
+cc_test(
+    name = "time_benchmark",
+    srcs = [
+        "civil_time_benchmark.cc",
+        "clock_benchmark.cc",
+        "duration_benchmark.cc",
+        "format_benchmark.cc",
+        "time_benchmark.cc",
+    ],
+    copts = ABSL_TEST_COPTS,
+    linkopts = ABSL_DEFAULT_LINKOPTS,
+    tags = [
+        "benchmark",
+    ],
+    deps = [
+        ":test_util",
+        ":time",
+        "//absl/base",
+        "//absl/base:core_headers",
+        "//absl/hash",
+        "@com_github_google_benchmark//:benchmark_main",
+    ],
+)
diff --git a/third_party/abseil_cpp/absl/time/CMakeLists.txt b/third_party/abseil_cpp/absl/time/CMakeLists.txt
new file mode 100644
index 0000000000..853563e875
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/CMakeLists.txt
@@ -0,0 +1,127 @@
+#
+# Copyright 2017 The Abseil Authors.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#      https://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+absl_cc_library(
+  NAME
+    time
+  HDRS
+    "civil_time.h"
+    "clock.h"
+    "time.h"
+  SRCS
+    "civil_time.cc"
+    "clock.cc"
+    "duration.cc"
+    "format.cc"
+    "internal/get_current_time_chrono.inc"
+    "internal/get_current_time_posix.inc"
+    "time.cc"
+  COPTS
+    ${ABSL_DEFAULT_COPTS}
+  DEPS
+    absl::base
+    absl::civil_time
+    absl::core_headers
+    absl::int128
+    absl::raw_logging_internal
+    absl::strings
+    absl::time_zone
+  PUBLIC
+)
+
+absl_cc_library(
+  NAME
+    civil_time
+  HDRS
+    "internal/cctz/include/cctz/civil_time.h"
+    "internal/cctz/include/cctz/civil_time_detail.h"
+  SRCS
+  "internal/cctz/src/civil_time_detail.cc"
+  COPTS
+    ${ABSL_DEFAULT_COPTS}
+)
+
+if(APPLE)
+  find_library(CoreFoundation CoreFoundation)
+endif()
+
+absl_cc_library(
+  NAME
+    time_zone
+  HDRS
+    "internal/cctz/include/cctz/time_zone.h"
+    "internal/cctz/include/cctz/zone_info_source.h"
+  SRCS
+    "internal/cctz/src/time_zone_fixed.cc"
+    "internal/cctz/src/time_zone_fixed.h"
+    "internal/cctz/src/time_zone_format.cc"
+    "internal/cctz/src/time_zone_if.cc"
+    "internal/cctz/src/time_zone_if.h"
+    "internal/cctz/src/time_zone_impl.cc"
+    "internal/cctz/src/time_zone_impl.h"
+    "internal/cctz/src/time_zone_info.cc"
+    "internal/cctz/src/time_zone_info.h"
+    "internal/cctz/src/time_zone_libc.cc"
+    "internal/cctz/src/time_zone_libc.h"
+    "internal/cctz/src/time_zone_lookup.cc"
+    "internal/cctz/src/time_zone_posix.cc"
+    "internal/cctz/src/time_zone_posix.h"
+    "internal/cctz/src/tzfile.h"
+    "internal/cctz/src/zone_info_source.cc"
+  COPTS
+    ${ABSL_DEFAULT_COPTS}
+  DEPS
+    $<$<PLATFORM_ID:Darwin>:${CoreFoundation}>
+)
+
+absl_cc_library(
+  NAME
+    time_internal_test_util
+  HDRS
+    "internal/test_util.h"
+  SRCS
+    "internal/test_util.cc"
+    "internal/zoneinfo.inc"
+  COPTS
+    ${ABSL_DEFAULT_COPTS}
+  DEPS
+    absl::time
+    absl::raw_logging_internal
+    absl::time_zone
+    gmock
+  TESTONLY
+)
+
+absl_cc_test(
+  NAME
+    time_test
+  SRCS
+    "civil_time_test.cc"
+    "clock_test.cc"
+    "duration_test.cc"
+    "format_test.cc"
+    "time_test.cc"
+    "time_zone_test.cc"
+  COPTS
+    ${ABSL_TEST_COPTS}
+  DEPS
+    absl::time_internal_test_util
+    absl::time
+    absl::config
+    absl::core_headers
+    absl::time_zone
+    gmock_main
+)
diff --git a/third_party/abseil_cpp/absl/time/civil_time.cc b/third_party/abseil_cpp/absl/time/civil_time.cc
new file mode 100644
index 0000000000..c4202c7399
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/civil_time.cc
@@ -0,0 +1,175 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/time/civil_time.h"
+
+#include <cstdlib>
+#include <string>
+
+#include "absl/strings/str_cat.h"
+#include "absl/time/time.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+
+namespace {
+
+// Since a civil time has a larger year range than absl::Time (64-bit years vs
+// 64-bit seconds, respectively) we normalize years to roughly +/- 400 years
+// around the year 2400, which will produce an equivalent year in a range that
+// absl::Time can handle.
+inline civil_year_t NormalizeYear(civil_year_t year) {
+  return 2400 + year % 400;
+}
+
+// Formats the given CivilSecond according to the given format.
+std::string FormatYearAnd(string_view fmt, CivilSecond cs) {
+  const CivilSecond ncs(NormalizeYear(cs.year()), cs.month(), cs.day(),
+                        cs.hour(), cs.minute(), cs.second());
+  const TimeZone utc = UTCTimeZone();
+  // TODO(absl-team): Avoid conversion of fmt string.
+  return StrCat(cs.year(),
+                FormatTime(std::string(fmt), FromCivil(ncs, utc), utc));
+}
+
+template <typename CivilT>
+bool ParseYearAnd(string_view fmt, string_view s, CivilT* c) {
+  // Civil times support a larger year range than absl::Time, so we need to
+  // parse the year separately, normalize it, then use absl::ParseTime on the
+  // normalized string.
+  const std::string ss = std::string(s);  // TODO(absl-team): Avoid conversion.
+  const char* const np = ss.c_str();
+  char* endp;
+  errno = 0;
+  const civil_year_t y =
+      std::strtoll(np, &endp, 10);  // NOLINT(runtime/deprecated_fn)
+  if (endp == np || errno == ERANGE) return false;
+  const std::string norm = StrCat(NormalizeYear(y), endp);
+
+  const TimeZone utc = UTCTimeZone();
+  Time t;
+  if (ParseTime(StrCat("%Y", fmt), norm, utc, &t, nullptr)) {
+    const auto cs = ToCivilSecond(t, utc);
+    *c = CivilT(y, cs.month(), cs.day(), cs.hour(), cs.minute(), cs.second());
+    return true;
+  }
+
+  return false;
+}
+
+// Tries to parse the type as a CivilT1, but then assigns the result to the
+// argument of type CivilT2.
+template <typename CivilT1, typename CivilT2>
+bool ParseAs(string_view s, CivilT2* c) {
+  CivilT1 t1;
+  if (ParseCivilTime(s, &t1)) {
+    *c = CivilT2(t1);
+    return true;
+  }
+  return false;
+}
+
+template <typename CivilT>
+bool ParseLenient(string_view s, CivilT* c) {
+  // A fastpath for when the given string data parses exactly into the given
+  // type T (e.g., s="YYYY-MM-DD" and CivilT=CivilDay).
+  if (ParseCivilTime(s, c)) return true;
+  // Try parsing as each of the 6 types, trying the most common types first
+  // (based on csearch results).
+  if (ParseAs<CivilDay>(s, c)) return true;
+  if (ParseAs<CivilSecond>(s, c)) return true;
+  if (ParseAs<CivilHour>(s, c)) return true;
+  if (ParseAs<CivilMonth>(s, c)) return true;
+  if (ParseAs<CivilMinute>(s, c)) return true;
+  if (ParseAs<CivilYear>(s, c)) return true;
+  return false;
+}
+}  // namespace
+
+std::string FormatCivilTime(CivilSecond c) {
+  return FormatYearAnd("-%m-%dT%H:%M:%S", c);
+}
+std::string FormatCivilTime(CivilMinute c) {
+  return FormatYearAnd("-%m-%dT%H:%M", c);
+}
+std::string FormatCivilTime(CivilHour c) {
+  return FormatYearAnd("-%m-%dT%H", c);
+}
+std::string FormatCivilTime(CivilDay c) { return FormatYearAnd("-%m-%d", c); }
+std::string FormatCivilTime(CivilMonth c) { return FormatYearAnd("-%m", c); }
+std::string FormatCivilTime(CivilYear c) { return FormatYearAnd("", c); }
+
+bool ParseCivilTime(string_view s, CivilSecond* c) {
+  return ParseYearAnd("-%m-%dT%H:%M:%S", s, c);
+}
+bool ParseCivilTime(string_view s, CivilMinute* c) {
+  return ParseYearAnd("-%m-%dT%H:%M", s, c);
+}
+bool ParseCivilTime(string_view s, CivilHour* c) {
+  return ParseYearAnd("-%m-%dT%H", s, c);
+}
+bool ParseCivilTime(string_view s, CivilDay* c) {
+  return ParseYearAnd("-%m-%d", s, c);
+}
+bool ParseCivilTime(string_view s, CivilMonth* c) {
+  return ParseYearAnd("-%m", s, c);
+}
+bool ParseCivilTime(string_view s, CivilYear* c) {
+  return ParseYearAnd("", s, c);
+}
+
+bool ParseLenientCivilTime(string_view s, CivilSecond* c) {
+  return ParseLenient(s, c);
+}
+bool ParseLenientCivilTime(string_view s, CivilMinute* c) {
+  return ParseLenient(s, c);
+}
+bool ParseLenientCivilTime(string_view s, CivilHour* c) {
+  return ParseLenient(s, c);
+}
+bool ParseLenientCivilTime(string_view s, CivilDay* c) {
+  return ParseLenient(s, c);
+}
+bool ParseLenientCivilTime(string_view s, CivilMonth* c) {
+  return ParseLenient(s, c);
+}
+bool ParseLenientCivilTime(string_view s, CivilYear* c) {
+  return ParseLenient(s, c);
+}
+
+namespace time_internal {
+
+std::ostream& operator<<(std::ostream& os, CivilYear y) {
+  return os << FormatCivilTime(y);
+}
+std::ostream& operator<<(std::ostream& os, CivilMonth m) {
+  return os << FormatCivilTime(m);
+}
+std::ostream& operator<<(std::ostream& os, CivilDay d) {
+  return os << FormatCivilTime(d);
+}
+std::ostream& operator<<(std::ostream& os, CivilHour h) {
+  return os << FormatCivilTime(h);
+}
+std::ostream& operator<<(std::ostream& os, CivilMinute m) {
+  return os << FormatCivilTime(m);
+}
+std::ostream& operator<<(std::ostream& os, CivilSecond s) {
+  return os << FormatCivilTime(s);
+}
+
+}  // namespace time_internal
+
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/civil_time.h b/third_party/abseil_cpp/absl/time/civil_time.h
new file mode 100644
index 0000000000..bb46004434
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/civil_time.h
@@ -0,0 +1,538 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+// -----------------------------------------------------------------------------
+// File: civil_time.h
+// -----------------------------------------------------------------------------
+//
+// This header file defines abstractions for computing with "civil time".
+// The term "civil time" refers to the legally recognized human-scale time
+// that is represented by the six fields `YYYY-MM-DD hh:mm:ss`. A "date"
+// is perhaps the most common example of a civil time (represented here as
+// an `absl::CivilDay`).
+//
+// Modern-day civil time follows the Gregorian Calendar and is a
+// time-zone-independent concept: a civil time of "2015-06-01 12:00:00", for
+// example, is not tied to a time zone. Put another way, a civil time does not
+// map to a unique point in time; a civil time must be mapped to an absolute
+// time *through* a time zone.
+//
+// Because a civil time is what most people think of as "time," it is common to
+// map absolute times to civil times to present to users.
+//
+// Time zones define the relationship between absolute and civil times. Given an
+// absolute or civil time and a time zone, you can compute the other time:
+//
+//   Civil Time = F(Absolute Time, Time Zone)
+//   Absolute Time = G(Civil Time, Time Zone)
+//
+// The Abseil time library allows you to construct such civil times from
+// absolute times; consult time.h for such functionality.
+//
+// This library provides six classes for constructing civil-time objects, and
+// provides several helper functions for rounding, iterating, and performing
+// arithmetic on civil-time objects, while avoiding complications like
+// daylight-saving time (DST):
+//
+//   * `absl::CivilSecond`
+//   * `absl::CivilMinute`
+//   * `absl::CivilHour`
+//   * `absl::CivilDay`
+//   * `absl::CivilMonth`
+//   * `absl::CivilYear`
+//
+// Example:
+//
+//   // Construct a civil-time object for a specific day
+//   const absl::CivilDay cd(1969, 07, 20);
+//
+//   // Construct a civil-time object for a specific second
+//   const absl::CivilSecond cd(2018, 8, 1, 12, 0, 1);
+//
+// Note: In C++14 and later, this library is usable in a constexpr context.
+//
+// Example:
+//
+//   // Valid in C++14
+//   constexpr absl::CivilDay cd(1969, 07, 20);
+
+#ifndef ABSL_TIME_CIVIL_TIME_H_
+#define ABSL_TIME_CIVIL_TIME_H_
+
+#include <string>
+
+#include "absl/strings/string_view.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+
+namespace time_internal {
+struct second_tag : cctz::detail::second_tag {};
+struct minute_tag : second_tag, cctz::detail::minute_tag {};
+struct hour_tag : minute_tag, cctz::detail::hour_tag {};
+struct day_tag : hour_tag, cctz::detail::day_tag {};
+struct month_tag : day_tag, cctz::detail::month_tag {};
+struct year_tag : month_tag, cctz::detail::year_tag {};
+}  // namespace time_internal
+
+// -----------------------------------------------------------------------------
+// CivilSecond, CivilMinute, CivilHour, CivilDay, CivilMonth, CivilYear
+// -----------------------------------------------------------------------------
+//
+// Each of these civil-time types is a simple value type with the same
+// interface for construction and the same six accessors for each of the civil
+// time fields (year, month, day, hour, minute, and second, aka YMDHMS). These
+// classes differ only in their alignment, which is indicated by the type name
+// and specifies the field on which arithmetic operates.
+//
+// CONSTRUCTION
+//
+// Each of the civil-time types can be constructed in two ways: by directly
+// passing to the constructor up to six integers representing the YMDHMS fields,
+// or by copying the YMDHMS fields from a differently aligned civil-time type.
+// Omitted fields are assigned their minimum valid value. Hours, minutes, and
+// seconds will be set to 0, month and day will be set to 1. Since there is no
+// minimum year, the default is 1970.
+//
+// Examples:
+//
+//   absl::CivilDay default_value;               // 1970-01-01 00:00:00
+//
+//   absl::CivilDay a(2015, 2, 3);               // 2015-02-03 00:00:00
+//   absl::CivilDay b(2015, 2, 3, 4, 5, 6);      // 2015-02-03 00:00:00
+//   absl::CivilDay c(2015);                     // 2015-01-01 00:00:00
+//
+//   absl::CivilSecond ss(2015, 2, 3, 4, 5, 6);  // 2015-02-03 04:05:06
+//   absl::CivilMinute mm(ss);                   // 2015-02-03 04:05:00
+//   absl::CivilHour hh(mm);                     // 2015-02-03 04:00:00
+//   absl::CivilDay d(hh);                       // 2015-02-03 00:00:00
+//   absl::CivilMonth m(d);                      // 2015-02-01 00:00:00
+//   absl::CivilYear y(m);                       // 2015-01-01 00:00:00
+//
+//   m = absl::CivilMonth(y);                    // 2015-01-01 00:00:00
+//   d = absl::CivilDay(m);                      // 2015-01-01 00:00:00
+//   hh = absl::CivilHour(d);                    // 2015-01-01 00:00:00
+//   mm = absl::CivilMinute(hh);                 // 2015-01-01 00:00:00
+//   ss = absl::CivilSecond(mm);                 // 2015-01-01 00:00:00
+//
+// Each civil-time class is aligned to the civil-time field indicated in the
+// class's name after normalization. Alignment is performed by setting all the
+// inferior fields to their minimum valid value (as described above). The
+// following are examples of how each of the six types would align the fields
+// representing November 22, 2015 at 12:34:56 in the afternoon. (Note: the
+// string format used here is not important; it's just a shorthand way of
+// showing the six YMDHMS fields.)
+//
+//   absl::CivilSecond   : 2015-11-22 12:34:56
+//   absl::CivilMinute   : 2015-11-22 12:34:00
+//   absl::CivilHour     : 2015-11-22 12:00:00
+//   absl::CivilDay      : 2015-11-22 00:00:00
+//   absl::CivilMonth    : 2015-11-01 00:00:00
+//   absl::CivilYear     : 2015-01-01 00:00:00
+//
+// Each civil-time type performs arithmetic on the field to which it is
+// aligned. This means that adding 1 to an absl::CivilDay increments the day
+// field (normalizing as necessary), and subtracting 7 from an absl::CivilMonth
+// operates on the month field (normalizing as necessary). All arithmetic
+// produces a valid civil time. Difference requires two similarly aligned
+// civil-time objects and returns the scalar answer in units of the objects'
+// alignment. For example, the difference between two absl::CivilHour objects
+// will give an answer in units of civil hours.
+//
+// ALIGNMENT CONVERSION
+//
+// The alignment of a civil-time object cannot change, but the object may be
+// used to construct a new object with a different alignment. This is referred
+// to as "realigning". When realigning to a type with the same or more
+// precision (e.g., absl::CivilDay -> absl::CivilSecond), the conversion may be
+// performed implicitly since no information is lost. However, if information
+// could be discarded (e.g., CivilSecond -> CivilDay), the conversion must
+// be explicit at the call site.
+//
+// Examples:
+//
+//   void UseDay(absl::CivilDay day);
+//
+//   absl::CivilSecond cs;
+//   UseDay(cs);                  // Won't compile because data may be discarded
+//   UseDay(absl::CivilDay(cs));  // OK: explicit conversion
+//
+//   absl::CivilDay cd;
+//   UseDay(cd);                  // OK: no conversion needed
+//
+//   absl::CivilMonth cm;
+//   UseDay(cm);                  // OK: implicit conversion to absl::CivilDay
+//
+// NORMALIZATION
+//
+// Normalization takes invalid values and adjusts them to produce valid values.
+// Within the civil-time library, integer arguments passed to the Civil*
+// constructors may be out-of-range, in which case they are normalized by
+// carrying overflow into a field of courser granularity to produce valid
+// civil-time objects. This normalization enables natural arithmetic on
+// constructor arguments without worrying about the field's range.
+//
+// Examples:
+//
+//   // Out-of-range; normalized to 2016-11-01
+//   absl::CivilDay d(2016, 10, 32);
+//   // Out-of-range, negative: normalized to 2016-10-30T23
+//   absl::CivilHour h1(2016, 10, 31, -1);
+//   // Normalization is cumulative: normalized to 2016-10-30T23
+//   absl::CivilHour h2(2016, 10, 32, -25);
+//
+// Note: If normalization is undesired, you can signal an error by comparing
+// the constructor arguments to the normalized values returned by the YMDHMS
+// properties.
+//
+// COMPARISON
+//
+// Comparison between civil-time objects considers all six YMDHMS fields,
+// regardless of the type's alignment. Comparison between differently aligned
+// civil-time types is allowed.
+//
+// Examples:
+//
+//   absl::CivilDay feb_3(2015, 2, 3);  // 2015-02-03 00:00:00
+//   absl::CivilDay mar_4(2015, 3, 4);  // 2015-03-04 00:00:00
+//   // feb_3 < mar_4
+//   // absl::CivilYear(feb_3) == absl::CivilYear(mar_4)
+//
+//   absl::CivilSecond feb_3_noon(2015, 2, 3, 12, 0, 0);  // 2015-02-03 12:00:00
+//   // feb_3 < feb_3_noon
+//   // feb_3 == absl::CivilDay(feb_3_noon)
+//
+//   // Iterates all the days of February 2015.
+//   for (absl::CivilDay d(2015, 2, 1); d < absl::CivilMonth(2015, 3); ++d) {
+//     // ...
+//   }
+//
+// ARITHMETIC
+//
+// Civil-time types support natural arithmetic operators such as addition,
+// subtraction, and difference. Arithmetic operates on the civil-time field
+// indicated in the type's name. Difference operators require arguments with
+// the same alignment and return the answer in units of the alignment.
+//
+// Example:
+//
+//   absl::CivilDay a(2015, 2, 3);
+//   ++a;                              // 2015-02-04 00:00:00
+//   --a;                              // 2015-02-03 00:00:00
+//   absl::CivilDay b = a + 1;         // 2015-02-04 00:00:00
+//   absl::CivilDay c = 1 + b;         // 2015-02-05 00:00:00
+//   int n = c - a;                    // n = 2 (civil days)
+//   int m = c - absl::CivilMonth(c);  // Won't compile: different types.
+//
+// ACCESSORS
+//
+// Each civil-time type has accessors for all six of the civil-time fields:
+// year, month, day, hour, minute, and second.
+//
+// civil_year_t year()
+// int          month()
+// int          day()
+// int          hour()
+// int          minute()
+// int          second()
+//
+// Recall that fields inferior to the type's alignment will be set to their
+// minimum valid value.
+//
+// Example:
+//
+//   absl::CivilDay d(2015, 6, 28);
+//   // d.year() == 2015
+//   // d.month() == 6
+//   // d.day() == 28
+//   // d.hour() == 0
+//   // d.minute() == 0
+//   // d.second() == 0
+//
+// CASE STUDY: Adding a month to January 31.
+//
+// One of the classic questions that arises when considering a civil time
+// library (or a date library or a date/time library) is this:
+//   "What is the result of adding a month to January 31?"
+// This is an interesting question because it is unclear what is meant by a
+// "month", and several different answers are possible, depending on context:
+//
+//   1. March 3 (or 2 if a leap year), if "add a month" means to add a month to
+//      the current month, and adjust the date to overflow the extra days into
+//      March. In this case the result of "February 31" would be normalized as
+//      within the civil-time library.
+//   2. February 28 (or 29 if a leap year), if "add a month" means to add a
+//      month, and adjust the date while holding the resulting month constant.
+//      In this case, the result of "February 31" would be truncated to the last
+//      day in February.
+//   3. An error. The caller may get some error, an exception, an invalid date
+//      object, or perhaps return `false`. This may make sense because there is
+//      no single unambiguously correct answer to the question.
+//
+// Practically speaking, any answer that is not what the programmer intended
+// is the wrong answer.
+//
+// The Abseil time library avoids this problem by making it impossible to
+// ask ambiguous questions. All civil-time objects are aligned to a particular
+// civil-field boundary (such as aligned to a year, month, day, hour, minute,
+// or second), and arithmetic operates on the field to which the object is
+// aligned. This means that in order to "add a month" the object must first be
+// aligned to a month boundary, which is equivalent to the first day of that
+// month.
+//
+// Of course, there are ways to compute an answer the question at hand using
+// this Abseil time library, but they require the programmer to be explicit
+// about the answer they expect. To illustrate, let's see how to compute all
+// three of the above possible answers to the question of "Jan 31 plus 1
+// month":
+//
+// Example:
+//
+//   const absl::CivilDay d(2015, 1, 31);
+//
+//   // Answer 1:
+//   // Add 1 to the month field in the constructor, and rely on normalization.
+//   const auto normalized = absl::CivilDay(d.year(), d.month() + 1, d.day());
+//   // normalized == 2015-03-03 (aka Feb 31)
+//
+//   // Answer 2:
+//   // Add 1 to month field, capping to the end of next month.
+//   const auto next_month = absl::CivilMonth(d) + 1;
+//   const auto last_day_of_next_month = absl::CivilDay(next_month + 1) - 1;
+//   const auto capped = std::min(normalized, last_day_of_next_month);
+//   // capped == 2015-02-28
+//
+//   // Answer 3:
+//   // Signal an error if the normalized answer is not in next month.
+//   if (absl::CivilMonth(normalized) != next_month) {
+//     // error, month overflow
+//   }
+//
+using CivilSecond =
+    time_internal::cctz::detail::civil_time<time_internal::second_tag>;
+using CivilMinute =
+    time_internal::cctz::detail::civil_time<time_internal::minute_tag>;
+using CivilHour =
+    time_internal::cctz::detail::civil_time<time_internal::hour_tag>;
+using CivilDay =
+    time_internal::cctz::detail::civil_time<time_internal::day_tag>;
+using CivilMonth =
+    time_internal::cctz::detail::civil_time<time_internal::month_tag>;
+using CivilYear =
+    time_internal::cctz::detail::civil_time<time_internal::year_tag>;
+
+// civil_year_t
+//
+// Type alias of a civil-time year value. This type is guaranteed to (at least)
+// support any year value supported by `time_t`.
+//
+// Example:
+//
+//   absl::CivilSecond cs = ...;
+//   absl::civil_year_t y = cs.year();
+//   cs = absl::CivilSecond(y, 1, 1, 0, 0, 0);  // CivilSecond(CivilYear(cs))
+//
+using civil_year_t = time_internal::cctz::year_t;
+
+// civil_diff_t
+//
+// Type alias of the difference between two civil-time values.
+// This type is used to indicate arguments that are not
+// normalized (such as parameters to the civil-time constructors), the results
+// of civil-time subtraction, or the operand to civil-time addition.
+//
+// Example:
+//
+//   absl::civil_diff_t n_sec = cs1 - cs2;             // cs1 == cs2 + n_sec;
+//
+using civil_diff_t = time_internal::cctz::diff_t;
+
+// Weekday::monday, Weekday::tuesday, Weekday::wednesday, Weekday::thursday,
+// Weekday::friday, Weekday::saturday, Weekday::sunday
+//
+// The Weekday enum class represents the civil-time concept of a "weekday" with
+// members for all days of the week.
+//
+//   absl::Weekday wd = absl::Weekday::thursday;
+//
+using Weekday = time_internal::cctz::weekday;
+
+// GetWeekday()
+//
+// Returns the absl::Weekday for the given (realigned) civil-time value.
+//
+// Example:
+//
+//   absl::CivilDay a(2015, 8, 13);
+//   absl::Weekday wd = absl::GetWeekday(a);  // wd == absl::Weekday::thursday
+//
+inline Weekday GetWeekday(CivilSecond cs) {
+  return time_internal::cctz::get_weekday(cs);
+}
+
+// NextWeekday()
+// PrevWeekday()
+//
+// Returns the absl::CivilDay that strictly follows or precedes a given
+// absl::CivilDay, and that falls on the given absl::Weekday.
+//
+// Example, given the following month:
+//
+//       August 2015
+//   Su Mo Tu We Th Fr Sa
+//                      1
+//    2  3  4  5  6  7  8
+//    9 10 11 12 13 14 15
+//   16 17 18 19 20 21 22
+//   23 24 25 26 27 28 29
+//   30 31
+//
+//   absl::CivilDay a(2015, 8, 13);
+//   // absl::GetWeekday(a) == absl::Weekday::thursday
+//   absl::CivilDay b = absl::NextWeekday(a, absl::Weekday::thursday);
+//   // b = 2015-08-20
+//   absl::CivilDay c = absl::PrevWeekday(a, absl::Weekday::thursday);
+//   // c = 2015-08-06
+//
+//   absl::CivilDay d = ...
+//   // Gets the following Thursday if d is not already Thursday
+//   absl::CivilDay thurs1 = absl::NextWeekday(d - 1, absl::Weekday::thursday);
+//   // Gets the previous Thursday if d is not already Thursday
+//   absl::CivilDay thurs2 = absl::PrevWeekday(d + 1, absl::Weekday::thursday);
+//
+inline CivilDay NextWeekday(CivilDay cd, Weekday wd) {
+  return CivilDay(time_internal::cctz::next_weekday(cd, wd));
+}
+inline CivilDay PrevWeekday(CivilDay cd, Weekday wd) {
+  return CivilDay(time_internal::cctz::prev_weekday(cd, wd));
+}
+
+// GetYearDay()
+//
+// Returns the day-of-year for the given (realigned) civil-time value.
+//
+// Example:
+//
+//   absl::CivilDay a(2015, 1, 1);
+//   int yd_jan_1 = absl::GetYearDay(a);   // yd_jan_1 = 1
+//   absl::CivilDay b(2015, 12, 31);
+//   int yd_dec_31 = absl::GetYearDay(b);  // yd_dec_31 = 365
+//
+inline int GetYearDay(CivilSecond cs) {
+  return time_internal::cctz::get_yearday(cs);
+}
+
+// FormatCivilTime()
+//
+// Formats the given civil-time value into a string value of the following
+// format:
+//
+//  Type        | Format
+//  ---------------------------------
+//  CivilSecond | YYYY-MM-DDTHH:MM:SS
+//  CivilMinute | YYYY-MM-DDTHH:MM
+//  CivilHour   | YYYY-MM-DDTHH
+//  CivilDay    | YYYY-MM-DD
+//  CivilMonth  | YYYY-MM
+//  CivilYear   | YYYY
+//
+// Example:
+//
+//   absl::CivilDay d = absl::CivilDay(1969, 7, 20);
+//   std::string day_string = absl::FormatCivilTime(d);  // "1969-07-20"
+//
+std::string FormatCivilTime(CivilSecond c);
+std::string FormatCivilTime(CivilMinute c);
+std::string FormatCivilTime(CivilHour c);
+std::string FormatCivilTime(CivilDay c);
+std::string FormatCivilTime(CivilMonth c);
+std::string FormatCivilTime(CivilYear c);
+
+// absl::ParseCivilTime()
+//
+// Parses a civil-time value from the specified `absl::string_view` into the
+// passed output parameter. Returns `true` upon successful parsing.
+//
+// The expected form of the input string is as follows:
+//
+//  Type        | Format
+//  ---------------------------------
+//  CivilSecond | YYYY-MM-DDTHH:MM:SS
+//  CivilMinute | YYYY-MM-DDTHH:MM
+//  CivilHour   | YYYY-MM-DDTHH
+//  CivilDay    | YYYY-MM-DD
+//  CivilMonth  | YYYY-MM
+//  CivilYear   | YYYY
+//
+// Example:
+//
+//   absl::CivilDay d;
+//   bool ok = absl::ParseCivilTime("2018-01-02", &d); // OK
+//
+// Note that parsing will fail if the string's format does not match the
+// expected type exactly. `ParseLenientCivilTime()` below is more lenient.
+//
+bool ParseCivilTime(absl::string_view s, CivilSecond* c);
+bool ParseCivilTime(absl::string_view s, CivilMinute* c);
+bool ParseCivilTime(absl::string_view s, CivilHour* c);
+bool ParseCivilTime(absl::string_view s, CivilDay* c);
+bool ParseCivilTime(absl::string_view s, CivilMonth* c);
+bool ParseCivilTime(absl::string_view s, CivilYear* c);
+
+// ParseLenientCivilTime()
+//
+// Parses any of the formats accepted by `absl::ParseCivilTime()`, but is more
+// lenient if the format of the string does not exactly match the associated
+// type.
+//
+// Example:
+//
+//   absl::CivilDay d;
+//   bool ok = absl::ParseLenientCivilTime("1969-07-20", &d); // OK
+//   ok = absl::ParseLenientCivilTime("1969-07-20T10", &d);   // OK: T10 floored
+//   ok = absl::ParseLenientCivilTime("1969-07", &d);   // OK: day defaults to 1
+//
+bool ParseLenientCivilTime(absl::string_view s, CivilSecond* c);
+bool ParseLenientCivilTime(absl::string_view s, CivilMinute* c);
+bool ParseLenientCivilTime(absl::string_view s, CivilHour* c);
+bool ParseLenientCivilTime(absl::string_view s, CivilDay* c);
+bool ParseLenientCivilTime(absl::string_view s, CivilMonth* c);
+bool ParseLenientCivilTime(absl::string_view s, CivilYear* c);
+
+namespace time_internal {  // For functions found via ADL on civil-time tags.
+
+// Streaming Operators
+//
+// Each civil-time type may be sent to an output stream using operator<<().
+// The result matches the string produced by `FormatCivilTime()`.
+//
+// Example:
+//
+//   absl::CivilDay d = absl::CivilDay(1969, 7, 20);
+//   std::cout << "Date is: " << d << "\n";
+//
+std::ostream& operator<<(std::ostream& os, CivilYear y);
+std::ostream& operator<<(std::ostream& os, CivilMonth m);
+std::ostream& operator<<(std::ostream& os, CivilDay d);
+std::ostream& operator<<(std::ostream& os, CivilHour h);
+std::ostream& operator<<(std::ostream& os, CivilMinute m);
+std::ostream& operator<<(std::ostream& os, CivilSecond s);
+
+}  // namespace time_internal
+
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+#endif  // ABSL_TIME_CIVIL_TIME_H_
diff --git a/third_party/abseil_cpp/absl/time/civil_time_benchmark.cc b/third_party/abseil_cpp/absl/time/civil_time_benchmark.cc
new file mode 100644
index 0000000000..f04dbe200e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/civil_time_benchmark.cc
@@ -0,0 +1,127 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/time/civil_time.h"
+
+#include <numeric>
+#include <vector>
+
+#include "absl/hash/hash.h"
+#include "benchmark/benchmark.h"
+
+namespace {
+
+// Run on (12 X 3492 MHz CPUs); 2018-11-05T13:44:29.814239103-08:00
+// CPU: Intel Haswell with HyperThreading (6 cores) dL1:32KB dL2:256KB dL3:15MB
+// Benchmark                 Time(ns)        CPU(ns)     Iterations
+// ----------------------------------------------------------------
+// BM_Difference_Days              14.5           14.5     48531105
+// BM_Step_Days                    12.6           12.6     54876006
+// BM_Format                      587            587        1000000
+// BM_Parse                       692            692        1000000
+// BM_RoundTripFormatParse       1309           1309         532075
+// BM_CivilYearAbslHash             0.710          0.710  976400000
+// BM_CivilMonthAbslHash            1.13           1.13   619500000
+// BM_CivilDayAbslHash              1.70           1.70   426000000
+// BM_CivilHourAbslHash             2.45           2.45   287600000
+// BM_CivilMinuteAbslHash           3.21           3.21   226200000
+// BM_CivilSecondAbslHash           4.10           4.10   171800000
+
+void BM_Difference_Days(benchmark::State& state) {
+  const absl::CivilDay c(2014, 8, 22);
+  const absl::CivilDay epoch(1970, 1, 1);
+  while (state.KeepRunning()) {
+    const absl::civil_diff_t n = c - epoch;
+    benchmark::DoNotOptimize(n);
+  }
+}
+BENCHMARK(BM_Difference_Days);
+
+void BM_Step_Days(benchmark::State& state) {
+  const absl::CivilDay kStart(2014, 8, 22);
+  absl::CivilDay c = kStart;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(++c);
+  }
+}
+BENCHMARK(BM_Step_Days);
+
+void BM_Format(benchmark::State& state) {
+  const absl::CivilSecond c(2014, 1, 2, 3, 4, 5);
+  while (state.KeepRunning()) {
+    const std::string s = absl::FormatCivilTime(c);
+    benchmark::DoNotOptimize(s);
+  }
+}
+BENCHMARK(BM_Format);
+
+void BM_Parse(benchmark::State& state) {
+  const std::string f = "2014-01-02T03:04:05";
+  absl::CivilSecond c;
+  while (state.KeepRunning()) {
+    const bool b = absl::ParseCivilTime(f, &c);
+    benchmark::DoNotOptimize(b);
+  }
+}
+BENCHMARK(BM_Parse);
+
+void BM_RoundTripFormatParse(benchmark::State& state) {
+  const absl::CivilSecond c(2014, 1, 2, 3, 4, 5);
+  absl::CivilSecond out;
+  while (state.KeepRunning()) {
+    const bool b = absl::ParseCivilTime(absl::FormatCivilTime(c), &out);
+    benchmark::DoNotOptimize(b);
+  }
+}
+BENCHMARK(BM_RoundTripFormatParse);
+
+template <typename T>
+void BM_CivilTimeAbslHash(benchmark::State& state) {
+  const int kSize = 100000;
+  std::vector<T> civil_times(kSize);
+  std::iota(civil_times.begin(), civil_times.end(), T(2018));
+
+  absl::Hash<T> absl_hasher;
+  while (state.KeepRunningBatch(kSize)) {
+    for (const T civil_time : civil_times) {
+      benchmark::DoNotOptimize(absl_hasher(civil_time));
+    }
+  }
+}
+void BM_CivilYearAbslHash(benchmark::State& state) {
+  BM_CivilTimeAbslHash<absl::CivilYear>(state);
+}
+void BM_CivilMonthAbslHash(benchmark::State& state) {
+  BM_CivilTimeAbslHash<absl::CivilMonth>(state);
+}
+void BM_CivilDayAbslHash(benchmark::State& state) {
+  BM_CivilTimeAbslHash<absl::CivilDay>(state);
+}
+void BM_CivilHourAbslHash(benchmark::State& state) {
+  BM_CivilTimeAbslHash<absl::CivilHour>(state);
+}
+void BM_CivilMinuteAbslHash(benchmark::State& state) {
+  BM_CivilTimeAbslHash<absl::CivilMinute>(state);
+}
+void BM_CivilSecondAbslHash(benchmark::State& state) {
+  BM_CivilTimeAbslHash<absl::CivilSecond>(state);
+}
+BENCHMARK(BM_CivilYearAbslHash);
+BENCHMARK(BM_CivilMonthAbslHash);
+BENCHMARK(BM_CivilDayAbslHash);
+BENCHMARK(BM_CivilHourAbslHash);
+BENCHMARK(BM_CivilMinuteAbslHash);
+BENCHMARK(BM_CivilSecondAbslHash);
+
+}  // namespace
diff --git a/third_party/abseil_cpp/absl/time/civil_time_test.cc b/third_party/abseil_cpp/absl/time/civil_time_test.cc
new file mode 100644
index 0000000000..0ebd97adbc
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/civil_time_test.cc
@@ -0,0 +1,1243 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/time/civil_time.h"
+
+#include <limits>
+#include <sstream>
+#include <type_traits>
+
+#include "absl/base/macros.h"
+#include "gtest/gtest.h"
+
+namespace {
+
+TEST(CivilTime, DefaultConstruction) {
+  absl::CivilSecond ss;
+  EXPECT_EQ("1970-01-01T00:00:00", absl::FormatCivilTime(ss));
+
+  absl::CivilMinute mm;
+  EXPECT_EQ("1970-01-01T00:00", absl::FormatCivilTime(mm));
+
+  absl::CivilHour hh;
+  EXPECT_EQ("1970-01-01T00", absl::FormatCivilTime(hh));
+
+  absl::CivilDay d;
+  EXPECT_EQ("1970-01-01", absl::FormatCivilTime(d));
+
+  absl::CivilMonth m;
+  EXPECT_EQ("1970-01", absl::FormatCivilTime(m));
+
+  absl::CivilYear y;
+  EXPECT_EQ("1970", absl::FormatCivilTime(y));
+}
+
+TEST(CivilTime, StructMember) {
+  struct S {
+    absl::CivilDay day;
+  };
+  S s = {};
+  EXPECT_EQ(absl::CivilDay{}, s.day);
+}
+
+TEST(CivilTime, FieldsConstruction) {
+  EXPECT_EQ("2015-01-02T03:04:05",
+            absl::FormatCivilTime(absl::CivilSecond(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015-01-02T03:04:00",
+            absl::FormatCivilTime(absl::CivilSecond(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015-01-02T03:00:00",
+            absl::FormatCivilTime(absl::CivilSecond(2015, 1, 2, 3)));
+  EXPECT_EQ("2015-01-02T00:00:00",
+            absl::FormatCivilTime(absl::CivilSecond(2015, 1, 2)));
+  EXPECT_EQ("2015-01-01T00:00:00",
+            absl::FormatCivilTime(absl::CivilSecond(2015, 1)));
+  EXPECT_EQ("2015-01-01T00:00:00",
+            absl::FormatCivilTime(absl::CivilSecond(2015)));
+
+  EXPECT_EQ("2015-01-02T03:04",
+            absl::FormatCivilTime(absl::CivilMinute(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015-01-02T03:04",
+            absl::FormatCivilTime(absl::CivilMinute(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015-01-02T03:00",
+            absl::FormatCivilTime(absl::CivilMinute(2015, 1, 2, 3)));
+  EXPECT_EQ("2015-01-02T00:00",
+            absl::FormatCivilTime(absl::CivilMinute(2015, 1, 2)));
+  EXPECT_EQ("2015-01-01T00:00",
+            absl::FormatCivilTime(absl::CivilMinute(2015, 1)));
+  EXPECT_EQ("2015-01-01T00:00",
+            absl::FormatCivilTime(absl::CivilMinute(2015)));
+
+  EXPECT_EQ("2015-01-02T03",
+            absl::FormatCivilTime(absl::CivilHour(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015-01-02T03",
+            absl::FormatCivilTime(absl::CivilHour(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015-01-02T03",
+            absl::FormatCivilTime(absl::CivilHour(2015, 1, 2, 3)));
+  EXPECT_EQ("2015-01-02T00",
+            absl::FormatCivilTime(absl::CivilHour(2015, 1, 2)));
+  EXPECT_EQ("2015-01-01T00",
+            absl::FormatCivilTime(absl::CivilHour(2015, 1)));
+  EXPECT_EQ("2015-01-01T00",
+            absl::FormatCivilTime(absl::CivilHour(2015)));
+
+  EXPECT_EQ("2015-01-02",
+            absl::FormatCivilTime(absl::CivilDay(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015-01-02",
+            absl::FormatCivilTime(absl::CivilDay(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015-01-02",
+            absl::FormatCivilTime(absl::CivilDay(2015, 1, 2, 3)));
+  EXPECT_EQ("2015-01-02",
+            absl::FormatCivilTime(absl::CivilDay(2015, 1, 2)));
+  EXPECT_EQ("2015-01-01",
+            absl::FormatCivilTime(absl::CivilDay(2015, 1)));
+  EXPECT_EQ("2015-01-01",
+            absl::FormatCivilTime(absl::CivilDay(2015)));
+
+  EXPECT_EQ("2015-01",
+            absl::FormatCivilTime(absl::CivilMonth(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015-01",
+            absl::FormatCivilTime(absl::CivilMonth(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015-01",
+            absl::FormatCivilTime(absl::CivilMonth(2015, 1, 2, 3)));
+  EXPECT_EQ("2015-01",
+            absl::FormatCivilTime(absl::CivilMonth(2015, 1, 2)));
+  EXPECT_EQ("2015-01",
+            absl::FormatCivilTime(absl::CivilMonth(2015, 1)));
+  EXPECT_EQ("2015-01",
+            absl::FormatCivilTime(absl::CivilMonth(2015)));
+
+  EXPECT_EQ("2015",
+            absl::FormatCivilTime(absl::CivilYear(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015",
+            absl::FormatCivilTime(absl::CivilYear(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015",
+            absl::FormatCivilTime(absl::CivilYear(2015, 1, 2, 3)));
+  EXPECT_EQ("2015",
+            absl::FormatCivilTime(absl::CivilYear(2015, 1, 2)));
+  EXPECT_EQ("2015",
+            absl::FormatCivilTime(absl::CivilYear(2015, 1)));
+  EXPECT_EQ("2015",
+            absl::FormatCivilTime(absl::CivilYear(2015)));
+}
+
+TEST(CivilTime, FieldsConstructionLimits) {
+  const int kIntMax = std::numeric_limits<int>::max();
+  EXPECT_EQ("2038-01-19T03:14:07",
+            absl::FormatCivilTime(absl::CivilSecond(
+                1970, 1, 1, 0, 0, kIntMax)));
+  EXPECT_EQ("6121-02-11T05:21:07",
+            absl::FormatCivilTime(absl::CivilSecond(
+                1970, 1, 1, 0, kIntMax, kIntMax)));
+  EXPECT_EQ("251104-11-20T12:21:07",
+            absl::FormatCivilTime(absl::CivilSecond(
+                1970, 1, 1, kIntMax, kIntMax, kIntMax)));
+  EXPECT_EQ("6130715-05-30T12:21:07",
+            absl::FormatCivilTime(absl::CivilSecond(
+                1970, 1, kIntMax, kIntMax, kIntMax, kIntMax)));
+  EXPECT_EQ("185087685-11-26T12:21:07",
+            absl::FormatCivilTime(absl::CivilSecond(
+                1970, kIntMax, kIntMax, kIntMax, kIntMax, kIntMax)));
+
+  const int kIntMin = std::numeric_limits<int>::min();
+  EXPECT_EQ("1901-12-13T20:45:52",
+            absl::FormatCivilTime(absl::CivilSecond(
+                1970, 1, 1, 0, 0, kIntMin)));
+  EXPECT_EQ("-2182-11-20T18:37:52",
+            absl::FormatCivilTime(absl::CivilSecond(
+                1970, 1, 1, 0, kIntMin, kIntMin)));
+  EXPECT_EQ("-247165-02-11T10:37:52",
+            absl::FormatCivilTime(absl::CivilSecond(
+                1970, 1, 1, kIntMin, kIntMin, kIntMin)));
+  EXPECT_EQ("-6126776-08-01T10:37:52",
+            absl::FormatCivilTime(absl::CivilSecond(
+                1970, 1, kIntMin, kIntMin, kIntMin, kIntMin)));
+  EXPECT_EQ("-185083747-10-31T10:37:52",
+            absl::FormatCivilTime(absl::CivilSecond(
+                1970, kIntMin, kIntMin, kIntMin, kIntMin, kIntMin)));
+}
+
+TEST(CivilTime, RangeLimits) {
+  const absl::civil_year_t kYearMax =
+      std::numeric_limits<absl::civil_year_t>::max();
+  EXPECT_EQ(absl::CivilYear(kYearMax),
+            absl::CivilYear::max());
+  EXPECT_EQ(absl::CivilMonth(kYearMax, 12),
+            absl::CivilMonth::max());
+  EXPECT_EQ(absl::CivilDay(kYearMax, 12, 31),
+            absl::CivilDay::max());
+  EXPECT_EQ(absl::CivilHour(kYearMax, 12, 31, 23),
+            absl::CivilHour::max());
+  EXPECT_EQ(absl::CivilMinute(kYearMax, 12, 31, 23, 59),
+            absl::CivilMinute::max());
+  EXPECT_EQ(absl::CivilSecond(kYearMax, 12, 31, 23, 59, 59),
+            absl::CivilSecond::max());
+
+  const absl::civil_year_t kYearMin =
+      std::numeric_limits<absl::civil_year_t>::min();
+  EXPECT_EQ(absl::CivilYear(kYearMin),
+            absl::CivilYear::min());
+  EXPECT_EQ(absl::CivilMonth(kYearMin, 1),
+            absl::CivilMonth::min());
+  EXPECT_EQ(absl::CivilDay(kYearMin, 1, 1),
+            absl::CivilDay::min());
+  EXPECT_EQ(absl::CivilHour(kYearMin, 1, 1, 0),
+            absl::CivilHour::min());
+  EXPECT_EQ(absl::CivilMinute(kYearMin, 1, 1, 0, 0),
+            absl::CivilMinute::min());
+  EXPECT_EQ(absl::CivilSecond(kYearMin, 1, 1, 0, 0, 0),
+            absl::CivilSecond::min());
+}
+
+TEST(CivilTime, ImplicitCrossAlignment) {
+  absl::CivilYear year(2015);
+  absl::CivilMonth month = year;
+  absl::CivilDay day = month;
+  absl::CivilHour hour = day;
+  absl::CivilMinute minute = hour;
+  absl::CivilSecond second = minute;
+
+  second = year;
+  EXPECT_EQ(second, year);
+  second = month;
+  EXPECT_EQ(second, month);
+  second = day;
+  EXPECT_EQ(second, day);
+  second = hour;
+  EXPECT_EQ(second, hour);
+  second = minute;
+  EXPECT_EQ(second, minute);
+
+  minute = year;
+  EXPECT_EQ(minute, year);
+  minute = month;
+  EXPECT_EQ(minute, month);
+  minute = day;
+  EXPECT_EQ(minute, day);
+  minute = hour;
+  EXPECT_EQ(minute, hour);
+
+  hour = year;
+  EXPECT_EQ(hour, year);
+  hour = month;
+  EXPECT_EQ(hour, month);
+  hour = day;
+  EXPECT_EQ(hour, day);
+
+  day = year;
+  EXPECT_EQ(day, year);
+  day = month;
+  EXPECT_EQ(day, month);
+
+  month = year;
+  EXPECT_EQ(month, year);
+
+  // Ensures unsafe conversions are not allowed.
+  EXPECT_FALSE(
+      (std::is_convertible<absl::CivilSecond, absl::CivilMinute>::value));
+  EXPECT_FALSE(
+      (std::is_convertible<absl::CivilSecond, absl::CivilHour>::value));
+  EXPECT_FALSE(
+      (std::is_convertible<absl::CivilSecond, absl::CivilDay>::value));
+  EXPECT_FALSE(
+      (std::is_convertible<absl::CivilSecond, absl::CivilMonth>::value));
+  EXPECT_FALSE(
+      (std::is_convertible<absl::CivilSecond, absl::CivilYear>::value));
+
+  EXPECT_FALSE(
+      (std::is_convertible<absl::CivilMinute, absl::CivilHour>::value));
+  EXPECT_FALSE(
+      (std::is_convertible<absl::CivilMinute, absl::CivilDay>::value));
+  EXPECT_FALSE(
+      (std::is_convertible<absl::CivilMinute, absl::CivilMonth>::value));
+  EXPECT_FALSE(
+      (std::is_convertible<absl::CivilMinute, absl::CivilYear>::value));
+
+  EXPECT_FALSE(
+      (std::is_convertible<absl::CivilHour, absl::CivilDay>::value));
+  EXPECT_FALSE(
+      (std::is_convertible<absl::CivilHour, absl::CivilMonth>::value));
+  EXPECT_FALSE(
+      (std::is_convertible<absl::CivilHour, absl::CivilYear>::value));
+
+  EXPECT_FALSE(
+      (std::is_convertible<absl::CivilDay, absl::CivilMonth>::value));
+  EXPECT_FALSE(
+      (std::is_convertible<absl::CivilDay, absl::CivilYear>::value));
+
+  EXPECT_FALSE(
+      (std::is_convertible<absl::CivilMonth, absl::CivilYear>::value));
+}
+
+TEST(CivilTime, ExplicitCrossAlignment) {
+  //
+  // Assign from smaller units -> larger units
+  //
+
+  absl::CivilSecond second(2015, 1, 2, 3, 4, 5);
+  EXPECT_EQ("2015-01-02T03:04:05", absl::FormatCivilTime(second));
+
+  absl::CivilMinute minute(second);
+  EXPECT_EQ("2015-01-02T03:04", absl::FormatCivilTime(minute));
+
+  absl::CivilHour hour(minute);
+  EXPECT_EQ("2015-01-02T03", absl::FormatCivilTime(hour));
+
+  absl::CivilDay day(hour);
+  EXPECT_EQ("2015-01-02", absl::FormatCivilTime(day));
+
+  absl::CivilMonth month(day);
+  EXPECT_EQ("2015-01", absl::FormatCivilTime(month));
+
+  absl::CivilYear year(month);
+  EXPECT_EQ("2015", absl::FormatCivilTime(year));
+
+  //
+  // Now assign from larger units -> smaller units
+  //
+
+  month = absl::CivilMonth(year);
+  EXPECT_EQ("2015-01", absl::FormatCivilTime(month));
+
+  day = absl::CivilDay(month);
+  EXPECT_EQ("2015-01-01", absl::FormatCivilTime(day));
+
+  hour = absl::CivilHour(day);
+  EXPECT_EQ("2015-01-01T00", absl::FormatCivilTime(hour));
+
+  minute = absl::CivilMinute(hour);
+  EXPECT_EQ("2015-01-01T00:00", absl::FormatCivilTime(minute));
+
+  second = absl::CivilSecond(minute);
+  EXPECT_EQ("2015-01-01T00:00:00", absl::FormatCivilTime(second));
+}
+
+// Metafunction to test whether difference is allowed between two types.
+template <typename T1, typename T2>
+struct HasDiff {
+  template <typename U1, typename U2>
+  static std::false_type test(...);
+  template <typename U1, typename U2>
+  static std::true_type test(decltype(std::declval<U1>() - std::declval<U2>()));
+  static constexpr bool value = decltype(test<T1, T2>(0))::value;
+};
+
+TEST(CivilTime, DisallowCrossAlignedDifference) {
+  // Difference is allowed between types with the same alignment.
+  static_assert(HasDiff<absl::CivilSecond, absl::CivilSecond>::value, "");
+  static_assert(HasDiff<absl::CivilMinute, absl::CivilMinute>::value, "");
+  static_assert(HasDiff<absl::CivilHour, absl::CivilHour>::value, "");
+  static_assert(HasDiff<absl::CivilDay, absl::CivilDay>::value, "");
+  static_assert(HasDiff<absl::CivilMonth, absl::CivilMonth>::value, "");
+  static_assert(HasDiff<absl::CivilYear, absl::CivilYear>::value, "");
+
+  // Difference is disallowed between types with different alignments.
+  static_assert(!HasDiff<absl::CivilSecond, absl::CivilMinute>::value, "");
+  static_assert(!HasDiff<absl::CivilSecond, absl::CivilHour>::value, "");
+  static_assert(!HasDiff<absl::CivilSecond, absl::CivilDay>::value, "");
+  static_assert(!HasDiff<absl::CivilSecond, absl::CivilMonth>::value, "");
+  static_assert(!HasDiff<absl::CivilSecond, absl::CivilYear>::value, "");
+
+  static_assert(!HasDiff<absl::CivilMinute, absl::CivilHour>::value, "");
+  static_assert(!HasDiff<absl::CivilMinute, absl::CivilDay>::value, "");
+  static_assert(!HasDiff<absl::CivilMinute, absl::CivilMonth>::value, "");
+  static_assert(!HasDiff<absl::CivilMinute, absl::CivilYear>::value, "");
+
+  static_assert(!HasDiff<absl::CivilHour, absl::CivilDay>::value, "");
+  static_assert(!HasDiff<absl::CivilHour, absl::CivilMonth>::value, "");
+  static_assert(!HasDiff<absl::CivilHour, absl::CivilYear>::value, "");
+
+  static_assert(!HasDiff<absl::CivilDay, absl::CivilMonth>::value, "");
+  static_assert(!HasDiff<absl::CivilDay, absl::CivilYear>::value, "");
+
+  static_assert(!HasDiff<absl::CivilMonth, absl::CivilYear>::value, "");
+}
+
+TEST(CivilTime, ValueSemantics) {
+  const absl::CivilHour a(2015, 1, 2, 3);
+  const absl::CivilHour b = a;
+  const absl::CivilHour c(b);
+  absl::CivilHour d;
+  d = c;
+  EXPECT_EQ("2015-01-02T03", absl::FormatCivilTime(d));
+}
+
+TEST(CivilTime, Relational) {
+  // Tests that the alignment unit is ignored in comparison.
+  const absl::CivilYear year(2014);
+  const absl::CivilMonth month(year);
+  EXPECT_EQ(year, month);
+
+#define TEST_RELATIONAL(OLDER, YOUNGER) \
+  do {                                  \
+    EXPECT_FALSE(OLDER < OLDER);        \
+    EXPECT_FALSE(OLDER > OLDER);        \
+    EXPECT_TRUE(OLDER >= OLDER);        \
+    EXPECT_TRUE(OLDER <= OLDER);        \
+    EXPECT_FALSE(YOUNGER < YOUNGER);    \
+    EXPECT_FALSE(YOUNGER > YOUNGER);    \
+    EXPECT_TRUE(YOUNGER >= YOUNGER);    \
+    EXPECT_TRUE(YOUNGER <= YOUNGER);    \
+    EXPECT_EQ(OLDER, OLDER);            \
+    EXPECT_NE(OLDER, YOUNGER);          \
+    EXPECT_LT(OLDER, YOUNGER);          \
+    EXPECT_LE(OLDER, YOUNGER);          \
+    EXPECT_GT(YOUNGER, OLDER);          \
+    EXPECT_GE(YOUNGER, OLDER);          \
+  } while (0)
+
+  // Alignment is ignored in comparison (verified above), so CivilSecond is
+  // used to test comparison in all field positions.
+  TEST_RELATIONAL(absl::CivilSecond(2014, 1, 1, 0, 0, 0),
+                  absl::CivilSecond(2015, 1, 1, 0, 0, 0));
+  TEST_RELATIONAL(absl::CivilSecond(2014, 1, 1, 0, 0, 0),
+                  absl::CivilSecond(2014, 2, 1, 0, 0, 0));
+  TEST_RELATIONAL(absl::CivilSecond(2014, 1, 1, 0, 0, 0),
+                  absl::CivilSecond(2014, 1, 2, 0, 0, 0));
+  TEST_RELATIONAL(absl::CivilSecond(2014, 1, 1, 0, 0, 0),
+                  absl::CivilSecond(2014, 1, 1, 1, 0, 0));
+  TEST_RELATIONAL(absl::CivilSecond(2014, 1, 1, 1, 0, 0),
+                  absl::CivilSecond(2014, 1, 1, 1, 1, 0));
+  TEST_RELATIONAL(absl::CivilSecond(2014, 1, 1, 1, 1, 0),
+                  absl::CivilSecond(2014, 1, 1, 1, 1, 1));
+
+  // Tests the relational operators of two different civil-time types.
+  TEST_RELATIONAL(absl::CivilDay(2014, 1, 1),
+                  absl::CivilMinute(2014, 1, 1, 1, 1));
+  TEST_RELATIONAL(absl::CivilDay(2014, 1, 1),
+                  absl::CivilMonth(2014, 2));
+
+#undef TEST_RELATIONAL
+}
+
+TEST(CivilTime, Arithmetic) {
+  absl::CivilSecond second(2015, 1, 2, 3, 4, 5);
+  EXPECT_EQ("2015-01-02T03:04:06", absl::FormatCivilTime(second += 1));
+  EXPECT_EQ("2015-01-02T03:04:07", absl::FormatCivilTime(second + 1));
+  EXPECT_EQ("2015-01-02T03:04:08", absl::FormatCivilTime(2 + second));
+  EXPECT_EQ("2015-01-02T03:04:05", absl::FormatCivilTime(second - 1));
+  EXPECT_EQ("2015-01-02T03:04:05", absl::FormatCivilTime(second -= 1));
+  EXPECT_EQ("2015-01-02T03:04:05", absl::FormatCivilTime(second++));
+  EXPECT_EQ("2015-01-02T03:04:07", absl::FormatCivilTime(++second));
+  EXPECT_EQ("2015-01-02T03:04:07", absl::FormatCivilTime(second--));
+  EXPECT_EQ("2015-01-02T03:04:05", absl::FormatCivilTime(--second));
+
+  absl::CivilMinute minute(2015, 1, 2, 3, 4);
+  EXPECT_EQ("2015-01-02T03:05", absl::FormatCivilTime(minute += 1));
+  EXPECT_EQ("2015-01-02T03:06", absl::FormatCivilTime(minute + 1));
+  EXPECT_EQ("2015-01-02T03:07", absl::FormatCivilTime(2 + minute));
+  EXPECT_EQ("2015-01-02T03:04", absl::FormatCivilTime(minute - 1));
+  EXPECT_EQ("2015-01-02T03:04", absl::FormatCivilTime(minute -= 1));
+  EXPECT_EQ("2015-01-02T03:04", absl::FormatCivilTime(minute++));
+  EXPECT_EQ("2015-01-02T03:06", absl::FormatCivilTime(++minute));
+  EXPECT_EQ("2015-01-02T03:06", absl::FormatCivilTime(minute--));
+  EXPECT_EQ("2015-01-02T03:04", absl::FormatCivilTime(--minute));
+
+  absl::CivilHour hour(2015, 1, 2, 3);
+  EXPECT_EQ("2015-01-02T04", absl::FormatCivilTime(hour += 1));
+  EXPECT_EQ("2015-01-02T05", absl::FormatCivilTime(hour + 1));
+  EXPECT_EQ("2015-01-02T06", absl::FormatCivilTime(2 + hour));
+  EXPECT_EQ("2015-01-02T03", absl::FormatCivilTime(hour - 1));
+  EXPECT_EQ("2015-01-02T03", absl::FormatCivilTime(hour -= 1));
+  EXPECT_EQ("2015-01-02T03", absl::FormatCivilTime(hour++));
+  EXPECT_EQ("2015-01-02T05", absl::FormatCivilTime(++hour));
+  EXPECT_EQ("2015-01-02T05", absl::FormatCivilTime(hour--));
+  EXPECT_EQ("2015-01-02T03", absl::FormatCivilTime(--hour));
+
+  absl::CivilDay day(2015, 1, 2);
+  EXPECT_EQ("2015-01-03", absl::FormatCivilTime(day += 1));
+  EXPECT_EQ("2015-01-04", absl::FormatCivilTime(day + 1));
+  EXPECT_EQ("2015-01-05", absl::FormatCivilTime(2 + day));
+  EXPECT_EQ("2015-01-02", absl::FormatCivilTime(day - 1));
+  EXPECT_EQ("2015-01-02", absl::FormatCivilTime(day -= 1));
+  EXPECT_EQ("2015-01-02", absl::FormatCivilTime(day++));
+  EXPECT_EQ("2015-01-04", absl::FormatCivilTime(++day));
+  EXPECT_EQ("2015-01-04", absl::FormatCivilTime(day--));
+  EXPECT_EQ("2015-01-02", absl::FormatCivilTime(--day));
+
+  absl::CivilMonth month(2015, 1);
+  EXPECT_EQ("2015-02", absl::FormatCivilTime(month += 1));
+  EXPECT_EQ("2015-03", absl::FormatCivilTime(month + 1));
+  EXPECT_EQ("2015-04", absl::FormatCivilTime(2 + month));
+  EXPECT_EQ("2015-01", absl::FormatCivilTime(month - 1));
+  EXPECT_EQ("2015-01", absl::FormatCivilTime(month -= 1));
+  EXPECT_EQ("2015-01", absl::FormatCivilTime(month++));
+  EXPECT_EQ("2015-03", absl::FormatCivilTime(++month));
+  EXPECT_EQ("2015-03", absl::FormatCivilTime(month--));
+  EXPECT_EQ("2015-01", absl::FormatCivilTime(--month));
+
+  absl::CivilYear year(2015);
+  EXPECT_EQ("2016", absl::FormatCivilTime(year += 1));
+  EXPECT_EQ("2017", absl::FormatCivilTime(year + 1));
+  EXPECT_EQ("2018", absl::FormatCivilTime(2 + year));
+  EXPECT_EQ("2015", absl::FormatCivilTime(year - 1));
+  EXPECT_EQ("2015", absl::FormatCivilTime(year -= 1));
+  EXPECT_EQ("2015", absl::FormatCivilTime(year++));
+  EXPECT_EQ("2017", absl::FormatCivilTime(++year));
+  EXPECT_EQ("2017", absl::FormatCivilTime(year--));
+  EXPECT_EQ("2015", absl::FormatCivilTime(--year));
+}
+
+TEST(CivilTime, ArithmeticLimits) {
+  const int kIntMax = std::numeric_limits<int>::max();
+  const int kIntMin = std::numeric_limits<int>::min();
+
+  absl::CivilSecond second(1970, 1, 1, 0, 0, 0);
+  second += kIntMax;
+  EXPECT_EQ("2038-01-19T03:14:07", absl::FormatCivilTime(second));
+  second -= kIntMax;
+  EXPECT_EQ("1970-01-01T00:00:00", absl::FormatCivilTime(second));
+  second += kIntMin;
+  EXPECT_EQ("1901-12-13T20:45:52", absl::FormatCivilTime(second));
+  second -= kIntMin;
+  EXPECT_EQ("1970-01-01T00:00:00", absl::FormatCivilTime(second));
+
+  absl::CivilMinute minute(1970, 1, 1, 0, 0);
+  minute += kIntMax;
+  EXPECT_EQ("6053-01-23T02:07", absl::FormatCivilTime(minute));
+  minute -= kIntMax;
+  EXPECT_EQ("1970-01-01T00:00", absl::FormatCivilTime(minute));
+  minute += kIntMin;
+  EXPECT_EQ("-2114-12-08T21:52", absl::FormatCivilTime(minute));
+  minute -= kIntMin;
+  EXPECT_EQ("1970-01-01T00:00", absl::FormatCivilTime(minute));
+
+  absl::CivilHour hour(1970, 1, 1, 0);
+  hour += kIntMax;
+  EXPECT_EQ("246953-10-09T07", absl::FormatCivilTime(hour));
+  hour -= kIntMax;
+  EXPECT_EQ("1970-01-01T00", absl::FormatCivilTime(hour));
+  hour += kIntMin;
+  EXPECT_EQ("-243014-03-24T16", absl::FormatCivilTime(hour));
+  hour -= kIntMin;
+  EXPECT_EQ("1970-01-01T00", absl::FormatCivilTime(hour));
+
+  absl::CivilDay day(1970, 1, 1);
+  day += kIntMax;
+  EXPECT_EQ("5881580-07-11", absl::FormatCivilTime(day));
+  day -= kIntMax;
+  EXPECT_EQ("1970-01-01", absl::FormatCivilTime(day));
+  day += kIntMin;
+  EXPECT_EQ("-5877641-06-23", absl::FormatCivilTime(day));
+  day -= kIntMin;
+  EXPECT_EQ("1970-01-01", absl::FormatCivilTime(day));
+
+  absl::CivilMonth month(1970, 1);
+  month += kIntMax;
+  EXPECT_EQ("178958940-08", absl::FormatCivilTime(month));
+  month -= kIntMax;
+  EXPECT_EQ("1970-01", absl::FormatCivilTime(month));
+  month += kIntMin;
+  EXPECT_EQ("-178955001-05", absl::FormatCivilTime(month));
+  month -= kIntMin;
+  EXPECT_EQ("1970-01", absl::FormatCivilTime(month));
+
+  absl::CivilYear year(0);
+  year += kIntMax;
+  EXPECT_EQ("2147483647", absl::FormatCivilTime(year));
+  year -= kIntMax;
+  EXPECT_EQ("0", absl::FormatCivilTime(year));
+  year += kIntMin;
+  EXPECT_EQ("-2147483648", absl::FormatCivilTime(year));
+  year -= kIntMin;
+  EXPECT_EQ("0", absl::FormatCivilTime(year));
+}
+
+TEST(CivilTime, Difference) {
+  absl::CivilSecond second(2015, 1, 2, 3, 4, 5);
+  EXPECT_EQ(0, second - second);
+  EXPECT_EQ(10, (second + 10) - second);
+  EXPECT_EQ(-10, (second - 10) - second);
+
+  absl::CivilMinute minute(2015, 1, 2, 3, 4);
+  EXPECT_EQ(0, minute - minute);
+  EXPECT_EQ(10, (minute + 10) - minute);
+  EXPECT_EQ(-10, (minute - 10) - minute);
+
+  absl::CivilHour hour(2015, 1, 2, 3);
+  EXPECT_EQ(0, hour - hour);
+  EXPECT_EQ(10, (hour + 10) - hour);
+  EXPECT_EQ(-10, (hour - 10) - hour);
+
+  absl::CivilDay day(2015, 1, 2);
+  EXPECT_EQ(0, day - day);
+  EXPECT_EQ(10, (day + 10) - day);
+  EXPECT_EQ(-10, (day - 10) - day);
+
+  absl::CivilMonth month(2015, 1);
+  EXPECT_EQ(0, month - month);
+  EXPECT_EQ(10, (month + 10) - month);
+  EXPECT_EQ(-10, (month - 10) - month);
+
+  absl::CivilYear year(2015);
+  EXPECT_EQ(0, year - year);
+  EXPECT_EQ(10, (year + 10) - year);
+  EXPECT_EQ(-10, (year - 10) - year);
+}
+
+TEST(CivilTime, DifferenceLimits) {
+  const absl::civil_diff_t kDiffMax =
+      std::numeric_limits<absl::civil_diff_t>::max();
+  const absl::civil_diff_t kDiffMin =
+      std::numeric_limits<absl::civil_diff_t>::min();
+
+  // Check day arithmetic at the end of the year range.
+  const absl::CivilDay max_day(kDiffMax, 12, 31);
+  EXPECT_EQ(1, max_day - (max_day - 1));
+  EXPECT_EQ(-1, (max_day - 1) - max_day);
+
+  // Check day arithmetic at the start of the year range.
+  const absl::CivilDay min_day(kDiffMin, 1, 1);
+  EXPECT_EQ(1, (min_day + 1) - min_day);
+  EXPECT_EQ(-1, min_day - (min_day + 1));
+
+  // Check the limits of the return value.
+  const absl::CivilDay d1(1970, 1, 1);
+  const absl::CivilDay d2(25252734927768524, 7, 27);
+  EXPECT_EQ(kDiffMax, d2 - d1);
+  EXPECT_EQ(kDiffMin, d1 - (d2 + 1));
+}
+
+TEST(CivilTime, Properties) {
+  absl::CivilSecond ss(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, ss.year());
+  EXPECT_EQ(2, ss.month());
+  EXPECT_EQ(3, ss.day());
+  EXPECT_EQ(4, ss.hour());
+  EXPECT_EQ(5, ss.minute());
+  EXPECT_EQ(6, ss.second());
+  EXPECT_EQ(absl::Weekday::tuesday, absl::GetWeekday(ss));
+  EXPECT_EQ(34, absl::GetYearDay(ss));
+
+  absl::CivilMinute mm(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, mm.year());
+  EXPECT_EQ(2, mm.month());
+  EXPECT_EQ(3, mm.day());
+  EXPECT_EQ(4, mm.hour());
+  EXPECT_EQ(5, mm.minute());
+  EXPECT_EQ(0, mm.second());
+  EXPECT_EQ(absl::Weekday::tuesday, absl::GetWeekday(mm));
+  EXPECT_EQ(34, absl::GetYearDay(mm));
+
+  absl::CivilHour hh(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, hh.year());
+  EXPECT_EQ(2, hh.month());
+  EXPECT_EQ(3, hh.day());
+  EXPECT_EQ(4, hh.hour());
+  EXPECT_EQ(0, hh.minute());
+  EXPECT_EQ(0, hh.second());
+  EXPECT_EQ(absl::Weekday::tuesday, absl::GetWeekday(hh));
+  EXPECT_EQ(34, absl::GetYearDay(hh));
+
+  absl::CivilDay d(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, d.year());
+  EXPECT_EQ(2, d.month());
+  EXPECT_EQ(3, d.day());
+  EXPECT_EQ(0, d.hour());
+  EXPECT_EQ(0, d.minute());
+  EXPECT_EQ(0, d.second());
+  EXPECT_EQ(absl::Weekday::tuesday, absl::GetWeekday(d));
+  EXPECT_EQ(34, absl::GetYearDay(d));
+
+  absl::CivilMonth m(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, m.year());
+  EXPECT_EQ(2, m.month());
+  EXPECT_EQ(1, m.day());
+  EXPECT_EQ(0, m.hour());
+  EXPECT_EQ(0, m.minute());
+  EXPECT_EQ(0, m.second());
+  EXPECT_EQ(absl::Weekday::sunday, absl::GetWeekday(m));
+  EXPECT_EQ(32, absl::GetYearDay(m));
+
+  absl::CivilYear y(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, y.year());
+  EXPECT_EQ(1, y.month());
+  EXPECT_EQ(1, y.day());
+  EXPECT_EQ(0, y.hour());
+  EXPECT_EQ(0, y.minute());
+  EXPECT_EQ(0, y.second());
+  EXPECT_EQ(absl::Weekday::thursday, absl::GetWeekday(y));
+  EXPECT_EQ(1, absl::GetYearDay(y));
+}
+
+TEST(CivilTime, Format) {
+  absl::CivilSecond ss;
+  EXPECT_EQ("1970-01-01T00:00:00", absl::FormatCivilTime(ss));
+
+  absl::CivilMinute mm;
+  EXPECT_EQ("1970-01-01T00:00", absl::FormatCivilTime(mm));
+
+  absl::CivilHour hh;
+  EXPECT_EQ("1970-01-01T00", absl::FormatCivilTime(hh));
+
+  absl::CivilDay d;
+  EXPECT_EQ("1970-01-01", absl::FormatCivilTime(d));
+
+  absl::CivilMonth m;
+  EXPECT_EQ("1970-01", absl::FormatCivilTime(m));
+
+  absl::CivilYear y;
+  EXPECT_EQ("1970", absl::FormatCivilTime(y));
+}
+
+TEST(CivilTime, Parse) {
+  absl::CivilSecond ss;
+  absl::CivilMinute mm;
+  absl::CivilHour hh;
+  absl::CivilDay d;
+  absl::CivilMonth m;
+  absl::CivilYear y;
+
+  // CivilSecond OK; others fail
+  EXPECT_TRUE(absl::ParseCivilTime("2015-01-02T03:04:05", &ss));
+  EXPECT_EQ("2015-01-02T03:04:05", absl::FormatCivilTime(ss));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02T03:04:05", &mm));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02T03:04:05", &hh));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02T03:04:05", &d));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02T03:04:05", &m));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02T03:04:05", &y));
+
+  // CivilMinute OK; others fail
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02T03:04", &ss));
+  EXPECT_TRUE(absl::ParseCivilTime("2015-01-02T03:04", &mm));
+  EXPECT_EQ("2015-01-02T03:04", absl::FormatCivilTime(mm));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02T03:04", &hh));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02T03:04", &d));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02T03:04", &m));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02T03:04", &y));
+
+  // CivilHour OK; others fail
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02T03", &ss));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02T03", &mm));
+  EXPECT_TRUE(absl::ParseCivilTime("2015-01-02T03", &hh));
+  EXPECT_EQ("2015-01-02T03", absl::FormatCivilTime(hh));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02T03", &d));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02T03", &m));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02T03", &y));
+
+  // CivilDay OK; others fail
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02", &ss));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02", &mm));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02", &hh));
+  EXPECT_TRUE(absl::ParseCivilTime("2015-01-02", &d));
+  EXPECT_EQ("2015-01-02", absl::FormatCivilTime(d));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02", &m));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01-02", &y));
+
+  // CivilMonth OK; others fail
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01", &ss));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01", &mm));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01", &hh));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01", &d));
+  EXPECT_TRUE(absl::ParseCivilTime("2015-01", &m));
+  EXPECT_EQ("2015-01", absl::FormatCivilTime(m));
+  EXPECT_FALSE(absl::ParseCivilTime("2015-01", &y));
+
+  // CivilYear OK; others fail
+  EXPECT_FALSE(absl::ParseCivilTime("2015", &ss));
+  EXPECT_FALSE(absl::ParseCivilTime("2015", &mm));
+  EXPECT_FALSE(absl::ParseCivilTime("2015", &hh));
+  EXPECT_FALSE(absl::ParseCivilTime("2015", &d));
+  EXPECT_FALSE(absl::ParseCivilTime("2015", &m));
+  EXPECT_TRUE(absl::ParseCivilTime("2015", &y));
+  EXPECT_EQ("2015", absl::FormatCivilTime(y));
+}
+
+TEST(CivilTime, FormatAndParseLenient) {
+  absl::CivilSecond ss;
+  EXPECT_EQ("1970-01-01T00:00:00", absl::FormatCivilTime(ss));
+
+  absl::CivilMinute mm;
+  EXPECT_EQ("1970-01-01T00:00", absl::FormatCivilTime(mm));
+
+  absl::CivilHour hh;
+  EXPECT_EQ("1970-01-01T00", absl::FormatCivilTime(hh));
+
+  absl::CivilDay d;
+  EXPECT_EQ("1970-01-01", absl::FormatCivilTime(d));
+
+  absl::CivilMonth m;
+  EXPECT_EQ("1970-01", absl::FormatCivilTime(m));
+
+  absl::CivilYear y;
+  EXPECT_EQ("1970", absl::FormatCivilTime(y));
+
+  EXPECT_TRUE(absl::ParseLenientCivilTime("2015-01-02T03:04:05", &ss));
+  EXPECT_EQ("2015-01-02T03:04:05", absl::FormatCivilTime(ss));
+
+  EXPECT_TRUE(absl::ParseLenientCivilTime("2015-01-02T03:04:05", &mm));
+  EXPECT_EQ("2015-01-02T03:04", absl::FormatCivilTime(mm));
+
+  EXPECT_TRUE(absl::ParseLenientCivilTime("2015-01-02T03:04:05", &hh));
+  EXPECT_EQ("2015-01-02T03", absl::FormatCivilTime(hh));
+
+  EXPECT_TRUE(absl::ParseLenientCivilTime("2015-01-02T03:04:05", &d));
+  EXPECT_EQ("2015-01-02", absl::FormatCivilTime(d));
+
+  EXPECT_TRUE(absl::ParseLenientCivilTime("2015-01-02T03:04:05", &m));
+  EXPECT_EQ("2015-01", absl::FormatCivilTime(m));
+
+  EXPECT_TRUE(absl::ParseLenientCivilTime("2015-01-02T03:04:05", &y));
+  EXPECT_EQ("2015", absl::FormatCivilTime(y));
+}
+
+TEST(CivilTime, ParseEdgeCases) {
+  absl::CivilSecond ss;
+  EXPECT_TRUE(
+      absl::ParseLenientCivilTime("9223372036854775807-12-31T23:59:59", &ss));
+  EXPECT_EQ("9223372036854775807-12-31T23:59:59", absl::FormatCivilTime(ss));
+  EXPECT_TRUE(
+      absl::ParseLenientCivilTime("-9223372036854775808-01-01T00:00:00", &ss));
+  EXPECT_EQ("-9223372036854775808-01-01T00:00:00", absl::FormatCivilTime(ss));
+
+  absl::CivilMinute mm;
+  EXPECT_TRUE(
+      absl::ParseLenientCivilTime("9223372036854775807-12-31T23:59", &mm));
+  EXPECT_EQ("9223372036854775807-12-31T23:59", absl::FormatCivilTime(mm));
+  EXPECT_TRUE(
+      absl::ParseLenientCivilTime("-9223372036854775808-01-01T00:00", &mm));
+  EXPECT_EQ("-9223372036854775808-01-01T00:00", absl::FormatCivilTime(mm));
+
+  absl::CivilHour hh;
+  EXPECT_TRUE(
+      absl::ParseLenientCivilTime("9223372036854775807-12-31T23", &hh));
+  EXPECT_EQ("9223372036854775807-12-31T23", absl::FormatCivilTime(hh));
+  EXPECT_TRUE(
+      absl::ParseLenientCivilTime("-9223372036854775808-01-01T00", &hh));
+  EXPECT_EQ("-9223372036854775808-01-01T00", absl::FormatCivilTime(hh));
+
+  absl::CivilDay d;
+  EXPECT_TRUE(absl::ParseLenientCivilTime("9223372036854775807-12-31", &d));
+  EXPECT_EQ("9223372036854775807-12-31", absl::FormatCivilTime(d));
+  EXPECT_TRUE(absl::ParseLenientCivilTime("-9223372036854775808-01-01", &d));
+  EXPECT_EQ("-9223372036854775808-01-01", absl::FormatCivilTime(d));
+
+  absl::CivilMonth m;
+  EXPECT_TRUE(absl::ParseLenientCivilTime("9223372036854775807-12", &m));
+  EXPECT_EQ("9223372036854775807-12", absl::FormatCivilTime(m));
+  EXPECT_TRUE(absl::ParseLenientCivilTime("-9223372036854775808-01", &m));
+  EXPECT_EQ("-9223372036854775808-01", absl::FormatCivilTime(m));
+
+  absl::CivilYear y;
+  EXPECT_TRUE(absl::ParseLenientCivilTime("9223372036854775807", &y));
+  EXPECT_EQ("9223372036854775807", absl::FormatCivilTime(y));
+  EXPECT_TRUE(absl::ParseLenientCivilTime("-9223372036854775808", &y));
+  EXPECT_EQ("-9223372036854775808", absl::FormatCivilTime(y));
+
+  // Tests some valid, but interesting, cases
+  EXPECT_TRUE(absl::ParseLenientCivilTime("0", &ss)) << ss;
+  EXPECT_EQ(absl::CivilYear(0), ss);
+  EXPECT_TRUE(absl::ParseLenientCivilTime("0-1", &ss)) << ss;
+  EXPECT_EQ(absl::CivilMonth(0, 1), ss);
+  EXPECT_TRUE(absl::ParseLenientCivilTime(" 2015 ", &ss)) << ss;
+  EXPECT_EQ(absl::CivilYear(2015), ss);
+  EXPECT_TRUE(absl::ParseLenientCivilTime(" 2015-6 ", &ss)) << ss;
+  EXPECT_EQ(absl::CivilMonth(2015, 6), ss);
+  EXPECT_TRUE(absl::ParseLenientCivilTime("2015-6-7", &ss)) << ss;
+  EXPECT_EQ(absl::CivilDay(2015, 6, 7), ss);
+  EXPECT_TRUE(absl::ParseLenientCivilTime(" 2015-6-7 ", &ss)) << ss;
+  EXPECT_EQ(absl::CivilDay(2015, 6, 7), ss);
+  EXPECT_TRUE(absl::ParseLenientCivilTime("2015-06-07T10:11:12 ", &ss)) << ss;
+  EXPECT_EQ(absl::CivilSecond(2015, 6, 7, 10, 11, 12), ss);
+  EXPECT_TRUE(absl::ParseLenientCivilTime(" 2015-06-07T10:11:12 ", &ss)) << ss;
+  EXPECT_EQ(absl::CivilSecond(2015, 6, 7, 10, 11, 12), ss);
+  EXPECT_TRUE(absl::ParseLenientCivilTime("-01-01", &ss)) << ss;
+  EXPECT_EQ(absl::CivilMonth(-1, 1), ss);
+
+  // Tests some invalid cases
+  EXPECT_FALSE(absl::ParseLenientCivilTime("01-01-2015", &ss)) << ss;
+  EXPECT_FALSE(absl::ParseLenientCivilTime("2015-", &ss)) << ss;
+  EXPECT_FALSE(absl::ParseLenientCivilTime("0xff-01", &ss)) << ss;
+  EXPECT_FALSE(absl::ParseLenientCivilTime("2015-02-30T04:05:06", &ss)) << ss;
+  EXPECT_FALSE(absl::ParseLenientCivilTime("2015-02-03T04:05:96", &ss)) << ss;
+  EXPECT_FALSE(absl::ParseLenientCivilTime("X2015-02-03T04:05:06", &ss)) << ss;
+  EXPECT_FALSE(absl::ParseLenientCivilTime("2015-02-03T04:05:003", &ss)) << ss;
+  EXPECT_FALSE(absl::ParseLenientCivilTime("2015 -02-03T04:05:06", &ss)) << ss;
+  EXPECT_FALSE(absl::ParseLenientCivilTime("2015-02-03-04:05:06", &ss)) << ss;
+  EXPECT_FALSE(absl::ParseLenientCivilTime("2015:02:03T04-05-06", &ss)) << ss;
+  EXPECT_FALSE(absl::ParseLenientCivilTime("9223372036854775808", &y)) << y;
+}
+
+TEST(CivilTime, OutputStream) {
+  absl::CivilSecond cs(2016, 2, 3, 4, 5, 6);
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << absl::CivilYear(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016.................X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << absl::CivilMonth(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016-02..............X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << absl::CivilDay(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016-02-03...........X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << absl::CivilHour(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016-02-03T04........X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << absl::CivilMinute(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016-02-03T04:05.....X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << absl::CivilSecond(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016-02-03T04:05:06..X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << absl::Weekday::wednesday;
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..Wednesday............X..", ss.str());
+  }
+}
+
+TEST(CivilTime, Weekday) {
+  absl::CivilDay d(1970, 1, 1);
+  EXPECT_EQ(absl::Weekday::thursday, absl::GetWeekday(d)) << d;
+
+  // We used to get this wrong for years < -30.
+  d = absl::CivilDay(-31, 12, 24);
+  EXPECT_EQ(absl::Weekday::wednesday, absl::GetWeekday(d)) << d;
+}
+
+TEST(CivilTime, NextPrevWeekday) {
+  // Jan 1, 1970 was a Thursday.
+  const absl::CivilDay thursday(1970, 1, 1);
+
+  // Thursday -> Thursday
+  absl::CivilDay d = absl::NextWeekday(thursday, absl::Weekday::thursday);
+  EXPECT_EQ(7, d - thursday) << d;
+  EXPECT_EQ(d - 14, absl::PrevWeekday(thursday, absl::Weekday::thursday));
+
+  // Thursday -> Friday
+  d = absl::NextWeekday(thursday, absl::Weekday::friday);
+  EXPECT_EQ(1, d - thursday) << d;
+  EXPECT_EQ(d - 7, absl::PrevWeekday(thursday, absl::Weekday::friday));
+
+  // Thursday -> Saturday
+  d = absl::NextWeekday(thursday, absl::Weekday::saturday);
+  EXPECT_EQ(2, d - thursday) << d;
+  EXPECT_EQ(d - 7, absl::PrevWeekday(thursday, absl::Weekday::saturday));
+
+  // Thursday -> Sunday
+  d = absl::NextWeekday(thursday, absl::Weekday::sunday);
+  EXPECT_EQ(3, d - thursday) << d;
+  EXPECT_EQ(d - 7, absl::PrevWeekday(thursday, absl::Weekday::sunday));
+
+  // Thursday -> Monday
+  d = absl::NextWeekday(thursday, absl::Weekday::monday);
+  EXPECT_EQ(4, d - thursday) << d;
+  EXPECT_EQ(d - 7, absl::PrevWeekday(thursday, absl::Weekday::monday));
+
+  // Thursday -> Tuesday
+  d = absl::NextWeekday(thursday, absl::Weekday::tuesday);
+  EXPECT_EQ(5, d - thursday) << d;
+  EXPECT_EQ(d - 7, absl::PrevWeekday(thursday, absl::Weekday::tuesday));
+
+  // Thursday -> Wednesday
+  d = absl::NextWeekday(thursday, absl::Weekday::wednesday);
+  EXPECT_EQ(6, d - thursday) << d;
+  EXPECT_EQ(d - 7, absl::PrevWeekday(thursday, absl::Weekday::wednesday));
+}
+
+// NOTE: Run this with --copt=-ftrapv to detect overflow problems.
+TEST(CivilTime, DifferenceWithHugeYear) {
+  absl::CivilDay d1(9223372036854775807, 1, 1);
+  absl::CivilDay d2(9223372036854775807, 12, 31);
+  EXPECT_EQ(364, d2 - d1);
+
+  d1 = absl::CivilDay(-9223372036854775807 - 1, 1, 1);
+  d2 = absl::CivilDay(-9223372036854775807 - 1, 12, 31);
+  EXPECT_EQ(365, d2 - d1);
+
+  // Check the limits of the return value at the end of the year range.
+  d1 = absl::CivilDay(9223372036854775807, 1, 1);
+  d2 = absl::CivilDay(9198119301927009252, 6, 6);
+  EXPECT_EQ(9223372036854775807, d1 - d2);
+  d2 = d2 - 1;
+  EXPECT_EQ(-9223372036854775807 - 1, d2 - d1);
+
+  // Check the limits of the return value at the start of the year range.
+  d1 = absl::CivilDay(-9223372036854775807 - 1, 1, 1);
+  d2 = absl::CivilDay(-9198119301927009254, 7, 28);
+  EXPECT_EQ(9223372036854775807, d2 - d1);
+  d2 = d2 + 1;
+  EXPECT_EQ(-9223372036854775807 - 1, d1 - d2);
+
+  // Check the limits of the return value from either side of year 0.
+  d1 = absl::CivilDay(-12626367463883278, 9, 3);
+  d2 = absl::CivilDay(12626367463883277, 3, 28);
+  EXPECT_EQ(9223372036854775807, d2 - d1);
+  d2 = d2 + 1;
+  EXPECT_EQ(-9223372036854775807 - 1, d1 - d2);
+}
+
+// NOTE: Run this with --copt=-ftrapv to detect overflow problems.
+TEST(CivilTime, DifferenceNoIntermediateOverflow) {
+  // The difference up to the minute field would be below the minimum
+  // int64_t, but the 52 extra seconds brings us back to the minimum.
+  absl::CivilSecond s1(-292277022657, 1, 27, 8, 29 - 1, 52);
+  absl::CivilSecond s2(1970, 1, 1, 0, 0 - 1, 0);
+  EXPECT_EQ(-9223372036854775807 - 1, s1 - s2);
+
+  // The difference up to the minute field would be above the maximum
+  // int64_t, but the -53 extra seconds brings us back to the maximum.
+  s1 = absl::CivilSecond(292277026596, 12, 4, 15, 30, 7 - 7);
+  s2 = absl::CivilSecond(1970, 1, 1, 0, 0, 0 - 7);
+  EXPECT_EQ(9223372036854775807, s1 - s2);
+}
+
+TEST(CivilTime, NormalizeSimpleOverflow) {
+  absl::CivilSecond cs;
+  cs = absl::CivilSecond(2013, 11, 15, 16, 32, 59 + 1);
+  EXPECT_EQ("2013-11-15T16:33:00", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11, 15, 16, 59 + 1, 14);
+  EXPECT_EQ("2013-11-15T17:00:14", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11, 15, 23 + 1, 32, 14);
+  EXPECT_EQ("2013-11-16T00:32:14", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11, 30 + 1, 16, 32, 14);
+  EXPECT_EQ("2013-12-01T16:32:14", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 12 + 1, 15, 16, 32, 14);
+  EXPECT_EQ("2014-01-15T16:32:14", absl::FormatCivilTime(cs));
+}
+
+TEST(CivilTime, NormalizeSimpleUnderflow) {
+  absl::CivilSecond cs;
+  cs = absl::CivilSecond(2013, 11, 15, 16, 32, 0 - 1);
+  EXPECT_EQ("2013-11-15T16:31:59", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11, 15, 16, 0 - 1, 14);
+  EXPECT_EQ("2013-11-15T15:59:14", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11, 15, 0 - 1, 32, 14);
+  EXPECT_EQ("2013-11-14T23:32:14", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11, 1 - 1, 16, 32, 14);
+  EXPECT_EQ("2013-10-31T16:32:14", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 1 - 1, 15, 16, 32, 14);
+  EXPECT_EQ("2012-12-15T16:32:14", absl::FormatCivilTime(cs));
+}
+
+TEST(CivilTime, NormalizeMultipleOverflow) {
+  absl::CivilSecond cs(2013, 12, 31, 23, 59, 59 + 1);
+  EXPECT_EQ("2014-01-01T00:00:00", absl::FormatCivilTime(cs));
+}
+
+TEST(CivilTime, NormalizeMultipleUnderflow) {
+  absl::CivilSecond cs(2014, 1, 1, 0, 0, 0 - 1);
+  EXPECT_EQ("2013-12-31T23:59:59", absl::FormatCivilTime(cs));
+}
+
+TEST(CivilTime, NormalizeOverflowLimits) {
+  absl::CivilSecond cs;
+
+  const int kintmax = std::numeric_limits<int>::max();
+  cs = absl::CivilSecond(0, kintmax, kintmax, kintmax, kintmax, kintmax);
+  EXPECT_EQ("185085715-11-27T12:21:07", absl::FormatCivilTime(cs));
+
+  const int kintmin = std::numeric_limits<int>::min();
+  cs = absl::CivilSecond(0, kintmin, kintmin, kintmin, kintmin, kintmin);
+  EXPECT_EQ("-185085717-10-31T10:37:52", absl::FormatCivilTime(cs));
+}
+
+TEST(CivilTime, NormalizeComplexOverflow) {
+  absl::CivilSecond cs;
+  cs = absl::CivilSecond(2013, 11, 15, 16, 32, 14 + 123456789);
+  EXPECT_EQ("2017-10-14T14:05:23", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11, 15, 16, 32 + 1234567, 14);
+  EXPECT_EQ("2016-03-22T00:39:14", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11, 15, 16 + 123456, 32, 14);
+  EXPECT_EQ("2027-12-16T16:32:14", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11, 15 + 1234, 16, 32, 14);
+  EXPECT_EQ("2017-04-02T16:32:14", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11 + 123, 15, 16, 32, 14);
+  EXPECT_EQ("2024-02-15T16:32:14", absl::FormatCivilTime(cs));
+}
+
+TEST(CivilTime, NormalizeComplexUnderflow) {
+  absl::CivilSecond cs;
+  cs = absl::CivilSecond(1999, 3, 0, 0, 0, 0);  // year 400
+  EXPECT_EQ("1999-02-28T00:00:00", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11, 15, 16, 32, 14 - 123456789);
+  EXPECT_EQ("2009-12-17T18:59:05", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11, 15, 16, 32 - 1234567, 14);
+  EXPECT_EQ("2011-07-12T08:25:14", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11, 15, 16 - 123456, 32, 14);
+  EXPECT_EQ("1999-10-16T16:32:14", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11, 15 - 1234, 16, 32, 14);
+  EXPECT_EQ("2010-06-30T16:32:14", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11 - 123, 15, 16, 32, 14);
+  EXPECT_EQ("2003-08-15T16:32:14", absl::FormatCivilTime(cs));
+}
+
+TEST(CivilTime, NormalizeMishmash) {
+  absl::CivilSecond cs;
+  cs = absl::CivilSecond(2013, 11 - 123, 15 + 1234, 16 - 123456, 32 + 1234567,
+                         14 - 123456789);
+  EXPECT_EQ("1991-05-09T03:06:05", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11 + 123, 15 - 1234, 16 + 123456, 32 - 1234567,
+                         14 + 123456789);
+  EXPECT_EQ("2036-05-24T05:58:23", absl::FormatCivilTime(cs));
+
+  cs = absl::CivilSecond(2013, 11, -146097 + 1, 16, 32, 14);
+  EXPECT_EQ("1613-11-01T16:32:14", absl::FormatCivilTime(cs));
+  cs = absl::CivilSecond(2013, 11 + 400 * 12, -146097 + 1, 16, 32, 14);
+  EXPECT_EQ("2013-11-01T16:32:14", absl::FormatCivilTime(cs));
+}
+
+// Convert all the days from 1970-1-1 to 1970-1-146097 (aka 2369-12-31)
+// and check that they normalize to the expected time.  146097 days span
+// the 400-year Gregorian cycle used during normalization.
+TEST(CivilTime, NormalizeAllTheDays) {
+  absl::CivilDay expected(1970, 1, 1);
+  for (int day = 1; day <= 146097; ++day) {
+    absl::CivilSecond cs(1970, 1, day, 0, 0, 0);
+    EXPECT_EQ(expected, cs);
+    ++expected;
+  }
+}
+
+TEST(CivilTime, NormalizeWithHugeYear) {
+  absl::CivilMonth c(9223372036854775807, 1);
+  EXPECT_EQ("9223372036854775807-01", absl::FormatCivilTime(c));
+  c = c - 1;  // Causes normalization
+  EXPECT_EQ("9223372036854775806-12", absl::FormatCivilTime(c));
+
+  c = absl::CivilMonth(-9223372036854775807 - 1, 1);
+  EXPECT_EQ("-9223372036854775808-01", absl::FormatCivilTime(c));
+  c = c + 12;  // Causes normalization
+  EXPECT_EQ("-9223372036854775807-01", absl::FormatCivilTime(c));
+}
+
+TEST(CivilTime, LeapYears) {
+  const absl::CivilSecond s1(2013, 2, 28 + 1, 0, 0, 0);
+  EXPECT_EQ("2013-03-01T00:00:00", absl::FormatCivilTime(s1));
+
+  const absl::CivilSecond s2(2012, 2, 28 + 1, 0, 0, 0);
+  EXPECT_EQ("2012-02-29T00:00:00", absl::FormatCivilTime(s2));
+
+  const absl::CivilSecond s3(1900, 2, 28 + 1, 0, 0, 0);
+  EXPECT_EQ("1900-03-01T00:00:00", absl::FormatCivilTime(s3));
+
+  const struct {
+    int year;
+    int days;
+    struct {
+      int month;
+      int day;
+    } leap_day;  // The date of the day after Feb 28.
+  } kLeapYearTable[]{
+      {1900, 365, {3, 1}},
+      {1999, 365, {3, 1}},
+      {2000, 366, {2, 29}},  // leap year
+      {2001, 365, {3, 1}},
+      {2002, 365, {3, 1}},
+      {2003, 365, {3, 1}},
+      {2004, 366, {2, 29}},  // leap year
+      {2005, 365, {3, 1}},
+      {2006, 365, {3, 1}},
+      {2007, 365, {3, 1}},
+      {2008, 366, {2, 29}},  // leap year
+      {2009, 365, {3, 1}},
+      {2100, 365, {3, 1}},
+  };
+
+  for (int i = 0; i < ABSL_ARRAYSIZE(kLeapYearTable); ++i) {
+    const int y = kLeapYearTable[i].year;
+    const int m = kLeapYearTable[i].leap_day.month;
+    const int d = kLeapYearTable[i].leap_day.day;
+    const int n = kLeapYearTable[i].days;
+
+    // Tests incrementing through the leap day.
+    const absl::CivilDay feb28(y, 2, 28);
+    const absl::CivilDay next_day = feb28 + 1;
+    EXPECT_EQ(m, next_day.month());
+    EXPECT_EQ(d, next_day.day());
+
+    // Tests difference in days of leap years.
+    const absl::CivilYear year(feb28);
+    const absl::CivilYear next_year = year + 1;
+    EXPECT_EQ(n, absl::CivilDay(next_year) - absl::CivilDay(year));
+  }
+}
+
+TEST(CivilTime, FirstThursdayInMonth) {
+  const absl::CivilDay nov1(2014, 11, 1);
+  const absl::CivilDay thursday =
+      absl::NextWeekday(nov1 - 1, absl::Weekday::thursday);
+  EXPECT_EQ("2014-11-06", absl::FormatCivilTime(thursday));
+
+  // Bonus: Date of Thanksgiving in the United States
+  // Rule: Fourth Thursday of November
+  const absl::CivilDay thanksgiving = thursday +  7 * 3;
+  EXPECT_EQ("2014-11-27", absl::FormatCivilTime(thanksgiving));
+}
+
+TEST(CivilTime, DocumentationExample) {
+  absl::CivilSecond second(2015, 6, 28, 1, 2, 3);  // 2015-06-28 01:02:03
+  absl::CivilMinute minute(second);                // 2015-06-28 01:02:00
+  absl::CivilDay day(minute);                      // 2015-06-28 00:00:00
+
+  second -= 1;                    // 2015-06-28 01:02:02
+  --second;                       // 2015-06-28 01:02:01
+  EXPECT_EQ(minute, second - 1);  // Comparison between types
+  EXPECT_LT(minute, second);
+
+  // int diff = second - minute;  // ERROR: Mixed types, won't compile
+
+  absl::CivilDay june_1(2015, 6, 1);  // Pass fields to c'tor.
+  int diff = day - june_1;            // Num days between 'day' and June 1
+  EXPECT_EQ(27, diff);
+
+  // Fields smaller than alignment are floored to their minimum value.
+  absl::CivilDay day_floor(2015, 1, 2, 9, 9, 9);
+  EXPECT_EQ(0, day_floor.hour());  // 09:09:09 is floored
+  EXPECT_EQ(absl::CivilDay(2015, 1, 2), day_floor);
+
+  // Unspecified fields default to their minium value
+  absl::CivilDay day_default(2015);  // Defaults to Jan 1
+  EXPECT_EQ(absl::CivilDay(2015, 1, 1), day_default);
+
+  // Iterates all the days of June.
+  absl::CivilMonth june(day);  // CivilDay -> CivilMonth
+  absl::CivilMonth july = june + 1;
+  for (absl::CivilDay day = june_1; day < july; ++day) {
+    // ...
+  }
+}
+
+}  // namespace
diff --git a/third_party/abseil_cpp/absl/time/clock.cc b/third_party/abseil_cpp/absl/time/clock.cc
new file mode 100644
index 0000000000..e5c423c7e4
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/clock.cc
@@ -0,0 +1,569 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/time/clock.h"
+
+#include "absl/base/attributes.h"
+
+#ifdef _WIN32
+#include <windows.h>
+#endif
+
+#include <algorithm>
+#include <atomic>
+#include <cerrno>
+#include <cstdint>
+#include <ctime>
+#include <limits>
+
+#include "absl/base/internal/spinlock.h"
+#include "absl/base/internal/unscaledcycleclock.h"
+#include "absl/base/macros.h"
+#include "absl/base/port.h"
+#include "absl/base/thread_annotations.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+Time Now() {
+  // TODO(bww): Get a timespec instead so we don't have to divide.
+  int64_t n = absl::GetCurrentTimeNanos();
+  if (n >= 0) {
+    return time_internal::FromUnixDuration(
+        time_internal::MakeDuration(n / 1000000000, n % 1000000000 * 4));
+  }
+  return time_internal::FromUnixDuration(absl::Nanoseconds(n));
+}
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+// Decide if we should use the fast GetCurrentTimeNanos() algorithm
+// based on the cyclecounter, otherwise just get the time directly
+// from the OS on every call. This can be chosen at compile-time via
+// -DABSL_USE_CYCLECLOCK_FOR_GET_CURRENT_TIME_NANOS=[0|1]
+#ifndef ABSL_USE_CYCLECLOCK_FOR_GET_CURRENT_TIME_NANOS
+#if ABSL_USE_UNSCALED_CYCLECLOCK
+#define ABSL_USE_CYCLECLOCK_FOR_GET_CURRENT_TIME_NANOS 1
+#else
+#define ABSL_USE_CYCLECLOCK_FOR_GET_CURRENT_TIME_NANOS 0
+#endif
+#endif
+
+#if defined(__APPLE__) || defined(_WIN32)
+#include "absl/time/internal/get_current_time_chrono.inc"
+#else
+#include "absl/time/internal/get_current_time_posix.inc"
+#endif
+
+// Allows override by test.
+#ifndef GET_CURRENT_TIME_NANOS_FROM_SYSTEM
+#define GET_CURRENT_TIME_NANOS_FROM_SYSTEM() \
+  ::absl::time_internal::GetCurrentTimeNanosFromSystem()
+#endif
+
+#if !ABSL_USE_CYCLECLOCK_FOR_GET_CURRENT_TIME_NANOS
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+int64_t GetCurrentTimeNanos() {
+  return GET_CURRENT_TIME_NANOS_FROM_SYSTEM();
+}
+ABSL_NAMESPACE_END
+}  // namespace absl
+#else  // Use the cyclecounter-based implementation below.
+
+// Allows override by test.
+#ifndef GET_CURRENT_TIME_NANOS_CYCLECLOCK_NOW
+#define GET_CURRENT_TIME_NANOS_CYCLECLOCK_NOW() \
+  ::absl::time_internal::UnscaledCycleClockWrapperForGetCurrentTime::Now()
+#endif
+
+// The following counters are used only by the test code.
+static int64_t stats_initializations;
+static int64_t stats_reinitializations;
+static int64_t stats_calibrations;
+static int64_t stats_slow_paths;
+static int64_t stats_fast_slow_paths;
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+// This is a friend wrapper around UnscaledCycleClock::Now()
+// (needed to access UnscaledCycleClock).
+class UnscaledCycleClockWrapperForGetCurrentTime {
+ public:
+  static int64_t Now() { return base_internal::UnscaledCycleClock::Now(); }
+};
+}  // namespace time_internal
+
+// uint64_t is used in this module to provide an extra bit in multiplications
+
+// Return the time in ns as told by the kernel interface.  Place in *cycleclock
+// the value of the cycleclock at about the time of the syscall.
+// This call represents the time base that this module synchronizes to.
+// Ensures that *cycleclock does not step back by up to (1 << 16) from
+// last_cycleclock, to discard small backward counter steps.  (Larger steps are
+// assumed to be complete resyncs, which shouldn't happen.  If they do, a full
+// reinitialization of the outer algorithm should occur.)
+static int64_t GetCurrentTimeNanosFromKernel(uint64_t last_cycleclock,
+                                             uint64_t *cycleclock) {
+  // We try to read clock values at about the same time as the kernel clock.
+  // This value gets adjusted up or down as estimate of how long that should
+  // take, so we can reject attempts that take unusually long.
+  static std::atomic<uint64_t> approx_syscall_time_in_cycles{10 * 1000};
+
+  uint64_t local_approx_syscall_time_in_cycles =  // local copy
+      approx_syscall_time_in_cycles.load(std::memory_order_relaxed);
+
+  int64_t current_time_nanos_from_system;
+  uint64_t before_cycles;
+  uint64_t after_cycles;
+  uint64_t elapsed_cycles;
+  int loops = 0;
+  do {
+    before_cycles = GET_CURRENT_TIME_NANOS_CYCLECLOCK_NOW();
+    current_time_nanos_from_system = GET_CURRENT_TIME_NANOS_FROM_SYSTEM();
+    after_cycles = GET_CURRENT_TIME_NANOS_CYCLECLOCK_NOW();
+    // elapsed_cycles is unsigned, so is large on overflow
+    elapsed_cycles = after_cycles - before_cycles;
+    if (elapsed_cycles >= local_approx_syscall_time_in_cycles &&
+        ++loops == 20) {  // clock changed frequencies?  Back off.
+      loops = 0;
+      if (local_approx_syscall_time_in_cycles < 1000 * 1000) {
+        local_approx_syscall_time_in_cycles =
+            (local_approx_syscall_time_in_cycles + 1) << 1;
+      }
+      approx_syscall_time_in_cycles.store(
+          local_approx_syscall_time_in_cycles,
+          std::memory_order_relaxed);
+    }
+  } while (elapsed_cycles >= local_approx_syscall_time_in_cycles ||
+           last_cycleclock - after_cycles < (static_cast<uint64_t>(1) << 16));
+
+  // Number of times in a row we've seen a kernel time call take substantially
+  // less than approx_syscall_time_in_cycles.
+  static std::atomic<uint32_t> seen_smaller{ 0 };
+
+  // Adjust approx_syscall_time_in_cycles to be within a factor of 2
+  // of the typical time to execute one iteration of the loop above.
+  if ((local_approx_syscall_time_in_cycles >> 1) < elapsed_cycles) {
+    // measured time is no smaller than half current approximation
+    seen_smaller.store(0, std::memory_order_relaxed);
+  } else if (seen_smaller.fetch_add(1, std::memory_order_relaxed) >= 3) {
+    // smaller delays several times in a row; reduce approximation by 12.5%
+    const uint64_t new_approximation =
+        local_approx_syscall_time_in_cycles -
+        (local_approx_syscall_time_in_cycles >> 3);
+    approx_syscall_time_in_cycles.store(new_approximation,
+                                        std::memory_order_relaxed);
+    seen_smaller.store(0, std::memory_order_relaxed);
+  }
+
+  *cycleclock = after_cycles;
+  return current_time_nanos_from_system;
+}
+
+
+// ---------------------------------------------------------------------
+// An implementation of reader-write locks that use no atomic ops in the read
+// case.  This is a generalization of Lamport's method for reading a multiword
+// clock.  Increment a word on each write acquisition, using the low-order bit
+// as a spinlock; the word is the high word of the "clock".  Readers read the
+// high word, then all other data, then the high word again, and repeat the
+// read if the reads of the high words yields different answers, or an odd
+// value (either case suggests possible interference from a writer).
+// Here we use a spinlock to ensure only one writer at a time, rather than
+// spinning on the bottom bit of the word to benefit from SpinLock
+// spin-delay tuning.
+
+// Acquire seqlock (*seq) and return the value to be written to unlock.
+static inline uint64_t SeqAcquire(std::atomic<uint64_t> *seq) {
+  uint64_t x = seq->fetch_add(1, std::memory_order_relaxed);
+
+  // We put a release fence between update to *seq and writes to shared data.
+  // Thus all stores to shared data are effectively release operations and
+  // update to *seq above cannot be re-ordered past any of them.  Note that
+  // this barrier is not for the fetch_add above.  A release barrier for the
+  // fetch_add would be before it, not after.
+  std::atomic_thread_fence(std::memory_order_release);
+
+  return x + 2;   // original word plus 2
+}
+
+// Release seqlock (*seq) by writing x to it---a value previously returned by
+// SeqAcquire.
+static inline void SeqRelease(std::atomic<uint64_t> *seq, uint64_t x) {
+  // The unlock store to *seq must have release ordering so that all
+  // updates to shared data must finish before this store.
+  seq->store(x, std::memory_order_release);  // release lock for readers
+}
+
+// ---------------------------------------------------------------------
+
+// "nsscaled" is unit of time equal to a (2**kScale)th of a nanosecond.
+enum { kScale = 30 };
+
+// The minimum interval between samples of the time base.
+// We pick enough time to amortize the cost of the sample,
+// to get a reasonably accurate cycle counter rate reading,
+// and not so much that calculations will overflow 64-bits.
+static const uint64_t kMinNSBetweenSamples = 2000 << 20;
+
+// We require that kMinNSBetweenSamples shifted by kScale
+// have at least a bit left over for 64-bit calculations.
+static_assert(((kMinNSBetweenSamples << (kScale + 1)) >> (kScale + 1)) ==
+               kMinNSBetweenSamples,
+               "cannot represent kMaxBetweenSamplesNSScaled");
+
+// A reader-writer lock protecting the static locations below.
+// See SeqAcquire() and SeqRelease() above.
+ABSL_CONST_INIT static absl::base_internal::SpinLock lock(
+    absl::kConstInit, base_internal::SCHEDULE_KERNEL_ONLY);
+ABSL_CONST_INIT static std::atomic<uint64_t> seq(0);
+
+// data from a sample of the kernel's time value
+struct TimeSampleAtomic {
+  std::atomic<uint64_t> raw_ns;              // raw kernel time
+  std::atomic<uint64_t> base_ns;             // our estimate of time
+  std::atomic<uint64_t> base_cycles;         // cycle counter reading
+  std::atomic<uint64_t> nsscaled_per_cycle;  // cycle period
+  // cycles before we'll sample again (a scaled reciprocal of the period,
+  // to avoid a division on the fast path).
+  std::atomic<uint64_t> min_cycles_per_sample;
+};
+// Same again, but with non-atomic types
+struct TimeSample {
+  uint64_t raw_ns;                 // raw kernel time
+  uint64_t base_ns;                // our estimate of time
+  uint64_t base_cycles;            // cycle counter reading
+  uint64_t nsscaled_per_cycle;     // cycle period
+  uint64_t min_cycles_per_sample;  // approx cycles before next sample
+};
+
+static struct TimeSampleAtomic last_sample;   // the last sample; under seq
+
+static int64_t GetCurrentTimeNanosSlowPath() ABSL_ATTRIBUTE_COLD;
+
+// Read the contents of *atomic into *sample.
+// Each field is read atomically, but to maintain atomicity between fields,
+// the access must be done under a lock.
+static void ReadTimeSampleAtomic(const struct TimeSampleAtomic *atomic,
+                                 struct TimeSample *sample) {
+  sample->base_ns = atomic->base_ns.load(std::memory_order_relaxed);
+  sample->base_cycles = atomic->base_cycles.load(std::memory_order_relaxed);
+  sample->nsscaled_per_cycle =
+      atomic->nsscaled_per_cycle.load(std::memory_order_relaxed);
+  sample->min_cycles_per_sample =
+      atomic->min_cycles_per_sample.load(std::memory_order_relaxed);
+  sample->raw_ns = atomic->raw_ns.load(std::memory_order_relaxed);
+}
+
+// Public routine.
+// Algorithm:  We wish to compute real time from a cycle counter.  In normal
+// operation, we construct a piecewise linear approximation to the kernel time
+// source, using the cycle counter value.  The start of each line segment is at
+// the same point as the end of the last, but may have a different slope (that
+// is, a different idea of the cycle counter frequency).  Every couple of
+// seconds, the kernel time source is sampled and compared with the current
+// approximation.  A new slope is chosen that, if followed for another couple
+// of seconds, will correct the error at the current position.  The information
+// for a sample is in the "last_sample" struct.  The linear approximation is
+//   estimated_time = last_sample.base_ns +
+//     last_sample.ns_per_cycle * (counter_reading - last_sample.base_cycles)
+// (ns_per_cycle is actually stored in different units and scaled, to avoid
+// overflow).  The base_ns of the next linear approximation is the
+// estimated_time using the last approximation; the base_cycles is the cycle
+// counter value at that time; the ns_per_cycle is the number of ns per cycle
+// measured since the last sample, but adjusted so that most of the difference
+// between the estimated_time and the kernel time will be corrected by the
+// estimated time to the next sample.  In normal operation, this algorithm
+// relies on:
+// - the cycle counter and kernel time rates not changing a lot in a few
+//   seconds.
+// - the client calling into the code often compared to a couple of seconds, so
+//   the time to the next correction can be estimated.
+// Any time ns_per_cycle is not known, a major error is detected, or the
+// assumption about frequent calls is violated, the implementation returns the
+// kernel time.  It records sufficient data that a linear approximation can
+// resume a little later.
+
+int64_t GetCurrentTimeNanos() {
+  // read the data from the "last_sample" struct (but don't need raw_ns yet)
+  // The reads of "seq" and test of the values emulate a reader lock.
+  uint64_t base_ns;
+  uint64_t base_cycles;
+  uint64_t nsscaled_per_cycle;
+  uint64_t min_cycles_per_sample;
+  uint64_t seq_read0;
+  uint64_t seq_read1;
+
+  // If we have enough information to interpolate, the value returned will be
+  // derived from this cycleclock-derived time estimate.  On some platforms
+  // (POWER) the function to retrieve this value has enough complexity to
+  // contribute to register pressure - reading it early before initializing
+  // the other pieces of the calculation minimizes spill/restore instructions,
+  // minimizing icache cost.
+  uint64_t now_cycles = GET_CURRENT_TIME_NANOS_CYCLECLOCK_NOW();
+
+  // Acquire pairs with the barrier in SeqRelease - if this load sees that
+  // store, the shared-data reads necessarily see that SeqRelease's updates
+  // to the same shared data.
+  seq_read0 = seq.load(std::memory_order_acquire);
+
+  base_ns = last_sample.base_ns.load(std::memory_order_relaxed);
+  base_cycles = last_sample.base_cycles.load(std::memory_order_relaxed);
+  nsscaled_per_cycle =
+      last_sample.nsscaled_per_cycle.load(std::memory_order_relaxed);
+  min_cycles_per_sample =
+      last_sample.min_cycles_per_sample.load(std::memory_order_relaxed);
+
+  // This acquire fence pairs with the release fence in SeqAcquire.  Since it
+  // is sequenced between reads of shared data and seq_read1, the reads of
+  // shared data are effectively acquiring.
+  std::atomic_thread_fence(std::memory_order_acquire);
+
+  // The shared-data reads are effectively acquire ordered, and the
+  // shared-data writes are effectively release ordered. Therefore if our
+  // shared-data reads see any of a particular update's shared-data writes,
+  // seq_read1 is guaranteed to see that update's SeqAcquire.
+  seq_read1 = seq.load(std::memory_order_relaxed);
+
+  // Fast path.  Return if min_cycles_per_sample has not yet elapsed since the
+  // last sample, and we read a consistent sample.  The fast path activates
+  // only when min_cycles_per_sample is non-zero, which happens when we get an
+  // estimate for the cycle time.  The predicate will fail if now_cycles <
+  // base_cycles, or if some other thread is in the slow path.
+  //
+  // Since we now read now_cycles before base_ns, it is possible for now_cycles
+  // to be less than base_cycles (if we were interrupted between those loads and
+  // last_sample was updated). This is harmless, because delta_cycles will wrap
+  // and report a time much much bigger than min_cycles_per_sample. In that case
+  // we will take the slow path.
+  uint64_t delta_cycles = now_cycles - base_cycles;
+  if (seq_read0 == seq_read1 && (seq_read0 & 1) == 0 &&
+      delta_cycles < min_cycles_per_sample) {
+    return base_ns + ((delta_cycles * nsscaled_per_cycle) >> kScale);
+  }
+  return GetCurrentTimeNanosSlowPath();
+}
+
+// Return (a << kScale)/b.
+// Zero is returned if b==0.   Scaling is performed internally to
+// preserve precision without overflow.
+static uint64_t SafeDivideAndScale(uint64_t a, uint64_t b) {
+  // Find maximum safe_shift so that
+  //  0 <= safe_shift <= kScale  and  (a << safe_shift) does not overflow.
+  int safe_shift = kScale;
+  while (((a << safe_shift) >> safe_shift) != a) {
+    safe_shift--;
+  }
+  uint64_t scaled_b = b >> (kScale - safe_shift);
+  uint64_t quotient = 0;
+  if (scaled_b != 0) {
+    quotient = (a << safe_shift) / scaled_b;
+  }
+  return quotient;
+}
+
+static uint64_t UpdateLastSample(
+    uint64_t now_cycles, uint64_t now_ns, uint64_t delta_cycles,
+    const struct TimeSample *sample) ABSL_ATTRIBUTE_COLD;
+
+// The slow path of GetCurrentTimeNanos().  This is taken while gathering
+// initial samples, when enough time has elapsed since the last sample, and if
+// any other thread is writing to last_sample.
+//
+// Manually mark this 'noinline' to minimize stack frame size of the fast
+// path.  Without this, sometimes a compiler may inline this big block of code
+// into the fast path.  That causes lots of register spills and reloads that
+// are unnecessary unless the slow path is taken.
+//
+// TODO(absl-team): Remove this attribute when our compiler is smart enough
+// to do the right thing.
+ABSL_ATTRIBUTE_NOINLINE
+static int64_t GetCurrentTimeNanosSlowPath() ABSL_LOCKS_EXCLUDED(lock) {
+  // Serialize access to slow-path.  Fast-path readers are not blocked yet, and
+  // code below must not modify last_sample until the seqlock is acquired.
+  lock.Lock();
+
+  // Sample the kernel time base.  This is the definition of
+  // "now" if we take the slow path.
+  static uint64_t last_now_cycles;  // protected by lock
+  uint64_t now_cycles;
+  uint64_t now_ns = GetCurrentTimeNanosFromKernel(last_now_cycles, &now_cycles);
+  last_now_cycles = now_cycles;
+
+  uint64_t estimated_base_ns;
+
+  // ----------
+  // Read the "last_sample" values again; this time holding the write lock.
+  struct TimeSample sample;
+  ReadTimeSampleAtomic(&last_sample, &sample);
+
+  // ----------
+  // Try running the fast path again; another thread may have updated the
+  // sample between our run of the fast path and the sample we just read.
+  uint64_t delta_cycles = now_cycles - sample.base_cycles;
+  if (delta_cycles < sample.min_cycles_per_sample) {
+    // Another thread updated the sample.  This path does not take the seqlock
+    // so that blocked readers can make progress without blocking new readers.
+    estimated_base_ns = sample.base_ns +
+        ((delta_cycles * sample.nsscaled_per_cycle) >> kScale);
+    stats_fast_slow_paths++;
+  } else {
+    estimated_base_ns =
+        UpdateLastSample(now_cycles, now_ns, delta_cycles, &sample);
+  }
+
+  lock.Unlock();
+
+  return estimated_base_ns;
+}
+
+// Main part of the algorithm.  Locks out readers, updates the approximation
+// using the new sample from the kernel, and stores the result in last_sample
+// for readers.  Returns the new estimated time.
+static uint64_t UpdateLastSample(uint64_t now_cycles, uint64_t now_ns,
+                                 uint64_t delta_cycles,
+                                 const struct TimeSample *sample)
+    ABSL_EXCLUSIVE_LOCKS_REQUIRED(lock) {
+  uint64_t estimated_base_ns = now_ns;
+  uint64_t lock_value = SeqAcquire(&seq);  // acquire seqlock to block readers
+
+  // The 5s in the next if-statement limits the time for which we will trust
+  // the cycle counter and our last sample to give a reasonable result.
+  // Errors in the rate of the source clock can be multiplied by the ratio
+  // between this limit and kMinNSBetweenSamples.
+  if (sample->raw_ns == 0 ||  // no recent sample, or clock went backwards
+      sample->raw_ns + static_cast<uint64_t>(5) * 1000 * 1000 * 1000 < now_ns ||
+      now_ns < sample->raw_ns || now_cycles < sample->base_cycles) {
+    // record this sample, and forget any previously known slope.
+    last_sample.raw_ns.store(now_ns, std::memory_order_relaxed);
+    last_sample.base_ns.store(estimated_base_ns, std::memory_order_relaxed);
+    last_sample.base_cycles.store(now_cycles, std::memory_order_relaxed);
+    last_sample.nsscaled_per_cycle.store(0, std::memory_order_relaxed);
+    last_sample.min_cycles_per_sample.store(0, std::memory_order_relaxed);
+    stats_initializations++;
+  } else if (sample->raw_ns + 500 * 1000 * 1000 < now_ns &&
+             sample->base_cycles + 50 < now_cycles) {
+    // Enough time has passed to compute the cycle time.
+    if (sample->nsscaled_per_cycle != 0) {  // Have a cycle time estimate.
+      // Compute time from counter reading, but avoiding overflow
+      // delta_cycles may be larger than on the fast path.
+      uint64_t estimated_scaled_ns;
+      int s = -1;
+      do {
+        s++;
+        estimated_scaled_ns = (delta_cycles >> s) * sample->nsscaled_per_cycle;
+      } while (estimated_scaled_ns / sample->nsscaled_per_cycle !=
+               (delta_cycles >> s));
+      estimated_base_ns = sample->base_ns +
+                          (estimated_scaled_ns >> (kScale - s));
+    }
+
+    // Compute the assumed cycle time kMinNSBetweenSamples ns into the future
+    // assuming the cycle counter rate stays the same as the last interval.
+    uint64_t ns = now_ns - sample->raw_ns;
+    uint64_t measured_nsscaled_per_cycle = SafeDivideAndScale(ns, delta_cycles);
+
+    uint64_t assumed_next_sample_delta_cycles =
+        SafeDivideAndScale(kMinNSBetweenSamples, measured_nsscaled_per_cycle);
+
+    int64_t diff_ns = now_ns - estimated_base_ns;  // estimate low by this much
+
+    // We want to set nsscaled_per_cycle so that our estimate of the ns time
+    // at the assumed cycle time is the assumed ns time.
+    // That is, we want to set nsscaled_per_cycle so:
+    //  kMinNSBetweenSamples + diff_ns  ==
+    //  (assumed_next_sample_delta_cycles * nsscaled_per_cycle) >> kScale
+    // But we wish to damp oscillations, so instead correct only most
+    // of our current error, by solving:
+    //  kMinNSBetweenSamples + diff_ns - (diff_ns / 16) ==
+    //  (assumed_next_sample_delta_cycles * nsscaled_per_cycle) >> kScale
+    ns = kMinNSBetweenSamples + diff_ns - (diff_ns / 16);
+    uint64_t new_nsscaled_per_cycle =
+        SafeDivideAndScale(ns, assumed_next_sample_delta_cycles);
+    if (new_nsscaled_per_cycle != 0 &&
+        diff_ns < 100 * 1000 * 1000 && -diff_ns < 100 * 1000 * 1000) {
+      // record the cycle time measurement
+      last_sample.nsscaled_per_cycle.store(
+          new_nsscaled_per_cycle, std::memory_order_relaxed);
+      uint64_t new_min_cycles_per_sample =
+          SafeDivideAndScale(kMinNSBetweenSamples, new_nsscaled_per_cycle);
+      last_sample.min_cycles_per_sample.store(
+          new_min_cycles_per_sample, std::memory_order_relaxed);
+      stats_calibrations++;
+    } else {  // something went wrong; forget the slope
+      last_sample.nsscaled_per_cycle.store(0, std::memory_order_relaxed);
+      last_sample.min_cycles_per_sample.store(0, std::memory_order_relaxed);
+      estimated_base_ns = now_ns;
+      stats_reinitializations++;
+    }
+    last_sample.raw_ns.store(now_ns, std::memory_order_relaxed);
+    last_sample.base_ns.store(estimated_base_ns, std::memory_order_relaxed);
+    last_sample.base_cycles.store(now_cycles, std::memory_order_relaxed);
+  } else {
+    // have a sample, but no slope; waiting for enough time for a calibration
+    stats_slow_paths++;
+  }
+
+  SeqRelease(&seq, lock_value);  // release the readers
+
+  return estimated_base_ns;
+}
+ABSL_NAMESPACE_END
+}  // namespace absl
+#endif  // ABSL_USE_CYCLECLOCK_FOR_GET_CURRENT_TIME_NANOS
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace {
+
+// Returns the maximum duration that SleepOnce() can sleep for.
+constexpr absl::Duration MaxSleep() {
+#ifdef _WIN32
+  // Windows Sleep() takes unsigned long argument in milliseconds.
+  return absl::Milliseconds(
+      std::numeric_limits<unsigned long>::max());  // NOLINT(runtime/int)
+#else
+  return absl::Seconds(std::numeric_limits<time_t>::max());
+#endif
+}
+
+// Sleeps for the given duration.
+// REQUIRES: to_sleep <= MaxSleep().
+void SleepOnce(absl::Duration to_sleep) {
+#ifdef _WIN32
+  Sleep(to_sleep / absl::Milliseconds(1));
+#else
+  struct timespec sleep_time = absl::ToTimespec(to_sleep);
+  while (nanosleep(&sleep_time, &sleep_time) != 0 && errno == EINTR) {
+    // Ignore signals and wait for the full interval to elapse.
+  }
+#endif
+}
+
+}  // namespace
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+extern "C" {
+
+ABSL_ATTRIBUTE_WEAK void AbslInternalSleepFor(absl::Duration duration) {
+  while (duration > absl::ZeroDuration()) {
+    absl::Duration to_sleep = std::min(duration, absl::MaxSleep());
+    absl::SleepOnce(to_sleep);
+    duration -= to_sleep;
+  }
+}
+
+}  // extern "C"
diff --git a/third_party/abseil_cpp/absl/time/clock.h b/third_party/abseil_cpp/absl/time/clock.h
new file mode 100644
index 0000000000..27764a922d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/clock.h
@@ -0,0 +1,74 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+// -----------------------------------------------------------------------------
+// File: clock.h
+// -----------------------------------------------------------------------------
+//
+// This header file contains utility functions for working with the system-wide
+// realtime clock. For descriptions of the main time abstractions used within
+// this header file, consult the time.h header file.
+#ifndef ABSL_TIME_CLOCK_H_
+#define ABSL_TIME_CLOCK_H_
+
+#include "absl/base/macros.h"
+#include "absl/time/time.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+
+// Now()
+//
+// Returns the current time, expressed as an `absl::Time` absolute time value.
+absl::Time Now();
+
+// GetCurrentTimeNanos()
+//
+// Returns the current time, expressed as a count of nanoseconds since the Unix
+// Epoch (https://en.wikipedia.org/wiki/Unix_time). Prefer `absl::Now()` instead
+// for all but the most performance-sensitive cases (i.e. when you are calling
+// this function hundreds of thousands of times per second).
+int64_t GetCurrentTimeNanos();
+
+// SleepFor()
+//
+// Sleeps for the specified duration, expressed as an `absl::Duration`.
+//
+// Notes:
+// * Signal interruptions will not reduce the sleep duration.
+// * Returns immediately when passed a nonpositive duration.
+void SleepFor(absl::Duration duration);
+
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+// -----------------------------------------------------------------------------
+// Implementation Details
+// -----------------------------------------------------------------------------
+
+// In some build configurations we pass --detect-odr-violations to the
+// gold linker.  This causes it to flag weak symbol overrides as ODR
+// violations.  Because ODR only applies to C++ and not C,
+// --detect-odr-violations ignores symbols not mangled with C++ names.
+// By changing our extension points to be extern "C", we dodge this
+// check.
+extern "C" {
+void AbslInternalSleepFor(absl::Duration duration);
+}  // extern "C"
+
+inline void absl::SleepFor(absl::Duration duration) {
+  AbslInternalSleepFor(duration);
+}
+
+#endif  // ABSL_TIME_CLOCK_H_
diff --git a/third_party/abseil_cpp/absl/time/clock_benchmark.cc b/third_party/abseil_cpp/absl/time/clock_benchmark.cc
new file mode 100644
index 0000000000..c5c795ecbd
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/clock_benchmark.cc
@@ -0,0 +1,74 @@
+// Copyright 2018 The Abseil Authors.
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/time/clock.h"
+
+#if !defined(_WIN32)
+#include <sys/time.h>
+#else
+#include <winsock2.h>
+#endif  // _WIN32
+#include <cstdio>
+
+#include "absl/base/internal/cycleclock.h"
+#include "benchmark/benchmark.h"
+
+namespace {
+
+void BM_Clock_Now_AbslTime(benchmark::State& state) {
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::Now());
+  }
+}
+BENCHMARK(BM_Clock_Now_AbslTime);
+
+void BM_Clock_Now_GetCurrentTimeNanos(benchmark::State& state) {
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::GetCurrentTimeNanos());
+  }
+}
+BENCHMARK(BM_Clock_Now_GetCurrentTimeNanos);
+
+void BM_Clock_Now_AbslTime_ToUnixNanos(benchmark::State& state) {
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::ToUnixNanos(absl::Now()));
+  }
+}
+BENCHMARK(BM_Clock_Now_AbslTime_ToUnixNanos);
+
+void BM_Clock_Now_CycleClock(benchmark::State& state) {
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::base_internal::CycleClock::Now());
+  }
+}
+BENCHMARK(BM_Clock_Now_CycleClock);
+
+#if !defined(_WIN32)
+static void BM_Clock_Now_gettimeofday(benchmark::State& state) {
+  struct timeval tv;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(gettimeofday(&tv, nullptr));
+  }
+}
+BENCHMARK(BM_Clock_Now_gettimeofday);
+
+static void BM_Clock_Now_clock_gettime(benchmark::State& state) {
+  struct timespec ts;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(clock_gettime(CLOCK_REALTIME, &ts));
+  }
+}
+BENCHMARK(BM_Clock_Now_clock_gettime);
+#endif  // _WIN32
+
+}  // namespace
diff --git a/third_party/abseil_cpp/absl/time/clock_test.cc b/third_party/abseil_cpp/absl/time/clock_test.cc
new file mode 100644
index 0000000000..4bcfc6bc72
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/clock_test.cc
@@ -0,0 +1,118 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/time/clock.h"
+
+#include "absl/base/config.h"
+#if defined(ABSL_HAVE_ALARM)
+#include <signal.h>
+#include <unistd.h>
+#elif defined(__linux__) || defined(__APPLE__)
+#error all known Linux and Apple targets have alarm
+#endif
+
+#include "gtest/gtest.h"
+#include "absl/time/time.h"
+
+namespace {
+
+TEST(Time, Now) {
+  const absl::Time before = absl::FromUnixNanos(absl::GetCurrentTimeNanos());
+  const absl::Time now = absl::Now();
+  const absl::Time after = absl::FromUnixNanos(absl::GetCurrentTimeNanos());
+  EXPECT_GE(now, before);
+  EXPECT_GE(after, now);
+}
+
+enum class AlarmPolicy { kWithoutAlarm, kWithAlarm };
+
+#if defined(ABSL_HAVE_ALARM)
+bool alarm_handler_invoked = false;
+
+void AlarmHandler(int signo) {
+  ASSERT_EQ(signo, SIGALRM);
+  alarm_handler_invoked = true;
+}
+#endif
+
+// Does SleepFor(d) take between lower_bound and upper_bound at least
+// once between now and (now + timeout)?  If requested (and supported),
+// add an alarm for the middle of the sleep period and expect it to fire.
+bool SleepForBounded(absl::Duration d, absl::Duration lower_bound,
+                     absl::Duration upper_bound, absl::Duration timeout,
+                     AlarmPolicy alarm_policy, int* attempts) {
+  const absl::Time deadline = absl::Now() + timeout;
+  while (absl::Now() < deadline) {
+#if defined(ABSL_HAVE_ALARM)
+    sig_t old_alarm = SIG_DFL;
+    if (alarm_policy == AlarmPolicy::kWithAlarm) {
+      alarm_handler_invoked = false;
+      old_alarm = signal(SIGALRM, AlarmHandler);
+      alarm(absl::ToInt64Seconds(d / 2));
+    }
+#else
+    EXPECT_EQ(alarm_policy, AlarmPolicy::kWithoutAlarm);
+#endif
+    ++*attempts;
+    absl::Time start = absl::Now();
+    absl::SleepFor(d);
+    absl::Duration actual = absl::Now() - start;
+#if defined(ABSL_HAVE_ALARM)
+    if (alarm_policy == AlarmPolicy::kWithAlarm) {
+      signal(SIGALRM, old_alarm);
+      if (!alarm_handler_invoked) continue;
+    }
+#endif
+    if (lower_bound <= actual && actual <= upper_bound) {
+      return true;  // yes, the SleepFor() was correctly bounded
+    }
+  }
+  return false;
+}
+
+testing::AssertionResult AssertSleepForBounded(absl::Duration d,
+                                               absl::Duration early,
+                                               absl::Duration late,
+                                               absl::Duration timeout,
+                                               AlarmPolicy alarm_policy) {
+  const absl::Duration lower_bound = d - early;
+  const absl::Duration upper_bound = d + late;
+  int attempts = 0;
+  if (SleepForBounded(d, lower_bound, upper_bound, timeout, alarm_policy,
+                      &attempts)) {
+    return testing::AssertionSuccess();
+  }
+  return testing::AssertionFailure()
+         << "SleepFor(" << d << ") did not return within [" << lower_bound
+         << ":" << upper_bound << "] in " << attempts << " attempt"
+         << (attempts == 1 ? "" : "s") << " over " << timeout
+         << (alarm_policy == AlarmPolicy::kWithAlarm ? " with" : " without")
+         << " an alarm";
+}
+
+// Tests that SleepFor() returns neither too early nor too late.
+TEST(SleepFor, Bounded) {
+  const absl::Duration d = absl::Milliseconds(2500);
+  const absl::Duration early = absl::Milliseconds(100);
+  const absl::Duration late = absl::Milliseconds(300);
+  const absl::Duration timeout = 48 * d;
+  EXPECT_TRUE(AssertSleepForBounded(d, early, late, timeout,
+                                    AlarmPolicy::kWithoutAlarm));
+#if defined(ABSL_HAVE_ALARM)
+  EXPECT_TRUE(AssertSleepForBounded(d, early, late, timeout,
+                                    AlarmPolicy::kWithAlarm));
+#endif
+}
+
+}  // namespace
diff --git a/third_party/abseil_cpp/absl/time/duration.cc b/third_party/abseil_cpp/absl/time/duration.cc
new file mode 100644
index 0000000000..d0f1aadbf2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/duration.cc
@@ -0,0 +1,951 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+// The implementation of the absl::Duration class, which is declared in
+// //absl/time.h.  This class behaves like a numeric type; it has no public
+// methods and is used only through the operators defined here.
+//
+// Implementation notes:
+//
+// An absl::Duration is represented as
+//
+//   rep_hi_ : (int64_t)  Whole seconds
+//   rep_lo_ : (uint32_t) Fractions of a second
+//
+// The seconds value (rep_hi_) may be positive or negative as appropriate.
+// The fractional seconds (rep_lo_) is always a positive offset from rep_hi_.
+// The API for Duration guarantees at least nanosecond resolution, which
+// means rep_lo_ could have a max value of 1B - 1 if it stored nanoseconds.
+// However, to utilize more of the available 32 bits of space in rep_lo_,
+// we instead store quarters of a nanosecond in rep_lo_ resulting in a max
+// value of 4B - 1.  This allows us to correctly handle calculations like
+// 0.5 nanos + 0.5 nanos = 1 nano.  The following example shows the actual
+// Duration rep using quarters of a nanosecond.
+//
+//    2.5 sec = {rep_hi_=2,  rep_lo_=2000000000}  // lo = 4 * 500000000
+//   -2.5 sec = {rep_hi_=-3, rep_lo_=2000000000}
+//
+// Infinite durations are represented as Durations with the rep_lo_ field set
+// to all 1s.
+//
+//   +InfiniteDuration:
+//     rep_hi_ : kint64max
+//     rep_lo_ : ~0U
+//
+//   -InfiniteDuration:
+//     rep_hi_ : kint64min
+//     rep_lo_ : ~0U
+//
+// Arithmetic overflows/underflows to +/- infinity and saturates.
+
+#if defined(_MSC_VER)
+#include <winsock2.h>  // for timeval
+#endif
+
+#include <algorithm>
+#include <cassert>
+#include <cctype>
+#include <cerrno>
+#include <cmath>
+#include <cstdint>
+#include <cstdlib>
+#include <cstring>
+#include <ctime>
+#include <functional>
+#include <limits>
+#include <string>
+
+#include "absl/base/casts.h"
+#include "absl/base/macros.h"
+#include "absl/numeric/int128.h"
+#include "absl/strings/strip.h"
+#include "absl/time/time.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+
+namespace {
+
+using time_internal::kTicksPerNanosecond;
+using time_internal::kTicksPerSecond;
+
+constexpr int64_t kint64max = std::numeric_limits<int64_t>::max();
+constexpr int64_t kint64min = std::numeric_limits<int64_t>::min();
+
+// Can't use std::isinfinite() because it doesn't exist on windows.
+inline bool IsFinite(double d) {
+  if (std::isnan(d)) return false;
+  return d != std::numeric_limits<double>::infinity() &&
+         d != -std::numeric_limits<double>::infinity();
+}
+
+inline bool IsValidDivisor(double d) {
+  if (std::isnan(d)) return false;
+  return d != 0.0;
+}
+
+// Can't use std::round() because it is only available in C++11.
+// Note that we ignore the possibility of floating-point over/underflow.
+template <typename Double>
+inline double Round(Double d) {
+  return d < 0 ? std::ceil(d - 0.5) : std::floor(d + 0.5);
+}
+
+// *sec may be positive or negative.  *ticks must be in the range
+// -kTicksPerSecond < *ticks < kTicksPerSecond.  If *ticks is negative it
+// will be normalized to a positive value by adjusting *sec accordingly.
+inline void NormalizeTicks(int64_t* sec, int64_t* ticks) {
+  if (*ticks < 0) {
+    --*sec;
+    *ticks += kTicksPerSecond;
+  }
+}
+
+// Makes a uint128 from the absolute value of the given scalar.
+inline uint128 MakeU128(int64_t a) {
+  uint128 u128 = 0;
+  if (a < 0) {
+    ++u128;
+    ++a;  // Makes it safe to negate 'a'
+    a = -a;
+  }
+  u128 += static_cast<uint64_t>(a);
+  return u128;
+}
+
+// Makes a uint128 count of ticks out of the absolute value of the Duration.
+inline uint128 MakeU128Ticks(Duration d) {
+  int64_t rep_hi = time_internal::GetRepHi(d);
+  uint32_t rep_lo = time_internal::GetRepLo(d);
+  if (rep_hi < 0) {
+    ++rep_hi;
+    rep_hi = -rep_hi;
+    rep_lo = kTicksPerSecond - rep_lo;
+  }
+  uint128 u128 = static_cast<uint64_t>(rep_hi);
+  u128 *= static_cast<uint64_t>(kTicksPerSecond);
+  u128 += rep_lo;
+  return u128;
+}
+
+// Breaks a uint128 of ticks into a Duration.
+inline Duration MakeDurationFromU128(uint128 u128, bool is_neg) {
+  int64_t rep_hi;
+  uint32_t rep_lo;
+  const uint64_t h64 = Uint128High64(u128);
+  const uint64_t l64 = Uint128Low64(u128);
+  if (h64 == 0) {  // fastpath
+    const uint64_t hi = l64 / kTicksPerSecond;
+    rep_hi = static_cast<int64_t>(hi);
+    rep_lo = static_cast<uint32_t>(l64 - hi * kTicksPerSecond);
+  } else {
+    // kMaxRepHi64 is the high 64 bits of (2^63 * kTicksPerSecond).
+    // Any positive tick count whose high 64 bits are >= kMaxRepHi64
+    // is not representable as a Duration.  A negative tick count can
+    // have its high 64 bits == kMaxRepHi64 but only when the low 64
+    // bits are all zero, otherwise it is not representable either.
+    const uint64_t kMaxRepHi64 = 0x77359400UL;
+    if (h64 >= kMaxRepHi64) {
+      if (is_neg && h64 == kMaxRepHi64 && l64 == 0) {
+        // Avoid trying to represent -kint64min below.
+        return time_internal::MakeDuration(kint64min);
+      }
+      return is_neg ? -InfiniteDuration() : InfiniteDuration();
+    }
+    const uint128 kTicksPerSecond128 = static_cast<uint64_t>(kTicksPerSecond);
+    const uint128 hi = u128 / kTicksPerSecond128;
+    rep_hi = static_cast<int64_t>(Uint128Low64(hi));
+    rep_lo =
+        static_cast<uint32_t>(Uint128Low64(u128 - hi * kTicksPerSecond128));
+  }
+  if (is_neg) {
+    rep_hi = -rep_hi;
+    if (rep_lo != 0) {
+      --rep_hi;
+      rep_lo = kTicksPerSecond - rep_lo;
+    }
+  }
+  return time_internal::MakeDuration(rep_hi, rep_lo);
+}
+
+// Convert between int64_t and uint64_t, preserving representation. This
+// allows us to do arithmetic in the unsigned domain, where overflow has
+// well-defined behavior. See operator+=() and operator-=().
+//
+// C99 7.20.1.1.1, as referenced by C++11 18.4.1.2, says, "The typedef
+// name intN_t designates a signed integer type with width N, no padding
+// bits, and a two's complement representation." So, we can convert to
+// and from the corresponding uint64_t value using a bit cast.
+inline uint64_t EncodeTwosComp(int64_t v) {
+  return absl::bit_cast<uint64_t>(v);
+}
+inline int64_t DecodeTwosComp(uint64_t v) { return absl::bit_cast<int64_t>(v); }
+
+// Note: The overflow detection in this function is done using greater/less *or
+// equal* because kint64max/min is too large to be represented exactly in a
+// double (which only has 53 bits of precision). In order to avoid assigning to
+// rep->hi a double value that is too large for an int64_t (and therefore is
+// undefined), we must consider computations that equal kint64max/min as a
+// double as overflow cases.
+inline bool SafeAddRepHi(double a_hi, double b_hi, Duration* d) {
+  double c = a_hi + b_hi;
+  if (c >= static_cast<double>(kint64max)) {
+    *d = InfiniteDuration();
+    return false;
+  }
+  if (c <= static_cast<double>(kint64min)) {
+    *d = -InfiniteDuration();
+    return false;
+  }
+  *d = time_internal::MakeDuration(c, time_internal::GetRepLo(*d));
+  return true;
+}
+
+// A functor that's similar to std::multiplies<T>, except this returns the max
+// T value instead of overflowing. This is only defined for uint128.
+template <typename Ignored>
+struct SafeMultiply {
+  uint128 operator()(uint128 a, uint128 b) const {
+    // b hi is always zero because it originated as an int64_t.
+    assert(Uint128High64(b) == 0);
+    // Fastpath to avoid the expensive overflow check with division.
+    if (Uint128High64(a) == 0) {
+      return (((Uint128Low64(a) | Uint128Low64(b)) >> 32) == 0)
+                 ? static_cast<uint128>(Uint128Low64(a) * Uint128Low64(b))
+                 : a * b;
+    }
+    return b == 0 ? b : (a > kuint128max / b) ? kuint128max : a * b;
+  }
+};
+
+// Scales (i.e., multiplies or divides, depending on the Operation template)
+// the Duration d by the int64_t r.
+template <template <typename> class Operation>
+inline Duration ScaleFixed(Duration d, int64_t r) {
+  const uint128 a = MakeU128Ticks(d);
+  const uint128 b = MakeU128(r);
+  const uint128 q = Operation<uint128>()(a, b);
+  const bool is_neg = (time_internal::GetRepHi(d) < 0) != (r < 0);
+  return MakeDurationFromU128(q, is_neg);
+}
+
+// Scales (i.e., multiplies or divides, depending on the Operation template)
+// the Duration d by the double r.
+template <template <typename> class Operation>
+inline Duration ScaleDouble(Duration d, double r) {
+  Operation<double> op;
+  double hi_doub = op(time_internal::GetRepHi(d), r);
+  double lo_doub = op(time_internal::GetRepLo(d), r);
+
+  double hi_int = 0;
+  double hi_frac = std::modf(hi_doub, &hi_int);
+
+  // Moves hi's fractional bits to lo.
+  lo_doub /= kTicksPerSecond;
+  lo_doub += hi_frac;
+
+  double lo_int = 0;
+  double lo_frac = std::modf(lo_doub, &lo_int);
+
+  // Rolls lo into hi if necessary.
+  int64_t lo64 = Round(lo_frac * kTicksPerSecond);
+
+  Duration ans;
+  if (!SafeAddRepHi(hi_int, lo_int, &ans)) return ans;
+  int64_t hi64 = time_internal::GetRepHi(ans);
+  if (!SafeAddRepHi(hi64, lo64 / kTicksPerSecond, &ans)) return ans;
+  hi64 = time_internal::GetRepHi(ans);
+  lo64 %= kTicksPerSecond;
+  NormalizeTicks(&hi64, &lo64);
+  return time_internal::MakeDuration(hi64, lo64);
+}
+
+// Tries to divide num by den as fast as possible by looking for common, easy
+// cases. If the division was done, the quotient is in *q and the remainder is
+// in *rem and true will be returned.
+inline bool IDivFastPath(const Duration num, const Duration den, int64_t* q,
+                         Duration* rem) {
+  // Bail if num or den is an infinity.
+  if (time_internal::IsInfiniteDuration(num) ||
+      time_internal::IsInfiniteDuration(den))
+    return false;
+
+  int64_t num_hi = time_internal::GetRepHi(num);
+  uint32_t num_lo = time_internal::GetRepLo(num);
+  int64_t den_hi = time_internal::GetRepHi(den);
+  uint32_t den_lo = time_internal::GetRepLo(den);
+
+  if (den_hi == 0 && den_lo == kTicksPerNanosecond) {
+    // Dividing by 1ns
+    if (num_hi >= 0 && num_hi < (kint64max - kTicksPerSecond) / 1000000000) {
+      *q = num_hi * 1000000000 + num_lo / kTicksPerNanosecond;
+      *rem = time_internal::MakeDuration(0, num_lo % den_lo);
+      return true;
+    }
+  } else if (den_hi == 0 && den_lo == 100 * kTicksPerNanosecond) {
+    // Dividing by 100ns (common when converting to Universal time)
+    if (num_hi >= 0 && num_hi < (kint64max - kTicksPerSecond) / 10000000) {
+      *q = num_hi * 10000000 + num_lo / (100 * kTicksPerNanosecond);
+      *rem = time_internal::MakeDuration(0, num_lo % den_lo);
+      return true;
+    }
+  } else if (den_hi == 0 && den_lo == 1000 * kTicksPerNanosecond) {
+    // Dividing by 1us
+    if (num_hi >= 0 && num_hi < (kint64max - kTicksPerSecond) / 1000000) {
+      *q = num_hi * 1000000 + num_lo / (1000 * kTicksPerNanosecond);
+      *rem = time_internal::MakeDuration(0, num_lo % den_lo);
+      return true;
+    }
+  } else if (den_hi == 0 && den_lo == 1000000 * kTicksPerNanosecond) {
+    // Dividing by 1ms
+    if (num_hi >= 0 && num_hi < (kint64max - kTicksPerSecond) / 1000) {
+      *q = num_hi * 1000 + num_lo / (1000000 * kTicksPerNanosecond);
+      *rem = time_internal::MakeDuration(0, num_lo % den_lo);
+      return true;
+    }
+  } else if (den_hi > 0 && den_lo == 0) {
+    // Dividing by positive multiple of 1s
+    if (num_hi >= 0) {
+      if (den_hi == 1) {
+        *q = num_hi;
+        *rem = time_internal::MakeDuration(0, num_lo);
+        return true;
+      }
+      *q = num_hi / den_hi;
+      *rem = time_internal::MakeDuration(num_hi % den_hi, num_lo);
+      return true;
+    }
+    if (num_lo != 0) {
+      num_hi += 1;
+    }
+    int64_t quotient = num_hi / den_hi;
+    int64_t rem_sec = num_hi % den_hi;
+    if (rem_sec > 0) {
+      rem_sec -= den_hi;
+      quotient += 1;
+    }
+    if (num_lo != 0) {
+      rem_sec -= 1;
+    }
+    *q = quotient;
+    *rem = time_internal::MakeDuration(rem_sec, num_lo);
+    return true;
+  }
+
+  return false;
+}
+
+}  // namespace
+
+namespace time_internal {
+
+// The 'satq' argument indicates whether the quotient should saturate at the
+// bounds of int64_t.  If it does saturate, the difference will spill over to
+// the remainder.  If it does not saturate, the remainder remain accurate,
+// but the returned quotient will over/underflow int64_t and should not be used.
+int64_t IDivDuration(bool satq, const Duration num, const Duration den,
+                   Duration* rem) {
+  int64_t q = 0;
+  if (IDivFastPath(num, den, &q, rem)) {
+    return q;
+  }
+
+  const bool num_neg = num < ZeroDuration();
+  const bool den_neg = den < ZeroDuration();
+  const bool quotient_neg = num_neg != den_neg;
+
+  if (time_internal::IsInfiniteDuration(num) || den == ZeroDuration()) {
+    *rem = num_neg ? -InfiniteDuration() : InfiniteDuration();
+    return quotient_neg ? kint64min : kint64max;
+  }
+  if (time_internal::IsInfiniteDuration(den)) {
+    *rem = num;
+    return 0;
+  }
+
+  const uint128 a = MakeU128Ticks(num);
+  const uint128 b = MakeU128Ticks(den);
+  uint128 quotient128 = a / b;
+
+  if (satq) {
+    // Limits the quotient to the range of int64_t.
+    if (quotient128 > uint128(static_cast<uint64_t>(kint64max))) {
+      quotient128 = quotient_neg ? uint128(static_cast<uint64_t>(kint64min))
+                                 : uint128(static_cast<uint64_t>(kint64max));
+    }
+  }
+
+  const uint128 remainder128 = a - quotient128 * b;
+  *rem = MakeDurationFromU128(remainder128, num_neg);
+
+  if (!quotient_neg || quotient128 == 0) {
+    return Uint128Low64(quotient128) & kint64max;
+  }
+  // The quotient needs to be negated, but we need to carefully handle
+  // quotient128s with the top bit on.
+  return -static_cast<int64_t>(Uint128Low64(quotient128 - 1) & kint64max) - 1;
+}
+
+}  // namespace time_internal
+
+//
+// Additive operators.
+//
+
+Duration& Duration::operator+=(Duration rhs) {
+  if (time_internal::IsInfiniteDuration(*this)) return *this;
+  if (time_internal::IsInfiniteDuration(rhs)) return *this = rhs;
+  const int64_t orig_rep_hi = rep_hi_;
+  rep_hi_ =
+      DecodeTwosComp(EncodeTwosComp(rep_hi_) + EncodeTwosComp(rhs.rep_hi_));
+  if (rep_lo_ >= kTicksPerSecond - rhs.rep_lo_) {
+    rep_hi_ = DecodeTwosComp(EncodeTwosComp(rep_hi_) + 1);
+    rep_lo_ -= kTicksPerSecond;
+  }
+  rep_lo_ += rhs.rep_lo_;
+  if (rhs.rep_hi_ < 0 ? rep_hi_ > orig_rep_hi : rep_hi_ < orig_rep_hi) {
+    return *this = rhs.rep_hi_ < 0 ? -InfiniteDuration() : InfiniteDuration();
+  }
+  return *this;
+}
+
+Duration& Duration::operator-=(Duration rhs) {
+  if (time_internal::IsInfiniteDuration(*this)) return *this;
+  if (time_internal::IsInfiniteDuration(rhs)) {
+    return *this = rhs.rep_hi_ >= 0 ? -InfiniteDuration() : InfiniteDuration();
+  }
+  const int64_t orig_rep_hi = rep_hi_;
+  rep_hi_ =
+      DecodeTwosComp(EncodeTwosComp(rep_hi_) - EncodeTwosComp(rhs.rep_hi_));
+  if (rep_lo_ < rhs.rep_lo_) {
+    rep_hi_ = DecodeTwosComp(EncodeTwosComp(rep_hi_) - 1);
+    rep_lo_ += kTicksPerSecond;
+  }
+  rep_lo_ -= rhs.rep_lo_;
+  if (rhs.rep_hi_ < 0 ? rep_hi_ < orig_rep_hi : rep_hi_ > orig_rep_hi) {
+    return *this = rhs.rep_hi_ >= 0 ? -InfiniteDuration() : InfiniteDuration();
+  }
+  return *this;
+}
+
+//
+// Multiplicative operators.
+//
+
+Duration& Duration::operator*=(int64_t r) {
+  if (time_internal::IsInfiniteDuration(*this)) {
+    const bool is_neg = (r < 0) != (rep_hi_ < 0);
+    return *this = is_neg ? -InfiniteDuration() : InfiniteDuration();
+  }
+  return *this = ScaleFixed<SafeMultiply>(*this, r);
+}
+
+Duration& Duration::operator*=(double r) {
+  if (time_internal::IsInfiniteDuration(*this) || !IsFinite(r)) {
+    const bool is_neg = (std::signbit(r) != 0) != (rep_hi_ < 0);
+    return *this = is_neg ? -InfiniteDuration() : InfiniteDuration();
+  }
+  return *this = ScaleDouble<std::multiplies>(*this, r);
+}
+
+Duration& Duration::operator/=(int64_t r) {
+  if (time_internal::IsInfiniteDuration(*this) || r == 0) {
+    const bool is_neg = (r < 0) != (rep_hi_ < 0);
+    return *this = is_neg ? -InfiniteDuration() : InfiniteDuration();
+  }
+  return *this = ScaleFixed<std::divides>(*this, r);
+}
+
+Duration& Duration::operator/=(double r) {
+  if (time_internal::IsInfiniteDuration(*this) || !IsValidDivisor(r)) {
+    const bool is_neg = (std::signbit(r) != 0) != (rep_hi_ < 0);
+    return *this = is_neg ? -InfiniteDuration() : InfiniteDuration();
+  }
+  return *this = ScaleDouble<std::divides>(*this, r);
+}
+
+Duration& Duration::operator%=(Duration rhs) {
+  time_internal::IDivDuration(false, *this, rhs, this);
+  return *this;
+}
+
+double FDivDuration(Duration num, Duration den) {
+  // Arithmetic with infinity is sticky.
+  if (time_internal::IsInfiniteDuration(num) || den == ZeroDuration()) {
+    return (num < ZeroDuration()) == (den < ZeroDuration())
+               ? std::numeric_limits<double>::infinity()
+               : -std::numeric_limits<double>::infinity();
+  }
+  if (time_internal::IsInfiniteDuration(den)) return 0.0;
+
+  double a =
+      static_cast<double>(time_internal::GetRepHi(num)) * kTicksPerSecond +
+      time_internal::GetRepLo(num);
+  double b =
+      static_cast<double>(time_internal::GetRepHi(den)) * kTicksPerSecond +
+      time_internal::GetRepLo(den);
+  return a / b;
+}
+
+//
+// Trunc/Floor/Ceil.
+//
+
+Duration Trunc(Duration d, Duration unit) {
+  return d - (d % unit);
+}
+
+Duration Floor(const Duration d, const Duration unit) {
+  const absl::Duration td = Trunc(d, unit);
+  return td <= d ? td : td - AbsDuration(unit);
+}
+
+Duration Ceil(const Duration d, const Duration unit) {
+  const absl::Duration td = Trunc(d, unit);
+  return td >= d ? td : td + AbsDuration(unit);
+}
+
+//
+// Factory functions.
+//
+
+Duration DurationFromTimespec(timespec ts) {
+  if (static_cast<uint64_t>(ts.tv_nsec) < 1000 * 1000 * 1000) {
+    int64_t ticks = ts.tv_nsec * kTicksPerNanosecond;
+    return time_internal::MakeDuration(ts.tv_sec, ticks);
+  }
+  return Seconds(ts.tv_sec) + Nanoseconds(ts.tv_nsec);
+}
+
+Duration DurationFromTimeval(timeval tv) {
+  if (static_cast<uint64_t>(tv.tv_usec) < 1000 * 1000) {
+    int64_t ticks = tv.tv_usec * 1000 * kTicksPerNanosecond;
+    return time_internal::MakeDuration(tv.tv_sec, ticks);
+  }
+  return Seconds(tv.tv_sec) + Microseconds(tv.tv_usec);
+}
+
+//
+// Conversion to other duration types.
+//
+
+int64_t ToInt64Nanoseconds(Duration d) {
+  if (time_internal::GetRepHi(d) >= 0 &&
+      time_internal::GetRepHi(d) >> 33 == 0) {
+    return (time_internal::GetRepHi(d) * 1000 * 1000 * 1000) +
+           (time_internal::GetRepLo(d) / kTicksPerNanosecond);
+  }
+  return d / Nanoseconds(1);
+}
+int64_t ToInt64Microseconds(Duration d) {
+  if (time_internal::GetRepHi(d) >= 0 &&
+      time_internal::GetRepHi(d) >> 43 == 0) {
+    return (time_internal::GetRepHi(d) * 1000 * 1000) +
+           (time_internal::GetRepLo(d) / (kTicksPerNanosecond * 1000));
+  }
+  return d / Microseconds(1);
+}
+int64_t ToInt64Milliseconds(Duration d) {
+  if (time_internal::GetRepHi(d) >= 0 &&
+      time_internal::GetRepHi(d) >> 53 == 0) {
+    return (time_internal::GetRepHi(d) * 1000) +
+           (time_internal::GetRepLo(d) / (kTicksPerNanosecond * 1000 * 1000));
+  }
+  return d / Milliseconds(1);
+}
+int64_t ToInt64Seconds(Duration d) {
+  int64_t hi = time_internal::GetRepHi(d);
+  if (time_internal::IsInfiniteDuration(d)) return hi;
+  if (hi < 0 && time_internal::GetRepLo(d) != 0) ++hi;
+  return hi;
+}
+int64_t ToInt64Minutes(Duration d) {
+  int64_t hi = time_internal::GetRepHi(d);
+  if (time_internal::IsInfiniteDuration(d)) return hi;
+  if (hi < 0 && time_internal::GetRepLo(d) != 0) ++hi;
+  return hi / 60;
+}
+int64_t ToInt64Hours(Duration d) {
+  int64_t hi = time_internal::GetRepHi(d);
+  if (time_internal::IsInfiniteDuration(d)) return hi;
+  if (hi < 0 && time_internal::GetRepLo(d) != 0) ++hi;
+  return hi / (60 * 60);
+}
+
+double ToDoubleNanoseconds(Duration d) {
+  return FDivDuration(d, Nanoseconds(1));
+}
+double ToDoubleMicroseconds(Duration d) {
+  return FDivDuration(d, Microseconds(1));
+}
+double ToDoubleMilliseconds(Duration d) {
+  return FDivDuration(d, Milliseconds(1));
+}
+double ToDoubleSeconds(Duration d) {
+  return FDivDuration(d, Seconds(1));
+}
+double ToDoubleMinutes(Duration d) {
+  return FDivDuration(d, Minutes(1));
+}
+double ToDoubleHours(Duration d) {
+  return FDivDuration(d, Hours(1));
+}
+
+timespec ToTimespec(Duration d) {
+  timespec ts;
+  if (!time_internal::IsInfiniteDuration(d)) {
+    int64_t rep_hi = time_internal::GetRepHi(d);
+    uint32_t rep_lo = time_internal::GetRepLo(d);
+    if (rep_hi < 0) {
+      // Tweak the fields so that unsigned division of rep_lo
+      // maps to truncation (towards zero) for the timespec.
+      rep_lo += kTicksPerNanosecond - 1;
+      if (rep_lo >= kTicksPerSecond) {
+        rep_hi += 1;
+        rep_lo -= kTicksPerSecond;
+      }
+    }
+    ts.tv_sec = rep_hi;
+    if (ts.tv_sec == rep_hi) {  // no time_t narrowing
+      ts.tv_nsec = rep_lo / kTicksPerNanosecond;
+      return ts;
+    }
+  }
+  if (d >= ZeroDuration()) {
+    ts.tv_sec = std::numeric_limits<time_t>::max();
+    ts.tv_nsec = 1000 * 1000 * 1000 - 1;
+  } else {
+    ts.tv_sec = std::numeric_limits<time_t>::min();
+    ts.tv_nsec = 0;
+  }
+  return ts;
+}
+
+timeval ToTimeval(Duration d) {
+  timeval tv;
+  timespec ts = ToTimespec(d);
+  if (ts.tv_sec < 0) {
+    // Tweak the fields so that positive division of tv_nsec
+    // maps to truncation (towards zero) for the timeval.
+    ts.tv_nsec += 1000 - 1;
+    if (ts.tv_nsec >= 1000 * 1000 * 1000) {
+      ts.tv_sec += 1;
+      ts.tv_nsec -= 1000 * 1000 * 1000;
+    }
+  }
+  tv.tv_sec = ts.tv_sec;
+  if (tv.tv_sec != ts.tv_sec) {  // narrowing
+    if (ts.tv_sec < 0) {
+      tv.tv_sec = std::numeric_limits<decltype(tv.tv_sec)>::min();
+      tv.tv_usec = 0;
+    } else {
+      tv.tv_sec = std::numeric_limits<decltype(tv.tv_sec)>::max();
+      tv.tv_usec = 1000 * 1000 - 1;
+    }
+    return tv;
+  }
+  tv.tv_usec = static_cast<int>(ts.tv_nsec / 1000);  // suseconds_t
+  return tv;
+}
+
+std::chrono::nanoseconds ToChronoNanoseconds(Duration d) {
+  return time_internal::ToChronoDuration<std::chrono::nanoseconds>(d);
+}
+std::chrono::microseconds ToChronoMicroseconds(Duration d) {
+  return time_internal::ToChronoDuration<std::chrono::microseconds>(d);
+}
+std::chrono::milliseconds ToChronoMilliseconds(Duration d) {
+  return time_internal::ToChronoDuration<std::chrono::milliseconds>(d);
+}
+std::chrono::seconds ToChronoSeconds(Duration d) {
+  return time_internal::ToChronoDuration<std::chrono::seconds>(d);
+}
+std::chrono::minutes ToChronoMinutes(Duration d) {
+  return time_internal::ToChronoDuration<std::chrono::minutes>(d);
+}
+std::chrono::hours ToChronoHours(Duration d) {
+  return time_internal::ToChronoDuration<std::chrono::hours>(d);
+}
+
+//
+// To/From string formatting.
+//
+
+namespace {
+
+// Formats a positive 64-bit integer in the given field width.  Note that
+// it is up to the caller of Format64() to ensure that there is sufficient
+// space before ep to hold the conversion.
+char* Format64(char* ep, int width, int64_t v) {
+  do {
+    --width;
+    *--ep = '0' + (v % 10);  // contiguous digits
+  } while (v /= 10);
+  while (--width >= 0) *--ep = '0';  // zero pad
+  return ep;
+}
+
+// Helpers for FormatDuration() that format 'n' and append it to 'out'
+// followed by the given 'unit'.  If 'n' formats to "0", nothing is
+// appended (not even the unit).
+
+// A type that encapsulates how to display a value of a particular unit. For
+// values that are displayed with fractional parts, the precision indicates
+// where to round the value. The precision varies with the display unit because
+// a Duration can hold only quarters of a nanosecond, so displaying information
+// beyond that is just noise.
+//
+// For example, a microsecond value of 42.00025xxxxx should not display beyond 5
+// fractional digits, because it is in the noise of what a Duration can
+// represent.
+struct DisplayUnit {
+  const char* abbr;
+  int prec;
+  double pow10;
+};
+const DisplayUnit kDisplayNano = {"ns", 2, 1e2};
+const DisplayUnit kDisplayMicro = {"us", 5, 1e5};
+const DisplayUnit kDisplayMilli = {"ms", 8, 1e8};
+const DisplayUnit kDisplaySec = {"s", 11, 1e11};
+const DisplayUnit kDisplayMin = {"m", -1, 0.0};   // prec ignored
+const DisplayUnit kDisplayHour = {"h", -1, 0.0};  // prec ignored
+
+void AppendNumberUnit(std::string* out, int64_t n, DisplayUnit unit) {
+  char buf[sizeof("2562047788015216")];  // hours in max duration
+  char* const ep = buf + sizeof(buf);
+  char* bp = Format64(ep, 0, n);
+  if (*bp != '0' || bp + 1 != ep) {
+    out->append(bp, ep - bp);
+    out->append(unit.abbr);
+  }
+}
+
+// Note: unit.prec is limited to double's digits10 value (typically 15) so it
+// always fits in buf[].
+void AppendNumberUnit(std::string* out, double n, DisplayUnit unit) {
+  constexpr int kBufferSize = std::numeric_limits<double>::digits10;
+  const int prec = std::min(kBufferSize, unit.prec);
+  char buf[kBufferSize];  // also large enough to hold integer part
+  char* ep = buf + sizeof(buf);
+  double d = 0;
+  int64_t frac_part = Round(std::modf(n, &d) * unit.pow10);
+  int64_t int_part = d;
+  if (int_part != 0 || frac_part != 0) {
+    char* bp = Format64(ep, 0, int_part);  // always < 1000
+    out->append(bp, ep - bp);
+    if (frac_part != 0) {
+      out->push_back('.');
+      bp = Format64(ep, prec, frac_part);
+      while (ep[-1] == '0') --ep;
+      out->append(bp, ep - bp);
+    }
+    out->append(unit.abbr);
+  }
+}
+
+}  // namespace
+
+// From Go's doc at https://golang.org/pkg/time/#Duration.String
+//   [FormatDuration] returns a string representing the duration in the
+//   form "72h3m0.5s". Leading zero units are omitted.  As a special
+//   case, durations less than one second format use a smaller unit
+//   (milli-, micro-, or nanoseconds) to ensure that the leading digit
+//   is non-zero.  The zero duration formats as 0, with no unit.
+std::string FormatDuration(Duration d) {
+  const Duration min_duration = Seconds(kint64min);
+  if (d == min_duration) {
+    // Avoid needing to negate kint64min by directly returning what the
+    // following code should produce in that case.
+    return "-2562047788015215h30m8s";
+  }
+  std::string s;
+  if (d < ZeroDuration()) {
+    s.append("-");
+    d = -d;
+  }
+  if (d == InfiniteDuration()) {
+    s.append("inf");
+  } else if (d < Seconds(1)) {
+    // Special case for durations with a magnitude < 1 second.  The duration
+    // is printed as a fraction of a single unit, e.g., "1.2ms".
+    if (d < Microseconds(1)) {
+      AppendNumberUnit(&s, FDivDuration(d, Nanoseconds(1)), kDisplayNano);
+    } else if (d < Milliseconds(1)) {
+      AppendNumberUnit(&s, FDivDuration(d, Microseconds(1)), kDisplayMicro);
+    } else {
+      AppendNumberUnit(&s, FDivDuration(d, Milliseconds(1)), kDisplayMilli);
+    }
+  } else {
+    AppendNumberUnit(&s, IDivDuration(d, Hours(1), &d), kDisplayHour);
+    AppendNumberUnit(&s, IDivDuration(d, Minutes(1), &d), kDisplayMin);
+    AppendNumberUnit(&s, FDivDuration(d, Seconds(1)), kDisplaySec);
+  }
+  if (s.empty() || s == "-") {
+    s = "0";
+  }
+  return s;
+}
+
+namespace {
+
+// A helper for ParseDuration() that parses a leading number from the given
+// string and stores the result in *int_part/*frac_part/*frac_scale.  The
+// given string pointer is modified to point to the first unconsumed char.
+bool ConsumeDurationNumber(const char** dpp, const char* ep, int64_t* int_part,
+                           int64_t* frac_part, int64_t* frac_scale) {
+  *int_part = 0;
+  *frac_part = 0;
+  *frac_scale = 1;  // invariant: *frac_part < *frac_scale
+  const char* start = *dpp;
+  for (; *dpp != ep; *dpp += 1) {
+    const int d = **dpp - '0';  // contiguous digits
+    if (d < 0 || 10 <= d) break;
+
+    if (*int_part > kint64max / 10) return false;
+    *int_part *= 10;
+    if (*int_part > kint64max - d) return false;
+    *int_part += d;
+  }
+  const bool int_part_empty = (*dpp == start);
+  if (*dpp == ep || **dpp != '.') return !int_part_empty;
+
+  for (*dpp += 1; *dpp != ep; *dpp += 1) {
+    const int d = **dpp - '0';  // contiguous digits
+    if (d < 0 || 10 <= d) break;
+    if (*frac_scale <= kint64max / 10) {
+      *frac_part *= 10;
+      *frac_part += d;
+      *frac_scale *= 10;
+    }
+  }
+  return !int_part_empty || *frac_scale != 1;
+}
+
+// A helper for ParseDuration() that parses a leading unit designator (e.g.,
+// ns, us, ms, s, m, h) from the given string and stores the resulting unit
+// in "*unit".  The given string pointer is modified to point to the first
+// unconsumed char.
+bool ConsumeDurationUnit(const char** start, const char* end, Duration* unit) {
+  size_t size = end - *start;
+  switch (size) {
+    case 0:
+      return false;
+    default:
+      switch (**start) {
+        case 'n':
+          if (*(*start + 1) == 's') {
+            *start += 2;
+            *unit = Nanoseconds(1);
+            return true;
+          }
+          break;
+        case 'u':
+          if (*(*start + 1) == 's') {
+            *start += 2;
+            *unit = Microseconds(1);
+            return true;
+          }
+          break;
+        case 'm':
+          if (*(*start + 1) == 's') {
+            *start += 2;
+            *unit = Milliseconds(1);
+            return true;
+          }
+          break;
+        default:
+          break;
+      }
+      ABSL_FALLTHROUGH_INTENDED;
+    case 1:
+      switch (**start) {
+        case 's':
+          *unit = Seconds(1);
+          *start += 1;
+          return true;
+        case 'm':
+          *unit = Minutes(1);
+          *start += 1;
+          return true;
+        case 'h':
+          *unit = Hours(1);
+          *start += 1;
+          return true;
+        default:
+          return false;
+      }
+  }
+}
+
+}  // namespace
+
+// From Go's doc at https://golang.org/pkg/time/#ParseDuration
+//   [ParseDuration] parses a duration string. A duration string is
+//   a possibly signed sequence of decimal numbers, each with optional
+//   fraction and a unit suffix, such as "300ms", "-1.5h" or "2h45m".
+//   Valid time units are "ns", "us" "ms", "s", "m", "h".
+bool ParseDuration(absl::string_view dur_sv, Duration* d) {
+  int sign = 1;
+  if (absl::ConsumePrefix(&dur_sv, "-")) {
+    sign = -1;
+  } else {
+    absl::ConsumePrefix(&dur_sv, "+");
+  }
+  if (dur_sv.empty()) return false;
+
+  // Special case for a string of "0".
+  if (dur_sv == "0") {
+    *d = ZeroDuration();
+    return true;
+  }
+
+  if (dur_sv == "inf") {
+    *d = sign * InfiniteDuration();
+    return true;
+  }
+
+  const char* start = dur_sv.data();
+  const char* end = start + dur_sv.size();
+
+  Duration dur;
+  while (start != end) {
+    int64_t int_part;
+    int64_t frac_part;
+    int64_t frac_scale;
+    Duration unit;
+    if (!ConsumeDurationNumber(&start, end, &int_part, &frac_part,
+                               &frac_scale) ||
+        !ConsumeDurationUnit(&start, end, &unit)) {
+      return false;
+    }
+    if (int_part != 0) dur += sign * int_part * unit;
+    if (frac_part != 0) dur += sign * frac_part * unit / frac_scale;
+  }
+  *d = dur;
+  return true;
+}
+
+bool AbslParseFlag(absl::string_view text, Duration* dst, std::string*) {
+  return ParseDuration(text, dst);
+}
+
+std::string AbslUnparseFlag(Duration d) { return FormatDuration(d); }
+bool ParseFlag(const std::string& text, Duration* dst, std::string* ) {
+  return ParseDuration(text, dst);
+}
+
+std::string UnparseFlag(Duration d) { return FormatDuration(d); }
+
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/duration_benchmark.cc b/third_party/abseil_cpp/absl/time/duration_benchmark.cc
new file mode 100644
index 0000000000..83a836c8c8
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/duration_benchmark.cc
@@ -0,0 +1,428 @@
+// Copyright 2018 The Abseil Authors.
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include <cmath>
+#include <cstddef>
+#include <cstdint>
+#include <ctime>
+#include <string>
+
+#include "absl/base/attributes.h"
+#include "absl/time/time.h"
+#include "benchmark/benchmark.h"
+
+namespace {
+
+//
+// Factory functions
+//
+
+void BM_Duration_Factory_Nanoseconds(benchmark::State& state) {
+  int64_t i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::Nanoseconds(i));
+    i += 314159;
+  }
+}
+BENCHMARK(BM_Duration_Factory_Nanoseconds);
+
+void BM_Duration_Factory_Microseconds(benchmark::State& state) {
+  int64_t i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::Microseconds(i));
+    i += 314;
+  }
+}
+BENCHMARK(BM_Duration_Factory_Microseconds);
+
+void BM_Duration_Factory_Milliseconds(benchmark::State& state) {
+  int64_t i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::Milliseconds(i));
+    i += 1;
+  }
+}
+BENCHMARK(BM_Duration_Factory_Milliseconds);
+
+void BM_Duration_Factory_Seconds(benchmark::State& state) {
+  int64_t i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::Seconds(i));
+    i += 1;
+  }
+}
+BENCHMARK(BM_Duration_Factory_Seconds);
+
+void BM_Duration_Factory_Minutes(benchmark::State& state) {
+  int64_t i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::Minutes(i));
+    i += 1;
+  }
+}
+BENCHMARK(BM_Duration_Factory_Minutes);
+
+void BM_Duration_Factory_Hours(benchmark::State& state) {
+  int64_t i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::Hours(i));
+    i += 1;
+  }
+}
+BENCHMARK(BM_Duration_Factory_Hours);
+
+void BM_Duration_Factory_DoubleNanoseconds(benchmark::State& state) {
+  double d = 1;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::Nanoseconds(d));
+    d = d * 1.00000001 + 1;
+  }
+}
+BENCHMARK(BM_Duration_Factory_DoubleNanoseconds);
+
+void BM_Duration_Factory_DoubleMicroseconds(benchmark::State& state) {
+  double d = 1e-3;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::Microseconds(d));
+    d = d * 1.00000001 + 1e-3;
+  }
+}
+BENCHMARK(BM_Duration_Factory_DoubleMicroseconds);
+
+void BM_Duration_Factory_DoubleMilliseconds(benchmark::State& state) {
+  double d = 1e-6;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::Milliseconds(d));
+    d = d * 1.00000001 + 1e-6;
+  }
+}
+BENCHMARK(BM_Duration_Factory_DoubleMilliseconds);
+
+void BM_Duration_Factory_DoubleSeconds(benchmark::State& state) {
+  double d = 1e-9;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::Seconds(d));
+    d = d * 1.00000001 + 1e-9;
+  }
+}
+BENCHMARK(BM_Duration_Factory_DoubleSeconds);
+
+void BM_Duration_Factory_DoubleMinutes(benchmark::State& state) {
+  double d = 1e-9;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::Minutes(d));
+    d = d * 1.00000001 + 1e-9;
+  }
+}
+BENCHMARK(BM_Duration_Factory_DoubleMinutes);
+
+void BM_Duration_Factory_DoubleHours(benchmark::State& state) {
+  double d = 1e-9;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::Hours(d));
+    d = d * 1.00000001 + 1e-9;
+  }
+}
+BENCHMARK(BM_Duration_Factory_DoubleHours);
+
+//
+// Arithmetic
+//
+
+void BM_Duration_Addition(benchmark::State& state) {
+  absl::Duration d = absl::Nanoseconds(1);
+  absl::Duration step = absl::Milliseconds(1);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(d += step);
+  }
+}
+BENCHMARK(BM_Duration_Addition);
+
+void BM_Duration_Subtraction(benchmark::State& state) {
+  absl::Duration d = absl::Seconds(std::numeric_limits<int64_t>::max());
+  absl::Duration step = absl::Milliseconds(1);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(d -= step);
+  }
+}
+BENCHMARK(BM_Duration_Subtraction);
+
+void BM_Duration_Multiplication_Fixed(benchmark::State& state) {
+  absl::Duration d = absl::Milliseconds(1);
+  absl::Duration s;
+  int i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(s += d * (i + 1));
+    ++i;
+  }
+}
+BENCHMARK(BM_Duration_Multiplication_Fixed);
+
+void BM_Duration_Multiplication_Double(benchmark::State& state) {
+  absl::Duration d = absl::Milliseconds(1);
+  absl::Duration s;
+  int i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(s += d * (i + 1.0));
+    ++i;
+  }
+}
+BENCHMARK(BM_Duration_Multiplication_Double);
+
+void BM_Duration_Division_Fixed(benchmark::State& state) {
+  absl::Duration d = absl::Seconds(1);
+  int i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(d /= i + 1);
+    ++i;
+  }
+}
+BENCHMARK(BM_Duration_Division_Fixed);
+
+void BM_Duration_Division_Double(benchmark::State& state) {
+  absl::Duration d = absl::Seconds(1);
+  int i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(d /= i + 1.0);
+    ++i;
+  }
+}
+BENCHMARK(BM_Duration_Division_Double);
+
+void BM_Duration_FDivDuration_Nanoseconds(benchmark::State& state) {
+  double d = 1;
+  int i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(
+        d += absl::FDivDuration(absl::Milliseconds(i), absl::Nanoseconds(1)));
+    ++i;
+  }
+}
+BENCHMARK(BM_Duration_FDivDuration_Nanoseconds);
+
+void BM_Duration_IDivDuration_Nanoseconds(benchmark::State& state) {
+  int64_t a = 1;
+  absl::Duration ignore;
+  int i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(a +=
+                             absl::IDivDuration(absl::Nanoseconds(i),
+                                                absl::Nanoseconds(1), &ignore));
+    ++i;
+  }
+}
+BENCHMARK(BM_Duration_IDivDuration_Nanoseconds);
+
+void BM_Duration_IDivDuration_Microseconds(benchmark::State& state) {
+  int64_t a = 1;
+  absl::Duration ignore;
+  int i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(a += absl::IDivDuration(absl::Microseconds(i),
+                                                     absl::Microseconds(1),
+                                                     &ignore));
+    ++i;
+  }
+}
+BENCHMARK(BM_Duration_IDivDuration_Microseconds);
+
+void BM_Duration_IDivDuration_Milliseconds(benchmark::State& state) {
+  int64_t a = 1;
+  absl::Duration ignore;
+  int i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(a += absl::IDivDuration(absl::Milliseconds(i),
+                                                     absl::Milliseconds(1),
+                                                     &ignore));
+    ++i;
+  }
+}
+BENCHMARK(BM_Duration_IDivDuration_Milliseconds);
+
+void BM_Duration_IDivDuration_Seconds(benchmark::State& state) {
+  int64_t a = 1;
+  absl::Duration ignore;
+  int i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(
+        a += absl::IDivDuration(absl::Seconds(i), absl::Seconds(1), &ignore));
+    ++i;
+  }
+}
+BENCHMARK(BM_Duration_IDivDuration_Seconds);
+
+void BM_Duration_IDivDuration_Minutes(benchmark::State& state) {
+  int64_t a = 1;
+  absl::Duration ignore;
+  int i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(
+        a += absl::IDivDuration(absl::Minutes(i), absl::Minutes(1), &ignore));
+    ++i;
+  }
+}
+BENCHMARK(BM_Duration_IDivDuration_Minutes);
+
+void BM_Duration_IDivDuration_Hours(benchmark::State& state) {
+  int64_t a = 1;
+  absl::Duration ignore;
+  int i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(
+        a += absl::IDivDuration(absl::Hours(i), absl::Hours(1), &ignore));
+    ++i;
+  }
+}
+BENCHMARK(BM_Duration_IDivDuration_Hours);
+
+void BM_Duration_ToInt64Nanoseconds(benchmark::State& state) {
+  absl::Duration d = absl::Seconds(100000);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::ToInt64Nanoseconds(d));
+  }
+}
+BENCHMARK(BM_Duration_ToInt64Nanoseconds);
+
+void BM_Duration_ToInt64Microseconds(benchmark::State& state) {
+  absl::Duration d = absl::Seconds(100000);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::ToInt64Microseconds(d));
+  }
+}
+BENCHMARK(BM_Duration_ToInt64Microseconds);
+
+void BM_Duration_ToInt64Milliseconds(benchmark::State& state) {
+  absl::Duration d = absl::Seconds(100000);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::ToInt64Milliseconds(d));
+  }
+}
+BENCHMARK(BM_Duration_ToInt64Milliseconds);
+
+void BM_Duration_ToInt64Seconds(benchmark::State& state) {
+  absl::Duration d = absl::Seconds(100000);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::ToInt64Seconds(d));
+  }
+}
+BENCHMARK(BM_Duration_ToInt64Seconds);
+
+void BM_Duration_ToInt64Minutes(benchmark::State& state) {
+  absl::Duration d = absl::Seconds(100000);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::ToInt64Minutes(d));
+  }
+}
+BENCHMARK(BM_Duration_ToInt64Minutes);
+
+void BM_Duration_ToInt64Hours(benchmark::State& state) {
+  absl::Duration d = absl::Seconds(100000);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::ToInt64Hours(d));
+  }
+}
+BENCHMARK(BM_Duration_ToInt64Hours);
+
+//
+// To/FromTimespec
+//
+
+void BM_Duration_ToTimespec_AbslTime(benchmark::State& state) {
+  absl::Duration d = absl::Seconds(1);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::ToTimespec(d));
+  }
+}
+BENCHMARK(BM_Duration_ToTimespec_AbslTime);
+
+ABSL_ATTRIBUTE_NOINLINE timespec DoubleToTimespec(double seconds) {
+  timespec ts;
+  ts.tv_sec = seconds;
+  ts.tv_nsec = (seconds - ts.tv_sec) * (1000 * 1000 * 1000);
+  return ts;
+}
+
+void BM_Duration_ToTimespec_Double(benchmark::State& state) {
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(DoubleToTimespec(1.0));
+  }
+}
+BENCHMARK(BM_Duration_ToTimespec_Double);
+
+void BM_Duration_FromTimespec_AbslTime(benchmark::State& state) {
+  timespec ts;
+  ts.tv_sec = 0;
+  ts.tv_nsec = 0;
+  while (state.KeepRunning()) {
+    if (++ts.tv_nsec == 1000 * 1000 * 1000) {
+      ++ts.tv_sec;
+      ts.tv_nsec = 0;
+    }
+    benchmark::DoNotOptimize(absl::DurationFromTimespec(ts));
+  }
+}
+BENCHMARK(BM_Duration_FromTimespec_AbslTime);
+
+ABSL_ATTRIBUTE_NOINLINE double TimespecToDouble(timespec ts) {
+  return ts.tv_sec + (ts.tv_nsec / (1000 * 1000 * 1000));
+}
+
+void BM_Duration_FromTimespec_Double(benchmark::State& state) {
+  timespec ts;
+  ts.tv_sec = 0;
+  ts.tv_nsec = 0;
+  while (state.KeepRunning()) {
+    if (++ts.tv_nsec == 1000 * 1000 * 1000) {
+      ++ts.tv_sec;
+      ts.tv_nsec = 0;
+    }
+    benchmark::DoNotOptimize(TimespecToDouble(ts));
+  }
+}
+BENCHMARK(BM_Duration_FromTimespec_Double);
+
+//
+// String conversions
+//
+
+const char* const kDurations[] = {
+    "0",                                   // 0
+    "123ns",                               // 1
+    "1h2m3s",                              // 2
+    "-2h3m4.005006007s",                   // 3
+    "2562047788015215h30m7.99999999975s",  // 4
+};
+const int kNumDurations = sizeof(kDurations) / sizeof(kDurations[0]);
+
+void BM_Duration_FormatDuration(benchmark::State& state) {
+  const std::string s = kDurations[state.range(0)];
+  state.SetLabel(s);
+  absl::Duration d;
+  absl::ParseDuration(kDurations[state.range(0)], &d);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::FormatDuration(d));
+  }
+}
+BENCHMARK(BM_Duration_FormatDuration)->DenseRange(0, kNumDurations - 1);
+
+void BM_Duration_ParseDuration(benchmark::State& state) {
+  const std::string s = kDurations[state.range(0)];
+  state.SetLabel(s);
+  absl::Duration d;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::ParseDuration(s, &d));
+  }
+}
+BENCHMARK(BM_Duration_ParseDuration)->DenseRange(0, kNumDurations - 1);
+
+}  // namespace
diff --git a/third_party/abseil_cpp/absl/time/duration_test.cc b/third_party/abseil_cpp/absl/time/duration_test.cc
new file mode 100644
index 0000000000..4d85a2c4f4
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/duration_test.cc
@@ -0,0 +1,1808 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#if defined(_MSC_VER)
+#include <winsock2.h>  // for timeval
+#endif
+
+#include <chrono>  // NOLINT(build/c++11)
+#include <cmath>
+#include <cstdint>
+#include <ctime>
+#include <iomanip>
+#include <limits>
+#include <random>
+#include <string>
+
+#include "gmock/gmock.h"
+#include "gtest/gtest.h"
+#include "absl/time/time.h"
+
+namespace {
+
+constexpr int64_t kint64max = std::numeric_limits<int64_t>::max();
+constexpr int64_t kint64min = std::numeric_limits<int64_t>::min();
+
+// Approximates the given number of years. This is only used to make some test
+// code more readable.
+absl::Duration ApproxYears(int64_t n) { return absl::Hours(n) * 365 * 24; }
+
+// A gMock matcher to match timespec values. Use this matcher like:
+// timespec ts1, ts2;
+// EXPECT_THAT(ts1, TimespecMatcher(ts2));
+MATCHER_P(TimespecMatcher, ts, "") {
+  if (ts.tv_sec == arg.tv_sec && ts.tv_nsec == arg.tv_nsec)
+    return true;
+  *result_listener << "expected: {" << ts.tv_sec << ", " << ts.tv_nsec << "} ";
+  *result_listener << "actual: {" << arg.tv_sec << ", " << arg.tv_nsec << "}";
+  return false;
+}
+
+// A gMock matcher to match timeval values. Use this matcher like:
+// timeval tv1, tv2;
+// EXPECT_THAT(tv1, TimevalMatcher(tv2));
+MATCHER_P(TimevalMatcher, tv, "") {
+  if (tv.tv_sec == arg.tv_sec && tv.tv_usec == arg.tv_usec)
+    return true;
+  *result_listener << "expected: {" << tv.tv_sec << ", " << tv.tv_usec << "} ";
+  *result_listener << "actual: {" << arg.tv_sec << ", " << arg.tv_usec << "}";
+  return false;
+}
+
+TEST(Duration, ConstExpr) {
+  constexpr absl::Duration d0 = absl::ZeroDuration();
+  static_assert(d0 == absl::ZeroDuration(), "ZeroDuration()");
+  constexpr absl::Duration d1 = absl::Seconds(1);
+  static_assert(d1 == absl::Seconds(1), "Seconds(1)");
+  static_assert(d1 != absl::ZeroDuration(), "Seconds(1)");
+  constexpr absl::Duration d2 = absl::InfiniteDuration();
+  static_assert(d2 == absl::InfiniteDuration(), "InfiniteDuration()");
+  static_assert(d2 != absl::ZeroDuration(), "InfiniteDuration()");
+}
+
+TEST(Duration, ValueSemantics) {
+  // If this compiles, the test passes.
+  constexpr absl::Duration a;      // Default construction
+  constexpr absl::Duration b = a;  // Copy construction
+  constexpr absl::Duration c(b);   // Copy construction (again)
+
+  absl::Duration d;
+  d = c;  // Assignment
+}
+
+TEST(Duration, Factories) {
+  constexpr absl::Duration zero = absl::ZeroDuration();
+  constexpr absl::Duration nano = absl::Nanoseconds(1);
+  constexpr absl::Duration micro = absl::Microseconds(1);
+  constexpr absl::Duration milli = absl::Milliseconds(1);
+  constexpr absl::Duration sec = absl::Seconds(1);
+  constexpr absl::Duration min = absl::Minutes(1);
+  constexpr absl::Duration hour = absl::Hours(1);
+
+  EXPECT_EQ(zero, absl::Duration());
+  EXPECT_EQ(zero, absl::Seconds(0));
+  EXPECT_EQ(nano, absl::Nanoseconds(1));
+  EXPECT_EQ(micro, absl::Nanoseconds(1000));
+  EXPECT_EQ(milli, absl::Microseconds(1000));
+  EXPECT_EQ(sec, absl::Milliseconds(1000));
+  EXPECT_EQ(min, absl::Seconds(60));
+  EXPECT_EQ(hour, absl::Minutes(60));
+
+  // Tests factory limits
+  const absl::Duration inf = absl::InfiniteDuration();
+
+  EXPECT_GT(inf, absl::Seconds(kint64max));
+  EXPECT_LT(-inf, absl::Seconds(kint64min));
+  EXPECT_LT(-inf, absl::Seconds(-kint64max));
+
+  EXPECT_EQ(inf, absl::Minutes(kint64max));
+  EXPECT_EQ(-inf, absl::Minutes(kint64min));
+  EXPECT_EQ(-inf, absl::Minutes(-kint64max));
+  EXPECT_GT(inf, absl::Minutes(kint64max / 60));
+  EXPECT_LT(-inf, absl::Minutes(kint64min / 60));
+  EXPECT_LT(-inf, absl::Minutes(-kint64max / 60));
+
+  EXPECT_EQ(inf, absl::Hours(kint64max));
+  EXPECT_EQ(-inf, absl::Hours(kint64min));
+  EXPECT_EQ(-inf, absl::Hours(-kint64max));
+  EXPECT_GT(inf, absl::Hours(kint64max / 3600));
+  EXPECT_LT(-inf, absl::Hours(kint64min / 3600));
+  EXPECT_LT(-inf, absl::Hours(-kint64max / 3600));
+}
+
+TEST(Duration, ToConversion) {
+#define TEST_DURATION_CONVERSION(UNIT)                                  \
+  do {                                                                  \
+    const absl::Duration d = absl::UNIT(1.5);                           \
+    constexpr absl::Duration z = absl::ZeroDuration();                  \
+    constexpr absl::Duration inf = absl::InfiniteDuration();            \
+    constexpr double dbl_inf = std::numeric_limits<double>::infinity(); \
+    EXPECT_EQ(kint64min, absl::ToInt64##UNIT(-inf));                    \
+    EXPECT_EQ(-1, absl::ToInt64##UNIT(-d));                             \
+    EXPECT_EQ(0, absl::ToInt64##UNIT(z));                               \
+    EXPECT_EQ(1, absl::ToInt64##UNIT(d));                               \
+    EXPECT_EQ(kint64max, absl::ToInt64##UNIT(inf));                     \
+    EXPECT_EQ(-dbl_inf, absl::ToDouble##UNIT(-inf));                    \
+    EXPECT_EQ(-1.5, absl::ToDouble##UNIT(-d));                          \
+    EXPECT_EQ(0, absl::ToDouble##UNIT(z));                              \
+    EXPECT_EQ(1.5, absl::ToDouble##UNIT(d));                            \
+    EXPECT_EQ(dbl_inf, absl::ToDouble##UNIT(inf));                      \
+  } while (0)
+
+  TEST_DURATION_CONVERSION(Nanoseconds);
+  TEST_DURATION_CONVERSION(Microseconds);
+  TEST_DURATION_CONVERSION(Milliseconds);
+  TEST_DURATION_CONVERSION(Seconds);
+  TEST_DURATION_CONVERSION(Minutes);
+  TEST_DURATION_CONVERSION(Hours);
+
+#undef TEST_DURATION_CONVERSION
+}
+
+template <int64_t N>
+void TestToConversion() {
+  constexpr absl::Duration nano = absl::Nanoseconds(N);
+  EXPECT_EQ(N, absl::ToInt64Nanoseconds(nano));
+  EXPECT_EQ(0, absl::ToInt64Microseconds(nano));
+  EXPECT_EQ(0, absl::ToInt64Milliseconds(nano));
+  EXPECT_EQ(0, absl::ToInt64Seconds(nano));
+  EXPECT_EQ(0, absl::ToInt64Minutes(nano));
+  EXPECT_EQ(0, absl::ToInt64Hours(nano));
+  const absl::Duration micro = absl::Microseconds(N);
+  EXPECT_EQ(N * 1000, absl::ToInt64Nanoseconds(micro));
+  EXPECT_EQ(N, absl::ToInt64Microseconds(micro));
+  EXPECT_EQ(0, absl::ToInt64Milliseconds(micro));
+  EXPECT_EQ(0, absl::ToInt64Seconds(micro));
+  EXPECT_EQ(0, absl::ToInt64Minutes(micro));
+  EXPECT_EQ(0, absl::ToInt64Hours(micro));
+  const absl::Duration milli = absl::Milliseconds(N);
+  EXPECT_EQ(N * 1000 * 1000, absl::ToInt64Nanoseconds(milli));
+  EXPECT_EQ(N * 1000, absl::ToInt64Microseconds(milli));
+  EXPECT_EQ(N, absl::ToInt64Milliseconds(milli));
+  EXPECT_EQ(0, absl::ToInt64Seconds(milli));
+  EXPECT_EQ(0, absl::ToInt64Minutes(milli));
+  EXPECT_EQ(0, absl::ToInt64Hours(milli));
+  const absl::Duration sec = absl::Seconds(N);
+  EXPECT_EQ(N * 1000 * 1000 * 1000, absl::ToInt64Nanoseconds(sec));
+  EXPECT_EQ(N * 1000 * 1000, absl::ToInt64Microseconds(sec));
+  EXPECT_EQ(N * 1000, absl::ToInt64Milliseconds(sec));
+  EXPECT_EQ(N, absl::ToInt64Seconds(sec));
+  EXPECT_EQ(0, absl::ToInt64Minutes(sec));
+  EXPECT_EQ(0, absl::ToInt64Hours(sec));
+  const absl::Duration min = absl::Minutes(N);
+  EXPECT_EQ(N * 60 * 1000 * 1000 * 1000, absl::ToInt64Nanoseconds(min));
+  EXPECT_EQ(N * 60 * 1000 * 1000, absl::ToInt64Microseconds(min));
+  EXPECT_EQ(N * 60 * 1000, absl::ToInt64Milliseconds(min));
+  EXPECT_EQ(N * 60, absl::ToInt64Seconds(min));
+  EXPECT_EQ(N, absl::ToInt64Minutes(min));
+  EXPECT_EQ(0, absl::ToInt64Hours(min));
+  const absl::Duration hour = absl::Hours(N);
+  EXPECT_EQ(N * 60 * 60 * 1000 * 1000 * 1000, absl::ToInt64Nanoseconds(hour));
+  EXPECT_EQ(N * 60 * 60 * 1000 * 1000, absl::ToInt64Microseconds(hour));
+  EXPECT_EQ(N * 60 * 60 * 1000, absl::ToInt64Milliseconds(hour));
+  EXPECT_EQ(N * 60 * 60, absl::ToInt64Seconds(hour));
+  EXPECT_EQ(N * 60, absl::ToInt64Minutes(hour));
+  EXPECT_EQ(N, absl::ToInt64Hours(hour));
+}
+
+TEST(Duration, ToConversionDeprecated) {
+  TestToConversion<43>();
+  TestToConversion<1>();
+  TestToConversion<0>();
+  TestToConversion<-1>();
+  TestToConversion<-43>();
+}
+
+template <int64_t N>
+void TestFromChronoBasicEquality() {
+  using std::chrono::nanoseconds;
+  using std::chrono::microseconds;
+  using std::chrono::milliseconds;
+  using std::chrono::seconds;
+  using std::chrono::minutes;
+  using std::chrono::hours;
+
+  static_assert(absl::Nanoseconds(N) == absl::FromChrono(nanoseconds(N)), "");
+  static_assert(absl::Microseconds(N) == absl::FromChrono(microseconds(N)), "");
+  static_assert(absl::Milliseconds(N) == absl::FromChrono(milliseconds(N)), "");
+  static_assert(absl::Seconds(N) == absl::FromChrono(seconds(N)), "");
+  static_assert(absl::Minutes(N) == absl::FromChrono(minutes(N)), "");
+  static_assert(absl::Hours(N) == absl::FromChrono(hours(N)), "");
+}
+
+TEST(Duration, FromChrono) {
+  TestFromChronoBasicEquality<-123>();
+  TestFromChronoBasicEquality<-1>();
+  TestFromChronoBasicEquality<0>();
+  TestFromChronoBasicEquality<1>();
+  TestFromChronoBasicEquality<123>();
+
+  // Minutes (might, depending on the platform) saturate at +inf.
+  const auto chrono_minutes_max = std::chrono::minutes::max();
+  const auto minutes_max = absl::FromChrono(chrono_minutes_max);
+  const int64_t minutes_max_count = chrono_minutes_max.count();
+  if (minutes_max_count > kint64max / 60) {
+    EXPECT_EQ(absl::InfiniteDuration(), minutes_max);
+  } else {
+    EXPECT_EQ(absl::Minutes(minutes_max_count), minutes_max);
+  }
+
+  // Minutes (might, depending on the platform) saturate at -inf.
+  const auto chrono_minutes_min = std::chrono::minutes::min();
+  const auto minutes_min = absl::FromChrono(chrono_minutes_min);
+  const int64_t minutes_min_count = chrono_minutes_min.count();
+  if (minutes_min_count < kint64min / 60) {
+    EXPECT_EQ(-absl::InfiniteDuration(), minutes_min);
+  } else {
+    EXPECT_EQ(absl::Minutes(minutes_min_count), minutes_min);
+  }
+
+  // Hours (might, depending on the platform) saturate at +inf.
+  const auto chrono_hours_max = std::chrono::hours::max();
+  const auto hours_max = absl::FromChrono(chrono_hours_max);
+  const int64_t hours_max_count = chrono_hours_max.count();
+  if (hours_max_count > kint64max / 3600) {
+    EXPECT_EQ(absl::InfiniteDuration(), hours_max);
+  } else {
+    EXPECT_EQ(absl::Hours(hours_max_count), hours_max);
+  }
+
+  // Hours (might, depending on the platform) saturate at -inf.
+  const auto chrono_hours_min = std::chrono::hours::min();
+  const auto hours_min = absl::FromChrono(chrono_hours_min);
+  const int64_t hours_min_count = chrono_hours_min.count();
+  if (hours_min_count < kint64min / 3600) {
+    EXPECT_EQ(-absl::InfiniteDuration(), hours_min);
+  } else {
+    EXPECT_EQ(absl::Hours(hours_min_count), hours_min);
+  }
+}
+
+template <int64_t N>
+void TestToChrono() {
+  using std::chrono::nanoseconds;
+  using std::chrono::microseconds;
+  using std::chrono::milliseconds;
+  using std::chrono::seconds;
+  using std::chrono::minutes;
+  using std::chrono::hours;
+
+  EXPECT_EQ(nanoseconds(N), absl::ToChronoNanoseconds(absl::Nanoseconds(N)));
+  EXPECT_EQ(microseconds(N), absl::ToChronoMicroseconds(absl::Microseconds(N)));
+  EXPECT_EQ(milliseconds(N), absl::ToChronoMilliseconds(absl::Milliseconds(N)));
+  EXPECT_EQ(seconds(N), absl::ToChronoSeconds(absl::Seconds(N)));
+
+  constexpr auto absl_minutes = absl::Minutes(N);
+  auto chrono_minutes = minutes(N);
+  if (absl_minutes == -absl::InfiniteDuration()) {
+    chrono_minutes = minutes::min();
+  } else if (absl_minutes == absl::InfiniteDuration()) {
+    chrono_minutes = minutes::max();
+  }
+  EXPECT_EQ(chrono_minutes, absl::ToChronoMinutes(absl_minutes));
+
+  constexpr auto absl_hours = absl::Hours(N);
+  auto chrono_hours = hours(N);
+  if (absl_hours == -absl::InfiniteDuration()) {
+    chrono_hours = hours::min();
+  } else if (absl_hours == absl::InfiniteDuration()) {
+    chrono_hours = hours::max();
+  }
+  EXPECT_EQ(chrono_hours, absl::ToChronoHours(absl_hours));
+}
+
+TEST(Duration, ToChrono) {
+  using std::chrono::nanoseconds;
+  using std::chrono::microseconds;
+  using std::chrono::milliseconds;
+  using std::chrono::seconds;
+  using std::chrono::minutes;
+  using std::chrono::hours;
+
+  TestToChrono<kint64min>();
+  TestToChrono<-1>();
+  TestToChrono<0>();
+  TestToChrono<1>();
+  TestToChrono<kint64max>();
+
+  // Verify truncation toward zero.
+  const auto tick = absl::Nanoseconds(1) / 4;
+  EXPECT_EQ(nanoseconds(0), absl::ToChronoNanoseconds(tick));
+  EXPECT_EQ(nanoseconds(0), absl::ToChronoNanoseconds(-tick));
+  EXPECT_EQ(microseconds(0), absl::ToChronoMicroseconds(tick));
+  EXPECT_EQ(microseconds(0), absl::ToChronoMicroseconds(-tick));
+  EXPECT_EQ(milliseconds(0), absl::ToChronoMilliseconds(tick));
+  EXPECT_EQ(milliseconds(0), absl::ToChronoMilliseconds(-tick));
+  EXPECT_EQ(seconds(0), absl::ToChronoSeconds(tick));
+  EXPECT_EQ(seconds(0), absl::ToChronoSeconds(-tick));
+  EXPECT_EQ(minutes(0), absl::ToChronoMinutes(tick));
+  EXPECT_EQ(minutes(0), absl::ToChronoMinutes(-tick));
+  EXPECT_EQ(hours(0), absl::ToChronoHours(tick));
+  EXPECT_EQ(hours(0), absl::ToChronoHours(-tick));
+
+  // Verifies +/- infinity saturation at max/min.
+  constexpr auto inf = absl::InfiniteDuration();
+  EXPECT_EQ(nanoseconds::min(), absl::ToChronoNanoseconds(-inf));
+  EXPECT_EQ(nanoseconds::max(), absl::ToChronoNanoseconds(inf));
+  EXPECT_EQ(microseconds::min(), absl::ToChronoMicroseconds(-inf));
+  EXPECT_EQ(microseconds::max(), absl::ToChronoMicroseconds(inf));
+  EXPECT_EQ(milliseconds::min(), absl::ToChronoMilliseconds(-inf));
+  EXPECT_EQ(milliseconds::max(), absl::ToChronoMilliseconds(inf));
+  EXPECT_EQ(seconds::min(), absl::ToChronoSeconds(-inf));
+  EXPECT_EQ(seconds::max(), absl::ToChronoSeconds(inf));
+  EXPECT_EQ(minutes::min(), absl::ToChronoMinutes(-inf));
+  EXPECT_EQ(minutes::max(), absl::ToChronoMinutes(inf));
+  EXPECT_EQ(hours::min(), absl::ToChronoHours(-inf));
+  EXPECT_EQ(hours::max(), absl::ToChronoHours(inf));
+}
+
+TEST(Duration, FactoryOverloads) {
+  enum E { kOne = 1 };
+#define TEST_FACTORY_OVERLOADS(NAME)                                          \
+  EXPECT_EQ(1, NAME(kOne) / NAME(kOne));                                      \
+  EXPECT_EQ(1, NAME(static_cast<int8_t>(1)) / NAME(1));                       \
+  EXPECT_EQ(1, NAME(static_cast<int16_t>(1)) / NAME(1));                      \
+  EXPECT_EQ(1, NAME(static_cast<int32_t>(1)) / NAME(1));                      \
+  EXPECT_EQ(1, NAME(static_cast<int64_t>(1)) / NAME(1));                      \
+  EXPECT_EQ(1, NAME(static_cast<uint8_t>(1)) / NAME(1));                      \
+  EXPECT_EQ(1, NAME(static_cast<uint16_t>(1)) / NAME(1));                     \
+  EXPECT_EQ(1, NAME(static_cast<uint32_t>(1)) / NAME(1));                     \
+  EXPECT_EQ(1, NAME(static_cast<uint64_t>(1)) / NAME(1));                     \
+  EXPECT_EQ(NAME(1) / 2, NAME(static_cast<float>(0.5)));                      \
+  EXPECT_EQ(NAME(1) / 2, NAME(static_cast<double>(0.5)));                     \
+  EXPECT_EQ(1.5, absl::FDivDuration(NAME(static_cast<float>(1.5)), NAME(1))); \
+  EXPECT_EQ(1.5, absl::FDivDuration(NAME(static_cast<double>(1.5)), NAME(1)));
+
+  TEST_FACTORY_OVERLOADS(absl::Nanoseconds);
+  TEST_FACTORY_OVERLOADS(absl::Microseconds);
+  TEST_FACTORY_OVERLOADS(absl::Milliseconds);
+  TEST_FACTORY_OVERLOADS(absl::Seconds);
+  TEST_FACTORY_OVERLOADS(absl::Minutes);
+  TEST_FACTORY_OVERLOADS(absl::Hours);
+
+#undef TEST_FACTORY_OVERLOADS
+
+  EXPECT_EQ(absl::Milliseconds(1500), absl::Seconds(1.5));
+  EXPECT_LT(absl::Nanoseconds(1), absl::Nanoseconds(1.5));
+  EXPECT_GT(absl::Nanoseconds(2), absl::Nanoseconds(1.5));
+
+  const double dbl_inf = std::numeric_limits<double>::infinity();
+  EXPECT_EQ(absl::InfiniteDuration(), absl::Nanoseconds(dbl_inf));
+  EXPECT_EQ(absl::InfiniteDuration(), absl::Microseconds(dbl_inf));
+  EXPECT_EQ(absl::InfiniteDuration(), absl::Milliseconds(dbl_inf));
+  EXPECT_EQ(absl::InfiniteDuration(), absl::Seconds(dbl_inf));
+  EXPECT_EQ(absl::InfiniteDuration(), absl::Minutes(dbl_inf));
+  EXPECT_EQ(absl::InfiniteDuration(), absl::Hours(dbl_inf));
+  EXPECT_EQ(-absl::InfiniteDuration(), absl::Nanoseconds(-dbl_inf));
+  EXPECT_EQ(-absl::InfiniteDuration(), absl::Microseconds(-dbl_inf));
+  EXPECT_EQ(-absl::InfiniteDuration(), absl::Milliseconds(-dbl_inf));
+  EXPECT_EQ(-absl::InfiniteDuration(), absl::Seconds(-dbl_inf));
+  EXPECT_EQ(-absl::InfiniteDuration(), absl::Minutes(-dbl_inf));
+  EXPECT_EQ(-absl::InfiniteDuration(), absl::Hours(-dbl_inf));
+}
+
+TEST(Duration, InfinityExamples) {
+  // These examples are used in the documentation in time.h. They are
+  // written so that they can be copy-n-pasted easily.
+
+  constexpr absl::Duration inf = absl::InfiniteDuration();
+  constexpr absl::Duration d = absl::Seconds(1);  // Any finite duration
+
+  EXPECT_TRUE(inf == inf + inf);
+  EXPECT_TRUE(inf == inf + d);
+  EXPECT_TRUE(inf == inf - inf);
+  EXPECT_TRUE(-inf == d - inf);
+
+  EXPECT_TRUE(inf == d * 1e100);
+  EXPECT_TRUE(0 == d / inf);  // NOLINT(readability/check)
+
+  // Division by zero returns infinity, or kint64min/MAX where necessary.
+  EXPECT_TRUE(inf == d / 0);
+  EXPECT_TRUE(kint64max == d / absl::ZeroDuration());
+}
+
+TEST(Duration, InfinityComparison) {
+  const absl::Duration inf = absl::InfiniteDuration();
+  const absl::Duration any_dur = absl::Seconds(1);
+
+  // Equality
+  EXPECT_EQ(inf, inf);
+  EXPECT_EQ(-inf, -inf);
+  EXPECT_NE(inf, -inf);
+  EXPECT_NE(any_dur, inf);
+  EXPECT_NE(any_dur, -inf);
+
+  // Relational
+  EXPECT_GT(inf, any_dur);
+  EXPECT_LT(-inf, any_dur);
+  EXPECT_LT(-inf, inf);
+  EXPECT_GT(inf, -inf);
+}
+
+TEST(Duration, InfinityAddition) {
+  const absl::Duration sec_max = absl::Seconds(kint64max);
+  const absl::Duration sec_min = absl::Seconds(kint64min);
+  const absl::Duration any_dur = absl::Seconds(1);
+  const absl::Duration inf = absl::InfiniteDuration();
+
+  // Addition
+  EXPECT_EQ(inf, inf + inf);
+  EXPECT_EQ(inf, inf + -inf);
+  EXPECT_EQ(-inf, -inf + inf);
+  EXPECT_EQ(-inf, -inf + -inf);
+
+  EXPECT_EQ(inf, inf + any_dur);
+  EXPECT_EQ(inf, any_dur + inf);
+  EXPECT_EQ(-inf, -inf + any_dur);
+  EXPECT_EQ(-inf, any_dur + -inf);
+
+  // Interesting case
+  absl::Duration almost_inf = sec_max + absl::Nanoseconds(999999999);
+  EXPECT_GT(inf, almost_inf);
+  almost_inf += -absl::Nanoseconds(999999999);
+  EXPECT_GT(inf, almost_inf);
+
+  // Addition overflow/underflow
+  EXPECT_EQ(inf, sec_max + absl::Seconds(1));
+  EXPECT_EQ(inf, sec_max + sec_max);
+  EXPECT_EQ(-inf, sec_min + -absl::Seconds(1));
+  EXPECT_EQ(-inf, sec_min + -sec_max);
+
+  // For reference: IEEE 754 behavior
+  const double dbl_inf = std::numeric_limits<double>::infinity();
+  EXPECT_TRUE(std::isinf(dbl_inf + dbl_inf));
+  EXPECT_TRUE(std::isnan(dbl_inf + -dbl_inf));  // We return inf
+  EXPECT_TRUE(std::isnan(-dbl_inf + dbl_inf));  // We return inf
+  EXPECT_TRUE(std::isinf(-dbl_inf + -dbl_inf));
+}
+
+TEST(Duration, InfinitySubtraction) {
+  const absl::Duration sec_max = absl::Seconds(kint64max);
+  const absl::Duration sec_min = absl::Seconds(kint64min);
+  const absl::Duration any_dur = absl::Seconds(1);
+  const absl::Duration inf = absl::InfiniteDuration();
+
+  // Subtraction
+  EXPECT_EQ(inf, inf - inf);
+  EXPECT_EQ(inf, inf - -inf);
+  EXPECT_EQ(-inf, -inf - inf);
+  EXPECT_EQ(-inf, -inf - -inf);
+
+  EXPECT_EQ(inf, inf - any_dur);
+  EXPECT_EQ(-inf, any_dur - inf);
+  EXPECT_EQ(-inf, -inf - any_dur);
+  EXPECT_EQ(inf, any_dur - -inf);
+
+  // Subtraction overflow/underflow
+  EXPECT_EQ(inf, sec_max - -absl::Seconds(1));
+  EXPECT_EQ(inf, sec_max - -sec_max);
+  EXPECT_EQ(-inf, sec_min - absl::Seconds(1));
+  EXPECT_EQ(-inf, sec_min - sec_max);
+
+  // Interesting case
+  absl::Duration almost_neg_inf = sec_min;
+  EXPECT_LT(-inf, almost_neg_inf);
+  almost_neg_inf -= -absl::Nanoseconds(1);
+  EXPECT_LT(-inf, almost_neg_inf);
+
+  // For reference: IEEE 754 behavior
+  const double dbl_inf = std::numeric_limits<double>::infinity();
+  EXPECT_TRUE(std::isnan(dbl_inf - dbl_inf));  // We return inf
+  EXPECT_TRUE(std::isinf(dbl_inf - -dbl_inf));
+  EXPECT_TRUE(std::isinf(-dbl_inf - dbl_inf));
+  EXPECT_TRUE(std::isnan(-dbl_inf - -dbl_inf));  // We return inf
+}
+
+TEST(Duration, InfinityMultiplication) {
+  const absl::Duration sec_max = absl::Seconds(kint64max);
+  const absl::Duration sec_min = absl::Seconds(kint64min);
+  const absl::Duration inf = absl::InfiniteDuration();
+
+#define TEST_INF_MUL_WITH_TYPE(T)                                     \
+  EXPECT_EQ(inf, inf * static_cast<T>(2));                            \
+  EXPECT_EQ(-inf, inf * static_cast<T>(-2));                          \
+  EXPECT_EQ(-inf, -inf * static_cast<T>(2));                          \
+  EXPECT_EQ(inf, -inf * static_cast<T>(-2));                          \
+  EXPECT_EQ(inf, inf * static_cast<T>(0));                            \
+  EXPECT_EQ(-inf, -inf * static_cast<T>(0));                          \
+  EXPECT_EQ(inf, sec_max * static_cast<T>(2));                        \
+  EXPECT_EQ(inf, sec_min * static_cast<T>(-2));                       \
+  EXPECT_EQ(inf, (sec_max / static_cast<T>(2)) * static_cast<T>(3));  \
+  EXPECT_EQ(-inf, sec_max * static_cast<T>(-2));                      \
+  EXPECT_EQ(-inf, sec_min * static_cast<T>(2));                       \
+  EXPECT_EQ(-inf, (sec_min / static_cast<T>(2)) * static_cast<T>(3));
+
+  TEST_INF_MUL_WITH_TYPE(int64_t);  // NOLINT(readability/function)
+  TEST_INF_MUL_WITH_TYPE(double);   // NOLINT(readability/function)
+
+#undef TEST_INF_MUL_WITH_TYPE
+
+  const double dbl_inf = std::numeric_limits<double>::infinity();
+  EXPECT_EQ(inf, inf * dbl_inf);
+  EXPECT_EQ(-inf, -inf * dbl_inf);
+  EXPECT_EQ(-inf, inf * -dbl_inf);
+  EXPECT_EQ(inf, -inf * -dbl_inf);
+
+  const absl::Duration any_dur = absl::Seconds(1);
+  EXPECT_EQ(inf, any_dur * dbl_inf);
+  EXPECT_EQ(-inf, -any_dur * dbl_inf);
+  EXPECT_EQ(-inf, any_dur * -dbl_inf);
+  EXPECT_EQ(inf, -any_dur * -dbl_inf);
+
+  // Fixed-point multiplication will produce a finite value, whereas floating
+  // point fuzziness will overflow to inf.
+  EXPECT_NE(absl::InfiniteDuration(), absl::Seconds(1) * kint64max);
+  EXPECT_EQ(inf, absl::Seconds(1) * static_cast<double>(kint64max));
+  EXPECT_NE(-absl::InfiniteDuration(), absl::Seconds(1) * kint64min);
+  EXPECT_EQ(-inf, absl::Seconds(1) * static_cast<double>(kint64min));
+
+  // Note that sec_max * or / by 1.0 overflows to inf due to the 53-bit
+  // limitations of double.
+  EXPECT_NE(inf, sec_max);
+  EXPECT_NE(inf, sec_max / 1);
+  EXPECT_EQ(inf, sec_max / 1.0);
+  EXPECT_NE(inf, sec_max * 1);
+  EXPECT_EQ(inf, sec_max * 1.0);
+}
+
+TEST(Duration, InfinityDivision) {
+  const absl::Duration sec_max = absl::Seconds(kint64max);
+  const absl::Duration sec_min = absl::Seconds(kint64min);
+  const absl::Duration inf = absl::InfiniteDuration();
+
+  // Division of Duration by a double
+#define TEST_INF_DIV_WITH_TYPE(T)            \
+  EXPECT_EQ(inf, inf / static_cast<T>(2));   \
+  EXPECT_EQ(-inf, inf / static_cast<T>(-2)); \
+  EXPECT_EQ(-inf, -inf / static_cast<T>(2)); \
+  EXPECT_EQ(inf, -inf / static_cast<T>(-2));
+
+  TEST_INF_DIV_WITH_TYPE(int64_t);  // NOLINT(readability/function)
+  TEST_INF_DIV_WITH_TYPE(double);   // NOLINT(readability/function)
+
+#undef TEST_INF_DIV_WITH_TYPE
+
+  // Division of Duration by a double overflow/underflow
+  EXPECT_EQ(inf, sec_max / 0.5);
+  EXPECT_EQ(inf, sec_min / -0.5);
+  EXPECT_EQ(inf, ((sec_max / 0.5) + absl::Seconds(1)) / 0.5);
+  EXPECT_EQ(-inf, sec_max / -0.5);
+  EXPECT_EQ(-inf, sec_min / 0.5);
+  EXPECT_EQ(-inf, ((sec_min / 0.5) - absl::Seconds(1)) / 0.5);
+
+  const double dbl_inf = std::numeric_limits<double>::infinity();
+  EXPECT_EQ(inf, inf / dbl_inf);
+  EXPECT_EQ(-inf, inf / -dbl_inf);
+  EXPECT_EQ(-inf, -inf / dbl_inf);
+  EXPECT_EQ(inf, -inf / -dbl_inf);
+
+  const absl::Duration any_dur = absl::Seconds(1);
+  EXPECT_EQ(absl::ZeroDuration(), any_dur / dbl_inf);
+  EXPECT_EQ(absl::ZeroDuration(), any_dur / -dbl_inf);
+  EXPECT_EQ(absl::ZeroDuration(), -any_dur / dbl_inf);
+  EXPECT_EQ(absl::ZeroDuration(), -any_dur / -dbl_inf);
+}
+
+TEST(Duration, InfinityModulus) {
+  const absl::Duration sec_max = absl::Seconds(kint64max);
+  const absl::Duration any_dur = absl::Seconds(1);
+  const absl::Duration inf = absl::InfiniteDuration();
+
+  EXPECT_EQ(inf, inf % inf);
+  EXPECT_EQ(inf, inf % -inf);
+  EXPECT_EQ(-inf, -inf % -inf);
+  EXPECT_EQ(-inf, -inf % inf);
+
+  EXPECT_EQ(any_dur, any_dur % inf);
+  EXPECT_EQ(any_dur, any_dur % -inf);
+  EXPECT_EQ(-any_dur, -any_dur % inf);
+  EXPECT_EQ(-any_dur, -any_dur % -inf);
+
+  EXPECT_EQ(inf, inf % -any_dur);
+  EXPECT_EQ(inf, inf % any_dur);
+  EXPECT_EQ(-inf, -inf % -any_dur);
+  EXPECT_EQ(-inf, -inf % any_dur);
+
+  // Remainder isn't affected by overflow.
+  EXPECT_EQ(absl::ZeroDuration(), sec_max % absl::Seconds(1));
+  EXPECT_EQ(absl::ZeroDuration(), sec_max % absl::Milliseconds(1));
+  EXPECT_EQ(absl::ZeroDuration(), sec_max % absl::Microseconds(1));
+  EXPECT_EQ(absl::ZeroDuration(), sec_max % absl::Nanoseconds(1));
+  EXPECT_EQ(absl::ZeroDuration(), sec_max % absl::Nanoseconds(1) / 4);
+}
+
+TEST(Duration, InfinityIDiv) {
+  const absl::Duration sec_max = absl::Seconds(kint64max);
+  const absl::Duration any_dur = absl::Seconds(1);
+  const absl::Duration inf = absl::InfiniteDuration();
+  const double dbl_inf = std::numeric_limits<double>::infinity();
+
+  // IDivDuration (int64_t return value + a remainer)
+  absl::Duration rem = absl::ZeroDuration();
+  EXPECT_EQ(kint64max, absl::IDivDuration(inf, inf, &rem));
+  EXPECT_EQ(inf, rem);
+
+  rem = absl::ZeroDuration();
+  EXPECT_EQ(kint64max, absl::IDivDuration(-inf, -inf, &rem));
+  EXPECT_EQ(-inf, rem);
+
+  rem = absl::ZeroDuration();
+  EXPECT_EQ(kint64max, absl::IDivDuration(inf, any_dur, &rem));
+  EXPECT_EQ(inf, rem);
+
+  rem = absl::ZeroDuration();
+  EXPECT_EQ(0, absl::IDivDuration(any_dur, inf, &rem));
+  EXPECT_EQ(any_dur, rem);
+
+  rem = absl::ZeroDuration();
+  EXPECT_EQ(kint64max, absl::IDivDuration(-inf, -any_dur, &rem));
+  EXPECT_EQ(-inf, rem);
+
+  rem = absl::ZeroDuration();
+  EXPECT_EQ(0, absl::IDivDuration(-any_dur, -inf, &rem));
+  EXPECT_EQ(-any_dur, rem);
+
+  rem = absl::ZeroDuration();
+  EXPECT_EQ(kint64min, absl::IDivDuration(-inf, inf, &rem));
+  EXPECT_EQ(-inf, rem);
+
+  rem = absl::ZeroDuration();
+  EXPECT_EQ(kint64min, absl::IDivDuration(inf, -inf, &rem));
+  EXPECT_EQ(inf, rem);
+
+  rem = absl::ZeroDuration();
+  EXPECT_EQ(kint64min, absl::IDivDuration(-inf, any_dur, &rem));
+  EXPECT_EQ(-inf, rem);
+
+  rem = absl::ZeroDuration();
+  EXPECT_EQ(0, absl::IDivDuration(-any_dur, inf, &rem));
+  EXPECT_EQ(-any_dur, rem);
+
+  rem = absl::ZeroDuration();
+  EXPECT_EQ(kint64min, absl::IDivDuration(inf, -any_dur, &rem));
+  EXPECT_EQ(inf, rem);
+
+  rem = absl::ZeroDuration();
+  EXPECT_EQ(0, absl::IDivDuration(any_dur, -inf, &rem));
+  EXPECT_EQ(any_dur, rem);
+
+  // IDivDuration overflow/underflow
+  rem = any_dur;
+  EXPECT_EQ(kint64max,
+            absl::IDivDuration(sec_max, absl::Nanoseconds(1) / 4, &rem));
+  EXPECT_EQ(sec_max - absl::Nanoseconds(kint64max) / 4, rem);
+
+  rem = any_dur;
+  EXPECT_EQ(kint64max,
+            absl::IDivDuration(sec_max, absl::Milliseconds(1), &rem));
+  EXPECT_EQ(sec_max - absl::Milliseconds(kint64max), rem);
+
+  rem = any_dur;
+  EXPECT_EQ(kint64max,
+            absl::IDivDuration(-sec_max, -absl::Milliseconds(1), &rem));
+  EXPECT_EQ(-sec_max + absl::Milliseconds(kint64max), rem);
+
+  rem = any_dur;
+  EXPECT_EQ(kint64min,
+            absl::IDivDuration(-sec_max, absl::Milliseconds(1), &rem));
+  EXPECT_EQ(-sec_max - absl::Milliseconds(kint64min), rem);
+
+  rem = any_dur;
+  EXPECT_EQ(kint64min,
+            absl::IDivDuration(sec_max, -absl::Milliseconds(1), &rem));
+  EXPECT_EQ(sec_max + absl::Milliseconds(kint64min), rem);
+
+  //
+  // operator/(Duration, Duration) is a wrapper for IDivDuration().
+  //
+
+  // IEEE 754 says inf / inf should be nan, but int64_t doesn't have
+  // nan so we'll return kint64max/kint64min instead.
+  EXPECT_TRUE(std::isnan(dbl_inf / dbl_inf));
+  EXPECT_EQ(kint64max, inf / inf);
+  EXPECT_EQ(kint64max, -inf / -inf);
+  EXPECT_EQ(kint64min, -inf / inf);
+  EXPECT_EQ(kint64min, inf / -inf);
+
+  EXPECT_TRUE(std::isinf(dbl_inf / 2.0));
+  EXPECT_EQ(kint64max, inf / any_dur);
+  EXPECT_EQ(kint64max, -inf / -any_dur);
+  EXPECT_EQ(kint64min, -inf / any_dur);
+  EXPECT_EQ(kint64min, inf / -any_dur);
+
+  EXPECT_EQ(0.0, 2.0 / dbl_inf);
+  EXPECT_EQ(0, any_dur / inf);
+  EXPECT_EQ(0, any_dur / -inf);
+  EXPECT_EQ(0, -any_dur / inf);
+  EXPECT_EQ(0, -any_dur / -inf);
+  EXPECT_EQ(0, absl::ZeroDuration() / inf);
+
+  // Division of Duration by a Duration overflow/underflow
+  EXPECT_EQ(kint64max, sec_max / absl::Milliseconds(1));
+  EXPECT_EQ(kint64max, -sec_max / -absl::Milliseconds(1));
+  EXPECT_EQ(kint64min, -sec_max / absl::Milliseconds(1));
+  EXPECT_EQ(kint64min, sec_max / -absl::Milliseconds(1));
+}
+
+TEST(Duration, InfinityFDiv) {
+  const absl::Duration any_dur = absl::Seconds(1);
+  const absl::Duration inf = absl::InfiniteDuration();
+  const double dbl_inf = std::numeric_limits<double>::infinity();
+
+  EXPECT_EQ(dbl_inf, absl::FDivDuration(inf, inf));
+  EXPECT_EQ(dbl_inf, absl::FDivDuration(-inf, -inf));
+  EXPECT_EQ(dbl_inf, absl::FDivDuration(inf, any_dur));
+  EXPECT_EQ(0.0, absl::FDivDuration(any_dur, inf));
+  EXPECT_EQ(dbl_inf, absl::FDivDuration(-inf, -any_dur));
+  EXPECT_EQ(0.0, absl::FDivDuration(-any_dur, -inf));
+
+  EXPECT_EQ(-dbl_inf, absl::FDivDuration(-inf, inf));
+  EXPECT_EQ(-dbl_inf, absl::FDivDuration(inf, -inf));
+  EXPECT_EQ(-dbl_inf, absl::FDivDuration(-inf, any_dur));
+  EXPECT_EQ(0.0, absl::FDivDuration(-any_dur, inf));
+  EXPECT_EQ(-dbl_inf, absl::FDivDuration(inf, -any_dur));
+  EXPECT_EQ(0.0, absl::FDivDuration(any_dur, -inf));
+}
+
+TEST(Duration, DivisionByZero) {
+  const absl::Duration zero = absl::ZeroDuration();
+  const absl::Duration inf = absl::InfiniteDuration();
+  const absl::Duration any_dur = absl::Seconds(1);
+  const double dbl_inf = std::numeric_limits<double>::infinity();
+  const double dbl_denorm = std::numeric_limits<double>::denorm_min();
+
+  // Operator/(Duration, double)
+  EXPECT_EQ(inf, zero / 0.0);
+  EXPECT_EQ(-inf, zero / -0.0);
+  EXPECT_EQ(inf, any_dur / 0.0);
+  EXPECT_EQ(-inf, any_dur / -0.0);
+  EXPECT_EQ(-inf, -any_dur / 0.0);
+  EXPECT_EQ(inf, -any_dur / -0.0);
+
+  // Tests dividing by a number very close to, but not quite zero.
+  EXPECT_EQ(zero, zero / dbl_denorm);
+  EXPECT_EQ(zero, zero / -dbl_denorm);
+  EXPECT_EQ(inf, any_dur / dbl_denorm);
+  EXPECT_EQ(-inf, any_dur / -dbl_denorm);
+  EXPECT_EQ(-inf, -any_dur / dbl_denorm);
+  EXPECT_EQ(inf, -any_dur / -dbl_denorm);
+
+  // IDiv
+  absl::Duration rem = zero;
+  EXPECT_EQ(kint64max, absl::IDivDuration(zero, zero, &rem));
+  EXPECT_EQ(inf, rem);
+
+  rem = zero;
+  EXPECT_EQ(kint64max, absl::IDivDuration(any_dur, zero, &rem));
+  EXPECT_EQ(inf, rem);
+
+  rem = zero;
+  EXPECT_EQ(kint64min, absl::IDivDuration(-any_dur, zero, &rem));
+  EXPECT_EQ(-inf, rem);
+
+  // Operator/(Duration, Duration)
+  EXPECT_EQ(kint64max, zero / zero);
+  EXPECT_EQ(kint64max, any_dur / zero);
+  EXPECT_EQ(kint64min, -any_dur / zero);
+
+  // FDiv
+  EXPECT_EQ(dbl_inf, absl::FDivDuration(zero, zero));
+  EXPECT_EQ(dbl_inf, absl::FDivDuration(any_dur, zero));
+  EXPECT_EQ(-dbl_inf, absl::FDivDuration(-any_dur, zero));
+}
+
+TEST(Duration, NaN) {
+  // Note that IEEE 754 does not define the behavior of a nan's sign when it is
+  // copied, so the code below allows for either + or - InfiniteDuration.
+#define TEST_NAN_HANDLING(NAME, NAN)           \
+  do {                                         \
+    const auto inf = absl::InfiniteDuration(); \
+    auto x = NAME(NAN);                        \
+    EXPECT_TRUE(x == inf || x == -inf);        \
+    auto y = NAME(42);                         \
+    y *= NAN;                                  \
+    EXPECT_TRUE(y == inf || y == -inf);        \
+    auto z = NAME(42);                         \
+    z /= NAN;                                  \
+    EXPECT_TRUE(z == inf || z == -inf);        \
+  } while (0)
+
+  const double nan = std::numeric_limits<double>::quiet_NaN();
+  TEST_NAN_HANDLING(absl::Nanoseconds, nan);
+  TEST_NAN_HANDLING(absl::Microseconds, nan);
+  TEST_NAN_HANDLING(absl::Milliseconds, nan);
+  TEST_NAN_HANDLING(absl::Seconds, nan);
+  TEST_NAN_HANDLING(absl::Minutes, nan);
+  TEST_NAN_HANDLING(absl::Hours, nan);
+
+  TEST_NAN_HANDLING(absl::Nanoseconds, -nan);
+  TEST_NAN_HANDLING(absl::Microseconds, -nan);
+  TEST_NAN_HANDLING(absl::Milliseconds, -nan);
+  TEST_NAN_HANDLING(absl::Seconds, -nan);
+  TEST_NAN_HANDLING(absl::Minutes, -nan);
+  TEST_NAN_HANDLING(absl::Hours, -nan);
+
+#undef TEST_NAN_HANDLING
+}
+
+TEST(Duration, Range) {
+  const absl::Duration range = ApproxYears(100 * 1e9);
+  const absl::Duration range_future = range;
+  const absl::Duration range_past = -range;
+
+  EXPECT_LT(range_future, absl::InfiniteDuration());
+  EXPECT_GT(range_past, -absl::InfiniteDuration());
+
+  const absl::Duration full_range = range_future - range_past;
+  EXPECT_GT(full_range, absl::ZeroDuration());
+  EXPECT_LT(full_range, absl::InfiniteDuration());
+
+  const absl::Duration neg_full_range = range_past - range_future;
+  EXPECT_LT(neg_full_range, absl::ZeroDuration());
+  EXPECT_GT(neg_full_range, -absl::InfiniteDuration());
+
+  EXPECT_LT(neg_full_range, full_range);
+  EXPECT_EQ(neg_full_range, -full_range);
+}
+
+TEST(Duration, RelationalOperators) {
+#define TEST_REL_OPS(UNIT)               \
+  static_assert(UNIT(2) == UNIT(2), ""); \
+  static_assert(UNIT(1) != UNIT(2), ""); \
+  static_assert(UNIT(1) < UNIT(2), "");  \
+  static_assert(UNIT(3) > UNIT(2), "");  \
+  static_assert(UNIT(1) <= UNIT(2), ""); \
+  static_assert(UNIT(2) <= UNIT(2), ""); \
+  static_assert(UNIT(3) >= UNIT(2), ""); \
+  static_assert(UNIT(2) >= UNIT(2), "");
+
+  TEST_REL_OPS(absl::Nanoseconds);
+  TEST_REL_OPS(absl::Microseconds);
+  TEST_REL_OPS(absl::Milliseconds);
+  TEST_REL_OPS(absl::Seconds);
+  TEST_REL_OPS(absl::Minutes);
+  TEST_REL_OPS(absl::Hours);
+
+#undef TEST_REL_OPS
+}
+
+TEST(Duration, Addition) {
+#define TEST_ADD_OPS(UNIT)                  \
+  do {                                      \
+    EXPECT_EQ(UNIT(2), UNIT(1) + UNIT(1));  \
+    EXPECT_EQ(UNIT(1), UNIT(2) - UNIT(1));  \
+    EXPECT_EQ(UNIT(0), UNIT(2) - UNIT(2));  \
+    EXPECT_EQ(UNIT(-1), UNIT(1) - UNIT(2)); \
+    EXPECT_EQ(UNIT(-2), UNIT(0) - UNIT(2)); \
+    EXPECT_EQ(UNIT(-2), UNIT(1) - UNIT(3)); \
+    absl::Duration a = UNIT(1);             \
+    a += UNIT(1);                           \
+    EXPECT_EQ(UNIT(2), a);                  \
+    a -= UNIT(1);                           \
+    EXPECT_EQ(UNIT(1), a);                  \
+  } while (0)
+
+  TEST_ADD_OPS(absl::Nanoseconds);
+  TEST_ADD_OPS(absl::Microseconds);
+  TEST_ADD_OPS(absl::Milliseconds);
+  TEST_ADD_OPS(absl::Seconds);
+  TEST_ADD_OPS(absl::Minutes);
+  TEST_ADD_OPS(absl::Hours);
+
+#undef TEST_ADD_OPS
+
+  EXPECT_EQ(absl::Seconds(2), absl::Seconds(3) - 2 * absl::Milliseconds(500));
+  EXPECT_EQ(absl::Seconds(2) + absl::Milliseconds(500),
+            absl::Seconds(3) - absl::Milliseconds(500));
+
+  EXPECT_EQ(absl::Seconds(1) + absl::Milliseconds(998),
+            absl::Milliseconds(999) + absl::Milliseconds(999));
+
+  EXPECT_EQ(absl::Milliseconds(-1),
+            absl::Milliseconds(998) - absl::Milliseconds(999));
+
+  // Tests fractions of a nanoseconds. These are implementation details only.
+  EXPECT_GT(absl::Nanoseconds(1), absl::Nanoseconds(1) / 2);
+  EXPECT_EQ(absl::Nanoseconds(1),
+            absl::Nanoseconds(1) / 2 + absl::Nanoseconds(1) / 2);
+  EXPECT_GT(absl::Nanoseconds(1) / 4, absl::Nanoseconds(0));
+  EXPECT_EQ(absl::Nanoseconds(1) / 8, absl::Nanoseconds(0));
+
+  // Tests subtraction that will cause wrap around of the rep_lo_ bits.
+  absl::Duration d_7_5 = absl::Seconds(7) + absl::Milliseconds(500);
+  absl::Duration d_3_7 = absl::Seconds(3) + absl::Milliseconds(700);
+  absl::Duration ans_3_8 = absl::Seconds(3) + absl::Milliseconds(800);
+  EXPECT_EQ(ans_3_8, d_7_5 - d_3_7);
+
+  // Subtracting min_duration
+  absl::Duration min_dur = absl::Seconds(kint64min);
+  EXPECT_EQ(absl::Seconds(0), min_dur - min_dur);
+  EXPECT_EQ(absl::Seconds(kint64max), absl::Seconds(-1) - min_dur);
+}
+
+TEST(Duration, Negation) {
+  // By storing negations of various values in constexpr variables we
+  // verify that the initializers are constant expressions.
+  constexpr absl::Duration negated_zero_duration = -absl::ZeroDuration();
+  EXPECT_EQ(negated_zero_duration, absl::ZeroDuration());
+
+  constexpr absl::Duration negated_infinite_duration =
+      -absl::InfiniteDuration();
+  EXPECT_NE(negated_infinite_duration, absl::InfiniteDuration());
+  EXPECT_EQ(-negated_infinite_duration, absl::InfiniteDuration());
+
+  // The public APIs to check if a duration is infinite depend on using
+  // -InfiniteDuration(), but we're trying to test operator- here, so we
+  // need to use the lower-level internal query IsInfiniteDuration.
+  EXPECT_TRUE(
+      absl::time_internal::IsInfiniteDuration(negated_infinite_duration));
+
+  // The largest Duration is kint64max seconds and kTicksPerSecond - 1 ticks.
+  // Using the absl::time_internal::MakeDuration API is the cleanest way to
+  // construct that Duration.
+  constexpr absl::Duration max_duration = absl::time_internal::MakeDuration(
+      kint64max, absl::time_internal::kTicksPerSecond - 1);
+  constexpr absl::Duration negated_max_duration = -max_duration;
+  // The largest negatable value is one tick above the minimum representable;
+  // it's the negation of max_duration.
+  constexpr absl::Duration nearly_min_duration =
+      absl::time_internal::MakeDuration(kint64min, int64_t{1});
+  constexpr absl::Duration negated_nearly_min_duration = -nearly_min_duration;
+
+  EXPECT_EQ(negated_max_duration, nearly_min_duration);
+  EXPECT_EQ(negated_nearly_min_duration, max_duration);
+  EXPECT_EQ(-(-max_duration), max_duration);
+
+  constexpr absl::Duration min_duration =
+      absl::time_internal::MakeDuration(kint64min);
+  constexpr absl::Duration negated_min_duration = -min_duration;
+  EXPECT_EQ(negated_min_duration, absl::InfiniteDuration());
+}
+
+TEST(Duration, AbsoluteValue) {
+  EXPECT_EQ(absl::ZeroDuration(), AbsDuration(absl::ZeroDuration()));
+  EXPECT_EQ(absl::Seconds(1), AbsDuration(absl::Seconds(1)));
+  EXPECT_EQ(absl::Seconds(1), AbsDuration(absl::Seconds(-1)));
+
+  EXPECT_EQ(absl::InfiniteDuration(), AbsDuration(absl::InfiniteDuration()));
+  EXPECT_EQ(absl::InfiniteDuration(), AbsDuration(-absl::InfiniteDuration()));
+
+  absl::Duration max_dur =
+      absl::Seconds(kint64max) + (absl::Seconds(1) - absl::Nanoseconds(1) / 4);
+  EXPECT_EQ(max_dur, AbsDuration(max_dur));
+
+  absl::Duration min_dur = absl::Seconds(kint64min);
+  EXPECT_EQ(absl::InfiniteDuration(), AbsDuration(min_dur));
+  EXPECT_EQ(max_dur, AbsDuration(min_dur + absl::Nanoseconds(1) / 4));
+}
+
+TEST(Duration, Multiplication) {
+#define TEST_MUL_OPS(UNIT)                                    \
+  do {                                                        \
+    EXPECT_EQ(UNIT(5), UNIT(2) * 2.5);                        \
+    EXPECT_EQ(UNIT(2), UNIT(5) / 2.5);                        \
+    EXPECT_EQ(UNIT(-5), UNIT(-2) * 2.5);                      \
+    EXPECT_EQ(UNIT(-5), -UNIT(2) * 2.5);                      \
+    EXPECT_EQ(UNIT(-5), UNIT(2) * -2.5);                      \
+    EXPECT_EQ(UNIT(-2), UNIT(-5) / 2.5);                      \
+    EXPECT_EQ(UNIT(-2), -UNIT(5) / 2.5);                      \
+    EXPECT_EQ(UNIT(-2), UNIT(5) / -2.5);                      \
+    EXPECT_EQ(UNIT(2), UNIT(11) % UNIT(3));                   \
+    absl::Duration a = UNIT(2);                               \
+    a *= 2.5;                                                 \
+    EXPECT_EQ(UNIT(5), a);                                    \
+    a /= 2.5;                                                 \
+    EXPECT_EQ(UNIT(2), a);                                    \
+    a %= UNIT(1);                                             \
+    EXPECT_EQ(UNIT(0), a);                                    \
+    absl::Duration big = UNIT(1000000000);                    \
+    big *= 3;                                                 \
+    big /= 3;                                                 \
+    EXPECT_EQ(UNIT(1000000000), big);                         \
+    EXPECT_EQ(-UNIT(2), -UNIT(2));                            \
+    EXPECT_EQ(-UNIT(2), UNIT(2) * -1);                        \
+    EXPECT_EQ(-UNIT(2), -1 * UNIT(2));                        \
+    EXPECT_EQ(-UNIT(-2), UNIT(2));                            \
+    EXPECT_EQ(2, UNIT(2) / UNIT(1));                          \
+    absl::Duration rem;                                       \
+    EXPECT_EQ(2, absl::IDivDuration(UNIT(2), UNIT(1), &rem)); \
+    EXPECT_EQ(2.0, absl::FDivDuration(UNIT(2), UNIT(1)));     \
+  } while (0)
+
+  TEST_MUL_OPS(absl::Nanoseconds);
+  TEST_MUL_OPS(absl::Microseconds);
+  TEST_MUL_OPS(absl::Milliseconds);
+  TEST_MUL_OPS(absl::Seconds);
+  TEST_MUL_OPS(absl::Minutes);
+  TEST_MUL_OPS(absl::Hours);
+
+#undef TEST_MUL_OPS
+
+  // Ensures that multiplication and division by 1 with a maxed-out durations
+  // doesn't lose precision.
+  absl::Duration max_dur =
+      absl::Seconds(kint64max) + (absl::Seconds(1) - absl::Nanoseconds(1) / 4);
+  absl::Duration min_dur = absl::Seconds(kint64min);
+  EXPECT_EQ(max_dur, max_dur * 1);
+  EXPECT_EQ(max_dur, max_dur / 1);
+  EXPECT_EQ(min_dur, min_dur * 1);
+  EXPECT_EQ(min_dur, min_dur / 1);
+
+  // Tests division on a Duration with a large number of significant digits.
+  // Tests when the digits span hi and lo as well as only in hi.
+  absl::Duration sigfigs = absl::Seconds(2000000000) + absl::Nanoseconds(3);
+  EXPECT_EQ(absl::Seconds(666666666) + absl::Nanoseconds(666666667) +
+                absl::Nanoseconds(1) / 2,
+            sigfigs / 3);
+  sigfigs = absl::Seconds(int64_t{7000000000});
+  EXPECT_EQ(absl::Seconds(2333333333) + absl::Nanoseconds(333333333) +
+                absl::Nanoseconds(1) / 4,
+            sigfigs / 3);
+
+  EXPECT_EQ(absl::Seconds(7) + absl::Milliseconds(500), absl::Seconds(3) * 2.5);
+  EXPECT_EQ(absl::Seconds(8) * -1 + absl::Milliseconds(300),
+            (absl::Seconds(2) + absl::Milliseconds(200)) * -3.5);
+  EXPECT_EQ(-absl::Seconds(8) + absl::Milliseconds(300),
+            (absl::Seconds(2) + absl::Milliseconds(200)) * -3.5);
+  EXPECT_EQ(absl::Seconds(1) + absl::Milliseconds(875),
+            (absl::Seconds(7) + absl::Milliseconds(500)) / 4);
+  EXPECT_EQ(absl::Seconds(30),
+            (absl::Seconds(7) + absl::Milliseconds(500)) / 0.25);
+  EXPECT_EQ(absl::Seconds(3),
+            (absl::Seconds(7) + absl::Milliseconds(500)) / 2.5);
+
+  // Tests division remainder.
+  EXPECT_EQ(absl::Nanoseconds(0), absl::Nanoseconds(7) % absl::Nanoseconds(1));
+  EXPECT_EQ(absl::Nanoseconds(0), absl::Nanoseconds(0) % absl::Nanoseconds(10));
+  EXPECT_EQ(absl::Nanoseconds(2), absl::Nanoseconds(7) % absl::Nanoseconds(5));
+  EXPECT_EQ(absl::Nanoseconds(2), absl::Nanoseconds(2) % absl::Nanoseconds(5));
+
+  EXPECT_EQ(absl::Nanoseconds(1), absl::Nanoseconds(10) % absl::Nanoseconds(3));
+  EXPECT_EQ(absl::Nanoseconds(1),
+            absl::Nanoseconds(10) % absl::Nanoseconds(-3));
+  EXPECT_EQ(absl::Nanoseconds(-1),
+            absl::Nanoseconds(-10) % absl::Nanoseconds(3));
+  EXPECT_EQ(absl::Nanoseconds(-1),
+            absl::Nanoseconds(-10) % absl::Nanoseconds(-3));
+
+  EXPECT_EQ(absl::Milliseconds(100),
+            absl::Seconds(1) % absl::Milliseconds(300));
+  EXPECT_EQ(
+      absl::Milliseconds(300),
+      (absl::Seconds(3) + absl::Milliseconds(800)) % absl::Milliseconds(500));
+
+  EXPECT_EQ(absl::Nanoseconds(1), absl::Nanoseconds(1) % absl::Seconds(1));
+  EXPECT_EQ(absl::Nanoseconds(-1), absl::Nanoseconds(-1) % absl::Seconds(1));
+  EXPECT_EQ(0, absl::Nanoseconds(-1) / absl::Seconds(1));  // Actual -1e-9
+
+  // Tests identity a = (a/b)*b + a%b
+#define TEST_MOD_IDENTITY(a, b) \
+  EXPECT_EQ((a), ((a) / (b))*(b) + ((a)%(b)))
+
+  TEST_MOD_IDENTITY(absl::Seconds(0), absl::Seconds(2));
+  TEST_MOD_IDENTITY(absl::Seconds(1), absl::Seconds(1));
+  TEST_MOD_IDENTITY(absl::Seconds(1), absl::Seconds(2));
+  TEST_MOD_IDENTITY(absl::Seconds(2), absl::Seconds(1));
+
+  TEST_MOD_IDENTITY(absl::Seconds(-2), absl::Seconds(1));
+  TEST_MOD_IDENTITY(absl::Seconds(2), absl::Seconds(-1));
+  TEST_MOD_IDENTITY(absl::Seconds(-2), absl::Seconds(-1));
+
+  TEST_MOD_IDENTITY(absl::Nanoseconds(0), absl::Nanoseconds(2));
+  TEST_MOD_IDENTITY(absl::Nanoseconds(1), absl::Nanoseconds(1));
+  TEST_MOD_IDENTITY(absl::Nanoseconds(1), absl::Nanoseconds(2));
+  TEST_MOD_IDENTITY(absl::Nanoseconds(2), absl::Nanoseconds(1));
+
+  TEST_MOD_IDENTITY(absl::Nanoseconds(-2), absl::Nanoseconds(1));
+  TEST_MOD_IDENTITY(absl::Nanoseconds(2), absl::Nanoseconds(-1));
+  TEST_MOD_IDENTITY(absl::Nanoseconds(-2), absl::Nanoseconds(-1));
+
+  // Mixed seconds + subseconds
+  absl::Duration mixed_a = absl::Seconds(1) + absl::Nanoseconds(2);
+  absl::Duration mixed_b = absl::Seconds(1) + absl::Nanoseconds(3);
+
+  TEST_MOD_IDENTITY(absl::Seconds(0), mixed_a);
+  TEST_MOD_IDENTITY(mixed_a, mixed_a);
+  TEST_MOD_IDENTITY(mixed_a, mixed_b);
+  TEST_MOD_IDENTITY(mixed_b, mixed_a);
+
+  TEST_MOD_IDENTITY(-mixed_a, mixed_b);
+  TEST_MOD_IDENTITY(mixed_a, -mixed_b);
+  TEST_MOD_IDENTITY(-mixed_a, -mixed_b);
+
+#undef TEST_MOD_IDENTITY
+}
+
+TEST(Duration, Truncation) {
+  const absl::Duration d = absl::Nanoseconds(1234567890);
+  const absl::Duration inf = absl::InfiniteDuration();
+  for (int unit_sign : {1, -1}) {  // sign shouldn't matter
+    EXPECT_EQ(absl::Nanoseconds(1234567890),
+              Trunc(d, unit_sign * absl::Nanoseconds(1)));
+    EXPECT_EQ(absl::Microseconds(1234567),
+              Trunc(d, unit_sign * absl::Microseconds(1)));
+    EXPECT_EQ(absl::Milliseconds(1234),
+              Trunc(d, unit_sign * absl::Milliseconds(1)));
+    EXPECT_EQ(absl::Seconds(1), Trunc(d, unit_sign * absl::Seconds(1)));
+    EXPECT_EQ(inf, Trunc(inf, unit_sign * absl::Seconds(1)));
+
+    EXPECT_EQ(absl::Nanoseconds(-1234567890),
+              Trunc(-d, unit_sign * absl::Nanoseconds(1)));
+    EXPECT_EQ(absl::Microseconds(-1234567),
+              Trunc(-d, unit_sign * absl::Microseconds(1)));
+    EXPECT_EQ(absl::Milliseconds(-1234),
+              Trunc(-d, unit_sign * absl::Milliseconds(1)));
+    EXPECT_EQ(absl::Seconds(-1), Trunc(-d, unit_sign * absl::Seconds(1)));
+    EXPECT_EQ(-inf, Trunc(-inf, unit_sign * absl::Seconds(1)));
+  }
+}
+
+TEST(Duration, Flooring) {
+  const absl::Duration d = absl::Nanoseconds(1234567890);
+  const absl::Duration inf = absl::InfiniteDuration();
+  for (int unit_sign : {1, -1}) {  // sign shouldn't matter
+    EXPECT_EQ(absl::Nanoseconds(1234567890),
+              absl::Floor(d, unit_sign * absl::Nanoseconds(1)));
+    EXPECT_EQ(absl::Microseconds(1234567),
+              absl::Floor(d, unit_sign * absl::Microseconds(1)));
+    EXPECT_EQ(absl::Milliseconds(1234),
+              absl::Floor(d, unit_sign * absl::Milliseconds(1)));
+    EXPECT_EQ(absl::Seconds(1), absl::Floor(d, unit_sign * absl::Seconds(1)));
+    EXPECT_EQ(inf, absl::Floor(inf, unit_sign * absl::Seconds(1)));
+
+    EXPECT_EQ(absl::Nanoseconds(-1234567890),
+              absl::Floor(-d, unit_sign * absl::Nanoseconds(1)));
+    EXPECT_EQ(absl::Microseconds(-1234568),
+              absl::Floor(-d, unit_sign * absl::Microseconds(1)));
+    EXPECT_EQ(absl::Milliseconds(-1235),
+              absl::Floor(-d, unit_sign * absl::Milliseconds(1)));
+    EXPECT_EQ(absl::Seconds(-2), absl::Floor(-d, unit_sign * absl::Seconds(1)));
+    EXPECT_EQ(-inf, absl::Floor(-inf, unit_sign * absl::Seconds(1)));
+  }
+}
+
+TEST(Duration, Ceiling) {
+  const absl::Duration d = absl::Nanoseconds(1234567890);
+  const absl::Duration inf = absl::InfiniteDuration();
+  for (int unit_sign : {1, -1}) {  // // sign shouldn't matter
+    EXPECT_EQ(absl::Nanoseconds(1234567890),
+              absl::Ceil(d, unit_sign * absl::Nanoseconds(1)));
+    EXPECT_EQ(absl::Microseconds(1234568),
+              absl::Ceil(d, unit_sign * absl::Microseconds(1)));
+    EXPECT_EQ(absl::Milliseconds(1235),
+              absl::Ceil(d, unit_sign * absl::Milliseconds(1)));
+    EXPECT_EQ(absl::Seconds(2), absl::Ceil(d, unit_sign * absl::Seconds(1)));
+    EXPECT_EQ(inf, absl::Ceil(inf, unit_sign * absl::Seconds(1)));
+
+    EXPECT_EQ(absl::Nanoseconds(-1234567890),
+              absl::Ceil(-d, unit_sign * absl::Nanoseconds(1)));
+    EXPECT_EQ(absl::Microseconds(-1234567),
+              absl::Ceil(-d, unit_sign * absl::Microseconds(1)));
+    EXPECT_EQ(absl::Milliseconds(-1234),
+              absl::Ceil(-d, unit_sign * absl::Milliseconds(1)));
+    EXPECT_EQ(absl::Seconds(-1), absl::Ceil(-d, unit_sign * absl::Seconds(1)));
+    EXPECT_EQ(-inf, absl::Ceil(-inf, unit_sign * absl::Seconds(1)));
+  }
+}
+
+TEST(Duration, RoundTripUnits) {
+  const int kRange = 100000;
+
+#define ROUND_TRIP_UNIT(U, LOW, HIGH)          \
+  do {                                         \
+    for (int64_t i = LOW; i < HIGH; ++i) {     \
+      absl::Duration d = absl::U(i);           \
+      if (d == absl::InfiniteDuration())       \
+        EXPECT_EQ(kint64max, d / absl::U(1));  \
+      else if (d == -absl::InfiniteDuration()) \
+        EXPECT_EQ(kint64min, d / absl::U(1));  \
+      else                                     \
+        EXPECT_EQ(i, absl::U(i) / absl::U(1)); \
+    }                                          \
+  } while (0)
+
+  ROUND_TRIP_UNIT(Nanoseconds, kint64min, kint64min + kRange);
+  ROUND_TRIP_UNIT(Nanoseconds, -kRange, kRange);
+  ROUND_TRIP_UNIT(Nanoseconds, kint64max - kRange, kint64max);
+
+  ROUND_TRIP_UNIT(Microseconds, kint64min, kint64min + kRange);
+  ROUND_TRIP_UNIT(Microseconds, -kRange, kRange);
+  ROUND_TRIP_UNIT(Microseconds, kint64max - kRange, kint64max);
+
+  ROUND_TRIP_UNIT(Milliseconds, kint64min, kint64min + kRange);
+  ROUND_TRIP_UNIT(Milliseconds, -kRange, kRange);
+  ROUND_TRIP_UNIT(Milliseconds, kint64max - kRange, kint64max);
+
+  ROUND_TRIP_UNIT(Seconds, kint64min, kint64min + kRange);
+  ROUND_TRIP_UNIT(Seconds, -kRange, kRange);
+  ROUND_TRIP_UNIT(Seconds, kint64max - kRange, kint64max);
+
+  ROUND_TRIP_UNIT(Minutes, kint64min / 60, kint64min / 60 + kRange);
+  ROUND_TRIP_UNIT(Minutes, -kRange, kRange);
+  ROUND_TRIP_UNIT(Minutes, kint64max / 60 - kRange, kint64max / 60);
+
+  ROUND_TRIP_UNIT(Hours, kint64min / 3600, kint64min / 3600 + kRange);
+  ROUND_TRIP_UNIT(Hours, -kRange, kRange);
+  ROUND_TRIP_UNIT(Hours, kint64max / 3600 - kRange, kint64max / 3600);
+
+#undef ROUND_TRIP_UNIT
+}
+
+TEST(Duration, TruncConversions) {
+  // Tests ToTimespec()/DurationFromTimespec()
+  const struct {
+    absl::Duration d;
+    timespec ts;
+  } to_ts[] = {
+      {absl::Seconds(1) + absl::Nanoseconds(1), {1, 1}},
+      {absl::Seconds(1) + absl::Nanoseconds(1) / 2, {1, 0}},
+      {absl::Seconds(1) + absl::Nanoseconds(0), {1, 0}},
+      {absl::Seconds(0) + absl::Nanoseconds(0), {0, 0}},
+      {absl::Seconds(0) - absl::Nanoseconds(1) / 2, {0, 0}},
+      {absl::Seconds(0) - absl::Nanoseconds(1), {-1, 999999999}},
+      {absl::Seconds(-1) + absl::Nanoseconds(1), {-1, 1}},
+      {absl::Seconds(-1) + absl::Nanoseconds(1) / 2, {-1, 1}},
+      {absl::Seconds(-1) + absl::Nanoseconds(0), {-1, 0}},
+      {absl::Seconds(-1) - absl::Nanoseconds(1) / 2, {-1, 0}},
+  };
+  for (const auto& test : to_ts) {
+    EXPECT_THAT(absl::ToTimespec(test.d), TimespecMatcher(test.ts));
+  }
+  const struct {
+    timespec ts;
+    absl::Duration d;
+  } from_ts[] = {
+      {{1, 1}, absl::Seconds(1) + absl::Nanoseconds(1)},
+      {{1, 0}, absl::Seconds(1) + absl::Nanoseconds(0)},
+      {{0, 0}, absl::Seconds(0) + absl::Nanoseconds(0)},
+      {{0, -1}, absl::Seconds(0) - absl::Nanoseconds(1)},
+      {{-1, 999999999}, absl::Seconds(0) - absl::Nanoseconds(1)},
+      {{-1, 1}, absl::Seconds(-1) + absl::Nanoseconds(1)},
+      {{-1, 0}, absl::Seconds(-1) + absl::Nanoseconds(0)},
+      {{-1, -1}, absl::Seconds(-1) - absl::Nanoseconds(1)},
+      {{-2, 999999999}, absl::Seconds(-1) - absl::Nanoseconds(1)},
+  };
+  for (const auto& test : from_ts) {
+    EXPECT_EQ(test.d, absl::DurationFromTimespec(test.ts));
+  }
+
+  // Tests ToTimeval()/DurationFromTimeval() (same as timespec above)
+  const struct {
+    absl::Duration d;
+    timeval tv;
+  } to_tv[] = {
+      {absl::Seconds(1) + absl::Microseconds(1), {1, 1}},
+      {absl::Seconds(1) + absl::Microseconds(1) / 2, {1, 0}},
+      {absl::Seconds(1) + absl::Microseconds(0), {1, 0}},
+      {absl::Seconds(0) + absl::Microseconds(0), {0, 0}},
+      {absl::Seconds(0) - absl::Microseconds(1) / 2, {0, 0}},
+      {absl::Seconds(0) - absl::Microseconds(1), {-1, 999999}},
+      {absl::Seconds(-1) + absl::Microseconds(1), {-1, 1}},
+      {absl::Seconds(-1) + absl::Microseconds(1) / 2, {-1, 1}},
+      {absl::Seconds(-1) + absl::Microseconds(0), {-1, 0}},
+      {absl::Seconds(-1) - absl::Microseconds(1) / 2, {-1, 0}},
+  };
+  for (const auto& test : to_tv) {
+    EXPECT_THAT(absl::ToTimeval(test.d), TimevalMatcher(test.tv));
+  }
+  const struct {
+    timeval tv;
+    absl::Duration d;
+  } from_tv[] = {
+      {{1, 1}, absl::Seconds(1) + absl::Microseconds(1)},
+      {{1, 0}, absl::Seconds(1) + absl::Microseconds(0)},
+      {{0, 0}, absl::Seconds(0) + absl::Microseconds(0)},
+      {{0, -1}, absl::Seconds(0) - absl::Microseconds(1)},
+      {{-1, 999999}, absl::Seconds(0) - absl::Microseconds(1)},
+      {{-1, 1}, absl::Seconds(-1) + absl::Microseconds(1)},
+      {{-1, 0}, absl::Seconds(-1) + absl::Microseconds(0)},
+      {{-1, -1}, absl::Seconds(-1) - absl::Microseconds(1)},
+      {{-2, 999999}, absl::Seconds(-1) - absl::Microseconds(1)},
+  };
+  for (const auto& test : from_tv) {
+    EXPECT_EQ(test.d, absl::DurationFromTimeval(test.tv));
+  }
+}
+
+TEST(Duration, SmallConversions) {
+  // Special tests for conversions of small durations.
+
+  EXPECT_EQ(absl::ZeroDuration(), absl::Seconds(0));
+  // TODO(bww): Is the next one OK?
+  EXPECT_EQ(absl::ZeroDuration(), absl::Seconds(0.124999999e-9));
+  EXPECT_EQ(absl::Nanoseconds(1) / 4, absl::Seconds(0.125e-9));
+  EXPECT_EQ(absl::Nanoseconds(1) / 4, absl::Seconds(0.250e-9));
+  EXPECT_EQ(absl::Nanoseconds(1) / 2, absl::Seconds(0.375e-9));
+  EXPECT_EQ(absl::Nanoseconds(1) / 2, absl::Seconds(0.500e-9));
+  EXPECT_EQ(absl::Nanoseconds(3) / 4, absl::Seconds(0.625e-9));
+  EXPECT_EQ(absl::Nanoseconds(3) / 4, absl::Seconds(0.750e-9));
+  EXPECT_EQ(absl::Nanoseconds(1), absl::Seconds(0.875e-9));
+  EXPECT_EQ(absl::Nanoseconds(1), absl::Seconds(1.000e-9));
+
+  EXPECT_EQ(absl::ZeroDuration(), absl::Seconds(-0.124999999e-9));
+  EXPECT_EQ(-absl::Nanoseconds(1) / 4, absl::Seconds(-0.125e-9));
+  EXPECT_EQ(-absl::Nanoseconds(1) / 4, absl::Seconds(-0.250e-9));
+  EXPECT_EQ(-absl::Nanoseconds(1) / 2, absl::Seconds(-0.375e-9));
+  EXPECT_EQ(-absl::Nanoseconds(1) / 2, absl::Seconds(-0.500e-9));
+  EXPECT_EQ(-absl::Nanoseconds(3) / 4, absl::Seconds(-0.625e-9));
+  EXPECT_EQ(-absl::Nanoseconds(3) / 4, absl::Seconds(-0.750e-9));
+  EXPECT_EQ(-absl::Nanoseconds(1), absl::Seconds(-0.875e-9));
+  EXPECT_EQ(-absl::Nanoseconds(1), absl::Seconds(-1.000e-9));
+
+  timespec ts;
+  ts.tv_sec = 0;
+  ts.tv_nsec = 0;
+  EXPECT_THAT(ToTimespec(absl::Nanoseconds(0)), TimespecMatcher(ts));
+  // TODO(bww): Are the next three OK?
+  EXPECT_THAT(ToTimespec(absl::Nanoseconds(1) / 4), TimespecMatcher(ts));
+  EXPECT_THAT(ToTimespec(absl::Nanoseconds(2) / 4), TimespecMatcher(ts));
+  EXPECT_THAT(ToTimespec(absl::Nanoseconds(3) / 4), TimespecMatcher(ts));
+  ts.tv_nsec = 1;
+  EXPECT_THAT(ToTimespec(absl::Nanoseconds(4) / 4), TimespecMatcher(ts));
+  EXPECT_THAT(ToTimespec(absl::Nanoseconds(5) / 4), TimespecMatcher(ts));
+  EXPECT_THAT(ToTimespec(absl::Nanoseconds(6) / 4), TimespecMatcher(ts));
+  EXPECT_THAT(ToTimespec(absl::Nanoseconds(7) / 4), TimespecMatcher(ts));
+  ts.tv_nsec = 2;
+  EXPECT_THAT(ToTimespec(absl::Nanoseconds(8) / 4), TimespecMatcher(ts));
+
+  timeval tv;
+  tv.tv_sec = 0;
+  tv.tv_usec = 0;
+  EXPECT_THAT(ToTimeval(absl::Nanoseconds(0)), TimevalMatcher(tv));
+  // TODO(bww): Is the next one OK?
+  EXPECT_THAT(ToTimeval(absl::Nanoseconds(999)), TimevalMatcher(tv));
+  tv.tv_usec = 1;
+  EXPECT_THAT(ToTimeval(absl::Nanoseconds(1000)), TimevalMatcher(tv));
+  EXPECT_THAT(ToTimeval(absl::Nanoseconds(1999)), TimevalMatcher(tv));
+  tv.tv_usec = 2;
+  EXPECT_THAT(ToTimeval(absl::Nanoseconds(2000)), TimevalMatcher(tv));
+}
+
+void VerifySameAsMul(double time_as_seconds, int* const misses) {
+  auto direct_seconds = absl::Seconds(time_as_seconds);
+  auto mul_by_one_second = time_as_seconds * absl::Seconds(1);
+  if (direct_seconds != mul_by_one_second) {
+    if (*misses > 10) return;
+    ASSERT_LE(++(*misses), 10) << "Too many errors, not reporting more.";
+    EXPECT_EQ(direct_seconds, mul_by_one_second)
+        << "given double time_as_seconds = " << std::setprecision(17)
+        << time_as_seconds;
+  }
+}
+
+// For a variety of interesting durations, we find the exact point
+// where one double converts to that duration, and the very next double
+// converts to the next duration.  For both of those points, verify that
+// Seconds(point) returns the same duration as point * Seconds(1.0)
+TEST(Duration, ToDoubleSecondsCheckEdgeCases) {
+  constexpr uint32_t kTicksPerSecond = absl::time_internal::kTicksPerSecond;
+  constexpr auto duration_tick = absl::time_internal::MakeDuration(0, 1u);
+  int misses = 0;
+  for (int64_t seconds = 0; seconds < 99; ++seconds) {
+    uint32_t tick_vals[] = {0, +999, +999999, +999999999, kTicksPerSecond - 1,
+                            0, 1000, 1000000, 1000000000, kTicksPerSecond,
+                            1, 1001, 1000001, 1000000001, kTicksPerSecond + 1,
+                            2, 1002, 1000002, 1000000002, kTicksPerSecond + 2,
+                            3, 1003, 1000003, 1000000003, kTicksPerSecond + 3,
+                            4, 1004, 1000004, 1000000004, kTicksPerSecond + 4,
+                            5, 6,    7,       8,          9};
+    for (uint32_t ticks : tick_vals) {
+      absl::Duration s_plus_t = absl::Seconds(seconds) + ticks * duration_tick;
+      for (absl::Duration d : {s_plus_t, -s_plus_t}) {
+        absl::Duration after_d = d + duration_tick;
+        EXPECT_NE(d, after_d);
+        EXPECT_EQ(after_d - d, duration_tick);
+
+        double low_edge = ToDoubleSeconds(d);
+        EXPECT_EQ(d, absl::Seconds(low_edge));
+
+        double high_edge = ToDoubleSeconds(after_d);
+        EXPECT_EQ(after_d, absl::Seconds(high_edge));
+
+        for (;;) {
+          double midpoint = low_edge + (high_edge - low_edge) / 2;
+          if (midpoint == low_edge || midpoint == high_edge) break;
+          absl::Duration mid_duration = absl::Seconds(midpoint);
+          if (mid_duration == d) {
+            low_edge = midpoint;
+          } else {
+            EXPECT_EQ(mid_duration, after_d);
+            high_edge = midpoint;
+          }
+        }
+        // Now low_edge is the highest double that converts to Duration d,
+        // and high_edge is the lowest double that converts to Duration after_d.
+        VerifySameAsMul(low_edge, &misses);
+        VerifySameAsMul(high_edge, &misses);
+      }
+    }
+  }
+}
+
+TEST(Duration, ToDoubleSecondsCheckRandom) {
+  std::random_device rd;
+  std::seed_seq seed({rd(), rd(), rd(), rd(), rd(), rd(), rd(), rd()});
+  std::mt19937_64 gen(seed);
+  // We want doubles distributed from 1/8ns up to 2^63, where
+  // as many values are tested from 1ns to 2ns as from 1sec to 2sec,
+  // so even distribute along a log-scale of those values, and
+  // exponentiate before using them.  (9.223377e+18 is just slightly
+  // out of bounds for absl::Duration.)
+  std::uniform_real_distribution<double> uniform(std::log(0.125e-9),
+                                                 std::log(9.223377e+18));
+  int misses = 0;
+  for (int i = 0; i < 1000000; ++i) {
+    double d = std::exp(uniform(gen));
+    VerifySameAsMul(d, &misses);
+    VerifySameAsMul(-d, &misses);
+  }
+}
+
+TEST(Duration, ConversionSaturation) {
+  absl::Duration d;
+
+  const auto max_timeval_sec =
+      std::numeric_limits<decltype(timeval::tv_sec)>::max();
+  const auto min_timeval_sec =
+      std::numeric_limits<decltype(timeval::tv_sec)>::min();
+  timeval tv;
+  tv.tv_sec = max_timeval_sec;
+  tv.tv_usec = 999998;
+  d = absl::DurationFromTimeval(tv);
+  tv = ToTimeval(d);
+  EXPECT_EQ(max_timeval_sec, tv.tv_sec);
+  EXPECT_EQ(999998, tv.tv_usec);
+  d += absl::Microseconds(1);
+  tv = ToTimeval(d);
+  EXPECT_EQ(max_timeval_sec, tv.tv_sec);
+  EXPECT_EQ(999999, tv.tv_usec);
+  d += absl::Microseconds(1);  // no effect
+  tv = ToTimeval(d);
+  EXPECT_EQ(max_timeval_sec, tv.tv_sec);
+  EXPECT_EQ(999999, tv.tv_usec);
+
+  tv.tv_sec = min_timeval_sec;
+  tv.tv_usec = 1;
+  d = absl::DurationFromTimeval(tv);
+  tv = ToTimeval(d);
+  EXPECT_EQ(min_timeval_sec, tv.tv_sec);
+  EXPECT_EQ(1, tv.tv_usec);
+  d -= absl::Microseconds(1);
+  tv = ToTimeval(d);
+  EXPECT_EQ(min_timeval_sec, tv.tv_sec);
+  EXPECT_EQ(0, tv.tv_usec);
+  d -= absl::Microseconds(1);  // no effect
+  tv = ToTimeval(d);
+  EXPECT_EQ(min_timeval_sec, tv.tv_sec);
+  EXPECT_EQ(0, tv.tv_usec);
+
+  const auto max_timespec_sec =
+      std::numeric_limits<decltype(timespec::tv_sec)>::max();
+  const auto min_timespec_sec =
+      std::numeric_limits<decltype(timespec::tv_sec)>::min();
+  timespec ts;
+  ts.tv_sec = max_timespec_sec;
+  ts.tv_nsec = 999999998;
+  d = absl::DurationFromTimespec(ts);
+  ts = absl::ToTimespec(d);
+  EXPECT_EQ(max_timespec_sec, ts.tv_sec);
+  EXPECT_EQ(999999998, ts.tv_nsec);
+  d += absl::Nanoseconds(1);
+  ts = absl::ToTimespec(d);
+  EXPECT_EQ(max_timespec_sec, ts.tv_sec);
+  EXPECT_EQ(999999999, ts.tv_nsec);
+  d += absl::Nanoseconds(1);  // no effect
+  ts = absl::ToTimespec(d);
+  EXPECT_EQ(max_timespec_sec, ts.tv_sec);
+  EXPECT_EQ(999999999, ts.tv_nsec);
+
+  ts.tv_sec = min_timespec_sec;
+  ts.tv_nsec = 1;
+  d = absl::DurationFromTimespec(ts);
+  ts = absl::ToTimespec(d);
+  EXPECT_EQ(min_timespec_sec, ts.tv_sec);
+  EXPECT_EQ(1, ts.tv_nsec);
+  d -= absl::Nanoseconds(1);
+  ts = absl::ToTimespec(d);
+  EXPECT_EQ(min_timespec_sec, ts.tv_sec);
+  EXPECT_EQ(0, ts.tv_nsec);
+  d -= absl::Nanoseconds(1);  // no effect
+  ts = absl::ToTimespec(d);
+  EXPECT_EQ(min_timespec_sec, ts.tv_sec);
+  EXPECT_EQ(0, ts.tv_nsec);
+}
+
+TEST(Duration, FormatDuration) {
+  // Example from Go's docs.
+  EXPECT_EQ("72h3m0.5s",
+            absl::FormatDuration(absl::Hours(72) + absl::Minutes(3) +
+                                 absl::Milliseconds(500)));
+  // Go's largest time: 2540400h10m10.000000000s
+  EXPECT_EQ("2540400h10m10s",
+            absl::FormatDuration(absl::Hours(2540400) + absl::Minutes(10) +
+                                 absl::Seconds(10)));
+
+  EXPECT_EQ("0", absl::FormatDuration(absl::ZeroDuration()));
+  EXPECT_EQ("0", absl::FormatDuration(absl::Seconds(0)));
+  EXPECT_EQ("0", absl::FormatDuration(absl::Nanoseconds(0)));
+
+  EXPECT_EQ("1ns", absl::FormatDuration(absl::Nanoseconds(1)));
+  EXPECT_EQ("1us", absl::FormatDuration(absl::Microseconds(1)));
+  EXPECT_EQ("1ms", absl::FormatDuration(absl::Milliseconds(1)));
+  EXPECT_EQ("1s", absl::FormatDuration(absl::Seconds(1)));
+  EXPECT_EQ("1m", absl::FormatDuration(absl::Minutes(1)));
+  EXPECT_EQ("1h", absl::FormatDuration(absl::Hours(1)));
+
+  EXPECT_EQ("1h1m", absl::FormatDuration(absl::Hours(1) + absl::Minutes(1)));
+  EXPECT_EQ("1h1s", absl::FormatDuration(absl::Hours(1) + absl::Seconds(1)));
+  EXPECT_EQ("1m1s", absl::FormatDuration(absl::Minutes(1) + absl::Seconds(1)));
+
+  EXPECT_EQ("1h0.25s",
+            absl::FormatDuration(absl::Hours(1) + absl::Milliseconds(250)));
+  EXPECT_EQ("1m0.25s",
+            absl::FormatDuration(absl::Minutes(1) + absl::Milliseconds(250)));
+  EXPECT_EQ("1h1m0.25s",
+            absl::FormatDuration(absl::Hours(1) + absl::Minutes(1) +
+                                 absl::Milliseconds(250)));
+  EXPECT_EQ("1h0.0005s",
+            absl::FormatDuration(absl::Hours(1) + absl::Microseconds(500)));
+  EXPECT_EQ("1h0.0000005s",
+            absl::FormatDuration(absl::Hours(1) + absl::Nanoseconds(500)));
+
+  // Subsecond special case.
+  EXPECT_EQ("1.5ns", absl::FormatDuration(absl::Nanoseconds(1) +
+                                          absl::Nanoseconds(1) / 2));
+  EXPECT_EQ("1.25ns", absl::FormatDuration(absl::Nanoseconds(1) +
+                                           absl::Nanoseconds(1) / 4));
+  EXPECT_EQ("1ns", absl::FormatDuration(absl::Nanoseconds(1) +
+                                        absl::Nanoseconds(1) / 9));
+  EXPECT_EQ("1.2us", absl::FormatDuration(absl::Microseconds(1) +
+                                          absl::Nanoseconds(200)));
+  EXPECT_EQ("1.2ms", absl::FormatDuration(absl::Milliseconds(1) +
+                                          absl::Microseconds(200)));
+  EXPECT_EQ("1.0002ms", absl::FormatDuration(absl::Milliseconds(1) +
+                                             absl::Nanoseconds(200)));
+  EXPECT_EQ("1.00001ms", absl::FormatDuration(absl::Milliseconds(1) +
+                                              absl::Nanoseconds(10)));
+  EXPECT_EQ("1.000001ms",
+            absl::FormatDuration(absl::Milliseconds(1) + absl::Nanoseconds(1)));
+
+  // Negative durations.
+  EXPECT_EQ("-1ns", absl::FormatDuration(absl::Nanoseconds(-1)));
+  EXPECT_EQ("-1us", absl::FormatDuration(absl::Microseconds(-1)));
+  EXPECT_EQ("-1ms", absl::FormatDuration(absl::Milliseconds(-1)));
+  EXPECT_EQ("-1s", absl::FormatDuration(absl::Seconds(-1)));
+  EXPECT_EQ("-1m", absl::FormatDuration(absl::Minutes(-1)));
+  EXPECT_EQ("-1h", absl::FormatDuration(absl::Hours(-1)));
+
+  EXPECT_EQ("-1h1m",
+            absl::FormatDuration(-(absl::Hours(1) + absl::Minutes(1))));
+  EXPECT_EQ("-1h1s",
+            absl::FormatDuration(-(absl::Hours(1) + absl::Seconds(1))));
+  EXPECT_EQ("-1m1s",
+            absl::FormatDuration(-(absl::Minutes(1) + absl::Seconds(1))));
+
+  EXPECT_EQ("-1ns", absl::FormatDuration(absl::Nanoseconds(-1)));
+  EXPECT_EQ("-1.2us", absl::FormatDuration(
+                          -(absl::Microseconds(1) + absl::Nanoseconds(200))));
+  EXPECT_EQ("-1.2ms", absl::FormatDuration(
+                          -(absl::Milliseconds(1) + absl::Microseconds(200))));
+  EXPECT_EQ("-1.0002ms", absl::FormatDuration(-(absl::Milliseconds(1) +
+                                                absl::Nanoseconds(200))));
+  EXPECT_EQ("-1.00001ms", absl::FormatDuration(-(absl::Milliseconds(1) +
+                                                 absl::Nanoseconds(10))));
+  EXPECT_EQ("-1.000001ms", absl::FormatDuration(-(absl::Milliseconds(1) +
+                                                  absl::Nanoseconds(1))));
+
+  //
+  // Interesting corner cases.
+  //
+
+  const absl::Duration qns = absl::Nanoseconds(1) / 4;
+  const absl::Duration max_dur =
+      absl::Seconds(kint64max) + (absl::Seconds(1) - qns);
+  const absl::Duration min_dur = absl::Seconds(kint64min);
+
+  EXPECT_EQ("0.25ns", absl::FormatDuration(qns));
+  EXPECT_EQ("-0.25ns", absl::FormatDuration(-qns));
+  EXPECT_EQ("2562047788015215h30m7.99999999975s",
+            absl::FormatDuration(max_dur));
+  EXPECT_EQ("-2562047788015215h30m8s", absl::FormatDuration(min_dur));
+
+  // Tests printing full precision from units that print using FDivDuration
+  EXPECT_EQ("55.00000000025s", absl::FormatDuration(absl::Seconds(55) + qns));
+  EXPECT_EQ("55.00000025ms",
+            absl::FormatDuration(absl::Milliseconds(55) + qns));
+  EXPECT_EQ("55.00025us", absl::FormatDuration(absl::Microseconds(55) + qns));
+  EXPECT_EQ("55.25ns", absl::FormatDuration(absl::Nanoseconds(55) + qns));
+
+  // Formatting infinity
+  EXPECT_EQ("inf", absl::FormatDuration(absl::InfiniteDuration()));
+  EXPECT_EQ("-inf", absl::FormatDuration(-absl::InfiniteDuration()));
+
+  // Formatting approximately +/- 100 billion years
+  const absl::Duration huge_range = ApproxYears(100000000000);
+  EXPECT_EQ("876000000000000h", absl::FormatDuration(huge_range));
+  EXPECT_EQ("-876000000000000h", absl::FormatDuration(-huge_range));
+
+  EXPECT_EQ("876000000000000h0.999999999s",
+            absl::FormatDuration(huge_range +
+                                 (absl::Seconds(1) - absl::Nanoseconds(1))));
+  EXPECT_EQ("876000000000000h0.9999999995s",
+            absl::FormatDuration(
+                huge_range + (absl::Seconds(1) - absl::Nanoseconds(1) / 2)));
+  EXPECT_EQ("876000000000000h0.99999999975s",
+            absl::FormatDuration(
+                huge_range + (absl::Seconds(1) - absl::Nanoseconds(1) / 4)));
+
+  EXPECT_EQ("-876000000000000h0.999999999s",
+            absl::FormatDuration(-huge_range -
+                                 (absl::Seconds(1) - absl::Nanoseconds(1))));
+  EXPECT_EQ("-876000000000000h0.9999999995s",
+            absl::FormatDuration(
+                -huge_range - (absl::Seconds(1) - absl::Nanoseconds(1) / 2)));
+  EXPECT_EQ("-876000000000000h0.99999999975s",
+            absl::FormatDuration(
+                -huge_range - (absl::Seconds(1) - absl::Nanoseconds(1) / 4)));
+}
+
+TEST(Duration, ParseDuration) {
+  absl::Duration d;
+
+  // No specified unit. Should only work for zero and infinity.
+  EXPECT_TRUE(absl::ParseDuration("0", &d));
+  EXPECT_EQ(absl::ZeroDuration(), d);
+  EXPECT_TRUE(absl::ParseDuration("+0", &d));
+  EXPECT_EQ(absl::ZeroDuration(), d);
+  EXPECT_TRUE(absl::ParseDuration("-0", &d));
+  EXPECT_EQ(absl::ZeroDuration(), d);
+
+  EXPECT_TRUE(absl::ParseDuration("inf", &d));
+  EXPECT_EQ(absl::InfiniteDuration(), d);
+  EXPECT_TRUE(absl::ParseDuration("+inf", &d));
+  EXPECT_EQ(absl::InfiniteDuration(), d);
+  EXPECT_TRUE(absl::ParseDuration("-inf", &d));
+  EXPECT_EQ(-absl::InfiniteDuration(), d);
+  EXPECT_FALSE(absl::ParseDuration("infBlah", &d));
+
+  // Illegal input forms.
+  EXPECT_FALSE(absl::ParseDuration("", &d));
+  EXPECT_FALSE(absl::ParseDuration("0.0", &d));
+  EXPECT_FALSE(absl::ParseDuration(".0", &d));
+  EXPECT_FALSE(absl::ParseDuration(".", &d));
+  EXPECT_FALSE(absl::ParseDuration("01", &d));
+  EXPECT_FALSE(absl::ParseDuration("1", &d));
+  EXPECT_FALSE(absl::ParseDuration("-1", &d));
+  EXPECT_FALSE(absl::ParseDuration("2", &d));
+  EXPECT_FALSE(absl::ParseDuration("2 s", &d));
+  EXPECT_FALSE(absl::ParseDuration(".s", &d));
+  EXPECT_FALSE(absl::ParseDuration("-.s", &d));
+  EXPECT_FALSE(absl::ParseDuration("s", &d));
+  EXPECT_FALSE(absl::ParseDuration(" 2s", &d));
+  EXPECT_FALSE(absl::ParseDuration("2s ", &d));
+  EXPECT_FALSE(absl::ParseDuration(" 2s ", &d));
+  EXPECT_FALSE(absl::ParseDuration("2mt", &d));
+  EXPECT_FALSE(absl::ParseDuration("1e3s", &d));
+
+  // One unit type.
+  EXPECT_TRUE(absl::ParseDuration("1ns", &d));
+  EXPECT_EQ(absl::Nanoseconds(1), d);
+  EXPECT_TRUE(absl::ParseDuration("1us", &d));
+  EXPECT_EQ(absl::Microseconds(1), d);
+  EXPECT_TRUE(absl::ParseDuration("1ms", &d));
+  EXPECT_EQ(absl::Milliseconds(1), d);
+  EXPECT_TRUE(absl::ParseDuration("1s", &d));
+  EXPECT_EQ(absl::Seconds(1), d);
+  EXPECT_TRUE(absl::ParseDuration("2m", &d));
+  EXPECT_EQ(absl::Minutes(2), d);
+  EXPECT_TRUE(absl::ParseDuration("2h", &d));
+  EXPECT_EQ(absl::Hours(2), d);
+
+  // Huge counts of a unit.
+  EXPECT_TRUE(absl::ParseDuration("9223372036854775807us", &d));
+  EXPECT_EQ(absl::Microseconds(9223372036854775807), d);
+  EXPECT_TRUE(absl::ParseDuration("-9223372036854775807us", &d));
+  EXPECT_EQ(absl::Microseconds(-9223372036854775807), d);
+
+  // Multiple units.
+  EXPECT_TRUE(absl::ParseDuration("2h3m4s", &d));
+  EXPECT_EQ(absl::Hours(2) + absl::Minutes(3) + absl::Seconds(4), d);
+  EXPECT_TRUE(absl::ParseDuration("3m4s5us", &d));
+  EXPECT_EQ(absl::Minutes(3) + absl::Seconds(4) + absl::Microseconds(5), d);
+  EXPECT_TRUE(absl::ParseDuration("2h3m4s5ms6us7ns", &d));
+  EXPECT_EQ(absl::Hours(2) + absl::Minutes(3) + absl::Seconds(4) +
+                absl::Milliseconds(5) + absl::Microseconds(6) +
+                absl::Nanoseconds(7),
+            d);
+
+  // Multiple units out of order.
+  EXPECT_TRUE(absl::ParseDuration("2us3m4s5h", &d));
+  EXPECT_EQ(absl::Hours(5) + absl::Minutes(3) + absl::Seconds(4) +
+                absl::Microseconds(2),
+            d);
+
+  // Fractional values of units.
+  EXPECT_TRUE(absl::ParseDuration("1.5ns", &d));
+  EXPECT_EQ(1.5 * absl::Nanoseconds(1), d);
+  EXPECT_TRUE(absl::ParseDuration("1.5us", &d));
+  EXPECT_EQ(1.5 * absl::Microseconds(1), d);
+  EXPECT_TRUE(absl::ParseDuration("1.5ms", &d));
+  EXPECT_EQ(1.5 * absl::Milliseconds(1), d);
+  EXPECT_TRUE(absl::ParseDuration("1.5s", &d));
+  EXPECT_EQ(1.5 * absl::Seconds(1), d);
+  EXPECT_TRUE(absl::ParseDuration("1.5m", &d));
+  EXPECT_EQ(1.5 * absl::Minutes(1), d);
+  EXPECT_TRUE(absl::ParseDuration("1.5h", &d));
+  EXPECT_EQ(1.5 * absl::Hours(1), d);
+
+  // Huge fractional counts of a unit.
+  EXPECT_TRUE(absl::ParseDuration("0.4294967295s", &d));
+  EXPECT_EQ(absl::Nanoseconds(429496729) + absl::Nanoseconds(1) / 2, d);
+  EXPECT_TRUE(absl::ParseDuration("0.429496729501234567890123456789s", &d));
+  EXPECT_EQ(absl::Nanoseconds(429496729) + absl::Nanoseconds(1) / 2, d);
+
+  // Negative durations.
+  EXPECT_TRUE(absl::ParseDuration("-1s", &d));
+  EXPECT_EQ(absl::Seconds(-1), d);
+  EXPECT_TRUE(absl::ParseDuration("-1m", &d));
+  EXPECT_EQ(absl::Minutes(-1), d);
+  EXPECT_TRUE(absl::ParseDuration("-1h", &d));
+  EXPECT_EQ(absl::Hours(-1), d);
+
+  EXPECT_TRUE(absl::ParseDuration("-1h2s", &d));
+  EXPECT_EQ(-(absl::Hours(1) + absl::Seconds(2)), d);
+  EXPECT_FALSE(absl::ParseDuration("1h-2s", &d));
+  EXPECT_FALSE(absl::ParseDuration("-1h-2s", &d));
+  EXPECT_FALSE(absl::ParseDuration("-1h -2s", &d));
+}
+
+TEST(Duration, FormatParseRoundTrip) {
+#define TEST_PARSE_ROUNDTRIP(d)                \
+  do {                                         \
+    std::string s = absl::FormatDuration(d);   \
+    absl::Duration dur;                        \
+    EXPECT_TRUE(absl::ParseDuration(s, &dur)); \
+    EXPECT_EQ(d, dur);                         \
+  } while (0)
+
+  TEST_PARSE_ROUNDTRIP(absl::Nanoseconds(1));
+  TEST_PARSE_ROUNDTRIP(absl::Microseconds(1));
+  TEST_PARSE_ROUNDTRIP(absl::Milliseconds(1));
+  TEST_PARSE_ROUNDTRIP(absl::Seconds(1));
+  TEST_PARSE_ROUNDTRIP(absl::Minutes(1));
+  TEST_PARSE_ROUNDTRIP(absl::Hours(1));
+  TEST_PARSE_ROUNDTRIP(absl::Hours(1) + absl::Nanoseconds(2));
+
+  TEST_PARSE_ROUNDTRIP(absl::Nanoseconds(-1));
+  TEST_PARSE_ROUNDTRIP(absl::Microseconds(-1));
+  TEST_PARSE_ROUNDTRIP(absl::Milliseconds(-1));
+  TEST_PARSE_ROUNDTRIP(absl::Seconds(-1));
+  TEST_PARSE_ROUNDTRIP(absl::Minutes(-1));
+  TEST_PARSE_ROUNDTRIP(absl::Hours(-1));
+
+  TEST_PARSE_ROUNDTRIP(absl::Hours(-1) + absl::Nanoseconds(2));
+  TEST_PARSE_ROUNDTRIP(absl::Hours(1) + absl::Nanoseconds(-2));
+  TEST_PARSE_ROUNDTRIP(absl::Hours(-1) + absl::Nanoseconds(-2));
+
+  TEST_PARSE_ROUNDTRIP(absl::Nanoseconds(1) +
+                       absl::Nanoseconds(1) / 4);  // 1.25ns
+
+  const absl::Duration huge_range = ApproxYears(100000000000);
+  TEST_PARSE_ROUNDTRIP(huge_range);
+  TEST_PARSE_ROUNDTRIP(huge_range + (absl::Seconds(1) - absl::Nanoseconds(1)));
+
+#undef TEST_PARSE_ROUNDTRIP
+}
+
+}  // namespace
diff --git a/third_party/abseil_cpp/absl/time/format.cc b/third_party/abseil_cpp/absl/time/format.cc
new file mode 100644
index 0000000000..228940ed1b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/format.cc
@@ -0,0 +1,163 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include <string.h>
+
+#include <cctype>
+#include <cstdint>
+
+#include "absl/strings/match.h"
+#include "absl/strings/string_view.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+#include "absl/time/time.h"
+
+namespace cctz = absl::time_internal::cctz;
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+
+ABSL_DLL extern const char RFC3339_full[] =
+    "%Y-%m-%dT%H:%M:%E*S%Ez";
+ABSL_DLL extern const char RFC3339_sec[] = "%Y-%m-%dT%H:%M:%S%Ez";
+
+ABSL_DLL extern const char RFC1123_full[] =
+    "%a, %d %b %E4Y %H:%M:%S %z";
+ABSL_DLL extern const char RFC1123_no_wday[] =
+    "%d %b %E4Y %H:%M:%S %z";
+
+namespace {
+
+const char kInfiniteFutureStr[] = "infinite-future";
+const char kInfinitePastStr[] = "infinite-past";
+
+struct cctz_parts {
+  cctz::time_point<cctz::seconds> sec;
+  cctz::detail::femtoseconds fem;
+};
+
+inline cctz::time_point<cctz::seconds> unix_epoch() {
+  return std::chrono::time_point_cast<cctz::seconds>(
+      std::chrono::system_clock::from_time_t(0));
+}
+
+// Splits a Time into seconds and femtoseconds, which can be used with CCTZ.
+// Requires that 't' is finite. See duration.cc for details about rep_hi and
+// rep_lo.
+cctz_parts Split(absl::Time t) {
+  const auto d = time_internal::ToUnixDuration(t);
+  const int64_t rep_hi = time_internal::GetRepHi(d);
+  const int64_t rep_lo = time_internal::GetRepLo(d);
+  const auto sec = unix_epoch() + cctz::seconds(rep_hi);
+  const auto fem = cctz::detail::femtoseconds(rep_lo * (1000 * 1000 / 4));
+  return {sec, fem};
+}
+
+// Joins the given seconds and femtoseconds into a Time. See duration.cc for
+// details about rep_hi and rep_lo.
+absl::Time Join(const cctz_parts& parts) {
+  const int64_t rep_hi = (parts.sec - unix_epoch()).count();
+  const uint32_t rep_lo = parts.fem.count() / (1000 * 1000 / 4);
+  const auto d = time_internal::MakeDuration(rep_hi, rep_lo);
+  return time_internal::FromUnixDuration(d);
+}
+
+}  // namespace
+
+std::string FormatTime(absl::string_view format, absl::Time t,
+                       absl::TimeZone tz) {
+  if (t == absl::InfiniteFuture()) return std::string(kInfiniteFutureStr);
+  if (t == absl::InfinitePast()) return std::string(kInfinitePastStr);
+  const auto parts = Split(t);
+  return cctz::detail::format(std::string(format), parts.sec, parts.fem,
+                              cctz::time_zone(tz));
+}
+
+std::string FormatTime(absl::Time t, absl::TimeZone tz) {
+  return FormatTime(RFC3339_full, t, tz);
+}
+
+std::string FormatTime(absl::Time t) {
+  return absl::FormatTime(RFC3339_full, t, absl::LocalTimeZone());
+}
+
+bool ParseTime(absl::string_view format, absl::string_view input,
+               absl::Time* time, std::string* err) {
+  return absl::ParseTime(format, input, absl::UTCTimeZone(), time, err);
+}
+
+// If the input string does not contain an explicit UTC offset, interpret
+// the fields with respect to the given TimeZone.
+bool ParseTime(absl::string_view format, absl::string_view input,
+               absl::TimeZone tz, absl::Time* time, std::string* err) {
+  auto strip_leading_space = [](absl::string_view* sv) {
+    while (!sv->empty()) {
+      if (!std::isspace(sv->front())) return;
+      sv->remove_prefix(1);
+    }
+  };
+
+  // Portable toolchains means we don't get nice constexpr here.
+  struct Literal {
+    const char* name;
+    size_t size;
+    absl::Time value;
+  };
+  static Literal literals[] = {
+      {kInfiniteFutureStr, strlen(kInfiniteFutureStr), InfiniteFuture()},
+      {kInfinitePastStr, strlen(kInfinitePastStr), InfinitePast()},
+  };
+  strip_leading_space(&input);
+  for (const auto& lit : literals) {
+    if (absl::StartsWith(input, absl::string_view(lit.name, lit.size))) {
+      absl::string_view tail = input;
+      tail.remove_prefix(lit.size);
+      strip_leading_space(&tail);
+      if (tail.empty()) {
+        *time = lit.value;
+        return true;
+      }
+    }
+  }
+
+  std::string error;
+  cctz_parts parts;
+  const bool b =
+      cctz::detail::parse(std::string(format), std::string(input),
+                          cctz::time_zone(tz), &parts.sec, &parts.fem, &error);
+  if (b) {
+    *time = Join(parts);
+  } else if (err != nullptr) {
+    *err = error;
+  }
+  return b;
+}
+
+// Functions required to support absl::Time flags.
+bool AbslParseFlag(absl::string_view text, absl::Time* t, std::string* error) {
+  return absl::ParseTime(RFC3339_full, text, absl::UTCTimeZone(), t, error);
+}
+
+std::string AbslUnparseFlag(absl::Time t) {
+  return absl::FormatTime(RFC3339_full, t, absl::UTCTimeZone());
+}
+bool ParseFlag(const std::string& text, absl::Time* t, std::string* error) {
+  return absl::ParseTime(RFC3339_full, text, absl::UTCTimeZone(), t, error);
+}
+
+std::string UnparseFlag(absl::Time t) {
+  return absl::FormatTime(RFC3339_full, t, absl::UTCTimeZone());
+}
+
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/format_benchmark.cc b/third_party/abseil_cpp/absl/time/format_benchmark.cc
new file mode 100644
index 0000000000..249c51d875
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/format_benchmark.cc
@@ -0,0 +1,64 @@
+// Copyright 2018 The Abseil Authors.
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include <cstddef>
+#include <string>
+
+#include "absl/time/internal/test_util.h"
+#include "absl/time/time.h"
+#include "benchmark/benchmark.h"
+
+namespace {
+
+namespace {
+const char* const kFormats[] = {
+    absl::RFC1123_full,     // 0
+    absl::RFC1123_no_wday,  // 1
+    absl::RFC3339_full,     // 2
+    absl::RFC3339_sec,      // 3
+    "%Y-%m-%dT%H:%M:%S",    // 4
+    "%Y-%m-%d",             // 5
+};
+const int kNumFormats = sizeof(kFormats) / sizeof(kFormats[0]);
+}  // namespace
+
+void BM_Format_FormatTime(benchmark::State& state) {
+  const std::string fmt = kFormats[state.range(0)];
+  state.SetLabel(fmt);
+  const absl::TimeZone lax =
+      absl::time_internal::LoadTimeZone("America/Los_Angeles");
+  const absl::Time t =
+      absl::FromCivil(absl::CivilSecond(1977, 6, 28, 9, 8, 7), lax) +
+      absl::Nanoseconds(1);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::FormatTime(fmt, t, lax).length());
+  }
+}
+BENCHMARK(BM_Format_FormatTime)->DenseRange(0, kNumFormats - 1);
+
+void BM_Format_ParseTime(benchmark::State& state) {
+  const std::string fmt = kFormats[state.range(0)];
+  state.SetLabel(fmt);
+  const absl::TimeZone lax =
+      absl::time_internal::LoadTimeZone("America/Los_Angeles");
+  absl::Time t = absl::FromCivil(absl::CivilSecond(1977, 6, 28, 9, 8, 7), lax) +
+                 absl::Nanoseconds(1);
+  const std::string when = absl::FormatTime(fmt, t, lax);
+  std::string err;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::ParseTime(fmt, when, lax, &t, &err));
+  }
+}
+BENCHMARK(BM_Format_ParseTime)->DenseRange(0, kNumFormats - 1);
+
+}  // namespace
diff --git a/third_party/abseil_cpp/absl/time/format_test.cc b/third_party/abseil_cpp/absl/time/format_test.cc
new file mode 100644
index 0000000000..a9a1eb8ee1
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/format_test.cc
@@ -0,0 +1,441 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include <cstdint>
+#include <limits>
+#include <string>
+
+#include "gmock/gmock.h"
+#include "gtest/gtest.h"
+#include "absl/time/internal/test_util.h"
+#include "absl/time/time.h"
+
+using testing::HasSubstr;
+
+namespace {
+
+// A helper that tests the given format specifier by itself, and with leading
+// and trailing characters.  For example: TestFormatSpecifier(t, "%a", "Thu").
+void TestFormatSpecifier(absl::Time t, absl::TimeZone tz,
+                         const std::string& fmt, const std::string& ans) {
+  EXPECT_EQ(ans, absl::FormatTime(fmt, t, tz));
+  EXPECT_EQ("xxx " + ans, absl::FormatTime("xxx " + fmt, t, tz));
+  EXPECT_EQ(ans + " yyy", absl::FormatTime(fmt + " yyy", t, tz));
+  EXPECT_EQ("xxx " + ans + " yyy",
+            absl::FormatTime("xxx " + fmt + " yyy", t, tz));
+}
+
+//
+// Testing FormatTime()
+//
+
+TEST(FormatTime, Basics) {
+  absl::TimeZone tz = absl::UTCTimeZone();
+  absl::Time t = absl::FromTimeT(0);
+
+  // Starts with a couple basic edge cases.
+  EXPECT_EQ("", absl::FormatTime("", t, tz));
+  EXPECT_EQ(" ", absl::FormatTime(" ", t, tz));
+  EXPECT_EQ("  ", absl::FormatTime("  ", t, tz));
+  EXPECT_EQ("xxx", absl::FormatTime("xxx", t, tz));
+  std::string big(128, 'x');
+  EXPECT_EQ(big, absl::FormatTime(big, t, tz));
+  // Cause the 1024-byte buffer to grow.
+  std::string bigger(100000, 'x');
+  EXPECT_EQ(bigger, absl::FormatTime(bigger, t, tz));
+
+  t += absl::Hours(13) + absl::Minutes(4) + absl::Seconds(5);
+  t += absl::Milliseconds(6) + absl::Microseconds(7) + absl::Nanoseconds(8);
+  EXPECT_EQ("1970-01-01", absl::FormatTime("%Y-%m-%d", t, tz));
+  EXPECT_EQ("13:04:05", absl::FormatTime("%H:%M:%S", t, tz));
+  EXPECT_EQ("13:04:05.006", absl::FormatTime("%H:%M:%E3S", t, tz));
+  EXPECT_EQ("13:04:05.006007", absl::FormatTime("%H:%M:%E6S", t, tz));
+  EXPECT_EQ("13:04:05.006007008", absl::FormatTime("%H:%M:%E9S", t, tz));
+}
+
+TEST(FormatTime, LocaleSpecific) {
+  const absl::TimeZone tz = absl::UTCTimeZone();
+  absl::Time t = absl::FromTimeT(0);
+
+  TestFormatSpecifier(t, tz, "%a", "Thu");
+  TestFormatSpecifier(t, tz, "%A", "Thursday");
+  TestFormatSpecifier(t, tz, "%b", "Jan");
+  TestFormatSpecifier(t, tz, "%B", "January");
+
+  // %c should at least produce the numeric year and time-of-day.
+  const std::string s =
+      absl::FormatTime("%c", absl::FromTimeT(0), absl::UTCTimeZone());
+  EXPECT_THAT(s, HasSubstr("1970"));
+  EXPECT_THAT(s, HasSubstr("00:00:00"));
+
+  TestFormatSpecifier(t, tz, "%p", "AM");
+  TestFormatSpecifier(t, tz, "%x", "01/01/70");
+  TestFormatSpecifier(t, tz, "%X", "00:00:00");
+}
+
+TEST(FormatTime, ExtendedSeconds) {
+  const absl::TimeZone tz = absl::UTCTimeZone();
+
+  // No subseconds.
+  absl::Time t = absl::FromTimeT(0) + absl::Seconds(5);
+  EXPECT_EQ("05", absl::FormatTime("%E*S", t, tz));
+  EXPECT_EQ("05.000000000000000", absl::FormatTime("%E15S", t, tz));
+
+  // With subseconds.
+  t += absl::Milliseconds(6) + absl::Microseconds(7) + absl::Nanoseconds(8);
+  EXPECT_EQ("05.006007008", absl::FormatTime("%E*S", t, tz));
+  EXPECT_EQ("05", absl::FormatTime("%E0S", t, tz));
+  EXPECT_EQ("05.006007008000000", absl::FormatTime("%E15S", t, tz));
+
+  // Times before the Unix epoch.
+  t = absl::FromUnixMicros(-1);
+  EXPECT_EQ("1969-12-31 23:59:59.999999",
+            absl::FormatTime("%Y-%m-%d %H:%M:%E*S", t, tz));
+
+  // Here is a "%E*S" case we got wrong for a while.  While the first
+  // instant below is correctly rendered as "...:07.333304", the second
+  // one used to appear as "...:07.33330499999999999".
+  t = absl::FromUnixMicros(1395024427333304);
+  EXPECT_EQ("2014-03-17 02:47:07.333304",
+            absl::FormatTime("%Y-%m-%d %H:%M:%E*S", t, tz));
+  t += absl::Microseconds(1);
+  EXPECT_EQ("2014-03-17 02:47:07.333305",
+            absl::FormatTime("%Y-%m-%d %H:%M:%E*S", t, tz));
+}
+
+TEST(FormatTime, RFC1123FormatPadsYear) {  // locale specific
+  absl::TimeZone tz = absl::UTCTimeZone();
+
+  // A year of 77 should be padded to 0077.
+  absl::Time t = absl::FromCivil(absl::CivilSecond(77, 6, 28, 9, 8, 7), tz);
+  EXPECT_EQ("Mon, 28 Jun 0077 09:08:07 +0000",
+            absl::FormatTime(absl::RFC1123_full, t, tz));
+  EXPECT_EQ("28 Jun 0077 09:08:07 +0000",
+            absl::FormatTime(absl::RFC1123_no_wday, t, tz));
+}
+
+TEST(FormatTime, InfiniteTime) {
+  absl::TimeZone tz = absl::time_internal::LoadTimeZone("America/Los_Angeles");
+
+  // The format and timezone are ignored.
+  EXPECT_EQ("infinite-future",
+            absl::FormatTime("%H:%M blah", absl::InfiniteFuture(), tz));
+  EXPECT_EQ("infinite-past",
+            absl::FormatTime("%H:%M blah", absl::InfinitePast(), tz));
+}
+
+//
+// Testing ParseTime()
+//
+
+TEST(ParseTime, Basics) {
+  absl::Time t = absl::FromTimeT(1234567890);
+  std::string err;
+
+  // Simple edge cases.
+  EXPECT_TRUE(absl::ParseTime("", "", &t, &err)) << err;
+  EXPECT_EQ(absl::UnixEpoch(), t);  // everything defaulted
+  EXPECT_TRUE(absl::ParseTime(" ", " ", &t, &err)) << err;
+  EXPECT_TRUE(absl::ParseTime("  ", "  ", &t, &err)) << err;
+  EXPECT_TRUE(absl::ParseTime("x", "x", &t, &err)) << err;
+  EXPECT_TRUE(absl::ParseTime("xxx", "xxx", &t, &err)) << err;
+
+  EXPECT_TRUE(absl::ParseTime("%Y-%m-%d %H:%M:%S %z",
+                              "2013-06-28 19:08:09 -0800", &t, &err))
+      << err;
+  const auto ci = absl::FixedTimeZone(-8 * 60 * 60).At(t);
+  EXPECT_EQ(absl::CivilSecond(2013, 6, 28, 19, 8, 9), ci.cs);
+  EXPECT_EQ(absl::ZeroDuration(), ci.subsecond);
+}
+
+TEST(ParseTime, NullErrorString) {
+  absl::Time t;
+  EXPECT_FALSE(absl::ParseTime("%Q", "invalid format", &t, nullptr));
+  EXPECT_FALSE(absl::ParseTime("%H", "12 trailing data", &t, nullptr));
+  EXPECT_FALSE(
+      absl::ParseTime("%H out of range", "42 out of range", &t, nullptr));
+}
+
+TEST(ParseTime, WithTimeZone) {
+  const absl::TimeZone tz =
+      absl::time_internal::LoadTimeZone("America/Los_Angeles");
+  absl::Time t;
+  std::string e;
+
+  // We can parse a string without a UTC offset if we supply a timezone.
+  EXPECT_TRUE(
+      absl::ParseTime("%Y-%m-%d %H:%M:%S", "2013-06-28 19:08:09", tz, &t, &e))
+      << e;
+  auto ci = tz.At(t);
+  EXPECT_EQ(absl::CivilSecond(2013, 6, 28, 19, 8, 9), ci.cs);
+  EXPECT_EQ(absl::ZeroDuration(), ci.subsecond);
+
+  // But the timezone is ignored when a UTC offset is present.
+  EXPECT_TRUE(absl::ParseTime("%Y-%m-%d %H:%M:%S %z",
+                              "2013-06-28 19:08:09 +0800", tz, &t, &e))
+      << e;
+  ci = absl::FixedTimeZone(8 * 60 * 60).At(t);
+  EXPECT_EQ(absl::CivilSecond(2013, 6, 28, 19, 8, 9), ci.cs);
+  EXPECT_EQ(absl::ZeroDuration(), ci.subsecond);
+}
+
+TEST(ParseTime, ErrorCases) {
+  absl::Time t = absl::FromTimeT(0);
+  std::string err;
+
+  EXPECT_FALSE(absl::ParseTime("%S", "123", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Illegal trailing data"));
+
+  // Can't parse an illegal format specifier.
+  err.clear();
+  EXPECT_FALSE(absl::ParseTime("%Q", "x", &t, &err)) << err;
+  // Exact contents of "err" are platform-dependent because of
+  // differences in the strptime implementation between macOS and Linux.
+  EXPECT_FALSE(err.empty());
+
+  // Fails because of trailing, unparsed data "blah".
+  EXPECT_FALSE(absl::ParseTime("%m-%d", "2-3 blah", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Illegal trailing data"));
+
+  // Feb 31 requires normalization.
+  EXPECT_FALSE(absl::ParseTime("%m-%d", "2-31", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Out-of-range"));
+
+  // Check that we cannot have spaces in UTC offsets.
+  EXPECT_TRUE(absl::ParseTime("%z", "-0203", &t, &err)) << err;
+  EXPECT_FALSE(absl::ParseTime("%z", "- 2 3", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Failed to parse"));
+  EXPECT_TRUE(absl::ParseTime("%Ez", "-02:03", &t, &err)) << err;
+  EXPECT_FALSE(absl::ParseTime("%Ez", "- 2: 3", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Failed to parse"));
+
+  // Check that we reject other malformed UTC offsets.
+  EXPECT_FALSE(absl::ParseTime("%Ez", "+-08:00", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Failed to parse"));
+  EXPECT_FALSE(absl::ParseTime("%Ez", "-+08:00", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Failed to parse"));
+
+  // Check that we do not accept "-0" in fields that allow zero.
+  EXPECT_FALSE(absl::ParseTime("%Y", "-0", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Failed to parse"));
+  EXPECT_FALSE(absl::ParseTime("%E4Y", "-0", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Failed to parse"));
+  EXPECT_FALSE(absl::ParseTime("%H", "-0", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Failed to parse"));
+  EXPECT_FALSE(absl::ParseTime("%M", "-0", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Failed to parse"));
+  EXPECT_FALSE(absl::ParseTime("%S", "-0", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Failed to parse"));
+  EXPECT_FALSE(absl::ParseTime("%z", "+-000", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Failed to parse"));
+  EXPECT_FALSE(absl::ParseTime("%Ez", "+-0:00", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Failed to parse"));
+  EXPECT_FALSE(absl::ParseTime("%z", "-00-0", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Illegal trailing data"));
+  EXPECT_FALSE(absl::ParseTime("%Ez", "-00:-0", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Illegal trailing data"));
+}
+
+TEST(ParseTime, ExtendedSeconds) {
+  std::string err;
+  absl::Time t;
+
+  // Here is a "%E*S" case we got wrong for a while.  The fractional
+  // part of the first instant is less than 2^31 and was correctly
+  // parsed, while the second (and any subsecond field >=2^31) failed.
+  t = absl::UnixEpoch();
+  EXPECT_TRUE(absl::ParseTime("%E*S", "0.2147483647", &t, &err)) << err;
+  EXPECT_EQ(absl::UnixEpoch() + absl::Nanoseconds(214748364) +
+                absl::Nanoseconds(1) / 2,
+            t);
+  t = absl::UnixEpoch();
+  EXPECT_TRUE(absl::ParseTime("%E*S", "0.2147483648", &t, &err)) << err;
+  EXPECT_EQ(absl::UnixEpoch() + absl::Nanoseconds(214748364) +
+                absl::Nanoseconds(3) / 4,
+            t);
+
+  // We should also be able to specify long strings of digits far
+  // beyond the current resolution and have them convert the same way.
+  t = absl::UnixEpoch();
+  EXPECT_TRUE(absl::ParseTime(
+      "%E*S", "0.214748364801234567890123456789012345678901234567890123456789",
+      &t, &err))
+      << err;
+  EXPECT_EQ(absl::UnixEpoch() + absl::Nanoseconds(214748364) +
+                absl::Nanoseconds(3) / 4,
+            t);
+}
+
+TEST(ParseTime, ExtendedOffsetErrors) {
+  std::string err;
+  absl::Time t;
+
+  // %z against +-HHMM.
+  EXPECT_FALSE(absl::ParseTime("%z", "-123", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Illegal trailing data"));
+
+  // %z against +-HH.
+  EXPECT_FALSE(absl::ParseTime("%z", "-1", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Failed to parse"));
+
+  // %Ez against +-HH:MM.
+  EXPECT_FALSE(absl::ParseTime("%Ez", "-12:3", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Illegal trailing data"));
+
+  // %Ez against +-HHMM.
+  EXPECT_FALSE(absl::ParseTime("%Ez", "-123", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Illegal trailing data"));
+
+  // %Ez against +-HH.
+  EXPECT_FALSE(absl::ParseTime("%Ez", "-1", &t, &err)) << err;
+  EXPECT_THAT(err, HasSubstr("Failed to parse"));
+}
+
+TEST(ParseTime, InfiniteTime) {
+  absl::Time t;
+  std::string err;
+  EXPECT_TRUE(absl::ParseTime("%H:%M blah", "infinite-future", &t, &err));
+  EXPECT_EQ(absl::InfiniteFuture(), t);
+
+  // Surrounding whitespace.
+  EXPECT_TRUE(absl::ParseTime("%H:%M blah", "  infinite-future", &t, &err));
+  EXPECT_EQ(absl::InfiniteFuture(), t);
+  EXPECT_TRUE(absl::ParseTime("%H:%M blah", "infinite-future  ", &t, &err));
+  EXPECT_EQ(absl::InfiniteFuture(), t);
+  EXPECT_TRUE(absl::ParseTime("%H:%M blah", "  infinite-future  ", &t, &err));
+  EXPECT_EQ(absl::InfiniteFuture(), t);
+
+  EXPECT_TRUE(absl::ParseTime("%H:%M blah", "infinite-past", &t, &err));
+  EXPECT_EQ(absl::InfinitePast(), t);
+
+  // Surrounding whitespace.
+  EXPECT_TRUE(absl::ParseTime("%H:%M blah", "  infinite-past", &t, &err));
+  EXPECT_EQ(absl::InfinitePast(), t);
+  EXPECT_TRUE(absl::ParseTime("%H:%M blah", "infinite-past  ", &t, &err));
+  EXPECT_EQ(absl::InfinitePast(), t);
+  EXPECT_TRUE(absl::ParseTime("%H:%M blah", "  infinite-past  ", &t, &err));
+  EXPECT_EQ(absl::InfinitePast(), t);
+
+  // "infinite-future" as literal string
+  absl::TimeZone tz = absl::UTCTimeZone();
+  EXPECT_TRUE(absl::ParseTime("infinite-future %H:%M", "infinite-future 03:04",
+                              &t, &err));
+  EXPECT_NE(absl::InfiniteFuture(), t);
+  EXPECT_EQ(3, tz.At(t).cs.hour());
+  EXPECT_EQ(4, tz.At(t).cs.minute());
+
+  // "infinite-past" as literal string
+  EXPECT_TRUE(
+      absl::ParseTime("infinite-past %H:%M", "infinite-past 03:04", &t, &err));
+  EXPECT_NE(absl::InfinitePast(), t);
+  EXPECT_EQ(3, tz.At(t).cs.hour());
+  EXPECT_EQ(4, tz.At(t).cs.minute());
+
+  // The input doesn't match the format.
+  EXPECT_FALSE(absl::ParseTime("infinite-future %H:%M", "03:04", &t, &err));
+  EXPECT_FALSE(absl::ParseTime("infinite-past %H:%M", "03:04", &t, &err));
+}
+
+TEST(ParseTime, FailsOnUnrepresentableTime) {
+  const absl::TimeZone utc = absl::UTCTimeZone();
+  absl::Time t;
+  EXPECT_FALSE(
+      absl::ParseTime("%Y-%m-%d", "-292277022657-01-27", utc, &t, nullptr));
+  EXPECT_TRUE(
+      absl::ParseTime("%Y-%m-%d", "-292277022657-01-28", utc, &t, nullptr));
+  EXPECT_TRUE(
+      absl::ParseTime("%Y-%m-%d", "292277026596-12-04", utc, &t, nullptr));
+  EXPECT_FALSE(
+      absl::ParseTime("%Y-%m-%d", "292277026596-12-05", utc, &t, nullptr));
+}
+
+//
+// Roundtrip test for FormatTime()/ParseTime().
+//
+
+TEST(FormatParse, RoundTrip) {
+  const absl::TimeZone lax =
+      absl::time_internal::LoadTimeZone("America/Los_Angeles");
+  const absl::Time in =
+      absl::FromCivil(absl::CivilSecond(1977, 6, 28, 9, 8, 7), lax);
+  const absl::Duration subseconds = absl::Nanoseconds(654321);
+  std::string err;
+
+  // RFC3339, which renders subseconds.
+  {
+    absl::Time out;
+    const std::string s =
+        absl::FormatTime(absl::RFC3339_full, in + subseconds, lax);
+    EXPECT_TRUE(absl::ParseTime(absl::RFC3339_full, s, &out, &err))
+        << s << ": " << err;
+    EXPECT_EQ(in + subseconds, out);  // RFC3339_full includes %Ez
+  }
+
+  // RFC1123, which only does whole seconds.
+  {
+    absl::Time out;
+    const std::string s = absl::FormatTime(absl::RFC1123_full, in, lax);
+    EXPECT_TRUE(absl::ParseTime(absl::RFC1123_full, s, &out, &err))
+        << s << ": " << err;
+    EXPECT_EQ(in, out);  // RFC1123_full includes %z
+  }
+
+  // `absl::FormatTime()` falls back to strftime() for "%c", which appears to
+  // work. On Windows, `absl::ParseTime()` falls back to std::get_time() which
+  // appears to fail on "%c" (or at least on the "%c" text produced by
+  // `strftime()`). This makes it fail the round-trip test.
+  //
+  // Under the emscripten compiler `absl::ParseTime() falls back to
+  // `strptime()`, but that ends up using a different definition for "%c"
+  // compared to `strftime()`, also causing the round-trip test to fail
+  // (see https://github.com/kripken/emscripten/pull/7491).
+#if !defined(_MSC_VER) && !defined(__EMSCRIPTEN__)
+  // Even though we don't know what %c will produce, it should roundtrip,
+  // but only in the 0-offset timezone.
+  {
+    absl::Time out;
+    const std::string s = absl::FormatTime("%c", in, absl::UTCTimeZone());
+    EXPECT_TRUE(absl::ParseTime("%c", s, &out, &err)) << s << ": " << err;
+    EXPECT_EQ(in, out);
+  }
+#endif  // !_MSC_VER && !__EMSCRIPTEN__
+}
+
+TEST(FormatParse, RoundTripDistantFuture) {
+  const absl::TimeZone tz = absl::UTCTimeZone();
+  const absl::Time in =
+      absl::FromUnixSeconds(std::numeric_limits<int64_t>::max());
+  std::string err;
+
+  absl::Time out;
+  const std::string s = absl::FormatTime(absl::RFC3339_full, in, tz);
+  EXPECT_TRUE(absl::ParseTime(absl::RFC3339_full, s, &out, &err))
+      << s << ": " << err;
+  EXPECT_EQ(in, out);
+}
+
+TEST(FormatParse, RoundTripDistantPast) {
+  const absl::TimeZone tz = absl::UTCTimeZone();
+  const absl::Time in =
+      absl::FromUnixSeconds(std::numeric_limits<int64_t>::min());
+  std::string err;
+
+  absl::Time out;
+  const std::string s = absl::FormatTime(absl::RFC3339_full, in, tz);
+  EXPECT_TRUE(absl::ParseTime(absl::RFC3339_full, s, &out, &err))
+      << s << ": " << err;
+  EXPECT_EQ(in, out);
+}
+
+}  // namespace
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/BUILD.bazel b/third_party/abseil_cpp/absl/time/internal/cctz/BUILD.bazel
new file mode 100644
index 0000000000..7a53c815b9
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/BUILD.bazel
@@ -0,0 +1,166 @@
+# Copyright 2016 Google Inc. All Rights Reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#   https://www.apache.org/licenses/LICENSE-2.0
+#
+#   Unless required by applicable law or agreed to in writing, software
+#   distributed under the License is distributed on an "AS IS" BASIS,
+#   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+#   See the License for the specific language governing permissions and
+#   limitations under the License.
+
+load("@rules_cc//cc:defs.bzl", "cc_library", "cc_test")
+
+package(features = ["-parse_headers"])
+
+licenses(["notice"])  # Apache License
+
+filegroup(
+    name = "zoneinfo",
+    srcs = glob(["testdata/zoneinfo/**"]),
+)
+
+config_setting(
+    name = "osx",
+    constraint_values = [
+        "@bazel_tools//platforms:osx",
+    ],
+)
+
+config_setting(
+    name = "ios",
+    constraint_values = [
+        "@bazel_tools//platforms:ios",
+    ],
+)
+
+### libraries
+
+cc_library(
+    name = "civil_time",
+    srcs = ["src/civil_time_detail.cc"],
+    hdrs = [
+        "include/cctz/civil_time.h",
+    ],
+    textual_hdrs = ["include/cctz/civil_time_detail.h"],
+    visibility = ["//visibility:public"],
+    deps = ["//absl/base:config"],
+)
+
+cc_library(
+    name = "time_zone",
+    srcs = [
+        "src/time_zone_fixed.cc",
+        "src/time_zone_fixed.h",
+        "src/time_zone_format.cc",
+        "src/time_zone_if.cc",
+        "src/time_zone_if.h",
+        "src/time_zone_impl.cc",
+        "src/time_zone_impl.h",
+        "src/time_zone_info.cc",
+        "src/time_zone_info.h",
+        "src/time_zone_libc.cc",
+        "src/time_zone_libc.h",
+        "src/time_zone_lookup.cc",
+        "src/time_zone_posix.cc",
+        "src/time_zone_posix.h",
+        "src/tzfile.h",
+        "src/zone_info_source.cc",
+    ],
+    hdrs = [
+        "include/cctz/time_zone.h",
+        "include/cctz/zone_info_source.h",
+    ],
+    linkopts = select({
+        ":osx": [
+            "-framework Foundation",
+        ],
+        ":ios": [
+            "-framework Foundation",
+        ],
+        "//conditions:default": [],
+    }),
+    visibility = ["//visibility:public"],
+    deps = [
+        ":civil_time",
+        "//absl/base:config",
+    ],
+)
+
+### tests
+
+cc_test(
+    name = "civil_time_test",
+    size = "small",
+    srcs = ["src/civil_time_test.cc"],
+    deps = [
+        ":civil_time",
+        "//absl/base:config",
+        "@com_google_googletest//:gtest_main",
+    ],
+)
+
+cc_test(
+    name = "time_zone_format_test",
+    size = "small",
+    srcs = ["src/time_zone_format_test.cc"],
+    data = [":zoneinfo"],
+    tags = [
+        "no_test_android_arm",
+        "no_test_android_arm64",
+        "no_test_android_x86",
+    ],
+    deps = [
+        ":civil_time",
+        ":time_zone",
+        "//absl/base:config",
+        "@com_google_googletest//:gtest_main",
+    ],
+)
+
+cc_test(
+    name = "time_zone_lookup_test",
+    size = "small",
+    timeout = "moderate",
+    srcs = ["src/time_zone_lookup_test.cc"],
+    data = [":zoneinfo"],
+    tags = [
+        "no_test_android_arm",
+        "no_test_android_arm64",
+        "no_test_android_x86",
+    ],
+    deps = [
+        ":civil_time",
+        ":time_zone",
+        "//absl/base:config",
+        "@com_google_googletest//:gtest_main",
+    ],
+)
+
+### benchmarks
+
+cc_test(
+    name = "cctz_benchmark",
+    srcs = [
+        "src/cctz_benchmark.cc",
+        "src/time_zone_if.h",
+        "src/time_zone_impl.h",
+        "src/time_zone_info.h",
+        "src/tzfile.h",
+    ],
+    linkstatic = 1,
+    tags = ["benchmark"],
+    deps = [
+        ":civil_time",
+        ":time_zone",
+        "//absl/base:config",
+        "@com_github_google_benchmark//:benchmark_main",
+    ],
+)
+
+### examples
+
+### binaries
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/civil_time.h b/third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/civil_time.h
new file mode 100644
index 0000000000..d47ff86fe4
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/civil_time.h
@@ -0,0 +1,332 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_H_
+#define ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_H_
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time_detail.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// The term "civil time" refers to the legally recognized human-scale time
+// that is represented by the six fields YYYY-MM-DD hh:mm:ss. Modern-day civil
+// time follows the Gregorian Calendar and is a time-zone-independent concept.
+// A "date" is perhaps the most common example of a civil time (represented in
+// this library as cctz::civil_day). This library provides six classes and a
+// handful of functions that help with rounding, iterating, and arithmetic on
+// civil times while avoiding complications like daylight-saving time (DST).
+//
+// The following six classes form the core of this civil-time library:
+//
+//   * civil_second
+//   * civil_minute
+//   * civil_hour
+//   * civil_day
+//   * civil_month
+//   * civil_year
+//
+// Each class is a simple value type with the same interface for construction
+// and the same six accessors for each of the civil fields (year, month, day,
+// hour, minute, and second, aka YMDHMS). These classes differ only in their
+// alignment, which is indicated by the type name and specifies the field on
+// which arithmetic operates.
+//
+// Each class can be constructed by passing up to six optional integer
+// arguments representing the YMDHMS fields (in that order) to the
+// constructor. Omitted fields are assigned their minimum valid value. Hours,
+// minutes, and seconds will be set to 0, month and day will be set to 1, and
+// since there is no minimum valid year, it will be set to 1970. So, a
+// default-constructed civil-time object will have YMDHMS fields representing
+// "1970-01-01 00:00:00". Fields that are out-of-range are normalized (e.g.,
+// October 32 -> November 1) so that all civil-time objects represent valid
+// values.
+//
+// Each civil-time class is aligned to the civil-time field indicated in the
+// class's name after normalization. Alignment is performed by setting all the
+// inferior fields to their minimum valid value (as described above). The
+// following are examples of how each of the six types would align the fields
+// representing November 22, 2015 at 12:34:56 in the afternoon. (Note: the
+// string format used here is not important; it's just a shorthand way of
+// showing the six YMDHMS fields.)
+//
+//   civil_second  2015-11-22 12:34:56
+//   civil_minute  2015-11-22 12:34:00
+//   civil_hour    2015-11-22 12:00:00
+//   civil_day     2015-11-22 00:00:00
+//   civil_month   2015-11-01 00:00:00
+//   civil_year    2015-01-01 00:00:00
+//
+// Each civil-time type performs arithmetic on the field to which it is
+// aligned. This means that adding 1 to a civil_day increments the day field
+// (normalizing as necessary), and subtracting 7 from a civil_month operates
+// on the month field (normalizing as necessary). All arithmetic produces a
+// valid civil time. Difference requires two similarly aligned civil-time
+// objects and returns the scalar answer in units of the objects' alignment.
+// For example, the difference between two civil_hour objects will give an
+// answer in units of civil hours.
+//
+// In addition to the six civil-time types just described, there are
+// a handful of helper functions and algorithms for performing common
+// calculations. These are described below.
+//
+// Note: In C++14 and later, this library is usable in a constexpr context.
+//
+// CONSTRUCTION:
+//
+// Each of the civil-time types can be constructed in two ways: by directly
+// passing to the constructor up to six (optional) integers representing the
+// YMDHMS fields, or by copying the YMDHMS fields from a differently aligned
+// civil-time type.
+//
+//   civil_day default_value;  // 1970-01-01 00:00:00
+//
+//   civil_day a(2015, 2, 3);           // 2015-02-03 00:00:00
+//   civil_day b(2015, 2, 3, 4, 5, 6);  // 2015-02-03 00:00:00
+//   civil_day c(2015);                 // 2015-01-01 00:00:00
+//
+//   civil_second ss(2015, 2, 3, 4, 5, 6);  // 2015-02-03 04:05:06
+//   civil_minute mm(ss);                   // 2015-02-03 04:05:00
+//   civil_hour hh(mm);                     // 2015-02-03 04:00:00
+//   civil_day d(hh);                       // 2015-02-03 00:00:00
+//   civil_month m(d);                      // 2015-02-01 00:00:00
+//   civil_year y(m);                       // 2015-01-01 00:00:00
+//
+//   m = civil_month(y);     // 2015-01-01 00:00:00
+//   d = civil_day(m);       // 2015-01-01 00:00:00
+//   hh = civil_hour(d);     // 2015-01-01 00:00:00
+//   mm = civil_minute(hh);  // 2015-01-01 00:00:00
+//   ss = civil_second(mm);  // 2015-01-01 00:00:00
+//
+// ALIGNMENT CONVERSION:
+//
+// The alignment of a civil-time object cannot change, but the object may be
+// used to construct a new object with a different alignment. This is referred
+// to as "realigning". When realigning to a type with the same or more
+// precision (e.g., civil_day -> civil_second), the conversion may be
+// performed implicitly since no information is lost. However, if information
+// could be discarded (e.g., civil_second -> civil_day), the conversion must
+// be explicit at the call site.
+//
+//   void fun(const civil_day& day);
+//
+//   civil_second cs;
+//   fun(cs);  // Won't compile because data may be discarded
+//   fun(civil_day(cs));  // OK: explicit conversion
+//
+//   civil_day cd;
+//   fun(cd);  // OK: no conversion needed
+//
+//   civil_month cm;
+//   fun(cm);  // OK: implicit conversion to civil_day
+//
+// NORMALIZATION:
+//
+// Integer arguments passed to the constructor may be out-of-range, in which
+// case they are normalized to produce a valid civil-time object. This enables
+// natural arithmetic on constructor arguments without worrying about the
+// field's range. Normalization guarantees that there are no invalid
+// civil-time objects.
+//
+//   civil_day d(2016, 10, 32);  // Out-of-range day; normalized to 2016-11-01
+//
+// Note: If normalization is undesired, you can signal an error by comparing
+// the constructor arguments to the normalized values returned by the YMDHMS
+// properties.
+//
+// PROPERTIES:
+//
+// All civil-time types have accessors for all six of the civil-time fields:
+// year, month, day, hour, minute, and second. Recall that fields inferior to
+// the type's alignment will be set to their minimum valid value.
+//
+//   civil_day d(2015, 6, 28);
+//   // d.year() == 2015
+//   // d.month() == 6
+//   // d.day() == 28
+//   // d.hour() == 0
+//   // d.minute() == 0
+//   // d.second() == 0
+//
+// COMPARISON:
+//
+// Comparison always considers all six YMDHMS fields, regardless of the type's
+// alignment. Comparison between differently aligned civil-time types is
+// allowed.
+//
+//   civil_day feb_3(2015, 2, 3);  // 2015-02-03 00:00:00
+//   civil_day mar_4(2015, 3, 4);  // 2015-03-04 00:00:00
+//   // feb_3 < mar_4
+//   // civil_year(feb_3) == civil_year(mar_4)
+//
+//   civil_second feb_3_noon(2015, 2, 3, 12, 0, 0);  // 2015-02-03 12:00:00
+//   // feb_3 < feb_3_noon
+//   // feb_3 == civil_day(feb_3_noon)
+//
+//   // Iterates all the days of February 2015.
+//   for (civil_day d(2015, 2, 1); d < civil_month(2015, 3); ++d) {
+//     // ...
+//   }
+//
+// STREAMING:
+//
+// Each civil-time type may be sent to an output stream using operator<<().
+// The output format follows the pattern "YYYY-MM-DDThh:mm:ss" where fields
+// inferior to the type's alignment are omitted.
+//
+//   civil_second cs(2015, 2, 3, 4, 5, 6);
+//   std::cout << cs << "\n";  // Outputs: 2015-02-03T04:05:06
+//
+//   civil_day cd(cs);
+//   std::cout << cd << "\n";  // Outputs: 2015-02-03
+//
+//   civil_year cy(cs);
+//   std::cout << cy << "\n";  // Outputs: 2015
+//
+// ARITHMETIC:
+//
+// Civil-time types support natural arithmetic operators such as addition,
+// subtraction, and difference. Arithmetic operates on the civil-time field
+// indicated in the type's name. Difference requires arguments with the same
+// alignment and returns the answer in units of the alignment.
+//
+//   civil_day a(2015, 2, 3);
+//   ++a;                         // 2015-02-04 00:00:00
+//   --a;                         // 2015-02-03 00:00:00
+//   civil_day b = a + 1;         // 2015-02-04 00:00:00
+//   civil_day c = 1 + b;         // 2015-02-05 00:00:00
+//   int n = c - a;               // n = 2 (civil days)
+//   int m = c - civil_month(c);  // Won't compile: different types.
+//
+// EXAMPLE: Adding a month to January 31.
+//
+// One of the classic questions that arises when considering a civil-time
+// library (or a date library or a date/time library) is this: "What happens
+// when you add a month to January 31?" This is an interesting question
+// because there could be a number of possible answers:
+//
+//   1. March 3 (or 2 if a leap year). This may make sense if the operation
+//      wants the equivalent of February 31.
+//   2. February 28 (or 29 if a leap year). This may make sense if the operation
+//      wants the last day of January to go to the last day of February.
+//   3. Error. The caller may get some error, an exception, an invalid date
+//      object, or maybe false is returned. This may make sense because there is
+//      no single unambiguously correct answer to the question.
+//
+// Practically speaking, any answer that is not what the programmer intended
+// is the wrong answer.
+//
+// This civil-time library avoids the problem by making it impossible to ask
+// ambiguous questions. All civil-time objects are aligned to a particular
+// civil-field boundary (such as aligned to a year, month, day, hour, minute,
+// or second), and arithmetic operates on the field to which the object is
+// aligned. This means that in order to "add a month" the object must first be
+// aligned to a month boundary, which is equivalent to the first day of that
+// month.
+//
+// Of course, there are ways to compute an answer the question at hand using
+// this civil-time library, but they require the programmer to be explicit
+// about the answer they expect. To illustrate, let's see how to compute all
+// three of the above possible answers to the question of "Jan 31 plus 1
+// month":
+//
+//   const civil_day d(2015, 1, 31);
+//
+//   // Answer 1:
+//   // Add 1 to the month field in the constructor, and rely on normalization.
+//   const auto ans_normalized = civil_day(d.year(), d.month() + 1, d.day());
+//   // ans_normalized == 2015-03-03 (aka Feb 31)
+//
+//   // Answer 2:
+//   // Add 1 to month field, capping to the end of next month.
+//   const auto next_month = civil_month(d) + 1;
+//   const auto last_day_of_next_month = civil_day(next_month + 1) - 1;
+//   const auto ans_capped = std::min(ans_normalized, last_day_of_next_month);
+//   // ans_capped == 2015-02-28
+//
+//   // Answer 3:
+//   // Signal an error if the normalized answer is not in next month.
+//   if (civil_month(ans_normalized) != next_month) {
+//     // error, month overflow
+//   }
+//
+using civil_year = detail::civil_year;
+using civil_month = detail::civil_month;
+using civil_day = detail::civil_day;
+using civil_hour = detail::civil_hour;
+using civil_minute = detail::civil_minute;
+using civil_second = detail::civil_second;
+
+// An enum class with members monday, tuesday, wednesday, thursday, friday,
+// saturday, and sunday. These enum values may be sent to an output stream
+// using operator<<(). The result is the full weekday name in English with a
+// leading capital letter.
+//
+//   weekday wd = weekday::thursday;
+//   std::cout << wd << "\n";  // Outputs: Thursday
+//
+using detail::weekday;
+
+// Returns the weekday for the given civil-time value.
+//
+//   civil_day a(2015, 8, 13);
+//   weekday wd = get_weekday(a);  // wd == weekday::thursday
+//
+using detail::get_weekday;
+
+// Returns the civil_day that strictly follows or precedes the given
+// civil_day, and that falls on the given weekday.
+//
+// For example, given:
+//
+//     August 2015
+// Su Mo Tu We Th Fr Sa
+//                    1
+//  2  3  4  5  6  7  8
+//  9 10 11 12 13 14 15
+// 16 17 18 19 20 21 22
+// 23 24 25 26 27 28 29
+// 30 31
+//
+//   civil_day a(2015, 8, 13);  // get_weekday(a) == weekday::thursday
+//   civil_day b = next_weekday(a, weekday::thursday);  // b = 2015-08-20
+//   civil_day c = prev_weekday(a, weekday::thursday);  // c = 2015-08-06
+//
+//   civil_day d = ...
+//   // Gets the following Thursday if d is not already Thursday
+//   civil_day thurs1 = next_weekday(d - 1, weekday::thursday);
+//   // Gets the previous Thursday if d is not already Thursday
+//   civil_day thurs2 = prev_weekday(d + 1, weekday::thursday);
+//
+using detail::next_weekday;
+using detail::prev_weekday;
+
+// Returns the day-of-year for the given civil-time value.
+//
+//   civil_day a(2015, 1, 1);
+//   int yd_jan_1 = get_yearday(a);   // yd_jan_1 = 1
+//   civil_day b(2015, 12, 31);
+//   int yd_dec_31 = get_yearday(b);  // yd_dec_31 = 365
+//
+using detail::get_yearday;
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_H_
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/civil_time_detail.h b/third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/civil_time_detail.h
new file mode 100644
index 0000000000..4cde96f1aa
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/civil_time_detail.h
@@ -0,0 +1,622 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_DETAIL_H_
+#define ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_DETAIL_H_
+
+#include <cstdint>
+#include <limits>
+#include <ostream>
+#include <type_traits>
+
+#include "absl/base/config.h"
+
+// Disable constexpr support unless we are in C++14 mode.
+#if __cpp_constexpr >= 201304 || (defined(_MSC_VER) && _MSC_VER >= 1910)
+#define CONSTEXPR_D constexpr  // data
+#define CONSTEXPR_F constexpr  // function
+#define CONSTEXPR_M constexpr  // member
+#else
+#define CONSTEXPR_D const
+#define CONSTEXPR_F inline
+#define CONSTEXPR_M
+#endif
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// Support years that at least span the range of 64-bit time_t values.
+using year_t = std::int_fast64_t;
+
+// Type alias that indicates an argument is not normalized (e.g., the
+// constructor parameters and operands/results of addition/subtraction).
+using diff_t = std::int_fast64_t;
+
+namespace detail {
+
+// Type aliases that indicate normalized argument values.
+using month_t = std::int_fast8_t;   // [1:12]
+using day_t = std::int_fast8_t;     // [1:31]
+using hour_t = std::int_fast8_t;    // [0:23]
+using minute_t = std::int_fast8_t;  // [0:59]
+using second_t = std::int_fast8_t;  // [0:59]
+
+// Normalized civil-time fields: Y-M-D HH:MM:SS.
+struct fields {
+  CONSTEXPR_M fields(year_t year, month_t month, day_t day, hour_t hour,
+                     minute_t minute, second_t second)
+      : y(year), m(month), d(day), hh(hour), mm(minute), ss(second) {}
+  std::int_least64_t y;
+  std::int_least8_t m;
+  std::int_least8_t d;
+  std::int_least8_t hh;
+  std::int_least8_t mm;
+  std::int_least8_t ss;
+};
+
+struct second_tag {};
+struct minute_tag : second_tag {};
+struct hour_tag : minute_tag {};
+struct day_tag : hour_tag {};
+struct month_tag : day_tag {};
+struct year_tag : month_tag {};
+
+////////////////////////////////////////////////////////////////////////
+
+// Field normalization (without avoidable overflow).
+
+namespace impl {
+
+CONSTEXPR_F bool is_leap_year(year_t y) noexcept {
+  return y % 4 == 0 && (y % 100 != 0 || y % 400 == 0);
+}
+CONSTEXPR_F int year_index(year_t y, month_t m) noexcept {
+  return (static_cast<int>((y + (m > 2)) % 400) + 400) % 400;
+}
+CONSTEXPR_F int days_per_century(year_t y, month_t m) noexcept {
+  const int yi = year_index(y, m);
+  return 36524 + (yi == 0 || yi > 300);
+}
+CONSTEXPR_F int days_per_4years(year_t y, month_t m) noexcept {
+  const int yi = year_index(y, m);
+  return 1460 + (yi == 0 || yi > 300 || (yi - 1) % 100 < 96);
+}
+CONSTEXPR_F int days_per_year(year_t y, month_t m) noexcept {
+  return is_leap_year(y + (m > 2)) ? 366 : 365;
+}
+CONSTEXPR_F int days_per_month(year_t y, month_t m) noexcept {
+  CONSTEXPR_D int k_days_per_month[1 + 12] = {
+      -1, 31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31  // non leap year
+  };
+  return k_days_per_month[m] + (m == 2 && is_leap_year(y));
+}
+
+CONSTEXPR_F fields n_day(year_t y, month_t m, diff_t d, diff_t cd, hour_t hh,
+                         minute_t mm, second_t ss) noexcept {
+  y += (cd / 146097) * 400;
+  cd %= 146097;
+  if (cd < 0) {
+    y -= 400;
+    cd += 146097;
+  }
+  y += (d / 146097) * 400;
+  d = d % 146097 + cd;
+  if (d > 0) {
+    if (d > 146097) {
+      y += 400;
+      d -= 146097;
+    }
+  } else {
+    if (d > -365) {
+      // We often hit the previous year when stepping a civil time backwards,
+      // so special case it to avoid counting up by 100/4/1-year chunks.
+      y -= 1;
+      d += days_per_year(y, m);
+    } else {
+      y -= 400;
+      d += 146097;
+    }
+  }
+  if (d > 365) {
+    for (int n = days_per_century(y, m); d > n; n = days_per_century(y, m)) {
+      d -= n;
+      y += 100;
+    }
+    for (int n = days_per_4years(y, m); d > n; n = days_per_4years(y, m)) {
+      d -= n;
+      y += 4;
+    }
+    for (int n = days_per_year(y, m); d > n; n = days_per_year(y, m)) {
+      d -= n;
+      ++y;
+    }
+  }
+  if (d > 28) {
+    for (int n = days_per_month(y, m); d > n; n = days_per_month(y, m)) {
+      d -= n;
+      if (++m > 12) {
+        ++y;
+        m = 1;
+      }
+    }
+  }
+  return fields(y, m, static_cast<day_t>(d), hh, mm, ss);
+}
+CONSTEXPR_F fields n_mon(year_t y, diff_t m, diff_t d, diff_t cd, hour_t hh,
+                         minute_t mm, second_t ss) noexcept {
+  if (m != 12) {
+    y += m / 12;
+    m %= 12;
+    if (m <= 0) {
+      y -= 1;
+      m += 12;
+    }
+  }
+  return n_day(y, static_cast<month_t>(m), d, cd, hh, mm, ss);
+}
+CONSTEXPR_F fields n_hour(year_t y, diff_t m, diff_t d, diff_t cd, diff_t hh,
+                          minute_t mm, second_t ss) noexcept {
+  cd += hh / 24;
+  hh %= 24;
+  if (hh < 0) {
+    cd -= 1;
+    hh += 24;
+  }
+  return n_mon(y, m, d, cd, static_cast<hour_t>(hh), mm, ss);
+}
+CONSTEXPR_F fields n_min(year_t y, diff_t m, diff_t d, diff_t hh, diff_t ch,
+                         diff_t mm, second_t ss) noexcept {
+  ch += mm / 60;
+  mm %= 60;
+  if (mm < 0) {
+    ch -= 1;
+    mm += 60;
+  }
+  return n_hour(y, m, d, hh / 24 + ch / 24, hh % 24 + ch % 24,
+                static_cast<minute_t>(mm), ss);
+}
+CONSTEXPR_F fields n_sec(year_t y, diff_t m, diff_t d, diff_t hh, diff_t mm,
+                         diff_t ss) noexcept {
+  // Optimization for when (non-constexpr) fields are already normalized.
+  if (0 <= ss && ss < 60) {
+    const second_t nss = static_cast<second_t>(ss);
+    if (0 <= mm && mm < 60) {
+      const minute_t nmm = static_cast<minute_t>(mm);
+      if (0 <= hh && hh < 24) {
+        const hour_t nhh = static_cast<hour_t>(hh);
+        if (1 <= d && d <= 28 && 1 <= m && m <= 12) {
+          const day_t nd = static_cast<day_t>(d);
+          const month_t nm = static_cast<month_t>(m);
+          return fields(y, nm, nd, nhh, nmm, nss);
+        }
+        return n_mon(y, m, d, 0, nhh, nmm, nss);
+      }
+      return n_hour(y, m, d, hh / 24, hh % 24, nmm, nss);
+    }
+    return n_min(y, m, d, hh, mm / 60, mm % 60, nss);
+  }
+  diff_t cm = ss / 60;
+  ss %= 60;
+  if (ss < 0) {
+    cm -= 1;
+    ss += 60;
+  }
+  return n_min(y, m, d, hh, mm / 60 + cm / 60, mm % 60 + cm % 60,
+               static_cast<second_t>(ss));
+}
+
+}  // namespace impl
+
+////////////////////////////////////////////////////////////////////////
+
+// Increments the indicated (normalized) field by "n".
+CONSTEXPR_F fields step(second_tag, fields f, diff_t n) noexcept {
+  return impl::n_sec(f.y, f.m, f.d, f.hh, f.mm + n / 60, f.ss + n % 60);
+}
+CONSTEXPR_F fields step(minute_tag, fields f, diff_t n) noexcept {
+  return impl::n_min(f.y, f.m, f.d, f.hh + n / 60, 0, f.mm + n % 60, f.ss);
+}
+CONSTEXPR_F fields step(hour_tag, fields f, diff_t n) noexcept {
+  return impl::n_hour(f.y, f.m, f.d + n / 24, 0, f.hh + n % 24, f.mm, f.ss);
+}
+CONSTEXPR_F fields step(day_tag, fields f, diff_t n) noexcept {
+  return impl::n_day(f.y, f.m, f.d, n, f.hh, f.mm, f.ss);
+}
+CONSTEXPR_F fields step(month_tag, fields f, diff_t n) noexcept {
+  return impl::n_mon(f.y + n / 12, f.m + n % 12, f.d, 0, f.hh, f.mm, f.ss);
+}
+CONSTEXPR_F fields step(year_tag, fields f, diff_t n) noexcept {
+  return fields(f.y + n, f.m, f.d, f.hh, f.mm, f.ss);
+}
+
+////////////////////////////////////////////////////////////////////////
+
+namespace impl {
+
+// Returns (v * f + a) but avoiding intermediate overflow when possible.
+CONSTEXPR_F diff_t scale_add(diff_t v, diff_t f, diff_t a) noexcept {
+  return (v < 0) ? ((v + 1) * f + a) - f : ((v - 1) * f + a) + f;
+}
+
+// Map a (normalized) Y/M/D to the number of days before/after 1970-01-01.
+// Probably overflows for years outside [-292277022656:292277026595].
+CONSTEXPR_F diff_t ymd_ord(year_t y, month_t m, day_t d) noexcept {
+  const diff_t eyear = (m <= 2) ? y - 1 : y;
+  const diff_t era = (eyear >= 0 ? eyear : eyear - 399) / 400;
+  const diff_t yoe = eyear - era * 400;
+  const diff_t doy = (153 * (m + (m > 2 ? -3 : 9)) + 2) / 5 + d - 1;
+  const diff_t doe = yoe * 365 + yoe / 4 - yoe / 100 + doy;
+  return era * 146097 + doe - 719468;
+}
+
+// Returns the difference in days between two normalized Y-M-D tuples.
+// ymd_ord() will encounter integer overflow given extreme year values,
+// yet the difference between two such extreme values may actually be
+// small, so we take a little care to avoid overflow when possible by
+// exploiting the 146097-day cycle.
+CONSTEXPR_F diff_t day_difference(year_t y1, month_t m1, day_t d1, year_t y2,
+                                  month_t m2, day_t d2) noexcept {
+  const diff_t a_c4_off = y1 % 400;
+  const diff_t b_c4_off = y2 % 400;
+  diff_t c4_diff = (y1 - a_c4_off) - (y2 - b_c4_off);
+  diff_t delta = ymd_ord(a_c4_off, m1, d1) - ymd_ord(b_c4_off, m2, d2);
+  if (c4_diff > 0 && delta < 0) {
+    delta += 2 * 146097;
+    c4_diff -= 2 * 400;
+  } else if (c4_diff < 0 && delta > 0) {
+    delta -= 2 * 146097;
+    c4_diff += 2 * 400;
+  }
+  return (c4_diff / 400 * 146097) + delta;
+}
+
+}  // namespace impl
+
+// Returns the difference between fields structs using the indicated unit.
+CONSTEXPR_F diff_t difference(year_tag, fields f1, fields f2) noexcept {
+  return f1.y - f2.y;
+}
+CONSTEXPR_F diff_t difference(month_tag, fields f1, fields f2) noexcept {
+  return impl::scale_add(difference(year_tag{}, f1, f2), 12, (f1.m - f2.m));
+}
+CONSTEXPR_F diff_t difference(day_tag, fields f1, fields f2) noexcept {
+  return impl::day_difference(f1.y, f1.m, f1.d, f2.y, f2.m, f2.d);
+}
+CONSTEXPR_F diff_t difference(hour_tag, fields f1, fields f2) noexcept {
+  return impl::scale_add(difference(day_tag{}, f1, f2), 24, (f1.hh - f2.hh));
+}
+CONSTEXPR_F diff_t difference(minute_tag, fields f1, fields f2) noexcept {
+  return impl::scale_add(difference(hour_tag{}, f1, f2), 60, (f1.mm - f2.mm));
+}
+CONSTEXPR_F diff_t difference(second_tag, fields f1, fields f2) noexcept {
+  return impl::scale_add(difference(minute_tag{}, f1, f2), 60, f1.ss - f2.ss);
+}
+
+////////////////////////////////////////////////////////////////////////
+
+// Aligns the (normalized) fields struct to the indicated field.
+CONSTEXPR_F fields align(second_tag, fields f) noexcept { return f; }
+CONSTEXPR_F fields align(minute_tag, fields f) noexcept {
+  return fields{f.y, f.m, f.d, f.hh, f.mm, 0};
+}
+CONSTEXPR_F fields align(hour_tag, fields f) noexcept {
+  return fields{f.y, f.m, f.d, f.hh, 0, 0};
+}
+CONSTEXPR_F fields align(day_tag, fields f) noexcept {
+  return fields{f.y, f.m, f.d, 0, 0, 0};
+}
+CONSTEXPR_F fields align(month_tag, fields f) noexcept {
+  return fields{f.y, f.m, 1, 0, 0, 0};
+}
+CONSTEXPR_F fields align(year_tag, fields f) noexcept {
+  return fields{f.y, 1, 1, 0, 0, 0};
+}
+
+////////////////////////////////////////////////////////////////////////
+
+namespace impl {
+
+template <typename H>
+H AbslHashValueImpl(second_tag, H h, fields f) {
+  return H::combine(std::move(h), f.y, f.m, f.d, f.hh, f.mm, f.ss);
+}
+template <typename H>
+H AbslHashValueImpl(minute_tag, H h, fields f) {
+  return H::combine(std::move(h), f.y, f.m, f.d, f.hh, f.mm);
+}
+template <typename H>
+H AbslHashValueImpl(hour_tag, H h, fields f) {
+  return H::combine(std::move(h), f.y, f.m, f.d, f.hh);
+}
+template <typename H>
+H AbslHashValueImpl(day_tag, H h, fields f) {
+  return H::combine(std::move(h), f.y, f.m, f.d);
+}
+template <typename H>
+H AbslHashValueImpl(month_tag, H h, fields f) {
+  return H::combine(std::move(h), f.y, f.m);
+}
+template <typename H>
+H AbslHashValueImpl(year_tag, H h, fields f) {
+  return H::combine(std::move(h), f.y);
+}
+
+}  // namespace impl
+
+////////////////////////////////////////////////////////////////////////
+
+template <typename T>
+class civil_time {
+ public:
+  explicit CONSTEXPR_M civil_time(year_t y, diff_t m = 1, diff_t d = 1,
+                                  diff_t hh = 0, diff_t mm = 0,
+                                  diff_t ss = 0) noexcept
+      : civil_time(impl::n_sec(y, m, d, hh, mm, ss)) {}
+
+  CONSTEXPR_M civil_time() noexcept : f_{1970, 1, 1, 0, 0, 0} {}
+  civil_time(const civil_time&) = default;
+  civil_time& operator=(const civil_time&) = default;
+
+  // Conversion between civil times of different alignment. Conversion to
+  // a more precise alignment is allowed implicitly (e.g., day -> hour),
+  // but conversion where information is discarded must be explicit
+  // (e.g., second -> minute).
+  template <typename U, typename S>
+  using preserves_data =
+      typename std::enable_if<std::is_base_of<U, S>::value>::type;
+  template <typename U>
+  CONSTEXPR_M civil_time(const civil_time<U>& ct,
+                         preserves_data<T, U>* = nullptr) noexcept
+      : civil_time(ct.f_) {}
+  template <typename U>
+  explicit CONSTEXPR_M civil_time(const civil_time<U>& ct,
+                                  preserves_data<U, T>* = nullptr) noexcept
+      : civil_time(ct.f_) {}
+
+  // Factories for the maximum/minimum representable civil_time.
+  static CONSTEXPR_F civil_time(max)() {
+    const auto max_year = (std::numeric_limits<std::int_least64_t>::max)();
+    return civil_time(max_year, 12, 31, 23, 59, 59);
+  }
+  static CONSTEXPR_F civil_time(min)() {
+    const auto min_year = (std::numeric_limits<std::int_least64_t>::min)();
+    return civil_time(min_year, 1, 1, 0, 0, 0);
+  }
+
+  // Field accessors.  Note: All but year() return an int.
+  CONSTEXPR_M year_t year() const noexcept { return f_.y; }
+  CONSTEXPR_M int month() const noexcept { return f_.m; }
+  CONSTEXPR_M int day() const noexcept { return f_.d; }
+  CONSTEXPR_M int hour() const noexcept { return f_.hh; }
+  CONSTEXPR_M int minute() const noexcept { return f_.mm; }
+  CONSTEXPR_M int second() const noexcept { return f_.ss; }
+
+  // Assigning arithmetic.
+  CONSTEXPR_M civil_time& operator+=(diff_t n) noexcept {
+    f_ = step(T{}, f_, n);
+    return *this;
+  }
+  CONSTEXPR_M civil_time& operator-=(diff_t n) noexcept {
+    if (n != (std::numeric_limits<diff_t>::min)()) {
+      f_ = step(T{}, f_, -n);
+    } else {
+      f_ = step(T{}, step(T{}, f_, -(n + 1)), 1);
+    }
+    return *this;
+  }
+  CONSTEXPR_M civil_time& operator++() noexcept { return *this += 1; }
+  CONSTEXPR_M civil_time operator++(int) noexcept {
+    const civil_time a = *this;
+    ++*this;
+    return a;
+  }
+  CONSTEXPR_M civil_time& operator--() noexcept { return *this -= 1; }
+  CONSTEXPR_M civil_time operator--(int) noexcept {
+    const civil_time a = *this;
+    --*this;
+    return a;
+  }
+
+  // Binary arithmetic operators.
+  friend CONSTEXPR_F civil_time operator+(civil_time a, diff_t n) noexcept {
+    return a += n;
+  }
+  friend CONSTEXPR_F civil_time operator+(diff_t n, civil_time a) noexcept {
+    return a += n;
+  }
+  friend CONSTEXPR_F civil_time operator-(civil_time a, diff_t n) noexcept {
+    return a -= n;
+  }
+  friend CONSTEXPR_F diff_t operator-(civil_time lhs, civil_time rhs) noexcept {
+    return difference(T{}, lhs.f_, rhs.f_);
+  }
+
+  template <typename H>
+  friend H AbslHashValue(H h, civil_time a) {
+    return impl::AbslHashValueImpl(T{}, std::move(h), a.f_);
+  }
+
+ private:
+  // All instantiations of this template are allowed to call the following
+  // private constructor and access the private fields member.
+  template <typename U>
+  friend class civil_time;
+
+  // The designated constructor that all others eventually call.
+  explicit CONSTEXPR_M civil_time(fields f) noexcept : f_(align(T{}, f)) {}
+
+  fields f_;
+};
+
+// Disallows difference between differently aligned types.
+// auto n = civil_day(...) - civil_hour(...);  // would be confusing.
+template <typename T, typename U>
+CONSTEXPR_F diff_t operator-(civil_time<T>, civil_time<U>) = delete;
+
+using civil_year = civil_time<year_tag>;
+using civil_month = civil_time<month_tag>;
+using civil_day = civil_time<day_tag>;
+using civil_hour = civil_time<hour_tag>;
+using civil_minute = civil_time<minute_tag>;
+using civil_second = civil_time<second_tag>;
+
+////////////////////////////////////////////////////////////////////////
+
+// Relational operators that work with differently aligned objects.
+// Always compares all six fields.
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator<(const civil_time<T1>& lhs,
+                           const civil_time<T2>& rhs) noexcept {
+  return (
+      lhs.year() < rhs.year() ||
+      (lhs.year() == rhs.year() &&
+       (lhs.month() < rhs.month() ||
+        (lhs.month() == rhs.month() &&
+         (lhs.day() < rhs.day() || (lhs.day() == rhs.day() &&
+                                    (lhs.hour() < rhs.hour() ||
+                                     (lhs.hour() == rhs.hour() &&
+                                      (lhs.minute() < rhs.minute() ||
+                                       (lhs.minute() == rhs.minute() &&
+                                        (lhs.second() < rhs.second())))))))))));
+}
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator<=(const civil_time<T1>& lhs,
+                            const civil_time<T2>& rhs) noexcept {
+  return !(rhs < lhs);
+}
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator>=(const civil_time<T1>& lhs,
+                            const civil_time<T2>& rhs) noexcept {
+  return !(lhs < rhs);
+}
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator>(const civil_time<T1>& lhs,
+                           const civil_time<T2>& rhs) noexcept {
+  return rhs < lhs;
+}
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator==(const civil_time<T1>& lhs,
+                            const civil_time<T2>& rhs) noexcept {
+  return lhs.year() == rhs.year() && lhs.month() == rhs.month() &&
+         lhs.day() == rhs.day() && lhs.hour() == rhs.hour() &&
+         lhs.minute() == rhs.minute() && lhs.second() == rhs.second();
+}
+template <typename T1, typename T2>
+CONSTEXPR_F bool operator!=(const civil_time<T1>& lhs,
+                            const civil_time<T2>& rhs) noexcept {
+  return !(lhs == rhs);
+}
+
+////////////////////////////////////////////////////////////////////////
+
+enum class weekday {
+  monday,
+  tuesday,
+  wednesday,
+  thursday,
+  friday,
+  saturday,
+  sunday,
+};
+
+CONSTEXPR_F weekday get_weekday(const civil_second& cs) noexcept {
+  CONSTEXPR_D weekday k_weekday_by_mon_off[13] = {
+      weekday::monday,    weekday::tuesday,  weekday::wednesday,
+      weekday::thursday,  weekday::friday,   weekday::saturday,
+      weekday::sunday,    weekday::monday,   weekday::tuesday,
+      weekday::wednesday, weekday::thursday, weekday::friday,
+      weekday::saturday,
+  };
+  CONSTEXPR_D int k_weekday_offsets[1 + 12] = {
+      -1, 0, 3, 2, 5, 0, 3, 5, 1, 4, 6, 2, 4,
+  };
+  year_t wd = 2400 + (cs.year() % 400) - (cs.month() < 3);
+  wd += wd / 4 - wd / 100 + wd / 400;
+  wd += k_weekday_offsets[cs.month()] + cs.day();
+  return k_weekday_by_mon_off[wd % 7 + 6];
+}
+
+////////////////////////////////////////////////////////////////////////
+
+CONSTEXPR_F civil_day next_weekday(civil_day cd, weekday wd) noexcept {
+  CONSTEXPR_D weekday k_weekdays_forw[14] = {
+      weekday::monday,    weekday::tuesday,  weekday::wednesday,
+      weekday::thursday,  weekday::friday,   weekday::saturday,
+      weekday::sunday,    weekday::monday,   weekday::tuesday,
+      weekday::wednesday, weekday::thursday, weekday::friday,
+      weekday::saturday,  weekday::sunday,
+  };
+  weekday base = get_weekday(cd);
+  for (int i = 0;; ++i) {
+    if (base == k_weekdays_forw[i]) {
+      for (int j = i + 1;; ++j) {
+        if (wd == k_weekdays_forw[j]) {
+          return cd + (j - i);
+        }
+      }
+    }
+  }
+}
+
+CONSTEXPR_F civil_day prev_weekday(civil_day cd, weekday wd) noexcept {
+  CONSTEXPR_D weekday k_weekdays_back[14] = {
+      weekday::sunday,   weekday::saturday,  weekday::friday,
+      weekday::thursday, weekday::wednesday, weekday::tuesday,
+      weekday::monday,   weekday::sunday,    weekday::saturday,
+      weekday::friday,   weekday::thursday,  weekday::wednesday,
+      weekday::tuesday,  weekday::monday,
+  };
+  weekday base = get_weekday(cd);
+  for (int i = 0;; ++i) {
+    if (base == k_weekdays_back[i]) {
+      for (int j = i + 1;; ++j) {
+        if (wd == k_weekdays_back[j]) {
+          return cd - (j - i);
+        }
+      }
+    }
+  }
+}
+
+CONSTEXPR_F int get_yearday(const civil_second& cs) noexcept {
+  CONSTEXPR_D int k_month_offsets[1 + 12] = {
+      -1, 0, 31, 59, 90, 120, 151, 181, 212, 243, 273, 304, 334,
+  };
+  const int feb29 = (cs.month() > 2 && impl::is_leap_year(cs.year()));
+  return k_month_offsets[cs.month()] + feb29 + cs.day();
+}
+
+////////////////////////////////////////////////////////////////////////
+
+std::ostream& operator<<(std::ostream& os, const civil_year& y);
+std::ostream& operator<<(std::ostream& os, const civil_month& m);
+std::ostream& operator<<(std::ostream& os, const civil_day& d);
+std::ostream& operator<<(std::ostream& os, const civil_hour& h);
+std::ostream& operator<<(std::ostream& os, const civil_minute& m);
+std::ostream& operator<<(std::ostream& os, const civil_second& s);
+std::ostream& operator<<(std::ostream& os, weekday wd);
+
+}  // namespace detail
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+#undef CONSTEXPR_M
+#undef CONSTEXPR_F
+#undef CONSTEXPR_D
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_CIVIL_TIME_DETAIL_H_
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/time_zone.h b/third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/time_zone.h
new file mode 100644
index 0000000000..d4ea90ef7e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/time_zone.h
@@ -0,0 +1,384 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+// A library for translating between absolute times (represented by
+// std::chrono::time_points of the std::chrono::system_clock) and civil
+// times (represented by cctz::civil_second) using the rules defined by
+// a time zone (cctz::time_zone).
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_H_
+
+#include <chrono>
+#include <cstdint>
+#include <string>
+#include <utility>
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// Convenience aliases. Not intended as public API points.
+template <typename D>
+using time_point = std::chrono::time_point<std::chrono::system_clock, D>;
+using seconds = std::chrono::duration<std::int_fast64_t>;
+using sys_seconds = seconds;  // Deprecated.  Use cctz::seconds instead.
+
+namespace detail {
+template <typename D>
+inline std::pair<time_point<seconds>, D> split_seconds(
+    const time_point<D>& tp) {
+  auto sec = std::chrono::time_point_cast<seconds>(tp);
+  auto sub = tp - sec;
+  if (sub.count() < 0) {
+    sec -= seconds(1);
+    sub += seconds(1);
+  }
+  return {sec, std::chrono::duration_cast<D>(sub)};
+}
+inline std::pair<time_point<seconds>, seconds> split_seconds(
+    const time_point<seconds>& tp) {
+  return {tp, seconds::zero()};
+}
+}  // namespace detail
+
+// cctz::time_zone is an opaque, small, value-type class representing a
+// geo-political region within which particular rules are used for mapping
+// between absolute and civil times. Time zones are named using the TZ
+// identifiers from the IANA Time Zone Database, such as "America/Los_Angeles"
+// or "Australia/Sydney". Time zones are created from factory functions such
+// as load_time_zone(). Note: strings like "PST" and "EDT" are not valid TZ
+// identifiers.
+//
+// Example:
+//   cctz::time_zone utc = cctz::utc_time_zone();
+//   cctz::time_zone pst = cctz::fixed_time_zone(std::chrono::hours(-8));
+//   cctz::time_zone loc = cctz::local_time_zone();
+//   cctz::time_zone lax;
+//   if (!cctz::load_time_zone("America/Los_Angeles", &lax)) { ... }
+//
+// See also:
+// - http://www.iana.org/time-zones
+// - https://en.wikipedia.org/wiki/Zoneinfo
+class time_zone {
+ public:
+  time_zone() : time_zone(nullptr) {}  // Equivalent to UTC
+  time_zone(const time_zone&) = default;
+  time_zone& operator=(const time_zone&) = default;
+
+  std::string name() const;
+
+  // An absolute_lookup represents the civil time (cctz::civil_second) within
+  // this time_zone at the given absolute time (time_point). There are
+  // additionally a few other fields that may be useful when working with
+  // older APIs, such as std::tm.
+  //
+  // Example:
+  //   const cctz::time_zone tz = ...
+  //   const auto tp = std::chrono::system_clock::now();
+  //   const cctz::time_zone::absolute_lookup al = tz.lookup(tp);
+  struct absolute_lookup {
+    civil_second cs;
+    // Note: The following fields exist for backward compatibility with older
+    // APIs. Accessing these fields directly is a sign of imprudent logic in
+    // the calling code. Modern time-related code should only access this data
+    // indirectly by way of cctz::format().
+    int offset;        // civil seconds east of UTC
+    bool is_dst;       // is offset non-standard?
+    const char* abbr;  // time-zone abbreviation (e.g., "PST")
+  };
+  absolute_lookup lookup(const time_point<seconds>& tp) const;
+  template <typename D>
+  absolute_lookup lookup(const time_point<D>& tp) const {
+    return lookup(detail::split_seconds(tp).first);
+  }
+
+  // A civil_lookup represents the absolute time(s) (time_point) that
+  // correspond to the given civil time (cctz::civil_second) within this
+  // time_zone. Usually the given civil time represents a unique instant
+  // in time, in which case the conversion is unambiguous. However,
+  // within this time zone, the given civil time may be skipped (e.g.,
+  // during a positive UTC offset shift), or repeated (e.g., during a
+  // negative UTC offset shift). To account for these possibilities,
+  // civil_lookup is richer than just a single time_point.
+  //
+  // In all cases the civil_lookup::kind enum will indicate the nature
+  // of the given civil-time argument, and the pre, trans, and post
+  // members will give the absolute time answers using the pre-transition
+  // offset, the transition point itself, and the post-transition offset,
+  // respectively (all three times are equal if kind == UNIQUE). If any
+  // of these three absolute times is outside the representable range of a
+  // time_point<seconds> the field is set to its maximum/minimum value.
+  //
+  // Example:
+  //   cctz::time_zone lax;
+  //   if (!cctz::load_time_zone("America/Los_Angeles", &lax)) { ... }
+  //
+  //   // A unique civil time.
+  //   auto jan01 = lax.lookup(cctz::civil_second(2011, 1, 1, 0, 0, 0));
+  //   // jan01.kind == cctz::time_zone::civil_lookup::UNIQUE
+  //   // jan01.pre    is 2011/01/01 00:00:00 -0800
+  //   // jan01.trans  is 2011/01/01 00:00:00 -0800
+  //   // jan01.post   is 2011/01/01 00:00:00 -0800
+  //
+  //   // A Spring DST transition, when there is a gap in civil time.
+  //   auto mar13 = lax.lookup(cctz::civil_second(2011, 3, 13, 2, 15, 0));
+  //   // mar13.kind == cctz::time_zone::civil_lookup::SKIPPED
+  //   // mar13.pre   is 2011/03/13 03:15:00 -0700
+  //   // mar13.trans is 2011/03/13 03:00:00 -0700
+  //   // mar13.post  is 2011/03/13 01:15:00 -0800
+  //
+  //   // A Fall DST transition, when civil times are repeated.
+  //   auto nov06 = lax.lookup(cctz::civil_second(2011, 11, 6, 1, 15, 0));
+  //   // nov06.kind == cctz::time_zone::civil_lookup::REPEATED
+  //   // nov06.pre   is 2011/11/06 01:15:00 -0700
+  //   // nov06.trans is 2011/11/06 01:00:00 -0800
+  //   // nov06.post  is 2011/11/06 01:15:00 -0800
+  struct civil_lookup {
+    enum civil_kind {
+      UNIQUE,    // the civil time was singular (pre == trans == post)
+      SKIPPED,   // the civil time did not exist (pre >= trans > post)
+      REPEATED,  // the civil time was ambiguous (pre < trans <= post)
+    } kind;
+    time_point<seconds> pre;    // uses the pre-transition offset
+    time_point<seconds> trans;  // instant of civil-offset change
+    time_point<seconds> post;   // uses the post-transition offset
+  };
+  civil_lookup lookup(const civil_second& cs) const;
+
+  // Finds the time of the next/previous offset change in this time zone.
+  //
+  // By definition, next_transition(tp, &trans) returns false when tp has
+  // its maximum value, and prev_transition(tp, &trans) returns false
+  // when tp has its minimum value. If the zone has no transitions, the
+  // result will also be false no matter what the argument.
+  //
+  // Otherwise, when tp has its minimum value, next_transition(tp, &trans)
+  // returns true and sets trans to the first recorded transition. Chains
+  // of calls to next_transition()/prev_transition() will eventually return
+  // false, but it is unspecified exactly when next_transition(tp, &trans)
+  // jumps to false, or what time is set by prev_transition(tp, &trans) for
+  // a very distant tp.
+  //
+  // Note: Enumeration of time-zone transitions is for informational purposes
+  // only. Modern time-related code should not care about when offset changes
+  // occur.
+  //
+  // Example:
+  //   cctz::time_zone nyc;
+  //   if (!cctz::load_time_zone("America/New_York", &nyc)) { ... }
+  //   const auto now = std::chrono::system_clock::now();
+  //   auto tp = cctz::time_point<cctz::seconds>::min();
+  //   cctz::time_zone::civil_transition trans;
+  //   while (tp <= now && nyc.next_transition(tp, &trans)) {
+  //     // transition: trans.from -> trans.to
+  //     tp = nyc.lookup(trans.to).trans;
+  //   }
+  struct civil_transition {
+    civil_second from;  // the civil time we jump from
+    civil_second to;    // the civil time we jump to
+  };
+  bool next_transition(const time_point<seconds>& tp,
+                       civil_transition* trans) const;
+  template <typename D>
+  bool next_transition(const time_point<D>& tp, civil_transition* trans) const {
+    return next_transition(detail::split_seconds(tp).first, trans);
+  }
+  bool prev_transition(const time_point<seconds>& tp,
+                       civil_transition* trans) const;
+  template <typename D>
+  bool prev_transition(const time_point<D>& tp, civil_transition* trans) const {
+    return prev_transition(detail::split_seconds(tp).first, trans);
+  }
+
+  // version() and description() provide additional information about the
+  // time zone. The content of each of the returned strings is unspecified,
+  // however, when the IANA Time Zone Database is the underlying data source
+  // the version() string will be in the familar form (e.g, "2018e") or
+  // empty when unavailable.
+  //
+  // Note: These functions are for informational or testing purposes only.
+  std::string version() const;  // empty when unknown
+  std::string description() const;
+
+  // Relational operators.
+  friend bool operator==(time_zone lhs, time_zone rhs) {
+    return &lhs.effective_impl() == &rhs.effective_impl();
+  }
+  friend bool operator!=(time_zone lhs, time_zone rhs) { return !(lhs == rhs); }
+
+  template <typename H>
+  friend H AbslHashValue(H h, time_zone tz) {
+    return H::combine(std::move(h), &tz.effective_impl());
+  }
+
+  class Impl;
+
+ private:
+  explicit time_zone(const Impl* impl) : impl_(impl) {}
+  const Impl& effective_impl() const;  // handles implicit UTC
+  const Impl* impl_;
+};
+
+// Loads the named time zone. May perform I/O on the initial load.
+// If the name is invalid, or some other kind of error occurs, returns
+// false and "*tz" is set to the UTC time zone.
+bool load_time_zone(const std::string& name, time_zone* tz);
+
+// Returns a time_zone representing UTC. Cannot fail.
+time_zone utc_time_zone();
+
+// Returns a time zone that is a fixed offset (seconds east) from UTC.
+// Note: If the absolute value of the offset is greater than 24 hours
+// you'll get UTC (i.e., zero offset) instead.
+time_zone fixed_time_zone(const seconds& offset);
+
+// Returns a time zone representing the local time zone. Falls back to UTC.
+// Note: local_time_zone.name() may only be something like "localtime".
+time_zone local_time_zone();
+
+// Returns the civil time (cctz::civil_second) within the given time zone at
+// the given absolute time (time_point). Since the additional fields provided
+// by the time_zone::absolute_lookup struct should rarely be needed in modern
+// code, this convert() function is simpler and should be preferred.
+template <typename D>
+inline civil_second convert(const time_point<D>& tp, const time_zone& tz) {
+  return tz.lookup(tp).cs;
+}
+
+// Returns the absolute time (time_point) that corresponds to the given civil
+// time within the given time zone. If the civil time is not unique (i.e., if
+// it was either repeated or non-existent), then the returned time_point is
+// the best estimate that preserves relative order. That is, this function
+// guarantees that if cs1 < cs2, then convert(cs1, tz) <= convert(cs2, tz).
+inline time_point<seconds> convert(const civil_second& cs,
+                                   const time_zone& tz) {
+  const time_zone::civil_lookup cl = tz.lookup(cs);
+  if (cl.kind == time_zone::civil_lookup::SKIPPED) return cl.trans;
+  return cl.pre;
+}
+
+namespace detail {
+using femtoseconds = std::chrono::duration<std::int_fast64_t, std::femto>;
+std::string format(const std::string&, const time_point<seconds>&,
+                   const femtoseconds&, const time_zone&);
+bool parse(const std::string&, const std::string&, const time_zone&,
+           time_point<seconds>*, femtoseconds*, std::string* err = nullptr);
+}  // namespace detail
+
+// Formats the given time_point in the given cctz::time_zone according to
+// the provided format string. Uses strftime()-like formatting options,
+// with the following extensions:
+//
+//   - %Ez  - RFC3339-compatible numeric UTC offset (+hh:mm or -hh:mm)
+//   - %E*z - Full-resolution numeric UTC offset (+hh:mm:ss or -hh:mm:ss)
+//   - %E#S - Seconds with # digits of fractional precision
+//   - %E*S - Seconds with full fractional precision (a literal '*')
+//   - %E#f - Fractional seconds with # digits of precision
+//   - %E*f - Fractional seconds with full precision (a literal '*')
+//   - %E4Y - Four-character years (-999 ... -001, 0000, 0001 ... 9999)
+//
+// Note that %E0S behaves like %S, and %E0f produces no characters. In
+// contrast %E*f always produces at least one digit, which may be '0'.
+//
+// Note that %Y produces as many characters as it takes to fully render the
+// year. A year outside of [-999:9999] when formatted with %E4Y will produce
+// more than four characters, just like %Y.
+//
+// Tip: Format strings should include the UTC offset (e.g., %z, %Ez, or %E*z)
+// so that the resulting string uniquely identifies an absolute time.
+//
+// Example:
+//   cctz::time_zone lax;
+//   if (!cctz::load_time_zone("America/Los_Angeles", &lax)) { ... }
+//   auto tp = cctz::convert(cctz::civil_second(2013, 1, 2, 3, 4, 5), lax);
+//   std::string f = cctz::format("%H:%M:%S", tp, lax);  // "03:04:05"
+//   f = cctz::format("%H:%M:%E3S", tp, lax);            // "03:04:05.000"
+template <typename D>
+inline std::string format(const std::string& fmt, const time_point<D>& tp,
+                          const time_zone& tz) {
+  const auto p = detail::split_seconds(tp);
+  const auto n = std::chrono::duration_cast<detail::femtoseconds>(p.second);
+  return detail::format(fmt, p.first, n, tz);
+}
+
+// Parses an input string according to the provided format string and
+// returns the corresponding time_point. Uses strftime()-like formatting
+// options, with the same extensions as cctz::format(), but with the
+// exceptions that %E#S is interpreted as %E*S, and %E#f as %E*f. %Ez
+// and %E*z also accept the same inputs.
+//
+// %Y consumes as many numeric characters as it can, so the matching data
+// should always be terminated with a non-numeric. %E4Y always consumes
+// exactly four characters, including any sign.
+//
+// Unspecified fields are taken from the default date and time of ...
+//
+//   "1970-01-01 00:00:00.0 +0000"
+//
+// For example, parsing a string of "15:45" (%H:%M) will return a time_point
+// that represents "1970-01-01 15:45:00.0 +0000".
+//
+// Note that parse() returns time instants, so it makes most sense to parse
+// fully-specified date/time strings that include a UTC offset (%z, %Ez, or
+// %E*z).
+//
+// Note also that parse() only heeds the fields year, month, day, hour,
+// minute, (fractional) second, and UTC offset. Other fields, like weekday (%a
+// or %A), while parsed for syntactic validity, are ignored in the conversion.
+//
+// Date and time fields that are out-of-range will be treated as errors rather
+// than normalizing them like cctz::civil_second() would do. For example, it
+// is an error to parse the date "Oct 32, 2013" because 32 is out of range.
+//
+// A second of ":60" is normalized to ":00" of the following minute with
+// fractional seconds discarded. The following table shows how the given
+// seconds and subseconds will be parsed:
+//
+//   "59.x" -> 59.x  // exact
+//   "60.x" -> 00.0  // normalized
+//   "00.x" -> 00.x  // exact
+//
+// Errors are indicated by returning false.
+//
+// Example:
+//   const cctz::time_zone tz = ...
+//   std::chrono::system_clock::time_point tp;
+//   if (cctz::parse("%Y-%m-%d", "2015-10-09", tz, &tp)) {
+//     ...
+//   }
+template <typename D>
+inline bool parse(const std::string& fmt, const std::string& input,
+                  const time_zone& tz, time_point<D>* tpp) {
+  time_point<seconds> sec;
+  detail::femtoseconds fs;
+  const bool b = detail::parse(fmt, input, tz, &sec, &fs);
+  if (b) {
+    // TODO: Return false if unrepresentable as a time_point<D>.
+    *tpp = std::chrono::time_point_cast<D>(sec);
+    *tpp += std::chrono::duration_cast<D>(fs);
+  }
+  return b;
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_H_
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/zone_info_source.h b/third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/zone_info_source.h
new file mode 100644
index 0000000000..012eb4ec30
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/include/cctz/zone_info_source.h
@@ -0,0 +1,102 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_ZONE_INFO_SOURCE_H_
+#define ABSL_TIME_INTERNAL_CCTZ_ZONE_INFO_SOURCE_H_
+
+#include <cstddef>
+#include <functional>
+#include <memory>
+#include <string>
+
+#include "absl/base/config.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// A stdio-like interface for providing zoneinfo data for a particular zone.
+class ZoneInfoSource {
+ public:
+  virtual ~ZoneInfoSource();
+
+  virtual std::size_t Read(void* ptr, std::size_t size) = 0;  // like fread()
+  virtual int Skip(std::size_t offset) = 0;                   // like fseek()
+
+  // Until the zoneinfo data supports versioning information, we provide
+  // a way for a ZoneInfoSource to indicate it out-of-band.  The default
+  // implementation returns an empty string.
+  virtual std::string Version() const;
+};
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz_extension {
+
+// A function-pointer type for a factory that returns a ZoneInfoSource
+// given the name of a time zone and a fallback factory.  Returns null
+// when the data for the named zone cannot be found.
+using ZoneInfoSourceFactory =
+    std::unique_ptr<absl::time_internal::cctz::ZoneInfoSource> (*)(
+        const std::string&,
+        const std::function<std::unique_ptr<
+            absl::time_internal::cctz::ZoneInfoSource>(const std::string&)>&);
+
+// The user can control the mapping of zone names to zoneinfo data by
+// providing a definition for cctz_extension::zone_info_source_factory.
+// For example, given functions my_factory() and my_other_factory() that
+// can return a ZoneInfoSource for a named zone, we could inject them into
+// cctz::load_time_zone() with:
+//
+//   namespace cctz_extension {
+//   namespace {
+//   std::unique_ptr<cctz::ZoneInfoSource> CustomFactory(
+//       const std::string& name,
+//       const std::function<std::unique_ptr<cctz::ZoneInfoSource>(
+//           const std::string& name)>& fallback_factory) {
+//     if (auto zip = my_factory(name)) return zip;
+//     if (auto zip = fallback_factory(name)) return zip;
+//     if (auto zip = my_other_factory(name)) return zip;
+//     return nullptr;
+//   }
+//   }  // namespace
+//   ZoneInfoSourceFactory zone_info_source_factory = CustomFactory;
+//   }  // namespace cctz_extension
+//
+// This might be used, say, to use zoneinfo data embedded in the program,
+// or read from a (possibly compressed) file archive, or both.
+//
+// cctz_extension::zone_info_source_factory() will be called:
+//   (1) from the same thread as the cctz::load_time_zone() call,
+//   (2) only once for any zone name, and
+//   (3) serially (i.e., no concurrent execution).
+//
+// The fallback factory obtains zoneinfo data by reading files in ${TZDIR},
+// and it is used automatically when no zone_info_source_factory definition
+// is linked into the program.
+extern ZoneInfoSourceFactory zone_info_source_factory;
+
+}  // namespace cctz_extension
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_ZONE_INFO_SOURCE_H_
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/cctz_benchmark.cc b/third_party/abseil_cpp/absl/time/internal/cctz/src/cctz_benchmark.cc
new file mode 100644
index 0000000000..a402760d19
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/cctz_benchmark.cc
@@ -0,0 +1,1030 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include <algorithm>
+#include <cassert>
+#include <chrono>
+#include <ctime>
+#include <random>
+#include <string>
+#include <vector>
+
+#include "benchmark/benchmark.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+#include "time_zone_impl.h"
+
+namespace {
+
+namespace cctz = absl::time_internal::cctz;
+
+void BM_Difference_Days(benchmark::State& state) {
+  const cctz::civil_day c(2014, 8, 22);
+  const cctz::civil_day epoch(1970, 1, 1);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(c - epoch);
+  }
+}
+BENCHMARK(BM_Difference_Days);
+
+void BM_Step_Days(benchmark::State& state) {
+  const cctz::civil_day kStart(2014, 8, 22);
+  cctz::civil_day c = kStart;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(++c);
+  }
+}
+BENCHMARK(BM_Step_Days);
+
+void BM_GetWeekday(benchmark::State& state) {
+  const cctz::civil_day c(2014, 8, 22);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::get_weekday(c));
+  }
+}
+BENCHMARK(BM_GetWeekday);
+
+void BM_NextWeekday(benchmark::State& state) {
+  const cctz::civil_day kStart(2014, 8, 22);
+  const cctz::civil_day kDays[7] = {
+      kStart + 0, kStart + 1, kStart + 2, kStart + 3,
+      kStart + 4, kStart + 5, kStart + 6,
+  };
+  const cctz::weekday kWeekdays[7] = {
+      cctz::weekday::monday,   cctz::weekday::tuesday, cctz::weekday::wednesday,
+      cctz::weekday::thursday, cctz::weekday::friday,  cctz::weekday::saturday,
+      cctz::weekday::sunday,
+  };
+  while (state.KeepRunningBatch(7 * 7)) {
+    for (const auto from : kDays) {
+      for (const auto to : kWeekdays) {
+        benchmark::DoNotOptimize(cctz::next_weekday(from, to));
+      }
+    }
+  }
+}
+BENCHMARK(BM_NextWeekday);
+
+void BM_PrevWeekday(benchmark::State& state) {
+  const cctz::civil_day kStart(2014, 8, 22);
+  const cctz::civil_day kDays[7] = {
+      kStart + 0, kStart + 1, kStart + 2, kStart + 3,
+      kStart + 4, kStart + 5, kStart + 6,
+  };
+  const cctz::weekday kWeekdays[7] = {
+      cctz::weekday::monday,   cctz::weekday::tuesday, cctz::weekday::wednesday,
+      cctz::weekday::thursday, cctz::weekday::friday,  cctz::weekday::saturday,
+      cctz::weekday::sunday,
+  };
+  while (state.KeepRunningBatch(7 * 7)) {
+    for (const auto from : kDays) {
+      for (const auto to : kWeekdays) {
+        benchmark::DoNotOptimize(cctz::prev_weekday(from, to));
+      }
+    }
+  }
+}
+BENCHMARK(BM_PrevWeekday);
+
+const char RFC3339_full[] = "%Y-%m-%dT%H:%M:%E*S%Ez";
+const char RFC3339_sec[] = "%Y-%m-%dT%H:%M:%S%Ez";
+
+const char RFC1123_full[] = "%a, %d %b %Y %H:%M:%S %z";
+const char RFC1123_no_wday[] = "%d %b %Y %H:%M:%S %z";
+
+// A list of known time-zone names.
+// TODO: Refactor with src/time_zone_lookup_test.cc.
+const char* const kTimeZoneNames[] = {"Africa/Abidjan",
+                                      "Africa/Accra",
+                                      "Africa/Addis_Ababa",
+                                      "Africa/Algiers",
+                                      "Africa/Asmara",
+                                      "Africa/Asmera",
+                                      "Africa/Bamako",
+                                      "Africa/Bangui",
+                                      "Africa/Banjul",
+                                      "Africa/Bissau",
+                                      "Africa/Blantyre",
+                                      "Africa/Brazzaville",
+                                      "Africa/Bujumbura",
+                                      "Africa/Cairo",
+                                      "Africa/Casablanca",
+                                      "Africa/Ceuta",
+                                      "Africa/Conakry",
+                                      "Africa/Dakar",
+                                      "Africa/Dar_es_Salaam",
+                                      "Africa/Djibouti",
+                                      "Africa/Douala",
+                                      "Africa/El_Aaiun",
+                                      "Africa/Freetown",
+                                      "Africa/Gaborone",
+                                      "Africa/Harare",
+                                      "Africa/Johannesburg",
+                                      "Africa/Juba",
+                                      "Africa/Kampala",
+                                      "Africa/Khartoum",
+                                      "Africa/Kigali",
+                                      "Africa/Kinshasa",
+                                      "Africa/Lagos",
+                                      "Africa/Libreville",
+                                      "Africa/Lome",
+                                      "Africa/Luanda",
+                                      "Africa/Lubumbashi",
+                                      "Africa/Lusaka",
+                                      "Africa/Malabo",
+                                      "Africa/Maputo",
+                                      "Africa/Maseru",
+                                      "Africa/Mbabane",
+                                      "Africa/Mogadishu",
+                                      "Africa/Monrovia",
+                                      "Africa/Nairobi",
+                                      "Africa/Ndjamena",
+                                      "Africa/Niamey",
+                                      "Africa/Nouakchott",
+                                      "Africa/Ouagadougou",
+                                      "Africa/Porto-Novo",
+                                      "Africa/Sao_Tome",
+                                      "Africa/Timbuktu",
+                                      "Africa/Tripoli",
+                                      "Africa/Tunis",
+                                      "Africa/Windhoek",
+                                      "America/Adak",
+                                      "America/Anchorage",
+                                      "America/Anguilla",
+                                      "America/Antigua",
+                                      "America/Araguaina",
+                                      "America/Argentina/Buenos_Aires",
+                                      "America/Argentina/Catamarca",
+                                      "America/Argentina/ComodRivadavia",
+                                      "America/Argentina/Cordoba",
+                                      "America/Argentina/Jujuy",
+                                      "America/Argentina/La_Rioja",
+                                      "America/Argentina/Mendoza",
+                                      "America/Argentina/Rio_Gallegos",
+                                      "America/Argentina/Salta",
+                                      "America/Argentina/San_Juan",
+                                      "America/Argentina/San_Luis",
+                                      "America/Argentina/Tucuman",
+                                      "America/Argentina/Ushuaia",
+                                      "America/Aruba",
+                                      "America/Asuncion",
+                                      "America/Atikokan",
+                                      "America/Atka",
+                                      "America/Bahia",
+                                      "America/Bahia_Banderas",
+                                      "America/Barbados",
+                                      "America/Belem",
+                                      "America/Belize",
+                                      "America/Blanc-Sablon",
+                                      "America/Boa_Vista",
+                                      "America/Bogota",
+                                      "America/Boise",
+                                      "America/Buenos_Aires",
+                                      "America/Cambridge_Bay",
+                                      "America/Campo_Grande",
+                                      "America/Cancun",
+                                      "America/Caracas",
+                                      "America/Catamarca",
+                                      "America/Cayenne",
+                                      "America/Cayman",
+                                      "America/Chicago",
+                                      "America/Chihuahua",
+                                      "America/Coral_Harbour",
+                                      "America/Cordoba",
+                                      "America/Costa_Rica",
+                                      "America/Creston",
+                                      "America/Cuiaba",
+                                      "America/Curacao",
+                                      "America/Danmarkshavn",
+                                      "America/Dawson",
+                                      "America/Dawson_Creek",
+                                      "America/Denver",
+                                      "America/Detroit",
+                                      "America/Dominica",
+                                      "America/Edmonton",
+                                      "America/Eirunepe",
+                                      "America/El_Salvador",
+                                      "America/Ensenada",
+                                      "America/Fort_Nelson",
+                                      "America/Fort_Wayne",
+                                      "America/Fortaleza",
+                                      "America/Glace_Bay",
+                                      "America/Godthab",
+                                      "America/Goose_Bay",
+                                      "America/Grand_Turk",
+                                      "America/Grenada",
+                                      "America/Guadeloupe",
+                                      "America/Guatemala",
+                                      "America/Guayaquil",
+                                      "America/Guyana",
+                                      "America/Halifax",
+                                      "America/Havana",
+                                      "America/Hermosillo",
+                                      "America/Indiana/Indianapolis",
+                                      "America/Indiana/Knox",
+                                      "America/Indiana/Marengo",
+                                      "America/Indiana/Petersburg",
+                                      "America/Indiana/Tell_City",
+                                      "America/Indiana/Vevay",
+                                      "America/Indiana/Vincennes",
+                                      "America/Indiana/Winamac",
+                                      "America/Indianapolis",
+                                      "America/Inuvik",
+                                      "America/Iqaluit",
+                                      "America/Jamaica",
+                                      "America/Jujuy",
+                                      "America/Juneau",
+                                      "America/Kentucky/Louisville",
+                                      "America/Kentucky/Monticello",
+                                      "America/Knox_IN",
+                                      "America/Kralendijk",
+                                      "America/La_Paz",
+                                      "America/Lima",
+                                      "America/Los_Angeles",
+                                      "America/Louisville",
+                                      "America/Lower_Princes",
+                                      "America/Maceio",
+                                      "America/Managua",
+                                      "America/Manaus",
+                                      "America/Marigot",
+                                      "America/Martinique",
+                                      "America/Matamoros",
+                                      "America/Mazatlan",
+                                      "America/Mendoza",
+                                      "America/Menominee",
+                                      "America/Merida",
+                                      "America/Metlakatla",
+                                      "America/Mexico_City",
+                                      "America/Miquelon",
+                                      "America/Moncton",
+                                      "America/Monterrey",
+                                      "America/Montevideo",
+                                      "America/Montreal",
+                                      "America/Montserrat",
+                                      "America/Nassau",
+                                      "America/New_York",
+                                      "America/Nipigon",
+                                      "America/Nome",
+                                      "America/Noronha",
+                                      "America/North_Dakota/Beulah",
+                                      "America/North_Dakota/Center",
+                                      "America/North_Dakota/New_Salem",
+                                      "America/Nuuk",
+                                      "America/Ojinaga",
+                                      "America/Panama",
+                                      "America/Pangnirtung",
+                                      "America/Paramaribo",
+                                      "America/Phoenix",
+                                      "America/Port-au-Prince",
+                                      "America/Port_of_Spain",
+                                      "America/Porto_Acre",
+                                      "America/Porto_Velho",
+                                      "America/Puerto_Rico",
+                                      "America/Punta_Arenas",
+                                      "America/Rainy_River",
+                                      "America/Rankin_Inlet",
+                                      "America/Recife",
+                                      "America/Regina",
+                                      "America/Resolute",
+                                      "America/Rio_Branco",
+                                      "America/Rosario",
+                                      "America/Santa_Isabel",
+                                      "America/Santarem",
+                                      "America/Santiago",
+                                      "America/Santo_Domingo",
+                                      "America/Sao_Paulo",
+                                      "America/Scoresbysund",
+                                      "America/Shiprock",
+                                      "America/Sitka",
+                                      "America/St_Barthelemy",
+                                      "America/St_Johns",
+                                      "America/St_Kitts",
+                                      "America/St_Lucia",
+                                      "America/St_Thomas",
+                                      "America/St_Vincent",
+                                      "America/Swift_Current",
+                                      "America/Tegucigalpa",
+                                      "America/Thule",
+                                      "America/Thunder_Bay",
+                                      "America/Tijuana",
+                                      "America/Toronto",
+                                      "America/Tortola",
+                                      "America/Vancouver",
+                                      "America/Virgin",
+                                      "America/Whitehorse",
+                                      "America/Winnipeg",
+                                      "America/Yakutat",
+                                      "America/Yellowknife",
+                                      "Antarctica/Casey",
+                                      "Antarctica/Davis",
+                                      "Antarctica/DumontDUrville",
+                                      "Antarctica/Macquarie",
+                                      "Antarctica/Mawson",
+                                      "Antarctica/McMurdo",
+                                      "Antarctica/Palmer",
+                                      "Antarctica/Rothera",
+                                      "Antarctica/South_Pole",
+                                      "Antarctica/Syowa",
+                                      "Antarctica/Troll",
+                                      "Antarctica/Vostok",
+                                      "Arctic/Longyearbyen",
+                                      "Asia/Aden",
+                                      "Asia/Almaty",
+                                      "Asia/Amman",
+                                      "Asia/Anadyr",
+                                      "Asia/Aqtau",
+                                      "Asia/Aqtobe",
+                                      "Asia/Ashgabat",
+                                      "Asia/Ashkhabad",
+                                      "Asia/Atyrau",
+                                      "Asia/Baghdad",
+                                      "Asia/Bahrain",
+                                      "Asia/Baku",
+                                      "Asia/Bangkok",
+                                      "Asia/Barnaul",
+                                      "Asia/Beirut",
+                                      "Asia/Bishkek",
+                                      "Asia/Brunei",
+                                      "Asia/Calcutta",
+                                      "Asia/Chita",
+                                      "Asia/Choibalsan",
+                                      "Asia/Chongqing",
+                                      "Asia/Chungking",
+                                      "Asia/Colombo",
+                                      "Asia/Dacca",
+                                      "Asia/Damascus",
+                                      "Asia/Dhaka",
+                                      "Asia/Dili",
+                                      "Asia/Dubai",
+                                      "Asia/Dushanbe",
+                                      "Asia/Famagusta",
+                                      "Asia/Gaza",
+                                      "Asia/Harbin",
+                                      "Asia/Hebron",
+                                      "Asia/Ho_Chi_Minh",
+                                      "Asia/Hong_Kong",
+                                      "Asia/Hovd",
+                                      "Asia/Irkutsk",
+                                      "Asia/Istanbul",
+                                      "Asia/Jakarta",
+                                      "Asia/Jayapura",
+                                      "Asia/Jerusalem",
+                                      "Asia/Kabul",
+                                      "Asia/Kamchatka",
+                                      "Asia/Karachi",
+                                      "Asia/Kashgar",
+                                      "Asia/Kathmandu",
+                                      "Asia/Katmandu",
+                                      "Asia/Khandyga",
+                                      "Asia/Kolkata",
+                                      "Asia/Krasnoyarsk",
+                                      "Asia/Kuala_Lumpur",
+                                      "Asia/Kuching",
+                                      "Asia/Kuwait",
+                                      "Asia/Macao",
+                                      "Asia/Macau",
+                                      "Asia/Magadan",
+                                      "Asia/Makassar",
+                                      "Asia/Manila",
+                                      "Asia/Muscat",
+                                      "Asia/Nicosia",
+                                      "Asia/Novokuznetsk",
+                                      "Asia/Novosibirsk",
+                                      "Asia/Omsk",
+                                      "Asia/Oral",
+                                      "Asia/Phnom_Penh",
+                                      "Asia/Pontianak",
+                                      "Asia/Pyongyang",
+                                      "Asia/Qatar",
+                                      "Asia/Qostanay",
+                                      "Asia/Qyzylorda",
+                                      "Asia/Rangoon",
+                                      "Asia/Riyadh",
+                                      "Asia/Saigon",
+                                      "Asia/Sakhalin",
+                                      "Asia/Samarkand",
+                                      "Asia/Seoul",
+                                      "Asia/Shanghai",
+                                      "Asia/Singapore",
+                                      "Asia/Srednekolymsk",
+                                      "Asia/Taipei",
+                                      "Asia/Tashkent",
+                                      "Asia/Tbilisi",
+                                      "Asia/Tehran",
+                                      "Asia/Tel_Aviv",
+                                      "Asia/Thimbu",
+                                      "Asia/Thimphu",
+                                      "Asia/Tokyo",
+                                      "Asia/Tomsk",
+                                      "Asia/Ujung_Pandang",
+                                      "Asia/Ulaanbaatar",
+                                      "Asia/Ulan_Bator",
+                                      "Asia/Urumqi",
+                                      "Asia/Ust-Nera",
+                                      "Asia/Vientiane",
+                                      "Asia/Vladivostok",
+                                      "Asia/Yakutsk",
+                                      "Asia/Yangon",
+                                      "Asia/Yekaterinburg",
+                                      "Asia/Yerevan",
+                                      "Atlantic/Azores",
+                                      "Atlantic/Bermuda",
+                                      "Atlantic/Canary",
+                                      "Atlantic/Cape_Verde",
+                                      "Atlantic/Faeroe",
+                                      "Atlantic/Faroe",
+                                      "Atlantic/Jan_Mayen",
+                                      "Atlantic/Madeira",
+                                      "Atlantic/Reykjavik",
+                                      "Atlantic/South_Georgia",
+                                      "Atlantic/St_Helena",
+                                      "Atlantic/Stanley",
+                                      "Australia/ACT",
+                                      "Australia/Adelaide",
+                                      "Australia/Brisbane",
+                                      "Australia/Broken_Hill",
+                                      "Australia/Canberra",
+                                      "Australia/Currie",
+                                      "Australia/Darwin",
+                                      "Australia/Eucla",
+                                      "Australia/Hobart",
+                                      "Australia/LHI",
+                                      "Australia/Lindeman",
+                                      "Australia/Lord_Howe",
+                                      "Australia/Melbourne",
+                                      "Australia/NSW",
+                                      "Australia/North",
+                                      "Australia/Perth",
+                                      "Australia/Queensland",
+                                      "Australia/South",
+                                      "Australia/Sydney",
+                                      "Australia/Tasmania",
+                                      "Australia/Victoria",
+                                      "Australia/West",
+                                      "Australia/Yancowinna",
+                                      "Brazil/Acre",
+                                      "Brazil/DeNoronha",
+                                      "Brazil/East",
+                                      "Brazil/West",
+                                      "CET",
+                                      "CST6CDT",
+                                      "Canada/Atlantic",
+                                      "Canada/Central",
+                                      "Canada/Eastern",
+                                      "Canada/Mountain",
+                                      "Canada/Newfoundland",
+                                      "Canada/Pacific",
+                                      "Canada/Saskatchewan",
+                                      "Canada/Yukon",
+                                      "Chile/Continental",
+                                      "Chile/EasterIsland",
+                                      "Cuba",
+                                      "EET",
+                                      "EST",
+                                      "EST5EDT",
+                                      "Egypt",
+                                      "Eire",
+                                      "Etc/GMT",
+                                      "Etc/GMT+0",
+                                      "Etc/GMT+1",
+                                      "Etc/GMT+10",
+                                      "Etc/GMT+11",
+                                      "Etc/GMT+12",
+                                      "Etc/GMT+2",
+                                      "Etc/GMT+3",
+                                      "Etc/GMT+4",
+                                      "Etc/GMT+5",
+                                      "Etc/GMT+6",
+                                      "Etc/GMT+7",
+                                      "Etc/GMT+8",
+                                      "Etc/GMT+9",
+                                      "Etc/GMT-0",
+                                      "Etc/GMT-1",
+                                      "Etc/GMT-10",
+                                      "Etc/GMT-11",
+                                      "Etc/GMT-12",
+                                      "Etc/GMT-13",
+                                      "Etc/GMT-14",
+                                      "Etc/GMT-2",
+                                      "Etc/GMT-3",
+                                      "Etc/GMT-4",
+                                      "Etc/GMT-5",
+                                      "Etc/GMT-6",
+                                      "Etc/GMT-7",
+                                      "Etc/GMT-8",
+                                      "Etc/GMT-9",
+                                      "Etc/GMT0",
+                                      "Etc/Greenwich",
+                                      "Etc/UCT",
+                                      "Etc/UTC",
+                                      "Etc/Universal",
+                                      "Etc/Zulu",
+                                      "Europe/Amsterdam",
+                                      "Europe/Andorra",
+                                      "Europe/Astrakhan",
+                                      "Europe/Athens",
+                                      "Europe/Belfast",
+                                      "Europe/Belgrade",
+                                      "Europe/Berlin",
+                                      "Europe/Bratislava",
+                                      "Europe/Brussels",
+                                      "Europe/Bucharest",
+                                      "Europe/Budapest",
+                                      "Europe/Busingen",
+                                      "Europe/Chisinau",
+                                      "Europe/Copenhagen",
+                                      "Europe/Dublin",
+                                      "Europe/Gibraltar",
+                                      "Europe/Guernsey",
+                                      "Europe/Helsinki",
+                                      "Europe/Isle_of_Man",
+                                      "Europe/Istanbul",
+                                      "Europe/Jersey",
+                                      "Europe/Kaliningrad",
+                                      "Europe/Kiev",
+                                      "Europe/Kirov",
+                                      "Europe/Lisbon",
+                                      "Europe/Ljubljana",
+                                      "Europe/London",
+                                      "Europe/Luxembourg",
+                                      "Europe/Madrid",
+                                      "Europe/Malta",
+                                      "Europe/Mariehamn",
+                                      "Europe/Minsk",
+                                      "Europe/Monaco",
+                                      "Europe/Moscow",
+                                      "Europe/Nicosia",
+                                      "Europe/Oslo",
+                                      "Europe/Paris",
+                                      "Europe/Podgorica",
+                                      "Europe/Prague",
+                                      "Europe/Riga",
+                                      "Europe/Rome",
+                                      "Europe/Samara",
+                                      "Europe/San_Marino",
+                                      "Europe/Sarajevo",
+                                      "Europe/Saratov",
+                                      "Europe/Simferopol",
+                                      "Europe/Skopje",
+                                      "Europe/Sofia",
+                                      "Europe/Stockholm",
+                                      "Europe/Tallinn",
+                                      "Europe/Tirane",
+                                      "Europe/Tiraspol",
+                                      "Europe/Ulyanovsk",
+                                      "Europe/Uzhgorod",
+                                      "Europe/Vaduz",
+                                      "Europe/Vatican",
+                                      "Europe/Vienna",
+                                      "Europe/Vilnius",
+                                      "Europe/Volgograd",
+                                      "Europe/Warsaw",
+                                      "Europe/Zagreb",
+                                      "Europe/Zaporozhye",
+                                      "Europe/Zurich",
+                                      "GB",
+                                      "GB-Eire",
+                                      "GMT",
+                                      "GMT+0",
+                                      "GMT-0",
+                                      "GMT0",
+                                      "Greenwich",
+                                      "HST",
+                                      "Hongkong",
+                                      "Iceland",
+                                      "Indian/Antananarivo",
+                                      "Indian/Chagos",
+                                      "Indian/Christmas",
+                                      "Indian/Cocos",
+                                      "Indian/Comoro",
+                                      "Indian/Kerguelen",
+                                      "Indian/Mahe",
+                                      "Indian/Maldives",
+                                      "Indian/Mauritius",
+                                      "Indian/Mayotte",
+                                      "Indian/Reunion",
+                                      "Iran",
+                                      "Israel",
+                                      "Jamaica",
+                                      "Japan",
+                                      "Kwajalein",
+                                      "Libya",
+                                      "MET",
+                                      "MST",
+                                      "MST7MDT",
+                                      "Mexico/BajaNorte",
+                                      "Mexico/BajaSur",
+                                      "Mexico/General",
+                                      "NZ",
+                                      "NZ-CHAT",
+                                      "Navajo",
+                                      "PRC",
+                                      "PST8PDT",
+                                      "Pacific/Apia",
+                                      "Pacific/Auckland",
+                                      "Pacific/Bougainville",
+                                      "Pacific/Chatham",
+                                      "Pacific/Chuuk",
+                                      "Pacific/Easter",
+                                      "Pacific/Efate",
+                                      "Pacific/Enderbury",
+                                      "Pacific/Fakaofo",
+                                      "Pacific/Fiji",
+                                      "Pacific/Funafuti",
+                                      "Pacific/Galapagos",
+                                      "Pacific/Gambier",
+                                      "Pacific/Guadalcanal",
+                                      "Pacific/Guam",
+                                      "Pacific/Honolulu",
+                                      "Pacific/Johnston",
+                                      "Pacific/Kiritimati",
+                                      "Pacific/Kosrae",
+                                      "Pacific/Kwajalein",
+                                      "Pacific/Majuro",
+                                      "Pacific/Marquesas",
+                                      "Pacific/Midway",
+                                      "Pacific/Nauru",
+                                      "Pacific/Niue",
+                                      "Pacific/Norfolk",
+                                      "Pacific/Noumea",
+                                      "Pacific/Pago_Pago",
+                                      "Pacific/Palau",
+                                      "Pacific/Pitcairn",
+                                      "Pacific/Pohnpei",
+                                      "Pacific/Ponape",
+                                      "Pacific/Port_Moresby",
+                                      "Pacific/Rarotonga",
+                                      "Pacific/Saipan",
+                                      "Pacific/Samoa",
+                                      "Pacific/Tahiti",
+                                      "Pacific/Tarawa",
+                                      "Pacific/Tongatapu",
+                                      "Pacific/Truk",
+                                      "Pacific/Wake",
+                                      "Pacific/Wallis",
+                                      "Pacific/Yap",
+                                      "Poland",
+                                      "Portugal",
+                                      "ROC",
+                                      "ROK",
+                                      "Singapore",
+                                      "Turkey",
+                                      "UCT",
+                                      "US/Alaska",
+                                      "US/Aleutian",
+                                      "US/Arizona",
+                                      "US/Central",
+                                      "US/East-Indiana",
+                                      "US/Eastern",
+                                      "US/Hawaii",
+                                      "US/Indiana-Starke",
+                                      "US/Michigan",
+                                      "US/Mountain",
+                                      "US/Pacific",
+                                      "US/Samoa",
+                                      "UTC",
+                                      "Universal",
+                                      "W-SU",
+                                      "WET",
+                                      "Zulu",
+                                      nullptr};
+
+std::vector<std::string> AllTimeZoneNames() {
+  std::vector<std::string> names;
+  for (const char* const* namep = kTimeZoneNames; *namep != nullptr; ++namep) {
+    names.push_back(std::string("file:") + *namep);
+  }
+  assert(!names.empty());
+
+  std::mt19937 urbg(42);  // a UniformRandomBitGenerator with fixed seed
+  std::shuffle(names.begin(), names.end(), urbg);
+  return names;
+}
+
+cctz::time_zone TestTimeZone() {
+  cctz::time_zone tz;
+  cctz::load_time_zone("America/Los_Angeles", &tz);
+  return tz;
+}
+
+void BM_Zone_LoadUTCTimeZoneFirst(benchmark::State& state) {
+  cctz::time_zone tz;
+  cctz::load_time_zone("UTC", &tz);  // in case we're first
+  cctz::time_zone::Impl::ClearTimeZoneMapTestOnly();
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::load_time_zone("UTC", &tz));
+  }
+}
+BENCHMARK(BM_Zone_LoadUTCTimeZoneFirst);
+
+void BM_Zone_LoadUTCTimeZoneLast(benchmark::State& state) {
+  cctz::time_zone tz;
+  for (const auto& name : AllTimeZoneNames()) {
+    cctz::load_time_zone(name, &tz);  // prime cache
+  }
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::load_time_zone("UTC", &tz));
+  }
+}
+BENCHMARK(BM_Zone_LoadUTCTimeZoneLast);
+
+void BM_Zone_LoadTimeZoneFirst(benchmark::State& state) {
+  cctz::time_zone tz = cctz::utc_time_zone();  // in case we're first
+  const std::string name = "file:America/Los_Angeles";
+  while (state.KeepRunning()) {
+    state.PauseTiming();
+    cctz::time_zone::Impl::ClearTimeZoneMapTestOnly();
+    state.ResumeTiming();
+    benchmark::DoNotOptimize(cctz::load_time_zone(name, &tz));
+  }
+}
+BENCHMARK(BM_Zone_LoadTimeZoneFirst);
+
+void BM_Zone_LoadTimeZoneCached(benchmark::State& state) {
+  cctz::time_zone tz = cctz::utc_time_zone();  // in case we're first
+  cctz::time_zone::Impl::ClearTimeZoneMapTestOnly();
+  const std::string name = "file:America/Los_Angeles";
+  cctz::load_time_zone(name, &tz);  // prime cache
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::load_time_zone(name, &tz));
+  }
+}
+BENCHMARK(BM_Zone_LoadTimeZoneCached);
+
+void BM_Zone_LoadLocalTimeZoneCached(benchmark::State& state) {
+  cctz::utc_time_zone();  // in case we're first
+  cctz::time_zone::Impl::ClearTimeZoneMapTestOnly();
+  cctz::local_time_zone();  // prime cache
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::local_time_zone());
+  }
+}
+BENCHMARK(BM_Zone_LoadLocalTimeZoneCached);
+
+void BM_Zone_LoadAllTimeZonesFirst(benchmark::State& state) {
+  cctz::time_zone tz;
+  const std::vector<std::string> names = AllTimeZoneNames();
+  for (auto index = names.size(); state.KeepRunning(); ++index) {
+    if (index == names.size()) {
+      index = 0;
+    }
+    if (index == 0) {
+      state.PauseTiming();
+      cctz::time_zone::Impl::ClearTimeZoneMapTestOnly();
+      state.ResumeTiming();
+    }
+    benchmark::DoNotOptimize(cctz::load_time_zone(names[index], &tz));
+  }
+}
+BENCHMARK(BM_Zone_LoadAllTimeZonesFirst);
+
+void BM_Zone_LoadAllTimeZonesCached(benchmark::State& state) {
+  cctz::time_zone tz;
+  const std::vector<std::string> names = AllTimeZoneNames();
+  for (const auto& name : names) {
+    cctz::load_time_zone(name, &tz);  // prime cache
+  }
+  for (auto index = names.size(); state.KeepRunning(); ++index) {
+    if (index == names.size()) {
+      index = 0;
+    }
+    benchmark::DoNotOptimize(cctz::load_time_zone(names[index], &tz));
+  }
+}
+BENCHMARK(BM_Zone_LoadAllTimeZonesCached);
+
+void BM_Zone_TimeZoneEqualityImplicit(benchmark::State& state) {
+  cctz::time_zone tz;  // implicit UTC
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(tz == tz);
+  }
+}
+BENCHMARK(BM_Zone_TimeZoneEqualityImplicit);
+
+void BM_Zone_TimeZoneEqualityExplicit(benchmark::State& state) {
+  cctz::time_zone tz = cctz::utc_time_zone();  // explicit UTC
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(tz == tz);
+  }
+}
+BENCHMARK(BM_Zone_TimeZoneEqualityExplicit);
+
+void BM_Zone_UTCTimeZone(benchmark::State& state) {
+  cctz::time_zone tz;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::utc_time_zone());
+  }
+}
+BENCHMARK(BM_Zone_UTCTimeZone);
+
+// In each "ToCivil" benchmark we switch between two instants separated
+// by at least one transition in order to defeat any internal caching of
+// previous results (e.g., see local_time_hint_).
+//
+// The "UTC" variants use UTC instead of the Google/local time zone.
+
+void BM_Time_ToCivil_CCTZ(benchmark::State& state) {
+  const cctz::time_zone tz = TestTimeZone();
+  std::chrono::system_clock::time_point tp =
+      std::chrono::system_clock::from_time_t(1384569027);
+  std::chrono::system_clock::time_point tp2 =
+      std::chrono::system_clock::from_time_t(1418962578);
+  while (state.KeepRunning()) {
+    std::swap(tp, tp2);
+    tp += std::chrono::seconds(1);
+    benchmark::DoNotOptimize(cctz::convert(tp, tz));
+  }
+}
+BENCHMARK(BM_Time_ToCivil_CCTZ);
+
+void BM_Time_ToCivil_Libc(benchmark::State& state) {
+  // No timezone support, so just use localtime.
+  time_t t = 1384569027;
+  time_t t2 = 1418962578;
+  struct tm tm;
+  while (state.KeepRunning()) {
+    std::swap(t, t2);
+    t += 1;
+#if defined(_WIN32) || defined(_WIN64)
+    benchmark::DoNotOptimize(localtime_s(&tm, &t));
+#else
+    benchmark::DoNotOptimize(localtime_r(&t, &tm));
+#endif
+  }
+}
+BENCHMARK(BM_Time_ToCivil_Libc);
+
+void BM_Time_ToCivilUTC_CCTZ(benchmark::State& state) {
+  const cctz::time_zone tz = cctz::utc_time_zone();
+  std::chrono::system_clock::time_point tp =
+      std::chrono::system_clock::from_time_t(1384569027);
+  while (state.KeepRunning()) {
+    tp += std::chrono::seconds(1);
+    benchmark::DoNotOptimize(cctz::convert(tp, tz));
+  }
+}
+BENCHMARK(BM_Time_ToCivilUTC_CCTZ);
+
+void BM_Time_ToCivilUTC_Libc(benchmark::State& state) {
+  time_t t = 1384569027;
+  struct tm tm;
+  while (state.KeepRunning()) {
+    t += 1;
+#if defined(_WIN32) || defined(_WIN64)
+    benchmark::DoNotOptimize(gmtime_s(&tm, &t));
+#else
+    benchmark::DoNotOptimize(gmtime_r(&t, &tm));
+#endif
+  }
+}
+BENCHMARK(BM_Time_ToCivilUTC_Libc);
+
+// In each "FromCivil" benchmark we switch between two YMDhms values
+// separated by at least one transition in order to defeat any internal
+// caching of previous results (e.g., see time_local_hint_).
+//
+// The "UTC" variants use UTC instead of the Google/local time zone.
+// The "Day0" variants require normalization of the day of month.
+
+void BM_Time_FromCivil_CCTZ(benchmark::State& state) {
+  const cctz::time_zone tz = TestTimeZone();
+  int i = 0;
+  while (state.KeepRunning()) {
+    if ((i++ & 1) == 0) {
+      benchmark::DoNotOptimize(
+          cctz::convert(cctz::civil_second(2014, 12, 18, 20, 16, 18), tz));
+    } else {
+      benchmark::DoNotOptimize(
+          cctz::convert(cctz::civil_second(2013, 11, 15, 18, 30, 27), tz));
+    }
+  }
+}
+BENCHMARK(BM_Time_FromCivil_CCTZ);
+
+void BM_Time_FromCivil_Libc(benchmark::State& state) {
+  // No timezone support, so just use localtime.
+  int i = 0;
+  while (state.KeepRunning()) {
+    struct tm tm;
+    if ((i++ & 1) == 0) {
+      tm.tm_year = 2014 - 1900;
+      tm.tm_mon = 12 - 1;
+      tm.tm_mday = 18;
+      tm.tm_hour = 20;
+      tm.tm_min = 16;
+      tm.tm_sec = 18;
+    } else {
+      tm.tm_year = 2013 - 1900;
+      tm.tm_mon = 11 - 1;
+      tm.tm_mday = 15;
+      tm.tm_hour = 18;
+      tm.tm_min = 30;
+      tm.tm_sec = 27;
+    }
+    tm.tm_isdst = -1;
+    benchmark::DoNotOptimize(mktime(&tm));
+  }
+}
+BENCHMARK(BM_Time_FromCivil_Libc);
+
+void BM_Time_FromCivilUTC_CCTZ(benchmark::State& state) {
+  const cctz::time_zone tz = cctz::utc_time_zone();
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(
+        cctz::convert(cctz::civil_second(2014, 12, 18, 20, 16, 18), tz));
+  }
+}
+BENCHMARK(BM_Time_FromCivilUTC_CCTZ);
+
+// There is no BM_Time_FromCivilUTC_Libc.
+
+void BM_Time_FromCivilDay0_CCTZ(benchmark::State& state) {
+  const cctz::time_zone tz = TestTimeZone();
+  int i = 0;
+  while (state.KeepRunning()) {
+    if ((i++ & 1) == 0) {
+      benchmark::DoNotOptimize(
+          cctz::convert(cctz::civil_second(2014, 12, 0, 20, 16, 18), tz));
+    } else {
+      benchmark::DoNotOptimize(
+          cctz::convert(cctz::civil_second(2013, 11, 0, 18, 30, 27), tz));
+    }
+  }
+}
+BENCHMARK(BM_Time_FromCivilDay0_CCTZ);
+
+void BM_Time_FromCivilDay0_Libc(benchmark::State& state) {
+  // No timezone support, so just use localtime.
+  int i = 0;
+  while (state.KeepRunning()) {
+    struct tm tm;
+    if ((i++ & 1) == 0) {
+      tm.tm_year = 2014 - 1900;
+      tm.tm_mon = 12 - 1;
+      tm.tm_mday = 0;
+      tm.tm_hour = 20;
+      tm.tm_min = 16;
+      tm.tm_sec = 18;
+    } else {
+      tm.tm_year = 2013 - 1900;
+      tm.tm_mon = 11 - 1;
+      tm.tm_mday = 0;
+      tm.tm_hour = 18;
+      tm.tm_min = 30;
+      tm.tm_sec = 27;
+    }
+    tm.tm_isdst = -1;
+    benchmark::DoNotOptimize(mktime(&tm));
+  }
+}
+BENCHMARK(BM_Time_FromCivilDay0_Libc);
+
+const char* const kFormats[] = {
+    RFC1123_full,         // 0
+    RFC1123_no_wday,      // 1
+    RFC3339_full,         // 2
+    RFC3339_sec,          // 3
+    "%Y-%m-%dT%H:%M:%S",  // 4
+    "%Y-%m-%d",           // 5
+};
+const int kNumFormats = sizeof(kFormats) / sizeof(kFormats[0]);
+
+void BM_Format_FormatTime(benchmark::State& state) {
+  const std::string fmt = kFormats[state.range(0)];
+  state.SetLabel(fmt);
+  const cctz::time_zone tz = TestTimeZone();
+  const std::chrono::system_clock::time_point tp =
+      cctz::convert(cctz::civil_second(1977, 6, 28, 9, 8, 7), tz) +
+      std::chrono::microseconds(1);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::format(fmt, tp, tz));
+  }
+}
+BENCHMARK(BM_Format_FormatTime)->DenseRange(0, kNumFormats - 1);
+
+void BM_Format_ParseTime(benchmark::State& state) {
+  const std::string fmt = kFormats[state.range(0)];
+  state.SetLabel(fmt);
+  const cctz::time_zone tz = TestTimeZone();
+  std::chrono::system_clock::time_point tp =
+      cctz::convert(cctz::civil_second(1977, 6, 28, 9, 8, 7), tz) +
+      std::chrono::microseconds(1);
+  const std::string when = cctz::format(fmt, tp, tz);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(cctz::parse(fmt, when, tz, &tp));
+  }
+}
+BENCHMARK(BM_Format_ParseTime)->DenseRange(0, kNumFormats - 1);
+
+}  // namespace
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/civil_time_detail.cc b/third_party/abseil_cpp/absl/time/internal/cctz/src/civil_time_detail.cc
new file mode 100644
index 0000000000..0b07e397e5
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/civil_time_detail.cc
@@ -0,0 +1,94 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "absl/time/internal/cctz/include/cctz/civil_time_detail.h"
+
+#include <iomanip>
+#include <ostream>
+#include <sstream>
+
+#include "absl/base/config.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+namespace detail {
+
+// Output stream operators output a format matching YYYY-MM-DDThh:mm:ss,
+// while omitting fields inferior to the type's alignment. For example,
+// civil_day is formatted only as YYYY-MM-DD.
+std::ostream& operator<<(std::ostream& os, const civil_year& y) {
+  std::stringstream ss;
+  ss << y.year();  // No padding.
+  return os << ss.str();
+}
+std::ostream& operator<<(std::ostream& os, const civil_month& m) {
+  std::stringstream ss;
+  ss << civil_year(m) << '-';
+  ss << std::setfill('0') << std::setw(2) << m.month();
+  return os << ss.str();
+}
+std::ostream& operator<<(std::ostream& os, const civil_day& d) {
+  std::stringstream ss;
+  ss << civil_month(d) << '-';
+  ss << std::setfill('0') << std::setw(2) << d.day();
+  return os << ss.str();
+}
+std::ostream& operator<<(std::ostream& os, const civil_hour& h) {
+  std::stringstream ss;
+  ss << civil_day(h) << 'T';
+  ss << std::setfill('0') << std::setw(2) << h.hour();
+  return os << ss.str();
+}
+std::ostream& operator<<(std::ostream& os, const civil_minute& m) {
+  std::stringstream ss;
+  ss << civil_hour(m) << ':';
+  ss << std::setfill('0') << std::setw(2) << m.minute();
+  return os << ss.str();
+}
+std::ostream& operator<<(std::ostream& os, const civil_second& s) {
+  std::stringstream ss;
+  ss << civil_minute(s) << ':';
+  ss << std::setfill('0') << std::setw(2) << s.second();
+  return os << ss.str();
+}
+
+////////////////////////////////////////////////////////////////////////
+
+std::ostream& operator<<(std::ostream& os, weekday wd) {
+  switch (wd) {
+    case weekday::monday:
+      return os << "Monday";
+    case weekday::tuesday:
+      return os << "Tuesday";
+    case weekday::wednesday:
+      return os << "Wednesday";
+    case weekday::thursday:
+      return os << "Thursday";
+    case weekday::friday:
+      return os << "Friday";
+    case weekday::saturday:
+      return os << "Saturday";
+    case weekday::sunday:
+      return os << "Sunday";
+  }
+  return os;  // Should never get here, but -Wreturn-type may warn without this.
+}
+
+}  // namespace detail
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/civil_time_test.cc b/third_party/abseil_cpp/absl/time/internal/cctz/src/civil_time_test.cc
new file mode 100644
index 0000000000..be894d7072
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/civil_time_test.cc
@@ -0,0 +1,1056 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+
+#include <iomanip>
+#include <limits>
+#include <sstream>
+#include <string>
+#include <type_traits>
+
+#include "gtest/gtest.h"
+#include "absl/base/config.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+template <typename T>
+std::string Format(const T& t) {
+  std::stringstream ss;
+  ss << t;
+  return ss.str();
+}
+
+}  // namespace
+
+#if __cpp_constexpr >= 201304 || (defined(_MSC_VER) && _MSC_VER >= 1910)
+// Construction constexpr tests
+
+TEST(CivilTime, Normal) {
+  constexpr civil_second css(2016, 1, 28, 17, 14, 12);
+  static_assert(css.second() == 12, "Normal.second");
+  constexpr civil_minute cmm(2016, 1, 28, 17, 14);
+  static_assert(cmm.minute() == 14, "Normal.minute");
+  constexpr civil_hour chh(2016, 1, 28, 17);
+  static_assert(chh.hour() == 17, "Normal.hour");
+  constexpr civil_day cd(2016, 1, 28);
+  static_assert(cd.day() == 28, "Normal.day");
+  constexpr civil_month cm(2016, 1);
+  static_assert(cm.month() == 1, "Normal.month");
+  constexpr civil_year cy(2016);
+  static_assert(cy.year() == 2016, "Normal.year");
+}
+
+TEST(CivilTime, Conversion) {
+  constexpr civil_year cy(2016);
+  static_assert(cy.year() == 2016, "Conversion.year");
+  constexpr civil_month cm(cy);
+  static_assert(cm.month() == 1, "Conversion.month");
+  constexpr civil_day cd(cm);
+  static_assert(cd.day() == 1, "Conversion.day");
+  constexpr civil_hour chh(cd);
+  static_assert(chh.hour() == 0, "Conversion.hour");
+  constexpr civil_minute cmm(chh);
+  static_assert(cmm.minute() == 0, "Conversion.minute");
+  constexpr civil_second css(cmm);
+  static_assert(css.second() == 0, "Conversion.second");
+}
+
+// Normalization constexpr tests
+
+TEST(CivilTime, Normalized) {
+  constexpr civil_second cs(2016, 1, 28, 17, 14, 12);
+  static_assert(cs.year() == 2016, "Normalized.year");
+  static_assert(cs.month() == 1, "Normalized.month");
+  static_assert(cs.day() == 28, "Normalized.day");
+  static_assert(cs.hour() == 17, "Normalized.hour");
+  static_assert(cs.minute() == 14, "Normalized.minute");
+  static_assert(cs.second() == 12, "Normalized.second");
+}
+
+TEST(CivilTime, SecondOverflow) {
+  constexpr civil_second cs(2016, 1, 28, 17, 14, 121);
+  static_assert(cs.year() == 2016, "SecondOverflow.year");
+  static_assert(cs.month() == 1, "SecondOverflow.month");
+  static_assert(cs.day() == 28, "SecondOverflow.day");
+  static_assert(cs.hour() == 17, "SecondOverflow.hour");
+  static_assert(cs.minute() == 16, "SecondOverflow.minute");
+  static_assert(cs.second() == 1, "SecondOverflow.second");
+}
+
+TEST(CivilTime, SecondUnderflow) {
+  constexpr civil_second cs(2016, 1, 28, 17, 14, -121);
+  static_assert(cs.year() == 2016, "SecondUnderflow.year");
+  static_assert(cs.month() == 1, "SecondUnderflow.month");
+  static_assert(cs.day() == 28, "SecondUnderflow.day");
+  static_assert(cs.hour() == 17, "SecondUnderflow.hour");
+  static_assert(cs.minute() == 11, "SecondUnderflow.minute");
+  static_assert(cs.second() == 59, "SecondUnderflow.second");
+}
+
+TEST(CivilTime, MinuteOverflow) {
+  constexpr civil_second cs(2016, 1, 28, 17, 121, 12);
+  static_assert(cs.year() == 2016, "MinuteOverflow.year");
+  static_assert(cs.month() == 1, "MinuteOverflow.month");
+  static_assert(cs.day() == 28, "MinuteOverflow.day");
+  static_assert(cs.hour() == 19, "MinuteOverflow.hour");
+  static_assert(cs.minute() == 1, "MinuteOverflow.minute");
+  static_assert(cs.second() == 12, "MinuteOverflow.second");
+}
+
+TEST(CivilTime, MinuteUnderflow) {
+  constexpr civil_second cs(2016, 1, 28, 17, -121, 12);
+  static_assert(cs.year() == 2016, "MinuteUnderflow.year");
+  static_assert(cs.month() == 1, "MinuteUnderflow.month");
+  static_assert(cs.day() == 28, "MinuteUnderflow.day");
+  static_assert(cs.hour() == 14, "MinuteUnderflow.hour");
+  static_assert(cs.minute() == 59, "MinuteUnderflow.minute");
+  static_assert(cs.second() == 12, "MinuteUnderflow.second");
+}
+
+TEST(CivilTime, HourOverflow) {
+  constexpr civil_second cs(2016, 1, 28, 49, 14, 12);
+  static_assert(cs.year() == 2016, "HourOverflow.year");
+  static_assert(cs.month() == 1, "HourOverflow.month");
+  static_assert(cs.day() == 30, "HourOverflow.day");
+  static_assert(cs.hour() == 1, "HourOverflow.hour");
+  static_assert(cs.minute() == 14, "HourOverflow.minute");
+  static_assert(cs.second() == 12, "HourOverflow.second");
+}
+
+TEST(CivilTime, HourUnderflow) {
+  constexpr civil_second cs(2016, 1, 28, -49, 14, 12);
+  static_assert(cs.year() == 2016, "HourUnderflow.year");
+  static_assert(cs.month() == 1, "HourUnderflow.month");
+  static_assert(cs.day() == 25, "HourUnderflow.day");
+  static_assert(cs.hour() == 23, "HourUnderflow.hour");
+  static_assert(cs.minute() == 14, "HourUnderflow.minute");
+  static_assert(cs.second() == 12, "HourUnderflow.second");
+}
+
+TEST(CivilTime, MonthOverflow) {
+  constexpr civil_second cs(2016, 25, 28, 17, 14, 12);
+  static_assert(cs.year() == 2018, "MonthOverflow.year");
+  static_assert(cs.month() == 1, "MonthOverflow.month");
+  static_assert(cs.day() == 28, "MonthOverflow.day");
+  static_assert(cs.hour() == 17, "MonthOverflow.hour");
+  static_assert(cs.minute() == 14, "MonthOverflow.minute");
+  static_assert(cs.second() == 12, "MonthOverflow.second");
+}
+
+TEST(CivilTime, MonthUnderflow) {
+  constexpr civil_second cs(2016, -25, 28, 17, 14, 12);
+  static_assert(cs.year() == 2013, "MonthUnderflow.year");
+  static_assert(cs.month() == 11, "MonthUnderflow.month");
+  static_assert(cs.day() == 28, "MonthUnderflow.day");
+  static_assert(cs.hour() == 17, "MonthUnderflow.hour");
+  static_assert(cs.minute() == 14, "MonthUnderflow.minute");
+  static_assert(cs.second() == 12, "MonthUnderflow.second");
+}
+
+TEST(CivilTime, C4Overflow) {
+  constexpr civil_second cs(2016, 1, 292195, 17, 14, 12);
+  static_assert(cs.year() == 2816, "C4Overflow.year");
+  static_assert(cs.month() == 1, "C4Overflow.month");
+  static_assert(cs.day() == 1, "C4Overflow.day");
+  static_assert(cs.hour() == 17, "C4Overflow.hour");
+  static_assert(cs.minute() == 14, "C4Overflow.minute");
+  static_assert(cs.second() == 12, "C4Overflow.second");
+}
+
+TEST(CivilTime, C4Underflow) {
+  constexpr civil_second cs(2016, 1, -292195, 17, 14, 12);
+  static_assert(cs.year() == 1215, "C4Underflow.year");
+  static_assert(cs.month() == 12, "C4Underflow.month");
+  static_assert(cs.day() == 30, "C4Underflow.day");
+  static_assert(cs.hour() == 17, "C4Underflow.hour");
+  static_assert(cs.minute() == 14, "C4Underflow.minute");
+  static_assert(cs.second() == 12, "C4Underflow.second");
+}
+
+TEST(CivilTime, MixedNormalization) {
+  constexpr civil_second cs(2016, -42, 122, 99, -147, 4949);
+  static_assert(cs.year() == 2012, "MixedNormalization.year");
+  static_assert(cs.month() == 10, "MixedNormalization.month");
+  static_assert(cs.day() == 4, "MixedNormalization.day");
+  static_assert(cs.hour() == 1, "MixedNormalization.hour");
+  static_assert(cs.minute() == 55, "MixedNormalization.minute");
+  static_assert(cs.second() == 29, "MixedNormalization.second");
+}
+
+// Relational constexpr tests
+
+TEST(CivilTime, Less) {
+  constexpr civil_second cs1(2016, 1, 28, 17, 14, 12);
+  constexpr civil_second cs2(2016, 1, 28, 17, 14, 13);
+  constexpr bool less = cs1 < cs2;
+  static_assert(less, "Less");
+}
+
+// Arithmetic constexpr tests
+
+TEST(CivilTime, Addition) {
+  constexpr civil_second cs1(2016, 1, 28, 17, 14, 12);
+  constexpr civil_second cs2 = cs1 + 50;
+  static_assert(cs2.year() == 2016, "Addition.year");
+  static_assert(cs2.month() == 1, "Addition.month");
+  static_assert(cs2.day() == 28, "Addition.day");
+  static_assert(cs2.hour() == 17, "Addition.hour");
+  static_assert(cs2.minute() == 15, "Addition.minute");
+  static_assert(cs2.second() == 2, "Addition.second");
+}
+
+TEST(CivilTime, Subtraction) {
+  constexpr civil_second cs1(2016, 1, 28, 17, 14, 12);
+  constexpr civil_second cs2 = cs1 - 50;
+  static_assert(cs2.year() == 2016, "Subtraction.year");
+  static_assert(cs2.month() == 1, "Subtraction.month");
+  static_assert(cs2.day() == 28, "Subtraction.day");
+  static_assert(cs2.hour() == 17, "Subtraction.hour");
+  static_assert(cs2.minute() == 13, "Subtraction.minute");
+  static_assert(cs2.second() == 22, "Subtraction.second");
+}
+
+TEST(CivilTime, Difference) {
+  constexpr civil_day cd1(2016, 1, 28);
+  constexpr civil_day cd2(2015, 1, 28);
+  constexpr int diff = cd1 - cd2;
+  static_assert(diff == 365, "Difference");
+}
+
+// NOTE: Run this with --copt=-ftrapv to detect overflow problems.
+TEST(CivilTime, DifferenceWithHugeYear) {
+  {
+    constexpr civil_day d1(9223372036854775807, 1, 1);
+    constexpr civil_day d2(9223372036854775807, 12, 31);
+    static_assert(d2 - d1 == 364, "DifferenceWithHugeYear");
+  }
+  {
+    constexpr civil_day d1(-9223372036854775807 - 1, 1, 1);
+    constexpr civil_day d2(-9223372036854775807 - 1, 12, 31);
+    static_assert(d2 - d1 == 365, "DifferenceWithHugeYear");
+  }
+  {
+    // Check the limits of the return value at the end of the year range.
+    constexpr civil_day d1(9223372036854775807, 1, 1);
+    constexpr civil_day d2(9198119301927009252, 6, 6);
+    static_assert(d1 - d2 == 9223372036854775807, "DifferenceWithHugeYear");
+    static_assert((d2 - 1) - d1 == -9223372036854775807 - 1,
+                  "DifferenceWithHugeYear");
+  }
+  {
+    // Check the limits of the return value at the start of the year range.
+    constexpr civil_day d1(-9223372036854775807 - 1, 1, 1);
+    constexpr civil_day d2(-9198119301927009254, 7, 28);
+    static_assert(d2 - d1 == 9223372036854775807, "DifferenceWithHugeYear");
+    static_assert(d1 - (d2 + 1) == -9223372036854775807 - 1,
+                  "DifferenceWithHugeYear");
+  }
+  {
+    // Check the limits of the return value from either side of year 0.
+    constexpr civil_day d1(-12626367463883278, 9, 3);
+    constexpr civil_day d2(12626367463883277, 3, 28);
+    static_assert(d2 - d1 == 9223372036854775807, "DifferenceWithHugeYear");
+    static_assert(d1 - (d2 + 1) == -9223372036854775807 - 1,
+                  "DifferenceWithHugeYear");
+  }
+}
+
+// NOTE: Run this with --copt=-ftrapv to detect overflow problems.
+TEST(CivilTime, DifferenceNoIntermediateOverflow) {
+  {
+    // The difference up to the minute field would be below the minimum
+    // diff_t, but the 52 extra seconds brings us back to the minimum.
+    constexpr civil_second s1(-292277022657, 1, 27, 8, 29 - 1, 52);
+    constexpr civil_second s2(1970, 1, 1, 0, 0 - 1, 0);
+    static_assert(s1 - s2 == -9223372036854775807 - 1,
+                  "DifferenceNoIntermediateOverflow");
+  }
+  {
+    // The difference up to the minute field would be above the maximum
+    // diff_t, but the -53 extra seconds brings us back to the maximum.
+    constexpr civil_second s1(292277026596, 12, 4, 15, 30, 7 - 7);
+    constexpr civil_second s2(1970, 1, 1, 0, 0, 0 - 7);
+    static_assert(s1 - s2 == 9223372036854775807,
+                  "DifferenceNoIntermediateOverflow");
+  }
+}
+
+// Helper constexpr tests
+
+TEST(CivilTime, WeekDay) {
+  constexpr civil_day cd(2016, 1, 28);
+  constexpr weekday wd = get_weekday(cd);
+  static_assert(wd == weekday::thursday, "Weekday");
+}
+
+TEST(CivilTime, NextWeekDay) {
+  constexpr civil_day cd(2016, 1, 28);
+  constexpr civil_day next = next_weekday(cd, weekday::thursday);
+  static_assert(next.year() == 2016, "NextWeekDay.year");
+  static_assert(next.month() == 2, "NextWeekDay.month");
+  static_assert(next.day() == 4, "NextWeekDay.day");
+}
+
+TEST(CivilTime, PrevWeekDay) {
+  constexpr civil_day cd(2016, 1, 28);
+  constexpr civil_day prev = prev_weekday(cd, weekday::thursday);
+  static_assert(prev.year() == 2016, "PrevWeekDay.year");
+  static_assert(prev.month() == 1, "PrevWeekDay.month");
+  static_assert(prev.day() == 21, "PrevWeekDay.day");
+}
+
+TEST(CivilTime, YearDay) {
+  constexpr civil_day cd(2016, 1, 28);
+  constexpr int yd = get_yearday(cd);
+  static_assert(yd == 28, "YearDay");
+}
+#endif  // __cpp_constexpr >= 201304 || (defined(_MSC_VER) && _MSC_VER >= 1910)
+
+// The remaining tests do not use constexpr.
+
+TEST(CivilTime, DefaultConstruction) {
+  civil_second ss;
+  EXPECT_EQ("1970-01-01T00:00:00", Format(ss));
+
+  civil_minute mm;
+  EXPECT_EQ("1970-01-01T00:00", Format(mm));
+
+  civil_hour hh;
+  EXPECT_EQ("1970-01-01T00", Format(hh));
+
+  civil_day d;
+  EXPECT_EQ("1970-01-01", Format(d));
+
+  civil_month m;
+  EXPECT_EQ("1970-01", Format(m));
+
+  civil_year y;
+  EXPECT_EQ("1970", Format(y));
+}
+
+TEST(CivilTime, StructMember) {
+  struct S {
+    civil_day day;
+  };
+  S s = {};
+  EXPECT_EQ(civil_day{}, s.day);
+}
+
+TEST(CivilTime, FieldsConstruction) {
+  EXPECT_EQ("2015-01-02T03:04:05", Format(civil_second(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015-01-02T03:04:00", Format(civil_second(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015-01-02T03:00:00", Format(civil_second(2015, 1, 2, 3)));
+  EXPECT_EQ("2015-01-02T00:00:00", Format(civil_second(2015, 1, 2)));
+  EXPECT_EQ("2015-01-01T00:00:00", Format(civil_second(2015, 1)));
+  EXPECT_EQ("2015-01-01T00:00:00", Format(civil_second(2015)));
+
+  EXPECT_EQ("2015-01-02T03:04", Format(civil_minute(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015-01-02T03:04", Format(civil_minute(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015-01-02T03:00", Format(civil_minute(2015, 1, 2, 3)));
+  EXPECT_EQ("2015-01-02T00:00", Format(civil_minute(2015, 1, 2)));
+  EXPECT_EQ("2015-01-01T00:00", Format(civil_minute(2015, 1)));
+  EXPECT_EQ("2015-01-01T00:00", Format(civil_minute(2015)));
+
+  EXPECT_EQ("2015-01-02T03", Format(civil_hour(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015-01-02T03", Format(civil_hour(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015-01-02T03", Format(civil_hour(2015, 1, 2, 3)));
+  EXPECT_EQ("2015-01-02T00", Format(civil_hour(2015, 1, 2)));
+  EXPECT_EQ("2015-01-01T00", Format(civil_hour(2015, 1)));
+  EXPECT_EQ("2015-01-01T00", Format(civil_hour(2015)));
+
+  EXPECT_EQ("2015-01-02", Format(civil_day(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015-01-02", Format(civil_day(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015-01-02", Format(civil_day(2015, 1, 2, 3)));
+  EXPECT_EQ("2015-01-02", Format(civil_day(2015, 1, 2)));
+  EXPECT_EQ("2015-01-01", Format(civil_day(2015, 1)));
+  EXPECT_EQ("2015-01-01", Format(civil_day(2015)));
+
+  EXPECT_EQ("2015-01", Format(civil_month(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015-01", Format(civil_month(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015-01", Format(civil_month(2015, 1, 2, 3)));
+  EXPECT_EQ("2015-01", Format(civil_month(2015, 1, 2)));
+  EXPECT_EQ("2015-01", Format(civil_month(2015, 1)));
+  EXPECT_EQ("2015-01", Format(civil_month(2015)));
+
+  EXPECT_EQ("2015", Format(civil_year(2015, 1, 2, 3, 4, 5)));
+  EXPECT_EQ("2015", Format(civil_year(2015, 1, 2, 3, 4)));
+  EXPECT_EQ("2015", Format(civil_year(2015, 1, 2, 3)));
+  EXPECT_EQ("2015", Format(civil_year(2015, 1, 2)));
+  EXPECT_EQ("2015", Format(civil_year(2015, 1)));
+  EXPECT_EQ("2015", Format(civil_year(2015)));
+}
+
+TEST(CivilTime, FieldsConstructionLimits) {
+  const int kIntMax = std::numeric_limits<int>::max();
+  EXPECT_EQ("2038-01-19T03:14:07",
+            Format(civil_second(1970, 1, 1, 0, 0, kIntMax)));
+  EXPECT_EQ("6121-02-11T05:21:07",
+            Format(civil_second(1970, 1, 1, 0, kIntMax, kIntMax)));
+  EXPECT_EQ("251104-11-20T12:21:07",
+            Format(civil_second(1970, 1, 1, kIntMax, kIntMax, kIntMax)));
+  EXPECT_EQ("6130715-05-30T12:21:07",
+            Format(civil_second(1970, 1, kIntMax, kIntMax, kIntMax, kIntMax)));
+  EXPECT_EQ(
+      "185087685-11-26T12:21:07",
+      Format(civil_second(1970, kIntMax, kIntMax, kIntMax, kIntMax, kIntMax)));
+
+  const int kIntMin = std::numeric_limits<int>::min();
+  EXPECT_EQ("1901-12-13T20:45:52",
+            Format(civil_second(1970, 1, 1, 0, 0, kIntMin)));
+  EXPECT_EQ("-2182-11-20T18:37:52",
+            Format(civil_second(1970, 1, 1, 0, kIntMin, kIntMin)));
+  EXPECT_EQ("-247165-02-11T10:37:52",
+            Format(civil_second(1970, 1, 1, kIntMin, kIntMin, kIntMin)));
+  EXPECT_EQ("-6126776-08-01T10:37:52",
+            Format(civil_second(1970, 1, kIntMin, kIntMin, kIntMin, kIntMin)));
+  EXPECT_EQ(
+      "-185083747-10-31T10:37:52",
+      Format(civil_second(1970, kIntMin, kIntMin, kIntMin, kIntMin, kIntMin)));
+}
+
+TEST(CivilTime, ImplicitCrossAlignment) {
+  civil_year year(2015);
+  civil_month month = year;
+  civil_day day = month;
+  civil_hour hour = day;
+  civil_minute minute = hour;
+  civil_second second = minute;
+
+  second = year;
+  EXPECT_EQ(second, year);
+  second = month;
+  EXPECT_EQ(second, month);
+  second = day;
+  EXPECT_EQ(second, day);
+  second = hour;
+  EXPECT_EQ(second, hour);
+  second = minute;
+  EXPECT_EQ(second, minute);
+
+  minute = year;
+  EXPECT_EQ(minute, year);
+  minute = month;
+  EXPECT_EQ(minute, month);
+  minute = day;
+  EXPECT_EQ(minute, day);
+  minute = hour;
+  EXPECT_EQ(minute, hour);
+
+  hour = year;
+  EXPECT_EQ(hour, year);
+  hour = month;
+  EXPECT_EQ(hour, month);
+  hour = day;
+  EXPECT_EQ(hour, day);
+
+  day = year;
+  EXPECT_EQ(day, year);
+  day = month;
+  EXPECT_EQ(day, month);
+
+  month = year;
+  EXPECT_EQ(month, year);
+
+  // Ensures unsafe conversions are not allowed.
+  EXPECT_FALSE((std::is_convertible<civil_second, civil_minute>::value));
+  EXPECT_FALSE((std::is_convertible<civil_second, civil_hour>::value));
+  EXPECT_FALSE((std::is_convertible<civil_second, civil_day>::value));
+  EXPECT_FALSE((std::is_convertible<civil_second, civil_month>::value));
+  EXPECT_FALSE((std::is_convertible<civil_second, civil_year>::value));
+
+  EXPECT_FALSE((std::is_convertible<civil_minute, civil_hour>::value));
+  EXPECT_FALSE((std::is_convertible<civil_minute, civil_day>::value));
+  EXPECT_FALSE((std::is_convertible<civil_minute, civil_month>::value));
+  EXPECT_FALSE((std::is_convertible<civil_minute, civil_year>::value));
+
+  EXPECT_FALSE((std::is_convertible<civil_hour, civil_day>::value));
+  EXPECT_FALSE((std::is_convertible<civil_hour, civil_month>::value));
+  EXPECT_FALSE((std::is_convertible<civil_hour, civil_year>::value));
+
+  EXPECT_FALSE((std::is_convertible<civil_day, civil_month>::value));
+  EXPECT_FALSE((std::is_convertible<civil_day, civil_year>::value));
+
+  EXPECT_FALSE((std::is_convertible<civil_month, civil_year>::value));
+}
+
+TEST(CivilTime, ExplicitCrossAlignment) {
+  //
+  // Assign from smaller units -> larger units
+  //
+
+  civil_second second(2015, 1, 2, 3, 4, 5);
+  EXPECT_EQ("2015-01-02T03:04:05", Format(second));
+
+  civil_minute minute(second);
+  EXPECT_EQ("2015-01-02T03:04", Format(minute));
+
+  civil_hour hour(minute);
+  EXPECT_EQ("2015-01-02T03", Format(hour));
+
+  civil_day day(hour);
+  EXPECT_EQ("2015-01-02", Format(day));
+
+  civil_month month(day);
+  EXPECT_EQ("2015-01", Format(month));
+
+  civil_year year(month);
+  EXPECT_EQ("2015", Format(year));
+
+  //
+  // Now assign from larger units -> smaller units
+  //
+
+  month = civil_month(year);
+  EXPECT_EQ("2015-01", Format(month));
+
+  day = civil_day(month);
+  EXPECT_EQ("2015-01-01", Format(day));
+
+  hour = civil_hour(day);
+  EXPECT_EQ("2015-01-01T00", Format(hour));
+
+  minute = civil_minute(hour);
+  EXPECT_EQ("2015-01-01T00:00", Format(minute));
+
+  second = civil_second(minute);
+  EXPECT_EQ("2015-01-01T00:00:00", Format(second));
+}
+
+// Metafunction to test whether difference is allowed between two types.
+template <typename T1, typename T2>
+struct HasDifference {
+  template <typename U1, typename U2>
+  static std::false_type test(...);
+  template <typename U1, typename U2>
+  static std::true_type test(decltype(std::declval<U1>() - std::declval<U2>()));
+  static constexpr bool value = decltype(test<T1, T2>(0))::value;
+};
+
+TEST(CivilTime, DisallowCrossAlignedDifference) {
+  // Difference is allowed between types with the same alignment.
+  static_assert(HasDifference<civil_second, civil_second>::value, "");
+  static_assert(HasDifference<civil_minute, civil_minute>::value, "");
+  static_assert(HasDifference<civil_hour, civil_hour>::value, "");
+  static_assert(HasDifference<civil_day, civil_day>::value, "");
+  static_assert(HasDifference<civil_month, civil_month>::value, "");
+  static_assert(HasDifference<civil_year, civil_year>::value, "");
+
+  // Difference is disallowed between types with different alignments.
+  static_assert(!HasDifference<civil_second, civil_minute>::value, "");
+  static_assert(!HasDifference<civil_second, civil_hour>::value, "");
+  static_assert(!HasDifference<civil_second, civil_day>::value, "");
+  static_assert(!HasDifference<civil_second, civil_month>::value, "");
+  static_assert(!HasDifference<civil_second, civil_year>::value, "");
+
+  static_assert(!HasDifference<civil_minute, civil_hour>::value, "");
+  static_assert(!HasDifference<civil_minute, civil_day>::value, "");
+  static_assert(!HasDifference<civil_minute, civil_month>::value, "");
+  static_assert(!HasDifference<civil_minute, civil_year>::value, "");
+
+  static_assert(!HasDifference<civil_hour, civil_day>::value, "");
+  static_assert(!HasDifference<civil_hour, civil_month>::value, "");
+  static_assert(!HasDifference<civil_hour, civil_year>::value, "");
+
+  static_assert(!HasDifference<civil_day, civil_month>::value, "");
+  static_assert(!HasDifference<civil_day, civil_year>::value, "");
+
+  static_assert(!HasDifference<civil_month, civil_year>::value, "");
+}
+
+TEST(CivilTime, ValueSemantics) {
+  const civil_hour a(2015, 1, 2, 3);
+  const civil_hour b = a;
+  const civil_hour c(b);
+  civil_hour d;
+  d = c;
+  EXPECT_EQ("2015-01-02T03", Format(d));
+}
+
+TEST(CivilTime, Relational) {
+  // Tests that the alignment unit is ignored in comparison.
+  const civil_year year(2014);
+  const civil_month month(year);
+  EXPECT_EQ(year, month);
+
+#define TEST_RELATIONAL(OLDER, YOUNGER) \
+  do {                                  \
+    EXPECT_FALSE(OLDER < OLDER);        \
+    EXPECT_FALSE(OLDER > OLDER);        \
+    EXPECT_TRUE(OLDER >= OLDER);        \
+    EXPECT_TRUE(OLDER <= OLDER);        \
+    EXPECT_FALSE(YOUNGER < YOUNGER);    \
+    EXPECT_FALSE(YOUNGER > YOUNGER);    \
+    EXPECT_TRUE(YOUNGER >= YOUNGER);    \
+    EXPECT_TRUE(YOUNGER <= YOUNGER);    \
+    EXPECT_EQ(OLDER, OLDER);            \
+    EXPECT_NE(OLDER, YOUNGER);          \
+    EXPECT_LT(OLDER, YOUNGER);          \
+    EXPECT_LE(OLDER, YOUNGER);          \
+    EXPECT_GT(YOUNGER, OLDER);          \
+    EXPECT_GE(YOUNGER, OLDER);          \
+  } while (0)
+
+  // Alignment is ignored in comparison (verified above), so kSecond is used
+  // to test comparison in all field positions.
+  TEST_RELATIONAL(civil_second(2014, 1, 1, 0, 0, 0),
+                  civil_second(2015, 1, 1, 0, 0, 0));
+  TEST_RELATIONAL(civil_second(2014, 1, 1, 0, 0, 0),
+                  civil_second(2014, 2, 1, 0, 0, 0));
+  TEST_RELATIONAL(civil_second(2014, 1, 1, 0, 0, 0),
+                  civil_second(2014, 1, 2, 0, 0, 0));
+  TEST_RELATIONAL(civil_second(2014, 1, 1, 0, 0, 0),
+                  civil_second(2014, 1, 1, 1, 0, 0));
+  TEST_RELATIONAL(civil_second(2014, 1, 1, 1, 0, 0),
+                  civil_second(2014, 1, 1, 1, 1, 0));
+  TEST_RELATIONAL(civil_second(2014, 1, 1, 1, 1, 0),
+                  civil_second(2014, 1, 1, 1, 1, 1));
+
+  // Tests the relational operators of two different civil-time types.
+  TEST_RELATIONAL(civil_day(2014, 1, 1), civil_minute(2014, 1, 1, 1, 1));
+  TEST_RELATIONAL(civil_day(2014, 1, 1), civil_month(2014, 2));
+
+#undef TEST_RELATIONAL
+}
+
+TEST(CivilTime, Arithmetic) {
+  civil_second second(2015, 1, 2, 3, 4, 5);
+  EXPECT_EQ("2015-01-02T03:04:06", Format(second += 1));
+  EXPECT_EQ("2015-01-02T03:04:07", Format(second + 1));
+  EXPECT_EQ("2015-01-02T03:04:08", Format(2 + second));
+  EXPECT_EQ("2015-01-02T03:04:05", Format(second - 1));
+  EXPECT_EQ("2015-01-02T03:04:05", Format(second -= 1));
+  EXPECT_EQ("2015-01-02T03:04:05", Format(second++));
+  EXPECT_EQ("2015-01-02T03:04:07", Format(++second));
+  EXPECT_EQ("2015-01-02T03:04:07", Format(second--));
+  EXPECT_EQ("2015-01-02T03:04:05", Format(--second));
+
+  civil_minute minute(2015, 1, 2, 3, 4);
+  EXPECT_EQ("2015-01-02T03:05", Format(minute += 1));
+  EXPECT_EQ("2015-01-02T03:06", Format(minute + 1));
+  EXPECT_EQ("2015-01-02T03:07", Format(2 + minute));
+  EXPECT_EQ("2015-01-02T03:04", Format(minute - 1));
+  EXPECT_EQ("2015-01-02T03:04", Format(minute -= 1));
+  EXPECT_EQ("2015-01-02T03:04", Format(minute++));
+  EXPECT_EQ("2015-01-02T03:06", Format(++minute));
+  EXPECT_EQ("2015-01-02T03:06", Format(minute--));
+  EXPECT_EQ("2015-01-02T03:04", Format(--minute));
+
+  civil_hour hour(2015, 1, 2, 3);
+  EXPECT_EQ("2015-01-02T04", Format(hour += 1));
+  EXPECT_EQ("2015-01-02T05", Format(hour + 1));
+  EXPECT_EQ("2015-01-02T06", Format(2 + hour));
+  EXPECT_EQ("2015-01-02T03", Format(hour - 1));
+  EXPECT_EQ("2015-01-02T03", Format(hour -= 1));
+  EXPECT_EQ("2015-01-02T03", Format(hour++));
+  EXPECT_EQ("2015-01-02T05", Format(++hour));
+  EXPECT_EQ("2015-01-02T05", Format(hour--));
+  EXPECT_EQ("2015-01-02T03", Format(--hour));
+
+  civil_day day(2015, 1, 2);
+  EXPECT_EQ("2015-01-03", Format(day += 1));
+  EXPECT_EQ("2015-01-04", Format(day + 1));
+  EXPECT_EQ("2015-01-05", Format(2 + day));
+  EXPECT_EQ("2015-01-02", Format(day - 1));
+  EXPECT_EQ("2015-01-02", Format(day -= 1));
+  EXPECT_EQ("2015-01-02", Format(day++));
+  EXPECT_EQ("2015-01-04", Format(++day));
+  EXPECT_EQ("2015-01-04", Format(day--));
+  EXPECT_EQ("2015-01-02", Format(--day));
+
+  civil_month month(2015, 1);
+  EXPECT_EQ("2015-02", Format(month += 1));
+  EXPECT_EQ("2015-03", Format(month + 1));
+  EXPECT_EQ("2015-04", Format(2 + month));
+  EXPECT_EQ("2015-01", Format(month - 1));
+  EXPECT_EQ("2015-01", Format(month -= 1));
+  EXPECT_EQ("2015-01", Format(month++));
+  EXPECT_EQ("2015-03", Format(++month));
+  EXPECT_EQ("2015-03", Format(month--));
+  EXPECT_EQ("2015-01", Format(--month));
+
+  civil_year year(2015);
+  EXPECT_EQ("2016", Format(year += 1));
+  EXPECT_EQ("2017", Format(year + 1));
+  EXPECT_EQ("2018", Format(2 + year));
+  EXPECT_EQ("2015", Format(year - 1));
+  EXPECT_EQ("2015", Format(year -= 1));
+  EXPECT_EQ("2015", Format(year++));
+  EXPECT_EQ("2017", Format(++year));
+  EXPECT_EQ("2017", Format(year--));
+  EXPECT_EQ("2015", Format(--year));
+}
+
+TEST(CivilTime, ArithmeticLimits) {
+  const int kIntMax = std::numeric_limits<int>::max();
+  const int kIntMin = std::numeric_limits<int>::min();
+
+  civil_second second(1970, 1, 1, 0, 0, 0);
+  second += kIntMax;
+  EXPECT_EQ("2038-01-19T03:14:07", Format(second));
+  second -= kIntMax;
+  EXPECT_EQ("1970-01-01T00:00:00", Format(second));
+  second += kIntMin;
+  EXPECT_EQ("1901-12-13T20:45:52", Format(second));
+  second -= kIntMin;
+  EXPECT_EQ("1970-01-01T00:00:00", Format(second));
+
+  civil_minute minute(1970, 1, 1, 0, 0);
+  minute += kIntMax;
+  EXPECT_EQ("6053-01-23T02:07", Format(minute));
+  minute -= kIntMax;
+  EXPECT_EQ("1970-01-01T00:00", Format(minute));
+  minute += kIntMin;
+  EXPECT_EQ("-2114-12-08T21:52", Format(minute));
+  minute -= kIntMin;
+  EXPECT_EQ("1970-01-01T00:00", Format(minute));
+
+  civil_hour hour(1970, 1, 1, 0);
+  hour += kIntMax;
+  EXPECT_EQ("246953-10-09T07", Format(hour));
+  hour -= kIntMax;
+  EXPECT_EQ("1970-01-01T00", Format(hour));
+  hour += kIntMin;
+  EXPECT_EQ("-243014-03-24T16", Format(hour));
+  hour -= kIntMin;
+  EXPECT_EQ("1970-01-01T00", Format(hour));
+
+  civil_day day(1970, 1, 1);
+  day += kIntMax;
+  EXPECT_EQ("5881580-07-11", Format(day));
+  day -= kIntMax;
+  EXPECT_EQ("1970-01-01", Format(day));
+  day += kIntMin;
+  EXPECT_EQ("-5877641-06-23", Format(day));
+  day -= kIntMin;
+  EXPECT_EQ("1970-01-01", Format(day));
+
+  civil_month month(1970, 1);
+  month += kIntMax;
+  EXPECT_EQ("178958940-08", Format(month));
+  month -= kIntMax;
+  EXPECT_EQ("1970-01", Format(month));
+  month += kIntMin;
+  EXPECT_EQ("-178955001-05", Format(month));
+  month -= kIntMin;
+  EXPECT_EQ("1970-01", Format(month));
+
+  civil_year year(0);
+  year += kIntMax;
+  EXPECT_EQ("2147483647", Format(year));
+  year -= kIntMax;
+  EXPECT_EQ("0", Format(year));
+  year += kIntMin;
+  EXPECT_EQ("-2147483648", Format(year));
+  year -= kIntMin;
+  EXPECT_EQ("0", Format(year));
+}
+
+TEST(CivilTime, ArithmeticDifference) {
+  civil_second second(2015, 1, 2, 3, 4, 5);
+  EXPECT_EQ(0, second - second);
+  EXPECT_EQ(10, (second + 10) - second);
+  EXPECT_EQ(-10, (second - 10) - second);
+
+  civil_minute minute(2015, 1, 2, 3, 4);
+  EXPECT_EQ(0, minute - minute);
+  EXPECT_EQ(10, (minute + 10) - minute);
+  EXPECT_EQ(-10, (minute - 10) - minute);
+
+  civil_hour hour(2015, 1, 2, 3);
+  EXPECT_EQ(0, hour - hour);
+  EXPECT_EQ(10, (hour + 10) - hour);
+  EXPECT_EQ(-10, (hour - 10) - hour);
+
+  civil_day day(2015, 1, 2);
+  EXPECT_EQ(0, day - day);
+  EXPECT_EQ(10, (day + 10) - day);
+  EXPECT_EQ(-10, (day - 10) - day);
+
+  civil_month month(2015, 1);
+  EXPECT_EQ(0, month - month);
+  EXPECT_EQ(10, (month + 10) - month);
+  EXPECT_EQ(-10, (month - 10) - month);
+
+  civil_year year(2015);
+  EXPECT_EQ(0, year - year);
+  EXPECT_EQ(10, (year + 10) - year);
+  EXPECT_EQ(-10, (year - 10) - year);
+}
+
+TEST(CivilTime, DifferenceLimits) {
+  const int kIntMax = std::numeric_limits<int>::max();
+  const int kIntMin = std::numeric_limits<int>::min();
+
+  // Check day arithmetic at the end of the year range.
+  const civil_day max_day(kIntMax, 12, 31);
+  EXPECT_EQ(1, max_day - (max_day - 1));
+  EXPECT_EQ(-1, (max_day - 1) - max_day);
+
+  // Check day arithmetic at the end of the year range.
+  const civil_day min_day(kIntMin, 1, 1);
+  EXPECT_EQ(1, (min_day + 1) - min_day);
+  EXPECT_EQ(-1, min_day - (min_day + 1));
+
+  // Check the limits of the return value.
+  const civil_day d1(1970, 1, 1);
+  const civil_day d2(5881580, 7, 11);
+  EXPECT_EQ(kIntMax, d2 - d1);
+  EXPECT_EQ(kIntMin, d1 - (d2 + 1));
+}
+
+TEST(CivilTime, Properties) {
+  civil_second ss(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, ss.year());
+  EXPECT_EQ(2, ss.month());
+  EXPECT_EQ(3, ss.day());
+  EXPECT_EQ(4, ss.hour());
+  EXPECT_EQ(5, ss.minute());
+  EXPECT_EQ(6, ss.second());
+  EXPECT_EQ(weekday::tuesday, get_weekday(ss));
+  EXPECT_EQ(34, get_yearday(ss));
+
+  civil_minute mm(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, mm.year());
+  EXPECT_EQ(2, mm.month());
+  EXPECT_EQ(3, mm.day());
+  EXPECT_EQ(4, mm.hour());
+  EXPECT_EQ(5, mm.minute());
+  EXPECT_EQ(0, mm.second());
+  EXPECT_EQ(weekday::tuesday, get_weekday(mm));
+  EXPECT_EQ(34, get_yearday(mm));
+
+  civil_hour hh(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, hh.year());
+  EXPECT_EQ(2, hh.month());
+  EXPECT_EQ(3, hh.day());
+  EXPECT_EQ(4, hh.hour());
+  EXPECT_EQ(0, hh.minute());
+  EXPECT_EQ(0, hh.second());
+  EXPECT_EQ(weekday::tuesday, get_weekday(hh));
+  EXPECT_EQ(34, get_yearday(hh));
+
+  civil_day d(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, d.year());
+  EXPECT_EQ(2, d.month());
+  EXPECT_EQ(3, d.day());
+  EXPECT_EQ(0, d.hour());
+  EXPECT_EQ(0, d.minute());
+  EXPECT_EQ(0, d.second());
+  EXPECT_EQ(weekday::tuesday, get_weekday(d));
+  EXPECT_EQ(34, get_yearday(d));
+
+  civil_month m(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, m.year());
+  EXPECT_EQ(2, m.month());
+  EXPECT_EQ(1, m.day());
+  EXPECT_EQ(0, m.hour());
+  EXPECT_EQ(0, m.minute());
+  EXPECT_EQ(0, m.second());
+  EXPECT_EQ(weekday::sunday, get_weekday(m));
+  EXPECT_EQ(32, get_yearday(m));
+
+  civil_year y(2015, 2, 3, 4, 5, 6);
+  EXPECT_EQ(2015, y.year());
+  EXPECT_EQ(1, y.month());
+  EXPECT_EQ(1, y.day());
+  EXPECT_EQ(0, y.hour());
+  EXPECT_EQ(0, y.minute());
+  EXPECT_EQ(0, y.second());
+  EXPECT_EQ(weekday::thursday, get_weekday(y));
+  EXPECT_EQ(1, get_yearday(y));
+}
+
+TEST(CivilTime, OutputStream) {
+  // Tests formatting of civil_year, which does not pad.
+  EXPECT_EQ("2016", Format(civil_year(2016)));
+  EXPECT_EQ("123", Format(civil_year(123)));
+  EXPECT_EQ("0", Format(civil_year(0)));
+  EXPECT_EQ("-1", Format(civil_year(-1)));
+
+  // Tests formatting of sub-year types, which pad to 2 digits
+  EXPECT_EQ("2016-02", Format(civil_month(2016, 2)));
+  EXPECT_EQ("2016-02-03", Format(civil_day(2016, 2, 3)));
+  EXPECT_EQ("2016-02-03T04", Format(civil_hour(2016, 2, 3, 4)));
+  EXPECT_EQ("2016-02-03T04:05", Format(civil_minute(2016, 2, 3, 4, 5)));
+  EXPECT_EQ("2016-02-03T04:05:06", Format(civil_second(2016, 2, 3, 4, 5, 6)));
+
+  // Tests formatting of weekday.
+  EXPECT_EQ("Monday", Format(weekday::monday));
+  EXPECT_EQ("Tuesday", Format(weekday::tuesday));
+  EXPECT_EQ("Wednesday", Format(weekday::wednesday));
+  EXPECT_EQ("Thursday", Format(weekday::thursday));
+  EXPECT_EQ("Friday", Format(weekday::friday));
+  EXPECT_EQ("Saturday", Format(weekday::saturday));
+  EXPECT_EQ("Sunday", Format(weekday::sunday));
+}
+
+TEST(CivilTime, OutputStreamLeftFillWidth) {
+  civil_second cs(2016, 2, 3, 4, 5, 6);
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << civil_year(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016.................X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << civil_month(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016-02..............X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << civil_day(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016-02-03...........X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << civil_hour(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016-02-03T04........X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << civil_minute(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016-02-03T04:05.....X..", ss.str());
+  }
+  {
+    std::stringstream ss;
+    ss << std::left << std::setfill('.');
+    ss << std::setw(3) << 'X';
+    ss << std::setw(21) << civil_second(cs);
+    ss << std::setw(3) << 'X';
+    EXPECT_EQ("X..2016-02-03T04:05:06..X..", ss.str());
+  }
+}
+
+TEST(CivilTime, NextPrevWeekday) {
+  // Jan 1, 1970 was a Thursday.
+  const civil_day thursday(1970, 1, 1);
+  EXPECT_EQ(weekday::thursday, get_weekday(thursday));
+
+  // Thursday -> Thursday
+  civil_day d = next_weekday(thursday, weekday::thursday);
+  EXPECT_EQ(7, d - thursday) << Format(d);
+  EXPECT_EQ(d - 14, prev_weekday(thursday, weekday::thursday));
+
+  // Thursday -> Friday
+  d = next_weekday(thursday, weekday::friday);
+  EXPECT_EQ(1, d - thursday) << Format(d);
+  EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::friday));
+
+  // Thursday -> Saturday
+  d = next_weekday(thursday, weekday::saturday);
+  EXPECT_EQ(2, d - thursday) << Format(d);
+  EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::saturday));
+
+  // Thursday -> Sunday
+  d = next_weekday(thursday, weekday::sunday);
+  EXPECT_EQ(3, d - thursday) << Format(d);
+  EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::sunday));
+
+  // Thursday -> Monday
+  d = next_weekday(thursday, weekday::monday);
+  EXPECT_EQ(4, d - thursday) << Format(d);
+  EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::monday));
+
+  // Thursday -> Tuesday
+  d = next_weekday(thursday, weekday::tuesday);
+  EXPECT_EQ(5, d - thursday) << Format(d);
+  EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::tuesday));
+
+  // Thursday -> Wednesday
+  d = next_weekday(thursday, weekday::wednesday);
+  EXPECT_EQ(6, d - thursday) << Format(d);
+  EXPECT_EQ(d - 7, prev_weekday(thursday, weekday::wednesday));
+}
+
+TEST(CivilTime, NormalizeWithHugeYear) {
+  civil_month c(9223372036854775807, 1);
+  EXPECT_EQ("9223372036854775807-01", Format(c));
+  c = c - 1;  // Causes normalization
+  EXPECT_EQ("9223372036854775806-12", Format(c));
+
+  c = civil_month(-9223372036854775807 - 1, 1);
+  EXPECT_EQ("-9223372036854775808-01", Format(c));
+  c = c + 12;  // Causes normalization
+  EXPECT_EQ("-9223372036854775807-01", Format(c));
+}
+
+TEST(CivilTime, LeapYears) {
+  // Test data for leap years.
+  const struct {
+    int year;
+    int days;
+    struct {
+      int month;
+      int day;
+    } leap_day;  // The date of the day after Feb 28.
+  } kLeapYearTable[]{
+      {1900, 365, {3, 1}},  {1999, 365, {3, 1}},
+      {2000, 366, {2, 29}},  // leap year
+      {2001, 365, {3, 1}},  {2002, 365, {3, 1}},
+      {2003, 365, {3, 1}},  {2004, 366, {2, 29}},  // leap year
+      {2005, 365, {3, 1}},  {2006, 365, {3, 1}},
+      {2007, 365, {3, 1}},  {2008, 366, {2, 29}},  // leap year
+      {2009, 365, {3, 1}},  {2100, 365, {3, 1}},
+  };
+
+  for (const auto& e : kLeapYearTable) {
+    // Tests incrementing through the leap day.
+    const civil_day feb28(e.year, 2, 28);
+    const civil_day next_day = feb28 + 1;
+    EXPECT_EQ(e.leap_day.month, next_day.month());
+    EXPECT_EQ(e.leap_day.day, next_day.day());
+
+    // Tests difference in days of leap years.
+    const civil_year year(feb28);
+    const civil_year next_year = year + 1;
+    EXPECT_EQ(e.days, civil_day(next_year) - civil_day(year));
+  }
+}
+
+TEST(CivilTime, FirstThursdayInMonth) {
+  const civil_day nov1(2014, 11, 1);
+  const civil_day thursday = next_weekday(nov1 - 1, weekday::thursday);
+  EXPECT_EQ("2014-11-06", Format(thursday));
+
+  // Bonus: Date of Thanksgiving in the United States
+  // Rule: Fourth Thursday of November
+  const civil_day thanksgiving = thursday + 7 * 3;
+  EXPECT_EQ("2014-11-27", Format(thanksgiving));
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_fixed.cc b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_fixed.cc
new file mode 100644
index 0000000000..303c0244a8
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_fixed.cc
@@ -0,0 +1,140 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "time_zone_fixed.h"
+
+#include <algorithm>
+#include <cassert>
+#include <chrono>
+#include <cstring>
+#include <string>
+
+#include "absl/base/config.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+// The prefix used for the internal names of fixed-offset zones.
+const char kFixedZonePrefix[] = "Fixed/UTC";
+
+const char kDigits[] = "0123456789";
+
+char* Format02d(char* p, int v) {
+  *p++ = kDigits[(v / 10) % 10];
+  *p++ = kDigits[v % 10];
+  return p;
+}
+
+int Parse02d(const char* p) {
+  if (const char* ap = std::strchr(kDigits, *p)) {
+    int v = static_cast<int>(ap - kDigits);
+    if (const char* bp = std::strchr(kDigits, *++p)) {
+      return (v * 10) + static_cast<int>(bp - kDigits);
+    }
+  }
+  return -1;
+}
+
+}  // namespace
+
+bool FixedOffsetFromName(const std::string& name, seconds* offset) {
+  if (name.compare(0, std::string::npos, "UTC", 3) == 0) {
+    *offset = seconds::zero();
+    return true;
+  }
+
+  const std::size_t prefix_len = sizeof(kFixedZonePrefix) - 1;
+  const char* const ep = kFixedZonePrefix + prefix_len;
+  if (name.size() != prefix_len + 9)  // <prefix>+99:99:99
+    return false;
+  if (!std::equal(kFixedZonePrefix, ep, name.begin())) return false;
+  const char* np = name.data() + prefix_len;
+  if (np[0] != '+' && np[0] != '-') return false;
+  if (np[3] != ':' || np[6] != ':')  // see note below about large offsets
+    return false;
+
+  int hours = Parse02d(np + 1);
+  if (hours == -1) return false;
+  int mins = Parse02d(np + 4);
+  if (mins == -1) return false;
+  int secs = Parse02d(np + 7);
+  if (secs == -1) return false;
+
+  secs += ((hours * 60) + mins) * 60;
+  if (secs > 24 * 60 * 60) return false;  // outside supported offset range
+  *offset = seconds(secs * (np[0] == '-' ? -1 : 1));  // "-" means west
+  return true;
+}
+
+std::string FixedOffsetToName(const seconds& offset) {
+  if (offset == seconds::zero()) return "UTC";
+  if (offset < std::chrono::hours(-24) || offset > std::chrono::hours(24)) {
+    // We don't support fixed-offset zones more than 24 hours
+    // away from UTC to avoid complications in rendering such
+    // offsets and to (somewhat) limit the total number of zones.
+    return "UTC";
+  }
+  int offset_seconds = static_cast<int>(offset.count());
+  const char sign = (offset_seconds < 0 ? '-' : '+');
+  int offset_minutes = offset_seconds / 60;
+  offset_seconds %= 60;
+  if (sign == '-') {
+    if (offset_seconds > 0) {
+      offset_seconds -= 60;
+      offset_minutes += 1;
+    }
+    offset_seconds = -offset_seconds;
+    offset_minutes = -offset_minutes;
+  }
+  int offset_hours = offset_minutes / 60;
+  offset_minutes %= 60;
+  const std::size_t prefix_len = sizeof(kFixedZonePrefix) - 1;
+  char buf[prefix_len + sizeof("-24:00:00")];
+  char* ep = std::copy(kFixedZonePrefix, kFixedZonePrefix + prefix_len, buf);
+  *ep++ = sign;
+  ep = Format02d(ep, offset_hours);
+  *ep++ = ':';
+  ep = Format02d(ep, offset_minutes);
+  *ep++ = ':';
+  ep = Format02d(ep, offset_seconds);
+  *ep++ = '\0';
+  assert(ep == buf + sizeof(buf));
+  return buf;
+}
+
+std::string FixedOffsetToAbbr(const seconds& offset) {
+  std::string abbr = FixedOffsetToName(offset);
+  const std::size_t prefix_len = sizeof(kFixedZonePrefix) - 1;
+  if (abbr.size() == prefix_len + 9) {         // <prefix>+99:99:99
+    abbr.erase(0, prefix_len);                 // +99:99:99
+    abbr.erase(6, 1);                          // +99:9999
+    abbr.erase(3, 1);                          // +999999
+    if (abbr[5] == '0' && abbr[6] == '0') {    // +999900
+      abbr.erase(5, 2);                        // +9999
+      if (abbr[3] == '0' && abbr[4] == '0') {  // +9900
+        abbr.erase(3, 2);                      // +99
+      }
+    }
+  }
+  return abbr;
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_fixed.h b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_fixed.h
new file mode 100644
index 0000000000..e74a0bbd9d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_fixed.h
@@ -0,0 +1,52 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_FIXED_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_FIXED_H_
+
+#include <string>
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// Helper functions for dealing with the names and abbreviations
+// of time zones that are a fixed offset (seconds east) from UTC.
+// FixedOffsetFromName() extracts the offset from a valid fixed-offset
+// name, while FixedOffsetToName() and FixedOffsetToAbbr() generate
+// the canonical zone name and abbreviation respectively for the given
+// offset.
+//
+// A fixed-offset name looks like "Fixed/UTC<+-><hours>:<mins>:<secs>".
+// Its abbreviation is of the form "UTC(<+->H?H(MM(SS)?)?)?" where the
+// optional pieces are omitted when their values are zero.  (Note that
+// the sign is the opposite of that used in a POSIX TZ specification.)
+//
+// Note: FixedOffsetFromName() fails on syntax errors or when the parsed
+// offset exceeds 24 hours.  FixedOffsetToName() and FixedOffsetToAbbr()
+// both produce "UTC" when the argument offset exceeds 24 hours.
+bool FixedOffsetFromName(const std::string& name, seconds* offset);
+std::string FixedOffsetToName(const seconds& offset);
+std::string FixedOffsetToAbbr(const seconds& offset);
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_FIXED_H_
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_format.cc b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_format.cc
new file mode 100644
index 0000000000..179975e062
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_format.cc
@@ -0,0 +1,922 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#if !defined(HAS_STRPTIME)
+#if !defined(_MSC_VER) && !defined(__MINGW32__)
+#define HAS_STRPTIME 1  // assume everyone has strptime() except windows
+#endif
+#endif
+
+#if defined(HAS_STRPTIME) && HAS_STRPTIME
+#if !defined(_XOPEN_SOURCE)
+#define _XOPEN_SOURCE  // Definedness suffices for strptime.
+#endif
+#endif
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+// Include time.h directly since, by C++ standards, ctime doesn't have to
+// declare strptime.
+#include <time.h>
+
+#include <cctype>
+#include <chrono>
+#include <cstddef>
+#include <cstdint>
+#include <cstring>
+#include <ctime>
+#include <limits>
+#include <string>
+#include <vector>
+#if !HAS_STRPTIME
+#include <iomanip>
+#include <sstream>
+#endif
+
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "time_zone_if.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+namespace detail {
+
+namespace {
+
+#if !HAS_STRPTIME
+// Build a strptime() using C++11's std::get_time().
+char* strptime(const char* s, const char* fmt, std::tm* tm) {
+  std::istringstream input(s);
+  input >> std::get_time(tm, fmt);
+  if (input.fail()) return nullptr;
+  return const_cast<char*>(s) +
+         (input.eof() ? strlen(s) : static_cast<std::size_t>(input.tellg()));
+}
+#endif
+
+std::tm ToTM(const time_zone::absolute_lookup& al) {
+  std::tm tm{};
+  tm.tm_sec = al.cs.second();
+  tm.tm_min = al.cs.minute();
+  tm.tm_hour = al.cs.hour();
+  tm.tm_mday = al.cs.day();
+  tm.tm_mon = al.cs.month() - 1;
+
+  // Saturate tm.tm_year is cases of over/underflow.
+  if (al.cs.year() < std::numeric_limits<int>::min() + 1900) {
+    tm.tm_year = std::numeric_limits<int>::min();
+  } else if (al.cs.year() - 1900 > std::numeric_limits<int>::max()) {
+    tm.tm_year = std::numeric_limits<int>::max();
+  } else {
+    tm.tm_year = static_cast<int>(al.cs.year() - 1900);
+  }
+
+  switch (get_weekday(al.cs)) {
+    case weekday::sunday:
+      tm.tm_wday = 0;
+      break;
+    case weekday::monday:
+      tm.tm_wday = 1;
+      break;
+    case weekday::tuesday:
+      tm.tm_wday = 2;
+      break;
+    case weekday::wednesday:
+      tm.tm_wday = 3;
+      break;
+    case weekday::thursday:
+      tm.tm_wday = 4;
+      break;
+    case weekday::friday:
+      tm.tm_wday = 5;
+      break;
+    case weekday::saturday:
+      tm.tm_wday = 6;
+      break;
+  }
+  tm.tm_yday = get_yearday(al.cs) - 1;
+  tm.tm_isdst = al.is_dst ? 1 : 0;
+  return tm;
+}
+
+const char kDigits[] = "0123456789";
+
+// Formats a 64-bit integer in the given field width.  Note that it is up
+// to the caller of Format64() [and Format02d()/FormatOffset()] to ensure
+// that there is sufficient space before ep to hold the conversion.
+char* Format64(char* ep, int width, std::int_fast64_t v) {
+  bool neg = false;
+  if (v < 0) {
+    --width;
+    neg = true;
+    if (v == std::numeric_limits<std::int_fast64_t>::min()) {
+      // Avoid negating minimum value.
+      std::int_fast64_t last_digit = -(v % 10);
+      v /= 10;
+      if (last_digit < 0) {
+        ++v;
+        last_digit += 10;
+      }
+      --width;
+      *--ep = kDigits[last_digit];
+    }
+    v = -v;
+  }
+  do {
+    --width;
+    *--ep = kDigits[v % 10];
+  } while (v /= 10);
+  while (--width >= 0) *--ep = '0';  // zero pad
+  if (neg) *--ep = '-';
+  return ep;
+}
+
+// Formats [0 .. 99] as %02d.
+char* Format02d(char* ep, int v) {
+  *--ep = kDigits[v % 10];
+  *--ep = kDigits[(v / 10) % 10];
+  return ep;
+}
+
+// Formats a UTC offset, like +00:00.
+char* FormatOffset(char* ep, int offset, const char* mode) {
+  // TODO: Follow the RFC3339 "Unknown Local Offset Convention" and
+  // generate a "negative zero" when we're formatting a zero offset
+  // as the result of a failed load_time_zone().
+  char sign = '+';
+  if (offset < 0) {
+    offset = -offset;  // bounded by 24h so no overflow
+    sign = '-';
+  }
+  const int seconds = offset % 60;
+  const int minutes = (offset /= 60) % 60;
+  const int hours = offset /= 60;
+  const char sep = mode[0];
+  const bool ext = (sep != '\0' && mode[1] == '*');
+  const bool ccc = (ext && mode[2] == ':');
+  if (ext && (!ccc || seconds != 0)) {
+    ep = Format02d(ep, seconds);
+    *--ep = sep;
+  } else {
+    // If we're not rendering seconds, sub-minute negative offsets
+    // should get a positive sign (e.g., offset=-10s => "+00:00").
+    if (hours == 0 && minutes == 0) sign = '+';
+  }
+  if (!ccc || minutes != 0 || seconds != 0) {
+    ep = Format02d(ep, minutes);
+    if (sep != '\0') *--ep = sep;
+  }
+  ep = Format02d(ep, hours);
+  *--ep = sign;
+  return ep;
+}
+
+// Formats a std::tm using strftime(3).
+void FormatTM(std::string* out, const std::string& fmt, const std::tm& tm) {
+  // strftime(3) returns the number of characters placed in the output
+  // array (which may be 0 characters).  It also returns 0 to indicate
+  // an error, like the array wasn't large enough.  To accommodate this,
+  // the following code grows the buffer size from 2x the format string
+  // length up to 32x.
+  for (std::size_t i = 2; i != 32; i *= 2) {
+    std::size_t buf_size = fmt.size() * i;
+    std::vector<char> buf(buf_size);
+    if (std::size_t len = strftime(&buf[0], buf_size, fmt.c_str(), &tm)) {
+      out->append(&buf[0], len);
+      return;
+    }
+  }
+}
+
+// Used for %E#S/%E#f specifiers and for data values in parse().
+template <typename T>
+const char* ParseInt(const char* dp, int width, T min, T max, T* vp) {
+  if (dp != nullptr) {
+    const T kmin = std::numeric_limits<T>::min();
+    bool erange = false;
+    bool neg = false;
+    T value = 0;
+    if (*dp == '-') {
+      neg = true;
+      if (width <= 0 || --width != 0) {
+        ++dp;
+      } else {
+        dp = nullptr;  // width was 1
+      }
+    }
+    if (const char* const bp = dp) {
+      while (const char* cp = strchr(kDigits, *dp)) {
+        int d = static_cast<int>(cp - kDigits);
+        if (d >= 10) break;
+        if (value < kmin / 10) {
+          erange = true;
+          break;
+        }
+        value *= 10;
+        if (value < kmin + d) {
+          erange = true;
+          break;
+        }
+        value -= d;
+        dp += 1;
+        if (width > 0 && --width == 0) break;
+      }
+      if (dp != bp && !erange && (neg || value != kmin)) {
+        if (!neg || value != 0) {
+          if (!neg) value = -value;  // make positive
+          if (min <= value && value <= max) {
+            *vp = value;
+          } else {
+            dp = nullptr;
+          }
+        } else {
+          dp = nullptr;
+        }
+      } else {
+        dp = nullptr;
+      }
+    }
+  }
+  return dp;
+}
+
+// The number of base-10 digits that can be represented by a signed 64-bit
+// integer.  That is, 10^kDigits10_64 <= 2^63 - 1 < 10^(kDigits10_64 + 1).
+const int kDigits10_64 = 18;
+
+// 10^n for everything that can be represented by a signed 64-bit integer.
+const std::int_fast64_t kExp10[kDigits10_64 + 1] = {
+    1,
+    10,
+    100,
+    1000,
+    10000,
+    100000,
+    1000000,
+    10000000,
+    100000000,
+    1000000000,
+    10000000000,
+    100000000000,
+    1000000000000,
+    10000000000000,
+    100000000000000,
+    1000000000000000,
+    10000000000000000,
+    100000000000000000,
+    1000000000000000000,
+};
+
+}  // namespace
+
+// Uses strftime(3) to format the given Time.  The following extended format
+// specifiers are also supported:
+//
+//   - %Ez  - RFC3339-compatible numeric UTC offset (+hh:mm or -hh:mm)
+//   - %E*z - Full-resolution numeric UTC offset (+hh:mm:ss or -hh:mm:ss)
+//   - %E#S - Seconds with # digits of fractional precision
+//   - %E*S - Seconds with full fractional precision (a literal '*')
+//   - %E4Y - Four-character years (-999 ... -001, 0000, 0001 ... 9999)
+//
+// The standard specifiers from RFC3339_* (%Y, %m, %d, %H, %M, and %S) are
+// handled internally for performance reasons.  strftime(3) is slow due to
+// a POSIX requirement to respect changes to ${TZ}.
+//
+// The TZ/GNU %s extension is handled internally because strftime() has
+// to use mktime() to generate it, and that assumes the local time zone.
+//
+// We also handle the %z and %Z specifiers to accommodate platforms that do
+// not support the tm_gmtoff and tm_zone extensions to std::tm.
+//
+// Requires that zero() <= fs < seconds(1).
+std::string format(const std::string& format, const time_point<seconds>& tp,
+                   const detail::femtoseconds& fs, const time_zone& tz) {
+  std::string result;
+  result.reserve(format.size());  // A reasonable guess for the result size.
+  const time_zone::absolute_lookup al = tz.lookup(tp);
+  const std::tm tm = ToTM(al);
+
+  // Scratch buffer for internal conversions.
+  char buf[3 + kDigits10_64];  // enough for longest conversion
+  char* const ep = buf + sizeof(buf);
+  char* bp;  // works back from ep
+
+  // Maintain three, disjoint subsequences that span format.
+  //   [format.begin() ... pending) : already formatted into result
+  //   [pending ... cur) : formatting pending, but no special cases
+  //   [cur ... format.end()) : unexamined
+  // Initially, everything is in the unexamined part.
+  const char* pending = format.c_str();  // NUL terminated
+  const char* cur = pending;
+  const char* end = pending + format.length();
+
+  while (cur != end) {  // while something is unexamined
+    // Moves cur to the next percent sign.
+    const char* start = cur;
+    while (cur != end && *cur != '%') ++cur;
+
+    // If the new pending text is all ordinary, copy it out.
+    if (cur != start && pending == start) {
+      result.append(pending, static_cast<std::size_t>(cur - pending));
+      pending = start = cur;
+    }
+
+    // Span the sequential percent signs.
+    const char* percent = cur;
+    while (cur != end && *cur == '%') ++cur;
+
+    // If the new pending text is all percents, copy out one
+    // percent for every matched pair, then skip those pairs.
+    if (cur != start && pending == start) {
+      std::size_t escaped = static_cast<std::size_t>(cur - pending) / 2;
+      result.append(pending, escaped);
+      pending += escaped * 2;
+      // Also copy out a single trailing percent.
+      if (pending != cur && cur == end) {
+        result.push_back(*pending++);
+      }
+    }
+
+    // Loop unless we have an unescaped percent.
+    if (cur == end || (cur - percent) % 2 == 0) continue;
+
+    // Simple specifiers that we handle ourselves.
+    if (strchr("YmdeHMSzZs%", *cur)) {
+      if (cur - 1 != pending) {
+        FormatTM(&result, std::string(pending, cur - 1), tm);
+      }
+      switch (*cur) {
+        case 'Y':
+          // This avoids the tm.tm_year overflow problem for %Y, however
+          // tm.tm_year will still be used by other specifiers like %D.
+          bp = Format64(ep, 0, al.cs.year());
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case 'm':
+          bp = Format02d(ep, al.cs.month());
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case 'd':
+        case 'e':
+          bp = Format02d(ep, al.cs.day());
+          if (*cur == 'e' && *bp == '0') *bp = ' ';  // for Windows
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case 'H':
+          bp = Format02d(ep, al.cs.hour());
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case 'M':
+          bp = Format02d(ep, al.cs.minute());
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case 'S':
+          bp = Format02d(ep, al.cs.second());
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case 'z':
+          bp = FormatOffset(ep, al.offset, "");
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case 'Z':
+          result.append(al.abbr);
+          break;
+        case 's':
+          bp = Format64(ep, 0, ToUnixSeconds(tp));
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          break;
+        case '%':
+          result.push_back('%');
+          break;
+      }
+      pending = ++cur;
+      continue;
+    }
+
+    // More complex specifiers that we handle ourselves.
+    if (*cur == ':' && cur + 1 != end) {
+      if (*(cur + 1) == 'z') {
+        // Formats %:z.
+        if (cur - 1 != pending) {
+          FormatTM(&result, std::string(pending, cur - 1), tm);
+        }
+        bp = FormatOffset(ep, al.offset, ":");
+        result.append(bp, static_cast<std::size_t>(ep - bp));
+        pending = cur += 2;
+        continue;
+      }
+      if (*(cur + 1) == ':' && cur + 2 != end) {
+        if (*(cur + 2) == 'z') {
+          // Formats %::z.
+          if (cur - 1 != pending) {
+            FormatTM(&result, std::string(pending, cur - 1), tm);
+          }
+          bp = FormatOffset(ep, al.offset, ":*");
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          pending = cur += 3;
+          continue;
+        }
+        if (*(cur + 2) == ':' && cur + 3 != end) {
+          if (*(cur + 3) == 'z') {
+            // Formats %:::z.
+            if (cur - 1 != pending) {
+              FormatTM(&result, std::string(pending, cur - 1), tm);
+            }
+            bp = FormatOffset(ep, al.offset, ":*:");
+            result.append(bp, static_cast<std::size_t>(ep - bp));
+            pending = cur += 4;
+            continue;
+          }
+        }
+      }
+    }
+
+    // Loop if there is no E modifier.
+    if (*cur != 'E' || ++cur == end) continue;
+
+    // Format our extensions.
+    if (*cur == 'z') {
+      // Formats %Ez.
+      if (cur - 2 != pending) {
+        FormatTM(&result, std::string(pending, cur - 2), tm);
+      }
+      bp = FormatOffset(ep, al.offset, ":");
+      result.append(bp, static_cast<std::size_t>(ep - bp));
+      pending = ++cur;
+    } else if (*cur == '*' && cur + 1 != end && *(cur + 1) == 'z') {
+      // Formats %E*z.
+      if (cur - 2 != pending) {
+        FormatTM(&result, std::string(pending, cur - 2), tm);
+      }
+      bp = FormatOffset(ep, al.offset, ":*");
+      result.append(bp, static_cast<std::size_t>(ep - bp));
+      pending = cur += 2;
+    } else if (*cur == '*' && cur + 1 != end &&
+               (*(cur + 1) == 'S' || *(cur + 1) == 'f')) {
+      // Formats %E*S or %E*F.
+      if (cur - 2 != pending) {
+        FormatTM(&result, std::string(pending, cur - 2), tm);
+      }
+      char* cp = ep;
+      bp = Format64(cp, 15, fs.count());
+      while (cp != bp && cp[-1] == '0') --cp;
+      switch (*(cur + 1)) {
+        case 'S':
+          if (cp != bp) *--bp = '.';
+          bp = Format02d(bp, al.cs.second());
+          break;
+        case 'f':
+          if (cp == bp) *--bp = '0';
+          break;
+      }
+      result.append(bp, static_cast<std::size_t>(cp - bp));
+      pending = cur += 2;
+    } else if (*cur == '4' && cur + 1 != end && *(cur + 1) == 'Y') {
+      // Formats %E4Y.
+      if (cur - 2 != pending) {
+        FormatTM(&result, std::string(pending, cur - 2), tm);
+      }
+      bp = Format64(ep, 4, al.cs.year());
+      result.append(bp, static_cast<std::size_t>(ep - bp));
+      pending = cur += 2;
+    } else if (std::isdigit(*cur)) {
+      // Possibly found %E#S or %E#f.
+      int n = 0;
+      if (const char* np = ParseInt(cur, 0, 0, 1024, &n)) {
+        if (*np == 'S' || *np == 'f') {
+          // Formats %E#S or %E#f.
+          if (cur - 2 != pending) {
+            FormatTM(&result, std::string(pending, cur - 2), tm);
+          }
+          bp = ep;
+          if (n > 0) {
+            if (n > kDigits10_64) n = kDigits10_64;
+            bp = Format64(bp, n,
+                          (n > 15) ? fs.count() * kExp10[n - 15]
+                                   : fs.count() / kExp10[15 - n]);
+            if (*np == 'S') *--bp = '.';
+          }
+          if (*np == 'S') bp = Format02d(bp, al.cs.second());
+          result.append(bp, static_cast<std::size_t>(ep - bp));
+          pending = cur = ++np;
+        }
+      }
+    }
+  }
+
+  // Formats any remaining data.
+  if (end != pending) {
+    FormatTM(&result, std::string(pending, end), tm);
+  }
+
+  return result;
+}
+
+namespace {
+
+const char* ParseOffset(const char* dp, const char* mode, int* offset) {
+  if (dp != nullptr) {
+    const char first = *dp++;
+    if (first == '+' || first == '-') {
+      char sep = mode[0];
+      int hours = 0;
+      int minutes = 0;
+      int seconds = 0;
+      const char* ap = ParseInt(dp, 2, 0, 23, &hours);
+      if (ap != nullptr && ap - dp == 2) {
+        dp = ap;
+        if (sep != '\0' && *ap == sep) ++ap;
+        const char* bp = ParseInt(ap, 2, 0, 59, &minutes);
+        if (bp != nullptr && bp - ap == 2) {
+          dp = bp;
+          if (sep != '\0' && *bp == sep) ++bp;
+          const char* cp = ParseInt(bp, 2, 0, 59, &seconds);
+          if (cp != nullptr && cp - bp == 2) dp = cp;
+        }
+        *offset = ((hours * 60 + minutes) * 60) + seconds;
+        if (first == '-') *offset = -*offset;
+      } else {
+        dp = nullptr;
+      }
+    } else if (first == 'Z') {  // Zulu
+      *offset = 0;
+    } else {
+      dp = nullptr;
+    }
+  }
+  return dp;
+}
+
+const char* ParseZone(const char* dp, std::string* zone) {
+  zone->clear();
+  if (dp != nullptr) {
+    while (*dp != '\0' && !std::isspace(*dp)) zone->push_back(*dp++);
+    if (zone->empty()) dp = nullptr;
+  }
+  return dp;
+}
+
+const char* ParseSubSeconds(const char* dp, detail::femtoseconds* subseconds) {
+  if (dp != nullptr) {
+    std::int_fast64_t v = 0;
+    std::int_fast64_t exp = 0;
+    const char* const bp = dp;
+    while (const char* cp = strchr(kDigits, *dp)) {
+      int d = static_cast<int>(cp - kDigits);
+      if (d >= 10) break;
+      if (exp < 15) {
+        exp += 1;
+        v *= 10;
+        v += d;
+      }
+      ++dp;
+    }
+    if (dp != bp) {
+      v *= kExp10[15 - exp];
+      *subseconds = detail::femtoseconds(v);
+    } else {
+      dp = nullptr;
+    }
+  }
+  return dp;
+}
+
+// Parses a string into a std::tm using strptime(3).
+const char* ParseTM(const char* dp, const char* fmt, std::tm* tm) {
+  if (dp != nullptr) {
+    dp = strptime(dp, fmt, tm);
+  }
+  return dp;
+}
+
+}  // namespace
+
+// Uses strptime(3) to parse the given input.  Supports the same extended
+// format specifiers as format(), although %E#S and %E*S are treated
+// identically (and similarly for %E#f and %E*f).  %Ez and %E*z also accept
+// the same inputs.
+//
+// The standard specifiers from RFC3339_* (%Y, %m, %d, %H, %M, and %S) are
+// handled internally so that we can normally avoid strptime() altogether
+// (which is particularly helpful when the native implementation is broken).
+//
+// The TZ/GNU %s extension is handled internally because strptime() has to
+// use localtime_r() to generate it, and that assumes the local time zone.
+//
+// We also handle the %z specifier to accommodate platforms that do not
+// support the tm_gmtoff extension to std::tm.  %Z is parsed but ignored.
+bool parse(const std::string& format, const std::string& input,
+           const time_zone& tz, time_point<seconds>* sec,
+           detail::femtoseconds* fs, std::string* err) {
+  // The unparsed input.
+  const char* data = input.c_str();  // NUL terminated
+
+  // Skips leading whitespace.
+  while (std::isspace(*data)) ++data;
+
+  const year_t kyearmax = std::numeric_limits<year_t>::max();
+  const year_t kyearmin = std::numeric_limits<year_t>::min();
+
+  // Sets default values for unspecified fields.
+  bool saw_year = false;
+  year_t year = 1970;
+  std::tm tm{};
+  tm.tm_year = 1970 - 1900;
+  tm.tm_mon = 1 - 1;  // Jan
+  tm.tm_mday = 1;
+  tm.tm_hour = 0;
+  tm.tm_min = 0;
+  tm.tm_sec = 0;
+  tm.tm_wday = 4;  // Thu
+  tm.tm_yday = 0;
+  tm.tm_isdst = 0;
+  auto subseconds = detail::femtoseconds::zero();
+  bool saw_offset = false;
+  int offset = 0;  // No offset from passed tz.
+  std::string zone = "UTC";
+
+  const char* fmt = format.c_str();  // NUL terminated
+  bool twelve_hour = false;
+  bool afternoon = false;
+
+  bool saw_percent_s = false;
+  std::int_fast64_t percent_s = 0;
+
+  // Steps through format, one specifier at a time.
+  while (data != nullptr && *fmt != '\0') {
+    if (std::isspace(*fmt)) {
+      while (std::isspace(*data)) ++data;
+      while (std::isspace(*++fmt)) continue;
+      continue;
+    }
+
+    if (*fmt != '%') {
+      if (*data == *fmt) {
+        ++data;
+        ++fmt;
+      } else {
+        data = nullptr;
+      }
+      continue;
+    }
+
+    const char* percent = fmt;
+    if (*++fmt == '\0') {
+      data = nullptr;
+      continue;
+    }
+    switch (*fmt++) {
+      case 'Y':
+        // Symmetrically with FormatTime(), directly handing %Y avoids the
+        // tm.tm_year overflow problem.  However, tm.tm_year will still be
+        // used by other specifiers like %D.
+        data = ParseInt(data, 0, kyearmin, kyearmax, &year);
+        if (data != nullptr) saw_year = true;
+        continue;
+      case 'm':
+        data = ParseInt(data, 2, 1, 12, &tm.tm_mon);
+        if (data != nullptr) tm.tm_mon -= 1;
+        continue;
+      case 'd':
+      case 'e':
+        data = ParseInt(data, 2, 1, 31, &tm.tm_mday);
+        continue;
+      case 'H':
+        data = ParseInt(data, 2, 0, 23, &tm.tm_hour);
+        twelve_hour = false;
+        continue;
+      case 'M':
+        data = ParseInt(data, 2, 0, 59, &tm.tm_min);
+        continue;
+      case 'S':
+        data = ParseInt(data, 2, 0, 60, &tm.tm_sec);
+        continue;
+      case 'I':
+      case 'l':
+      case 'r':  // probably uses %I
+        twelve_hour = true;
+        break;
+      case 'R':  // uses %H
+      case 'T':  // uses %H
+      case 'c':  // probably uses %H
+      case 'X':  // probably uses %H
+        twelve_hour = false;
+        break;
+      case 'z':
+        data = ParseOffset(data, "", &offset);
+        if (data != nullptr) saw_offset = true;
+        continue;
+      case 'Z':  // ignored; zone abbreviations are ambiguous
+        data = ParseZone(data, &zone);
+        continue;
+      case 's':
+        data =
+            ParseInt(data, 0, std::numeric_limits<std::int_fast64_t>::min(),
+                     std::numeric_limits<std::int_fast64_t>::max(), &percent_s);
+        if (data != nullptr) saw_percent_s = true;
+        continue;
+      case ':':
+        if (fmt[0] == 'z' ||
+            (fmt[0] == ':' &&
+             (fmt[1] == 'z' || (fmt[1] == ':' && fmt[2] == 'z')))) {
+          data = ParseOffset(data, ":", &offset);
+          if (data != nullptr) saw_offset = true;
+          fmt += (fmt[0] == 'z') ? 1 : (fmt[1] == 'z') ? 2 : 3;
+          continue;
+        }
+        break;
+      case '%':
+        data = (*data == '%' ? data + 1 : nullptr);
+        continue;
+      case 'E':
+        if (fmt[0] == 'z' || (fmt[0] == '*' && fmt[1] == 'z')) {
+          data = ParseOffset(data, ":", &offset);
+          if (data != nullptr) saw_offset = true;
+          fmt += (fmt[0] == 'z') ? 1 : 2;
+          continue;
+        }
+        if (fmt[0] == '*' && fmt[1] == 'S') {
+          data = ParseInt(data, 2, 0, 60, &tm.tm_sec);
+          if (data != nullptr && *data == '.') {
+            data = ParseSubSeconds(data + 1, &subseconds);
+          }
+          fmt += 2;
+          continue;
+        }
+        if (fmt[0] == '*' && fmt[1] == 'f') {
+          if (data != nullptr && std::isdigit(*data)) {
+            data = ParseSubSeconds(data, &subseconds);
+          }
+          fmt += 2;
+          continue;
+        }
+        if (fmt[0] == '4' && fmt[1] == 'Y') {
+          const char* bp = data;
+          data = ParseInt(data, 4, year_t{-999}, year_t{9999}, &year);
+          if (data != nullptr) {
+            if (data - bp == 4) {
+              saw_year = true;
+            } else {
+              data = nullptr;  // stopped too soon
+            }
+          }
+          fmt += 2;
+          continue;
+        }
+        if (std::isdigit(*fmt)) {
+          int n = 0;  // value ignored
+          if (const char* np = ParseInt(fmt, 0, 0, 1024, &n)) {
+            if (*np == 'S') {
+              data = ParseInt(data, 2, 0, 60, &tm.tm_sec);
+              if (data != nullptr && *data == '.') {
+                data = ParseSubSeconds(data + 1, &subseconds);
+              }
+              fmt = ++np;
+              continue;
+            }
+            if (*np == 'f') {
+              if (data != nullptr && std::isdigit(*data)) {
+                data = ParseSubSeconds(data, &subseconds);
+              }
+              fmt = ++np;
+              continue;
+            }
+          }
+        }
+        if (*fmt == 'c') twelve_hour = false;  // probably uses %H
+        if (*fmt == 'X') twelve_hour = false;  // probably uses %H
+        if (*fmt != '\0') ++fmt;
+        break;
+      case 'O':
+        if (*fmt == 'H') twelve_hour = false;
+        if (*fmt == 'I') twelve_hour = true;
+        if (*fmt != '\0') ++fmt;
+        break;
+    }
+
+    // Parses the current specifier.
+    const char* orig_data = data;
+    std::string spec(percent, static_cast<std::size_t>(fmt - percent));
+    data = ParseTM(data, spec.c_str(), &tm);
+
+    // If we successfully parsed %p we need to remember whether the result
+    // was AM or PM so that we can adjust tm_hour before time_zone::lookup().
+    // So reparse the input with a known AM hour, and check if it is shifted
+    // to a PM hour.
+    if (spec == "%p" && data != nullptr) {
+      std::string test_input = "1";
+      test_input.append(orig_data, static_cast<std::size_t>(data - orig_data));
+      const char* test_data = test_input.c_str();
+      std::tm tmp{};
+      ParseTM(test_data, "%I%p", &tmp);
+      afternoon = (tmp.tm_hour == 13);
+    }
+  }
+
+  // Adjust a 12-hour tm_hour value if it should be in the afternoon.
+  if (twelve_hour && afternoon && tm.tm_hour < 12) {
+    tm.tm_hour += 12;
+  }
+
+  if (data == nullptr) {
+    if (err != nullptr) *err = "Failed to parse input";
+    return false;
+  }
+
+  // Skip any remaining whitespace.
+  while (std::isspace(*data)) ++data;
+
+  // parse() must consume the entire input string.
+  if (*data != '\0') {
+    if (err != nullptr) *err = "Illegal trailing data in input string";
+    return false;
+  }
+
+  // If we saw %s then we ignore anything else and return that time.
+  if (saw_percent_s) {
+    *sec = FromUnixSeconds(percent_s);
+    *fs = detail::femtoseconds::zero();
+    return true;
+  }
+
+  // If we saw %z, %Ez, or %E*z then we want to interpret the parsed fields
+  // in UTC and then shift by that offset.  Otherwise we want to interpret
+  // the fields directly in the passed time_zone.
+  time_zone ptz = saw_offset ? utc_time_zone() : tz;
+
+  // Allows a leap second of 60 to normalize forward to the following ":00".
+  if (tm.tm_sec == 60) {
+    tm.tm_sec -= 1;
+    offset -= 1;
+    subseconds = detail::femtoseconds::zero();
+  }
+
+  if (!saw_year) {
+    year = year_t{tm.tm_year};
+    if (year > kyearmax - 1900) {
+      // Platform-dependent, maybe unreachable.
+      if (err != nullptr) *err = "Out-of-range year";
+      return false;
+    }
+    year += 1900;
+  }
+
+  const int month = tm.tm_mon + 1;
+  civil_second cs(year, month, tm.tm_mday, tm.tm_hour, tm.tm_min, tm.tm_sec);
+
+  // parse() should not allow normalization. Due to the restricted field
+  // ranges above (see ParseInt()), the only possibility is for days to roll
+  // into months. That is, parsing "Sep 31" should not produce "Oct 1".
+  if (cs.month() != month || cs.day() != tm.tm_mday) {
+    if (err != nullptr) *err = "Out-of-range field";
+    return false;
+  }
+
+  // Accounts for the offset adjustment before converting to absolute time.
+  if ((offset < 0 && cs > civil_second::max() + offset) ||
+      (offset > 0 && cs < civil_second::min() + offset)) {
+    if (err != nullptr) *err = "Out-of-range field";
+    return false;
+  }
+  cs -= offset;
+
+  const auto tp = ptz.lookup(cs).pre;
+  // Checks for overflow/underflow and returns an error as necessary.
+  if (tp == time_point<seconds>::max()) {
+    const auto al = ptz.lookup(time_point<seconds>::max());
+    if (cs > al.cs) {
+      if (err != nullptr) *err = "Out-of-range field";
+      return false;
+    }
+  }
+  if (tp == time_point<seconds>::min()) {
+    const auto al = ptz.lookup(time_point<seconds>::min());
+    if (cs < al.cs) {
+      if (err != nullptr) *err = "Out-of-range field";
+      return false;
+    }
+  }
+
+  *sec = tp;
+  *fs = subseconds;
+  return true;
+}
+
+}  // namespace detail
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_format_test.cc b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_format_test.cc
new file mode 100644
index 0000000000..87382e156d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_format_test.cc
@@ -0,0 +1,1500 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include <chrono>
+#include <iomanip>
+#include <sstream>
+#include <string>
+
+#include "gmock/gmock.h"
+#include "gtest/gtest.h"
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+namespace chrono = std::chrono;
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+// This helper is a macro so that failed expectations show up with the
+// correct line numbers.
+#define ExpectTime(tp, tz, y, m, d, hh, mm, ss, off, isdst, zone) \
+  do {                                                            \
+    time_zone::absolute_lookup al = tz.lookup(tp);                \
+    EXPECT_EQ(y, al.cs.year());                                   \
+    EXPECT_EQ(m, al.cs.month());                                  \
+    EXPECT_EQ(d, al.cs.day());                                    \
+    EXPECT_EQ(hh, al.cs.hour());                                  \
+    EXPECT_EQ(mm, al.cs.minute());                                \
+    EXPECT_EQ(ss, al.cs.second());                                \
+    EXPECT_EQ(off, al.offset);                                    \
+    EXPECT_TRUE(isdst == al.is_dst);                              \
+    EXPECT_STREQ(zone, al.abbr);                                  \
+  } while (0)
+
+const char RFC3339_full[] = "%Y-%m-%dT%H:%M:%E*S%Ez";
+const char RFC3339_sec[] = "%Y-%m-%dT%H:%M:%S%Ez";
+
+const char RFC1123_full[] = "%a, %d %b %Y %H:%M:%S %z";
+const char RFC1123_no_wday[] = "%d %b %Y %H:%M:%S %z";
+
+// A helper that tests the given format specifier by itself, and with leading
+// and trailing characters.  For example: TestFormatSpecifier(tp, "%a", "Thu").
+template <typename D>
+void TestFormatSpecifier(time_point<D> tp, time_zone tz, const std::string& fmt,
+                         const std::string& ans) {
+  EXPECT_EQ(ans, format(fmt, tp, tz)) << fmt;
+  EXPECT_EQ("xxx " + ans, format("xxx " + fmt, tp, tz));
+  EXPECT_EQ(ans + " yyy", format(fmt + " yyy", tp, tz));
+  EXPECT_EQ("xxx " + ans + " yyy", format("xxx " + fmt + " yyy", tp, tz));
+}
+
+}  // namespace
+
+//
+// Testing format()
+//
+
+TEST(Format, TimePointResolution) {
+  const char kFmt[] = "%H:%M:%E*S";
+  const time_zone utc = utc_time_zone();
+  const time_point<chrono::nanoseconds> t0 =
+      chrono::system_clock::from_time_t(1420167845) +
+      chrono::milliseconds(123) + chrono::microseconds(456) +
+      chrono::nanoseconds(789);
+  EXPECT_EQ(
+      "03:04:05.123456789",
+      format(kFmt, chrono::time_point_cast<chrono::nanoseconds>(t0), utc));
+  EXPECT_EQ(
+      "03:04:05.123456",
+      format(kFmt, chrono::time_point_cast<chrono::microseconds>(t0), utc));
+  EXPECT_EQ(
+      "03:04:05.123",
+      format(kFmt, chrono::time_point_cast<chrono::milliseconds>(t0), utc));
+  EXPECT_EQ("03:04:05",
+            format(kFmt, chrono::time_point_cast<chrono::seconds>(t0), utc));
+  EXPECT_EQ(
+      "03:04:05",
+      format(kFmt,
+             chrono::time_point_cast<absl::time_internal::cctz::seconds>(t0),
+             utc));
+  EXPECT_EQ("03:04:00",
+            format(kFmt, chrono::time_point_cast<chrono::minutes>(t0), utc));
+  EXPECT_EQ("03:00:00",
+            format(kFmt, chrono::time_point_cast<chrono::hours>(t0), utc));
+}
+
+TEST(Format, TimePointExtendedResolution) {
+  const char kFmt[] = "%H:%M:%E*S";
+  const time_zone utc = utc_time_zone();
+  const time_point<absl::time_internal::cctz::seconds> tp =
+      chrono::time_point_cast<absl::time_internal::cctz::seconds>(
+          chrono::system_clock::from_time_t(0)) +
+      chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56);
+
+  EXPECT_EQ(
+      "12:34:56.123456789012345",
+      detail::format(kFmt, tp, detail::femtoseconds(123456789012345), utc));
+  EXPECT_EQ(
+      "12:34:56.012345678901234",
+      detail::format(kFmt, tp, detail::femtoseconds(12345678901234), utc));
+  EXPECT_EQ("12:34:56.001234567890123",
+            detail::format(kFmt, tp, detail::femtoseconds(1234567890123), utc));
+  EXPECT_EQ("12:34:56.000123456789012",
+            detail::format(kFmt, tp, detail::femtoseconds(123456789012), utc));
+
+  EXPECT_EQ("12:34:56.000000000000123",
+            detail::format(kFmt, tp, detail::femtoseconds(123), utc));
+  EXPECT_EQ("12:34:56.000000000000012",
+            detail::format(kFmt, tp, detail::femtoseconds(12), utc));
+  EXPECT_EQ("12:34:56.000000000000001",
+            detail::format(kFmt, tp, detail::femtoseconds(1), utc));
+}
+
+TEST(Format, Basics) {
+  time_zone tz = utc_time_zone();
+  time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
+
+  // Starts with a couple basic edge cases.
+  EXPECT_EQ("", format("", tp, tz));
+  EXPECT_EQ(" ", format(" ", tp, tz));
+  EXPECT_EQ("  ", format("  ", tp, tz));
+  EXPECT_EQ("xxx", format("xxx", tp, tz));
+  std::string big(128, 'x');
+  EXPECT_EQ(big, format(big, tp, tz));
+  // Cause the 1024-byte buffer to grow.
+  std::string bigger(100000, 'x');
+  EXPECT_EQ(bigger, format(bigger, tp, tz));
+
+  tp += chrono::hours(13) + chrono::minutes(4) + chrono::seconds(5);
+  tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+        chrono::nanoseconds(8);
+  EXPECT_EQ("1970-01-01", format("%Y-%m-%d", tp, tz));
+  EXPECT_EQ("13:04:05", format("%H:%M:%S", tp, tz));
+  EXPECT_EQ("13:04:05.006", format("%H:%M:%E3S", tp, tz));
+  EXPECT_EQ("13:04:05.006007", format("%H:%M:%E6S", tp, tz));
+  EXPECT_EQ("13:04:05.006007008", format("%H:%M:%E9S", tp, tz));
+}
+
+TEST(Format, PosixConversions) {
+  const time_zone tz = utc_time_zone();
+  auto tp = chrono::system_clock::from_time_t(0);
+
+  TestFormatSpecifier(tp, tz, "%d", "01");
+  TestFormatSpecifier(tp, tz, "%e", " 1");  // extension but internal support
+  TestFormatSpecifier(tp, tz, "%H", "00");
+  TestFormatSpecifier(tp, tz, "%I", "12");
+  TestFormatSpecifier(tp, tz, "%j", "001");
+  TestFormatSpecifier(tp, tz, "%m", "01");
+  TestFormatSpecifier(tp, tz, "%M", "00");
+  TestFormatSpecifier(tp, tz, "%S", "00");
+  TestFormatSpecifier(tp, tz, "%U", "00");
+#if !defined(__EMSCRIPTEN__)
+  TestFormatSpecifier(tp, tz, "%w", "4");  // 4=Thursday
+#endif
+  TestFormatSpecifier(tp, tz, "%W", "00");
+  TestFormatSpecifier(tp, tz, "%y", "70");
+  TestFormatSpecifier(tp, tz, "%Y", "1970");
+  TestFormatSpecifier(tp, tz, "%z", "+0000");
+  TestFormatSpecifier(tp, tz, "%Z", "UTC");
+  TestFormatSpecifier(tp, tz, "%%", "%");
+
+#if defined(__linux__)
+  // SU/C99/TZ extensions
+  TestFormatSpecifier(tp, tz, "%C", "19");
+  TestFormatSpecifier(tp, tz, "%D", "01/01/70");
+  TestFormatSpecifier(tp, tz, "%F", "1970-01-01");
+  TestFormatSpecifier(tp, tz, "%g", "70");
+  TestFormatSpecifier(tp, tz, "%G", "1970");
+  TestFormatSpecifier(tp, tz, "%k", " 0");
+  TestFormatSpecifier(tp, tz, "%l", "12");
+  TestFormatSpecifier(tp, tz, "%n", "\n");
+  TestFormatSpecifier(tp, tz, "%R", "00:00");
+  TestFormatSpecifier(tp, tz, "%t", "\t");
+  TestFormatSpecifier(tp, tz, "%T", "00:00:00");
+  TestFormatSpecifier(tp, tz, "%u", "4");  // 4=Thursday
+  TestFormatSpecifier(tp, tz, "%V", "01");
+  TestFormatSpecifier(tp, tz, "%s", "0");
+#endif
+}
+
+TEST(Format, LocaleSpecific) {
+  const time_zone tz = utc_time_zone();
+  auto tp = chrono::system_clock::from_time_t(0);
+
+  TestFormatSpecifier(tp, tz, "%a", "Thu");
+  TestFormatSpecifier(tp, tz, "%A", "Thursday");
+  TestFormatSpecifier(tp, tz, "%b", "Jan");
+  TestFormatSpecifier(tp, tz, "%B", "January");
+
+  // %c should at least produce the numeric year and time-of-day.
+  const std::string s = format("%c", tp, utc_time_zone());
+  EXPECT_THAT(s, testing::HasSubstr("1970"));
+  EXPECT_THAT(s, testing::HasSubstr("00:00:00"));
+
+  TestFormatSpecifier(tp, tz, "%p", "AM");
+  TestFormatSpecifier(tp, tz, "%x", "01/01/70");
+  TestFormatSpecifier(tp, tz, "%X", "00:00:00");
+
+#if defined(__linux__)
+  // SU/C99/TZ extensions
+  TestFormatSpecifier(tp, tz, "%h", "Jan");  // Same as %b
+  TestFormatSpecifier(tp, tz, "%P", "am");
+  TestFormatSpecifier(tp, tz, "%r", "12:00:00 AM");
+
+  // Modified conversion specifiers %E_
+  TestFormatSpecifier(tp, tz, "%Ec", "Thu Jan  1 00:00:00 1970");
+  TestFormatSpecifier(tp, tz, "%EC", "19");
+  TestFormatSpecifier(tp, tz, "%Ex", "01/01/70");
+  TestFormatSpecifier(tp, tz, "%EX", "00:00:00");
+  TestFormatSpecifier(tp, tz, "%Ey", "70");
+  TestFormatSpecifier(tp, tz, "%EY", "1970");
+
+  // Modified conversion specifiers %O_
+  TestFormatSpecifier(tp, tz, "%Od", "01");
+  TestFormatSpecifier(tp, tz, "%Oe", " 1");
+  TestFormatSpecifier(tp, tz, "%OH", "00");
+  TestFormatSpecifier(tp, tz, "%OI", "12");
+  TestFormatSpecifier(tp, tz, "%Om", "01");
+  TestFormatSpecifier(tp, tz, "%OM", "00");
+  TestFormatSpecifier(tp, tz, "%OS", "00");
+  TestFormatSpecifier(tp, tz, "%Ou", "4");  // 4=Thursday
+  TestFormatSpecifier(tp, tz, "%OU", "00");
+  TestFormatSpecifier(tp, tz, "%OV", "01");
+  TestFormatSpecifier(tp, tz, "%Ow", "4");  // 4=Thursday
+  TestFormatSpecifier(tp, tz, "%OW", "00");
+  TestFormatSpecifier(tp, tz, "%Oy", "70");
+#endif
+}
+
+TEST(Format, Escaping) {
+  const time_zone tz = utc_time_zone();
+  auto tp = chrono::system_clock::from_time_t(0);
+
+  TestFormatSpecifier(tp, tz, "%%", "%");
+  TestFormatSpecifier(tp, tz, "%%a", "%a");
+  TestFormatSpecifier(tp, tz, "%%b", "%b");
+  TestFormatSpecifier(tp, tz, "%%Ea", "%Ea");
+  TestFormatSpecifier(tp, tz, "%%Es", "%Es");
+  TestFormatSpecifier(tp, tz, "%%E3S", "%E3S");
+  TestFormatSpecifier(tp, tz, "%%OS", "%OS");
+  TestFormatSpecifier(tp, tz, "%%O3S", "%O3S");
+
+  // Multiple levels of escaping.
+  TestFormatSpecifier(tp, tz, "%%%Y", "%1970");
+  TestFormatSpecifier(tp, tz, "%%%E3S", "%00.000");
+  TestFormatSpecifier(tp, tz, "%%%%E3S", "%%E3S");
+}
+
+TEST(Format, ExtendedSeconds) {
+  const time_zone tz = utc_time_zone();
+
+  // No subseconds.
+  time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
+  tp += chrono::seconds(5);
+  EXPECT_EQ("05", format("%E*S", tp, tz));
+  EXPECT_EQ("05", format("%E0S", tp, tz));
+  EXPECT_EQ("05.0", format("%E1S", tp, tz));
+  EXPECT_EQ("05.00", format("%E2S", tp, tz));
+  EXPECT_EQ("05.000", format("%E3S", tp, tz));
+  EXPECT_EQ("05.0000", format("%E4S", tp, tz));
+  EXPECT_EQ("05.00000", format("%E5S", tp, tz));
+  EXPECT_EQ("05.000000", format("%E6S", tp, tz));
+  EXPECT_EQ("05.0000000", format("%E7S", tp, tz));
+  EXPECT_EQ("05.00000000", format("%E8S", tp, tz));
+  EXPECT_EQ("05.000000000", format("%E9S", tp, tz));
+  EXPECT_EQ("05.0000000000", format("%E10S", tp, tz));
+  EXPECT_EQ("05.00000000000", format("%E11S", tp, tz));
+  EXPECT_EQ("05.000000000000", format("%E12S", tp, tz));
+  EXPECT_EQ("05.0000000000000", format("%E13S", tp, tz));
+  EXPECT_EQ("05.00000000000000", format("%E14S", tp, tz));
+  EXPECT_EQ("05.000000000000000", format("%E15S", tp, tz));
+
+  // With subseconds.
+  tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+        chrono::nanoseconds(8);
+  EXPECT_EQ("05.006007008", format("%E*S", tp, tz));
+  EXPECT_EQ("05", format("%E0S", tp, tz));
+  EXPECT_EQ("05.0", format("%E1S", tp, tz));
+  EXPECT_EQ("05.00", format("%E2S", tp, tz));
+  EXPECT_EQ("05.006", format("%E3S", tp, tz));
+  EXPECT_EQ("05.0060", format("%E4S", tp, tz));
+  EXPECT_EQ("05.00600", format("%E5S", tp, tz));
+  EXPECT_EQ("05.006007", format("%E6S", tp, tz));
+  EXPECT_EQ("05.0060070", format("%E7S", tp, tz));
+  EXPECT_EQ("05.00600700", format("%E8S", tp, tz));
+  EXPECT_EQ("05.006007008", format("%E9S", tp, tz));
+  EXPECT_EQ("05.0060070080", format("%E10S", tp, tz));
+  EXPECT_EQ("05.00600700800", format("%E11S", tp, tz));
+  EXPECT_EQ("05.006007008000", format("%E12S", tp, tz));
+  EXPECT_EQ("05.0060070080000", format("%E13S", tp, tz));
+  EXPECT_EQ("05.00600700800000", format("%E14S", tp, tz));
+  EXPECT_EQ("05.006007008000000", format("%E15S", tp, tz));
+
+  // Times before the Unix epoch.
+  tp = chrono::system_clock::from_time_t(0) + chrono::microseconds(-1);
+  EXPECT_EQ("1969-12-31 23:59:59.999999",
+            format("%Y-%m-%d %H:%M:%E*S", tp, tz));
+
+  // Here is a "%E*S" case we got wrong for a while.  While the first
+  // instant below is correctly rendered as "...:07.333304", the second
+  // one used to appear as "...:07.33330499999999999".
+  tp = chrono::system_clock::from_time_t(0) +
+       chrono::microseconds(1395024427333304);
+  EXPECT_EQ("2014-03-17 02:47:07.333304",
+            format("%Y-%m-%d %H:%M:%E*S", tp, tz));
+  tp += chrono::microseconds(1);
+  EXPECT_EQ("2014-03-17 02:47:07.333305",
+            format("%Y-%m-%d %H:%M:%E*S", tp, tz));
+}
+
+TEST(Format, ExtendedSubeconds) {
+  const time_zone tz = utc_time_zone();
+
+  // No subseconds.
+  time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
+  tp += chrono::seconds(5);
+  EXPECT_EQ("0", format("%E*f", tp, tz));
+  EXPECT_EQ("", format("%E0f", tp, tz));
+  EXPECT_EQ("0", format("%E1f", tp, tz));
+  EXPECT_EQ("00", format("%E2f", tp, tz));
+  EXPECT_EQ("000", format("%E3f", tp, tz));
+  EXPECT_EQ("0000", format("%E4f", tp, tz));
+  EXPECT_EQ("00000", format("%E5f", tp, tz));
+  EXPECT_EQ("000000", format("%E6f", tp, tz));
+  EXPECT_EQ("0000000", format("%E7f", tp, tz));
+  EXPECT_EQ("00000000", format("%E8f", tp, tz));
+  EXPECT_EQ("000000000", format("%E9f", tp, tz));
+  EXPECT_EQ("0000000000", format("%E10f", tp, tz));
+  EXPECT_EQ("00000000000", format("%E11f", tp, tz));
+  EXPECT_EQ("000000000000", format("%E12f", tp, tz));
+  EXPECT_EQ("0000000000000", format("%E13f", tp, tz));
+  EXPECT_EQ("00000000000000", format("%E14f", tp, tz));
+  EXPECT_EQ("000000000000000", format("%E15f", tp, tz));
+
+  // With subseconds.
+  tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+        chrono::nanoseconds(8);
+  EXPECT_EQ("006007008", format("%E*f", tp, tz));
+  EXPECT_EQ("", format("%E0f", tp, tz));
+  EXPECT_EQ("0", format("%E1f", tp, tz));
+  EXPECT_EQ("00", format("%E2f", tp, tz));
+  EXPECT_EQ("006", format("%E3f", tp, tz));
+  EXPECT_EQ("0060", format("%E4f", tp, tz));
+  EXPECT_EQ("00600", format("%E5f", tp, tz));
+  EXPECT_EQ("006007", format("%E6f", tp, tz));
+  EXPECT_EQ("0060070", format("%E7f", tp, tz));
+  EXPECT_EQ("00600700", format("%E8f", tp, tz));
+  EXPECT_EQ("006007008", format("%E9f", tp, tz));
+  EXPECT_EQ("0060070080", format("%E10f", tp, tz));
+  EXPECT_EQ("00600700800", format("%E11f", tp, tz));
+  EXPECT_EQ("006007008000", format("%E12f", tp, tz));
+  EXPECT_EQ("0060070080000", format("%E13f", tp, tz));
+  EXPECT_EQ("00600700800000", format("%E14f", tp, tz));
+  EXPECT_EQ("006007008000000", format("%E15f", tp, tz));
+
+  // Times before the Unix epoch.
+  tp = chrono::system_clock::from_time_t(0) + chrono::microseconds(-1);
+  EXPECT_EQ("1969-12-31 23:59:59.999999",
+            format("%Y-%m-%d %H:%M:%S.%E*f", tp, tz));
+
+  // Here is a "%E*S" case we got wrong for a while.  While the first
+  // instant below is correctly rendered as "...:07.333304", the second
+  // one used to appear as "...:07.33330499999999999".
+  tp = chrono::system_clock::from_time_t(0) +
+       chrono::microseconds(1395024427333304);
+  EXPECT_EQ("2014-03-17 02:47:07.333304",
+            format("%Y-%m-%d %H:%M:%S.%E*f", tp, tz));
+  tp += chrono::microseconds(1);
+  EXPECT_EQ("2014-03-17 02:47:07.333305",
+            format("%Y-%m-%d %H:%M:%S.%E*f", tp, tz));
+}
+
+TEST(Format, CompareExtendSecondsVsSubseconds) {
+  const time_zone tz = utc_time_zone();
+
+  // This test case illustrates the differences/similarities between:
+  //   fmt_A: %E<prec>S
+  //   fmt_B: %S.%E<prec>f
+  auto fmt_A = [](const std::string& prec) { return "%E" + prec + "S"; };
+  auto fmt_B = [](const std::string& prec) { return "%S.%E" + prec + "f"; };
+
+  // No subseconds:
+  time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0);
+  tp += chrono::seconds(5);
+  // ... %E*S and %S.%E*f are different.
+  EXPECT_EQ("05", format(fmt_A("*"), tp, tz));
+  EXPECT_EQ("05.0", format(fmt_B("*"), tp, tz));
+  // ... %E0S and %S.%E0f are different.
+  EXPECT_EQ("05", format(fmt_A("0"), tp, tz));
+  EXPECT_EQ("05.", format(fmt_B("0"), tp, tz));
+  // ... %E<prec>S and %S.%E<prec>f are the same for prec in [1:15].
+  for (int prec = 1; prec <= 15; ++prec) {
+    const std::string a = format(fmt_A(std::to_string(prec)), tp, tz);
+    const std::string b = format(fmt_B(std::to_string(prec)), tp, tz);
+    EXPECT_EQ(a, b) << "prec=" << prec;
+  }
+
+  // With subseconds:
+  // ... %E*S and %S.%E*f are the same.
+  tp += chrono::milliseconds(6) + chrono::microseconds(7) +
+        chrono::nanoseconds(8);
+  EXPECT_EQ("05.006007008", format(fmt_A("*"), tp, tz));
+  EXPECT_EQ("05.006007008", format(fmt_B("*"), tp, tz));
+  // ... %E0S and %S.%E0f are different.
+  EXPECT_EQ("05", format(fmt_A("0"), tp, tz));
+  EXPECT_EQ("05.", format(fmt_B("0"), tp, tz));
+  // ... %E<prec>S and %S.%E<prec>f are the same for prec in [1:15].
+  for (int prec = 1; prec <= 15; ++prec) {
+    const std::string a = format(fmt_A(std::to_string(prec)), tp, tz);
+    const std::string b = format(fmt_B(std::to_string(prec)), tp, tz);
+    EXPECT_EQ(a, b) << "prec=" << prec;
+  }
+}
+
+TEST(Format, ExtendedOffset) {
+  const auto tp = chrono::system_clock::from_time_t(0);
+
+  auto tz = fixed_time_zone(absl::time_internal::cctz::seconds::zero());
+  TestFormatSpecifier(tp, tz, "%z", "+0000");
+  TestFormatSpecifier(tp, tz, "%:z", "+00:00");
+  TestFormatSpecifier(tp, tz, "%Ez", "+00:00");
+
+  tz = fixed_time_zone(chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%z", "+0000");
+  TestFormatSpecifier(tp, tz, "%:z", "+00:00");
+  TestFormatSpecifier(tp, tz, "%Ez", "+00:00");
+
+  tz = fixed_time_zone(-chrono::seconds(56));  // NOTE: +00:00
+  TestFormatSpecifier(tp, tz, "%z", "+0000");
+  TestFormatSpecifier(tp, tz, "%:z", "+00:00");
+  TestFormatSpecifier(tp, tz, "%Ez", "+00:00");
+
+  tz = fixed_time_zone(chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%z", "+0034");
+  TestFormatSpecifier(tp, tz, "%:z", "+00:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "+00:34");
+
+  tz = fixed_time_zone(-chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%z", "-0034");
+  TestFormatSpecifier(tp, tz, "%:z", "-00:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "-00:34");
+
+  tz = fixed_time_zone(chrono::minutes(34) + chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%z", "+0034");
+  TestFormatSpecifier(tp, tz, "%:z", "+00:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "+00:34");
+
+  tz = fixed_time_zone(-chrono::minutes(34) - chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%z", "-0034");
+  TestFormatSpecifier(tp, tz, "%:z", "-00:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "-00:34");
+
+  tz = fixed_time_zone(chrono::hours(12));
+  TestFormatSpecifier(tp, tz, "%z", "+1200");
+  TestFormatSpecifier(tp, tz, "%:z", "+12:00");
+  TestFormatSpecifier(tp, tz, "%Ez", "+12:00");
+
+  tz = fixed_time_zone(-chrono::hours(12));
+  TestFormatSpecifier(tp, tz, "%z", "-1200");
+  TestFormatSpecifier(tp, tz, "%:z", "-12:00");
+  TestFormatSpecifier(tp, tz, "%Ez", "-12:00");
+
+  tz = fixed_time_zone(chrono::hours(12) + chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%z", "+1200");
+  TestFormatSpecifier(tp, tz, "%:z", "+12:00");
+  TestFormatSpecifier(tp, tz, "%Ez", "+12:00");
+
+  tz = fixed_time_zone(-chrono::hours(12) - chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%z", "-1200");
+  TestFormatSpecifier(tp, tz, "%:z", "-12:00");
+  TestFormatSpecifier(tp, tz, "%Ez", "-12:00");
+
+  tz = fixed_time_zone(chrono::hours(12) + chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%z", "+1234");
+  TestFormatSpecifier(tp, tz, "%:z", "+12:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "+12:34");
+
+  tz = fixed_time_zone(-chrono::hours(12) - chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%z", "-1234");
+  TestFormatSpecifier(tp, tz, "%:z", "-12:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "-12:34");
+
+  tz = fixed_time_zone(chrono::hours(12) + chrono::minutes(34) +
+                       chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%z", "+1234");
+  TestFormatSpecifier(tp, tz, "%:z", "+12:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "+12:34");
+
+  tz = fixed_time_zone(-chrono::hours(12) - chrono::minutes(34) -
+                       chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%z", "-1234");
+  TestFormatSpecifier(tp, tz, "%:z", "-12:34");
+  TestFormatSpecifier(tp, tz, "%Ez", "-12:34");
+}
+
+TEST(Format, ExtendedSecondOffset) {
+  const auto tp = chrono::system_clock::from_time_t(0);
+
+  auto tz = fixed_time_zone(absl::time_internal::cctz::seconds::zero());
+  TestFormatSpecifier(tp, tz, "%E*z", "+00:00:00");
+  TestFormatSpecifier(tp, tz, "%::z", "+00:00:00");
+  TestFormatSpecifier(tp, tz, "%:::z", "+00");
+
+  tz = fixed_time_zone(chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "+00:00:56");
+  TestFormatSpecifier(tp, tz, "%::z", "+00:00:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "+00:00:56");
+
+  tz = fixed_time_zone(-chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "-00:00:56");
+  TestFormatSpecifier(tp, tz, "%::z", "-00:00:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "-00:00:56");
+
+  tz = fixed_time_zone(chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%E*z", "+00:34:00");
+  TestFormatSpecifier(tp, tz, "%::z", "+00:34:00");
+  TestFormatSpecifier(tp, tz, "%:::z", "+00:34");
+
+  tz = fixed_time_zone(-chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%E*z", "-00:34:00");
+  TestFormatSpecifier(tp, tz, "%::z", "-00:34:00");
+  TestFormatSpecifier(tp, tz, "%:::z", "-00:34");
+
+  tz = fixed_time_zone(chrono::minutes(34) + chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "+00:34:56");
+  TestFormatSpecifier(tp, tz, "%::z", "+00:34:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "+00:34:56");
+
+  tz = fixed_time_zone(-chrono::minutes(34) - chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "-00:34:56");
+  TestFormatSpecifier(tp, tz, "%::z", "-00:34:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "-00:34:56");
+
+  tz = fixed_time_zone(chrono::hours(12));
+  TestFormatSpecifier(tp, tz, "%E*z", "+12:00:00");
+  TestFormatSpecifier(tp, tz, "%::z", "+12:00:00");
+  TestFormatSpecifier(tp, tz, "%:::z", "+12");
+
+  tz = fixed_time_zone(-chrono::hours(12));
+  TestFormatSpecifier(tp, tz, "%E*z", "-12:00:00");
+  TestFormatSpecifier(tp, tz, "%::z", "-12:00:00");
+  TestFormatSpecifier(tp, tz, "%:::z", "-12");
+
+  tz = fixed_time_zone(chrono::hours(12) + chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "+12:00:56");
+  TestFormatSpecifier(tp, tz, "%::z", "+12:00:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "+12:00:56");
+
+  tz = fixed_time_zone(-chrono::hours(12) - chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "-12:00:56");
+  TestFormatSpecifier(tp, tz, "%::z", "-12:00:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "-12:00:56");
+
+  tz = fixed_time_zone(chrono::hours(12) + chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%E*z", "+12:34:00");
+  TestFormatSpecifier(tp, tz, "%::z", "+12:34:00");
+  TestFormatSpecifier(tp, tz, "%:::z", "+12:34");
+
+  tz = fixed_time_zone(-chrono::hours(12) - chrono::minutes(34));
+  TestFormatSpecifier(tp, tz, "%E*z", "-12:34:00");
+  TestFormatSpecifier(tp, tz, "%::z", "-12:34:00");
+  TestFormatSpecifier(tp, tz, "%:::z", "-12:34");
+
+  tz = fixed_time_zone(chrono::hours(12) + chrono::minutes(34) +
+                       chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "+12:34:56");
+  TestFormatSpecifier(tp, tz, "%::z", "+12:34:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "+12:34:56");
+
+  tz = fixed_time_zone(-chrono::hours(12) - chrono::minutes(34) -
+                       chrono::seconds(56));
+  TestFormatSpecifier(tp, tz, "%E*z", "-12:34:56");
+  TestFormatSpecifier(tp, tz, "%::z", "-12:34:56");
+  TestFormatSpecifier(tp, tz, "%:::z", "-12:34:56");
+}
+
+TEST(Format, ExtendedYears) {
+  const time_zone utc = utc_time_zone();
+  const char e4y_fmt[] = "%E4Y%m%d";  // no separators
+
+  // %E4Y zero-pads the year to produce at least 4 chars, including the sign.
+  auto tp = convert(civil_second(-999, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("-9991127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(-99, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("-0991127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(-9, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("-0091127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(-1, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("-0011127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(0, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("00001127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(1, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("00011127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(9, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("00091127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(99, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("00991127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(999, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("09991127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(9999, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("99991127", format(e4y_fmt, tp, utc));
+
+  // When the year is outside [-999:9999], more than 4 chars are produced.
+  tp = convert(civil_second(-1000, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("-10001127", format(e4y_fmt, tp, utc));
+  tp = convert(civil_second(10000, 11, 27, 0, 0, 0), utc);
+  EXPECT_EQ("100001127", format(e4y_fmt, tp, utc));
+}
+
+TEST(Format, RFC3339Format) {
+  time_zone tz;
+  EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz));
+
+  time_point<chrono::nanoseconds> tp =
+      convert(civil_second(1977, 6, 28, 9, 8, 7), tz);
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::milliseconds(100);
+  EXPECT_EQ("1977-06-28T09:08:07.1-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::milliseconds(20);
+  EXPECT_EQ("1977-06-28T09:08:07.12-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::milliseconds(3);
+  EXPECT_EQ("1977-06-28T09:08:07.123-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::microseconds(400);
+  EXPECT_EQ("1977-06-28T09:08:07.1234-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::microseconds(50);
+  EXPECT_EQ("1977-06-28T09:08:07.12345-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::microseconds(6);
+  EXPECT_EQ("1977-06-28T09:08:07.123456-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::nanoseconds(700);
+  EXPECT_EQ("1977-06-28T09:08:07.1234567-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::nanoseconds(80);
+  EXPECT_EQ("1977-06-28T09:08:07.12345678-07:00", format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+
+  tp += chrono::nanoseconds(9);
+  EXPECT_EQ("1977-06-28T09:08:07.123456789-07:00",
+            format(RFC3339_full, tp, tz));
+  EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz));
+}
+
+TEST(Format, RFC1123Format) {  // locale specific
+  time_zone tz;
+  EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz));
+
+  auto tp = convert(civil_second(1977, 6, 28, 9, 8, 7), tz);
+  EXPECT_EQ("Tue, 28 Jun 1977 09:08:07 -0700", format(RFC1123_full, tp, tz));
+  EXPECT_EQ("28 Jun 1977 09:08:07 -0700", format(RFC1123_no_wday, tp, tz));
+}
+
+//
+// Testing parse()
+//
+
+TEST(Parse, TimePointResolution) {
+  const char kFmt[] = "%H:%M:%E*S";
+  const time_zone utc = utc_time_zone();
+
+  time_point<chrono::nanoseconds> tp_ns;
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123456789", utc, &tp_ns));
+  EXPECT_EQ("03:04:05.123456789", format(kFmt, tp_ns, utc));
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123456", utc, &tp_ns));
+  EXPECT_EQ("03:04:05.123456", format(kFmt, tp_ns, utc));
+
+  time_point<chrono::microseconds> tp_us;
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123456789", utc, &tp_us));
+  EXPECT_EQ("03:04:05.123456", format(kFmt, tp_us, utc));
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123456", utc, &tp_us));
+  EXPECT_EQ("03:04:05.123456", format(kFmt, tp_us, utc));
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123", utc, &tp_us));
+  EXPECT_EQ("03:04:05.123", format(kFmt, tp_us, utc));
+
+  time_point<chrono::milliseconds> tp_ms;
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123456", utc, &tp_ms));
+  EXPECT_EQ("03:04:05.123", format(kFmt, tp_ms, utc));
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123", utc, &tp_ms));
+  EXPECT_EQ("03:04:05.123", format(kFmt, tp_ms, utc));
+  EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_ms));
+  EXPECT_EQ("03:04:05", format(kFmt, tp_ms, utc));
+
+  time_point<chrono::seconds> tp_s;
+  EXPECT_TRUE(parse(kFmt, "03:04:05.123", utc, &tp_s));
+  EXPECT_EQ("03:04:05", format(kFmt, tp_s, utc));
+  EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_s));
+  EXPECT_EQ("03:04:05", format(kFmt, tp_s, utc));
+
+  time_point<chrono::minutes> tp_m;
+  EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_m));
+  EXPECT_EQ("03:04:00", format(kFmt, tp_m, utc));
+
+  time_point<chrono::hours> tp_h;
+  EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_h));
+  EXPECT_EQ("03:00:00", format(kFmt, tp_h, utc));
+}
+
+TEST(Parse, TimePointExtendedResolution) {
+  const char kFmt[] = "%H:%M:%E*S";
+  const time_zone utc = utc_time_zone();
+
+  time_point<absl::time_internal::cctz::seconds> tp;
+  detail::femtoseconds fs;
+  EXPECT_TRUE(detail::parse(kFmt, "12:34:56.123456789012345", utc, &tp, &fs));
+  EXPECT_EQ("12:34:56.123456789012345", detail::format(kFmt, tp, fs, utc));
+  EXPECT_TRUE(detail::parse(kFmt, "12:34:56.012345678901234", utc, &tp, &fs));
+  EXPECT_EQ("12:34:56.012345678901234", detail::format(kFmt, tp, fs, utc));
+  EXPECT_TRUE(detail::parse(kFmt, "12:34:56.001234567890123", utc, &tp, &fs));
+  EXPECT_EQ("12:34:56.001234567890123", detail::format(kFmt, tp, fs, utc));
+  EXPECT_TRUE(detail::parse(kFmt, "12:34:56.000000000000123", utc, &tp, &fs));
+  EXPECT_EQ("12:34:56.000000000000123", detail::format(kFmt, tp, fs, utc));
+  EXPECT_TRUE(detail::parse(kFmt, "12:34:56.000000000000012", utc, &tp, &fs));
+  EXPECT_EQ("12:34:56.000000000000012", detail::format(kFmt, tp, fs, utc));
+  EXPECT_TRUE(detail::parse(kFmt, "12:34:56.000000000000001", utc, &tp, &fs));
+  EXPECT_EQ("12:34:56.000000000000001", detail::format(kFmt, tp, fs, utc));
+}
+
+TEST(Parse, Basics) {
+  time_zone tz = utc_time_zone();
+  time_point<chrono::nanoseconds> tp =
+      chrono::system_clock::from_time_t(1234567890);
+
+  // Simple edge cases.
+  EXPECT_TRUE(parse("", "", tz, &tp));
+  EXPECT_EQ(chrono::system_clock::from_time_t(0), tp);  // everything defaulted
+  EXPECT_TRUE(parse(" ", " ", tz, &tp));
+  EXPECT_TRUE(parse("  ", "  ", tz, &tp));
+  EXPECT_TRUE(parse("x", "x", tz, &tp));
+  EXPECT_TRUE(parse("xxx", "xxx", tz, &tp));
+
+  EXPECT_TRUE(
+      parse("%Y-%m-%d %H:%M:%S %z", "2013-06-28 19:08:09 -0800", tz, &tp));
+  ExpectTime(tp, tz, 2013, 6, 29, 3, 8, 9, 0, false, "UTC");
+}
+
+TEST(Parse, WithTimeZone) {
+  time_zone tz;
+  EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz));
+  time_point<chrono::nanoseconds> tp;
+
+  // We can parse a string without a UTC offset if we supply a timezone.
+  EXPECT_TRUE(parse("%Y-%m-%d %H:%M:%S", "2013-06-28 19:08:09", tz, &tp));
+  ExpectTime(tp, tz, 2013, 6, 28, 19, 8, 9, -7 * 60 * 60, true, "PDT");
+
+  // But the timezone is ignored when a UTC offset is present.
+  EXPECT_TRUE(parse("%Y-%m-%d %H:%M:%S %z", "2013-06-28 19:08:09 +0800",
+                    utc_time_zone(), &tp));
+  ExpectTime(tp, tz, 2013, 6, 28, 19 - 8 - 7, 8, 9, -7 * 60 * 60, true, "PDT");
+
+  // Check a skipped time (a Spring DST transition). parse() uses the
+  // pre-transition offset.
+  EXPECT_TRUE(parse("%Y-%m-%d %H:%M:%S", "2011-03-13 02:15:00", tz, &tp));
+  ExpectTime(tp, tz, 2011, 3, 13, 3, 15, 0, -7 * 60 * 60, true, "PDT");
+
+  // Check a repeated time (a Fall DST transition).  parse() uses the
+  // pre-transition offset.
+  EXPECT_TRUE(parse("%Y-%m-%d %H:%M:%S", "2011-11-06 01:15:00", tz, &tp));
+  ExpectTime(tp, tz, 2011, 11, 6, 1, 15, 0, -7 * 60 * 60, true, "PDT");
+}
+
+TEST(Parse, LeapSecond) {
+  time_zone tz;
+  EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz));
+  time_point<chrono::nanoseconds> tp;
+
+  // ":59" -> ":59"
+  EXPECT_TRUE(parse(RFC3339_full, "2013-06-28T07:08:59-08:00", tz, &tp));
+  ExpectTime(tp, tz, 2013, 6, 28, 8, 8, 59, -7 * 60 * 60, true, "PDT");
+
+  // ":59.5" -> ":59.5"
+  EXPECT_TRUE(parse(RFC3339_full, "2013-06-28T07:08:59.5-08:00", tz, &tp));
+  ExpectTime(tp, tz, 2013, 6, 28, 8, 8, 59, -7 * 60 * 60, true, "PDT");
+
+  // ":60" -> ":00"
+  EXPECT_TRUE(parse(RFC3339_full, "2013-06-28T07:08:60-08:00", tz, &tp));
+  ExpectTime(tp, tz, 2013, 6, 28, 8, 9, 0, -7 * 60 * 60, true, "PDT");
+
+  // ":60.5" -> ":00.0"
+  EXPECT_TRUE(parse(RFC3339_full, "2013-06-28T07:08:60.5-08:00", tz, &tp));
+  ExpectTime(tp, tz, 2013, 6, 28, 8, 9, 0, -7 * 60 * 60, true, "PDT");
+
+  // ":61" -> error
+  EXPECT_FALSE(parse(RFC3339_full, "2013-06-28T07:08:61-08:00", tz, &tp));
+}
+
+TEST(Parse, ErrorCases) {
+  const time_zone tz = utc_time_zone();
+  auto tp = chrono::system_clock::from_time_t(0);
+
+  // Illegal trailing data.
+  EXPECT_FALSE(parse("%S", "123", tz, &tp));
+
+  // Can't parse an illegal format specifier.
+  EXPECT_FALSE(parse("%Q", "x", tz, &tp));
+
+  // Fails because of trailing, unparsed data "blah".
+  EXPECT_FALSE(parse("%m-%d", "2-3 blah", tz, &tp));
+
+  // Trailing whitespace is allowed.
+  EXPECT_TRUE(parse("%m-%d", "2-3  ", tz, &tp));
+  EXPECT_EQ(2, convert(tp, utc_time_zone()).month());
+  EXPECT_EQ(3, convert(tp, utc_time_zone()).day());
+
+  // Feb 31 requires normalization.
+  EXPECT_FALSE(parse("%m-%d", "2-31", tz, &tp));
+
+  // Check that we cannot have spaces in UTC offsets.
+  EXPECT_TRUE(parse("%z", "-0203", tz, &tp));
+  EXPECT_FALSE(parse("%z", "- 2 3", tz, &tp));
+  EXPECT_TRUE(parse("%Ez", "-02:03", tz, &tp));
+  EXPECT_FALSE(parse("%Ez", "- 2: 3", tz, &tp));
+
+  // Check that we reject other malformed UTC offsets.
+  EXPECT_FALSE(parse("%Ez", "+-08:00", tz, &tp));
+  EXPECT_FALSE(parse("%Ez", "-+08:00", tz, &tp));
+
+  // Check that we do not accept "-0" in fields that allow zero.
+  EXPECT_FALSE(parse("%Y", "-0", tz, &tp));
+  EXPECT_FALSE(parse("%E4Y", "-0", tz, &tp));
+  EXPECT_FALSE(parse("%H", "-0", tz, &tp));
+  EXPECT_FALSE(parse("%M", "-0", tz, &tp));
+  EXPECT_FALSE(parse("%S", "-0", tz, &tp));
+  EXPECT_FALSE(parse("%z", "+-000", tz, &tp));
+  EXPECT_FALSE(parse("%Ez", "+-0:00", tz, &tp));
+  EXPECT_FALSE(parse("%z", "-00-0", tz, &tp));
+  EXPECT_FALSE(parse("%Ez", "-00:-0", tz, &tp));
+}
+
+TEST(Parse, PosixConversions) {
+  time_zone tz = utc_time_zone();
+  auto tp = chrono::system_clock::from_time_t(0);
+  const auto reset = convert(civil_second(1977, 6, 28, 9, 8, 7), tz);
+
+  tp = reset;
+  EXPECT_TRUE(parse("%d", "15", tz, &tp));
+  EXPECT_EQ(15, convert(tp, tz).day());
+
+  // %e is an extension, but is supported internally.
+  tp = reset;
+  EXPECT_TRUE(parse("%e", "15", tz, &tp));
+  EXPECT_EQ(15, convert(tp, tz).day());  // Equivalent to %d
+
+  tp = reset;
+  EXPECT_TRUE(parse("%H", "17", tz, &tp));
+  EXPECT_EQ(17, convert(tp, tz).hour());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%I", "5", tz, &tp));
+  EXPECT_EQ(5, convert(tp, tz).hour());
+
+  // %j is parsed but ignored.
+  EXPECT_TRUE(parse("%j", "32", tz, &tp));
+
+  tp = reset;
+  EXPECT_TRUE(parse("%m", "11", tz, &tp));
+  EXPECT_EQ(11, convert(tp, tz).month());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%M", "33", tz, &tp));
+  EXPECT_EQ(33, convert(tp, tz).minute());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%S", "55", tz, &tp));
+  EXPECT_EQ(55, convert(tp, tz).second());
+
+  // %U is parsed but ignored.
+  EXPECT_TRUE(parse("%U", "15", tz, &tp));
+
+  // %w is parsed but ignored.
+  EXPECT_TRUE(parse("%w", "2", tz, &tp));
+
+  // %W is parsed but ignored.
+  EXPECT_TRUE(parse("%W", "22", tz, &tp));
+
+  tp = reset;
+  EXPECT_TRUE(parse("%y", "04", tz, &tp));
+  EXPECT_EQ(2004, convert(tp, tz).year());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%Y", "2004", tz, &tp));
+  EXPECT_EQ(2004, convert(tp, tz).year());
+
+  EXPECT_TRUE(parse("%%", "%", tz, &tp));
+
+#if defined(__linux__)
+  // SU/C99/TZ extensions
+
+  // Because we handle each (non-internal) specifier in a separate call
+  // to strptime(), there is no way to group %C and %y together.  So we
+  // just skip the %C/%y case.
+#if 0
+  tp = reset;
+  EXPECT_TRUE(parse("%C %y", "20 04", tz, &tp));
+  EXPECT_EQ(2004, convert(tp, tz).year());
+#endif
+
+  tp = reset;
+  EXPECT_TRUE(parse("%D", "02/03/04", tz, &tp));
+  EXPECT_EQ(2, convert(tp, tz).month());
+  EXPECT_EQ(3, convert(tp, tz).day());
+  EXPECT_EQ(2004, convert(tp, tz).year());
+
+  EXPECT_TRUE(parse("%n", "\n", tz, &tp));
+
+  tp = reset;
+  EXPECT_TRUE(parse("%R", "03:44", tz, &tp));
+  EXPECT_EQ(3, convert(tp, tz).hour());
+  EXPECT_EQ(44, convert(tp, tz).minute());
+
+  EXPECT_TRUE(parse("%t", "\t\v\f\n\r ", tz, &tp));
+
+  tp = reset;
+  EXPECT_TRUE(parse("%T", "03:44:55", tz, &tp));
+  EXPECT_EQ(3, convert(tp, tz).hour());
+  EXPECT_EQ(44, convert(tp, tz).minute());
+  EXPECT_EQ(55, convert(tp, tz).second());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%s", "1234567890", tz, &tp));
+  EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp);
+
+  // %s conversion, like %z/%Ez, pays no heed to the optional zone.
+  time_zone lax;
+  EXPECT_TRUE(load_time_zone("America/Los_Angeles", &lax));
+  tp = reset;
+  EXPECT_TRUE(parse("%s", "1234567890", lax, &tp));
+  EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp);
+
+  // This is most important when the time has the same YMDhms
+  // breakdown in the zone as some other time.  For example, ...
+  //  1414917000 in US/Pacific -> Sun Nov 2 01:30:00 2014 (PDT)
+  //  1414920600 in US/Pacific -> Sun Nov 2 01:30:00 2014 (PST)
+  tp = reset;
+  EXPECT_TRUE(parse("%s", "1414917000", lax, &tp));
+  EXPECT_EQ(chrono::system_clock::from_time_t(1414917000), tp);
+  tp = reset;
+  EXPECT_TRUE(parse("%s", "1414920600", lax, &tp));
+  EXPECT_EQ(chrono::system_clock::from_time_t(1414920600), tp);
+#endif
+}
+
+TEST(Parse, LocaleSpecific) {
+  time_zone tz = utc_time_zone();
+  auto tp = chrono::system_clock::from_time_t(0);
+  const auto reset = convert(civil_second(1977, 6, 28, 9, 8, 7), tz);
+
+  // %a is parsed but ignored.
+  EXPECT_TRUE(parse("%a", "Mon", tz, &tp));
+
+  // %A is parsed but ignored.
+  EXPECT_TRUE(parse("%A", "Monday", tz, &tp));
+
+  tp = reset;
+  EXPECT_TRUE(parse("%b", "Feb", tz, &tp));
+  EXPECT_EQ(2, convert(tp, tz).month());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%B", "February", tz, &tp));
+  EXPECT_EQ(2, convert(tp, tz).month());
+
+  // %p is parsed but ignored if it's alone.  But it's used with %I.
+  EXPECT_TRUE(parse("%p", "AM", tz, &tp));
+  tp = reset;
+  EXPECT_TRUE(parse("%I %p", "5 PM", tz, &tp));
+  EXPECT_EQ(17, convert(tp, tz).hour());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%x", "02/03/04", tz, &tp));
+  if (convert(tp, tz).month() == 2) {
+    EXPECT_EQ(3, convert(tp, tz).day());
+  } else {
+    EXPECT_EQ(2, convert(tp, tz).day());
+    EXPECT_EQ(3, convert(tp, tz).month());
+  }
+  EXPECT_EQ(2004, convert(tp, tz).year());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%X", "15:44:55", tz, &tp));
+  EXPECT_EQ(15, convert(tp, tz).hour());
+  EXPECT_EQ(44, convert(tp, tz).minute());
+  EXPECT_EQ(55, convert(tp, tz).second());
+
+#if defined(__linux__)
+  // SU/C99/TZ extensions
+
+  tp = reset;
+  EXPECT_TRUE(parse("%h", "Feb", tz, &tp));
+  EXPECT_EQ(2, convert(tp, tz).month());  // Equivalent to %b
+
+  tp = reset;
+  EXPECT_TRUE(parse("%l %p", "5 PM", tz, &tp));
+  EXPECT_EQ(17, convert(tp, tz).hour());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%r", "03:44:55 PM", tz, &tp));
+  EXPECT_EQ(15, convert(tp, tz).hour());
+  EXPECT_EQ(44, convert(tp, tz).minute());
+  EXPECT_EQ(55, convert(tp, tz).second());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%Ec", "Tue Nov 19 05:06:07 2013", tz, &tp));
+  EXPECT_EQ(convert(civil_second(2013, 11, 19, 5, 6, 7), tz), tp);
+
+  // Modified conversion specifiers %E_
+
+  tp = reset;
+  EXPECT_TRUE(parse("%Ex", "02/03/04", tz, &tp));
+  EXPECT_EQ(2, convert(tp, tz).month());
+  EXPECT_EQ(3, convert(tp, tz).day());
+  EXPECT_EQ(2004, convert(tp, tz).year());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%EX", "15:44:55", tz, &tp));
+  EXPECT_EQ(15, convert(tp, tz).hour());
+  EXPECT_EQ(44, convert(tp, tz).minute());
+  EXPECT_EQ(55, convert(tp, tz).second());
+
+  // %Ey, the year offset from %EC, doesn't really make sense alone as there
+  // is no way to represent it in tm_year (%EC is not simply the century).
+  // Yet, because we handle each (non-internal) specifier in a separate call
+  // to strptime(), there is no way to group %EC and %Ey either.  So we just
+  // skip the %EC and %Ey cases.
+
+  tp = reset;
+  EXPECT_TRUE(parse("%EY", "2004", tz, &tp));
+  EXPECT_EQ(2004, convert(tp, tz).year());
+
+  // Modified conversion specifiers %O_
+
+  tp = reset;
+  EXPECT_TRUE(parse("%Od", "15", tz, &tp));
+  EXPECT_EQ(15, convert(tp, tz).day());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%Oe", "15", tz, &tp));
+  EXPECT_EQ(15, convert(tp, tz).day());  // Equivalent to %d
+
+  tp = reset;
+  EXPECT_TRUE(parse("%OH", "17", tz, &tp));
+  EXPECT_EQ(17, convert(tp, tz).hour());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%OI", "5", tz, &tp));
+  EXPECT_EQ(5, convert(tp, tz).hour());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%Om", "11", tz, &tp));
+  EXPECT_EQ(11, convert(tp, tz).month());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%OM", "33", tz, &tp));
+  EXPECT_EQ(33, convert(tp, tz).minute());
+
+  tp = reset;
+  EXPECT_TRUE(parse("%OS", "55", tz, &tp));
+  EXPECT_EQ(55, convert(tp, tz).second());
+
+  // %OU is parsed but ignored.
+  EXPECT_TRUE(parse("%OU", "15", tz, &tp));
+
+  // %Ow is parsed but ignored.
+  EXPECT_TRUE(parse("%Ow", "2", tz, &tp));
+
+  // %OW is parsed but ignored.
+  EXPECT_TRUE(parse("%OW", "22", tz, &tp));
+
+  tp = reset;
+  EXPECT_TRUE(parse("%Oy", "04", tz, &tp));
+  EXPECT_EQ(2004, convert(tp, tz).year());
+#endif
+}
+
+TEST(Parse, ExtendedSeconds) {
+  const time_zone tz = utc_time_zone();
+  const time_point<chrono::nanoseconds> unix_epoch =
+      chrono::system_clock::from_time_t(0);
+
+  // All %E<prec>S cases are treated the same as %E*S on input.
+  auto precisions = {"*", "0", "1",  "2",  "3",  "4",  "5",  "6", "7",
+                     "8", "9", "10", "11", "12", "13", "14", "15"};
+  for (const std::string& prec : precisions) {
+    const std::string fmt = "%E" + prec + "S";
+    SCOPED_TRACE(fmt);
+    time_point<chrono::nanoseconds> tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "5", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.0", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.00", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.6", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(600), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.60", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(600), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.600", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(600), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.67", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(670), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.670", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(670), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "05.678", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(678), tp);
+  }
+
+  // Here is a "%E*S" case we got wrong for a while.  The fractional
+  // part of the first instant is less than 2^31 and was correctly
+  // parsed, while the second (and any subsecond field >=2^31) failed.
+  time_point<chrono::nanoseconds> tp = unix_epoch;
+  EXPECT_TRUE(parse("%E*S", "0.2147483647", tz, &tp));
+  EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+  tp = unix_epoch;
+  EXPECT_TRUE(parse("%E*S", "0.2147483648", tz, &tp));
+  EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+
+  // We should also be able to specify long strings of digits far
+  // beyond the current resolution and have them convert the same way.
+  tp = unix_epoch;
+  EXPECT_TRUE(parse(
+      "%E*S", "0.214748364801234567890123456789012345678901234567890123456789",
+      tz, &tp));
+  EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+}
+
+TEST(Parse, ExtendedSecondsScan) {
+  const time_zone tz = utc_time_zone();
+  time_point<chrono::nanoseconds> tp;
+  for (int ms = 0; ms < 1000; ms += 111) {
+    for (int us = 0; us < 1000; us += 27) {
+      const int micros = ms * 1000 + us;
+      for (int ns = 0; ns < 1000; ns += 9) {
+        const auto expected = chrono::system_clock::from_time_t(0) +
+                              chrono::nanoseconds(micros * 1000 + ns);
+        std::ostringstream oss;
+        oss << "0." << std::setfill('0') << std::setw(3);
+        oss << ms << std::setw(3) << us << std::setw(3) << ns;
+        const std::string input = oss.str();
+        EXPECT_TRUE(parse("%E*S", input, tz, &tp));
+        EXPECT_EQ(expected, tp) << input;
+      }
+    }
+  }
+}
+
+TEST(Parse, ExtendedSubeconds) {
+  const time_zone tz = utc_time_zone();
+  const time_point<chrono::nanoseconds> unix_epoch =
+      chrono::system_clock::from_time_t(0);
+
+  // All %E<prec>f cases are treated the same as %E*f on input.
+  auto precisions = {"*", "0", "1",  "2",  "3",  "4",  "5",  "6", "7",
+                     "8", "9", "10", "11", "12", "13", "14", "15"};
+  for (const std::string& prec : precisions) {
+    const std::string fmt = "%E" + prec + "f";
+    SCOPED_TRACE(fmt);
+    time_point<chrono::nanoseconds> tp = unix_epoch - chrono::seconds(1);
+    EXPECT_TRUE(parse(fmt, "", tz, &tp));
+    EXPECT_EQ(unix_epoch, tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "6", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::milliseconds(600), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "60", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::milliseconds(600), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "600", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::milliseconds(600), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "67", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::milliseconds(670), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "670", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::milliseconds(670), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "678", tz, &tp));
+    EXPECT_EQ(unix_epoch + chrono::milliseconds(678), tp);
+    tp = unix_epoch;
+    EXPECT_TRUE(parse(fmt, "6789", tz, &tp));
+    EXPECT_EQ(
+        unix_epoch + chrono::milliseconds(678) + chrono::microseconds(900), tp);
+  }
+
+  // Here is a "%E*f" case we got wrong for a while.  The fractional
+  // part of the first instant is less than 2^31 and was correctly
+  // parsed, while the second (and any subsecond field >=2^31) failed.
+  time_point<chrono::nanoseconds> tp = unix_epoch;
+  EXPECT_TRUE(parse("%E*f", "2147483647", tz, &tp));
+  EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+  tp = unix_epoch;
+  EXPECT_TRUE(parse("%E*f", "2147483648", tz, &tp));
+  EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+
+  // We should also be able to specify long strings of digits far
+  // beyond the current resolution and have them convert the same way.
+  tp = unix_epoch;
+  EXPECT_TRUE(parse(
+      "%E*f", "214748364801234567890123456789012345678901234567890123456789",
+      tz, &tp));
+  EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp);
+}
+
+TEST(Parse, ExtendedSubecondsScan) {
+  time_point<chrono::nanoseconds> tp;
+  const time_zone tz = utc_time_zone();
+  for (int ms = 0; ms < 1000; ms += 111) {
+    for (int us = 0; us < 1000; us += 27) {
+      const int micros = ms * 1000 + us;
+      for (int ns = 0; ns < 1000; ns += 9) {
+        std::ostringstream oss;
+        oss << std::setfill('0') << std::setw(3) << ms;
+        oss << std::setw(3) << us << std::setw(3) << ns;
+        const std::string nanos = oss.str();
+        const auto expected = chrono::system_clock::from_time_t(0) +
+                              chrono::nanoseconds(micros * 1000 + ns);
+        for (int ps = 0; ps < 1000; ps += 250) {
+          std::ostringstream ps_oss;
+          oss << std::setfill('0') << std::setw(3) << ps;
+          const std::string input = nanos + ps_oss.str() + "999";
+          EXPECT_TRUE(parse("%E*f", input, tz, &tp));
+          EXPECT_EQ(expected + chrono::nanoseconds(ps) / 1000, tp) << input;
+        }
+      }
+    }
+  }
+}
+
+TEST(Parse, ExtendedOffset) {
+  const time_zone utc = utc_time_zone();
+  time_point<absl::time_internal::cctz::seconds> tp;
+
+  EXPECT_TRUE(parse("%Ez", "+00:00", utc, &tp));
+  EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse("%Ez", "-12:34", utc, &tp));
+  EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 0), utc), tp);
+  EXPECT_TRUE(parse("%Ez", "+12:34", utc, &tp));
+  EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 26, 0), utc), tp);
+  EXPECT_FALSE(parse("%Ez", "-12:3", utc, &tp));
+
+  for (auto fmt : {"%Ez", "%z"}) {
+    EXPECT_TRUE(parse(fmt, "+0000", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "-1234", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "+1234", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 26, 0), utc), tp);
+    EXPECT_FALSE(parse(fmt, "-123", utc, &tp));
+
+    EXPECT_TRUE(parse(fmt, "+00", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "-12", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "+12", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1969, 12, 31, 12, 0, 0), utc), tp);
+    EXPECT_FALSE(parse(fmt, "-1", utc, &tp));
+  }
+}
+
+TEST(Parse, ExtendedSecondOffset) {
+  const time_zone utc = utc_time_zone();
+  time_point<absl::time_internal::cctz::seconds> tp;
+
+  for (auto fmt : {"%Ez", "%E*z", "%:z", "%::z", "%:::z"}) {
+    EXPECT_TRUE(parse(fmt, "+00:00:00", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "-12:34:56", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 56), utc), tp);
+    EXPECT_TRUE(parse(fmt, "+12:34:56", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 25, 4), utc), tp);
+    EXPECT_FALSE(parse(fmt, "-12:34:5", utc, &tp));
+
+    EXPECT_TRUE(parse(fmt, "+000000", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "-123456", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 56), utc), tp);
+    EXPECT_TRUE(parse(fmt, "+123456", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 25, 4), utc), tp);
+    EXPECT_FALSE(parse(fmt, "-12345", utc, &tp));
+
+    EXPECT_TRUE(parse(fmt, "+00:00", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "-12:34", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "+12:34", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 26, 0), utc), tp);
+    EXPECT_FALSE(parse(fmt, "-12:3", utc, &tp));
+
+    EXPECT_TRUE(parse(fmt, "+0000", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "-1234", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 34, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "+1234", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1969, 12, 31, 11, 26, 0), utc), tp);
+    EXPECT_FALSE(parse(fmt, "-123", utc, &tp));
+
+    EXPECT_TRUE(parse(fmt, "+00", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 0, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "-12", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1970, 1, 1, 12, 0, 0), utc), tp);
+    EXPECT_TRUE(parse(fmt, "+12", utc, &tp));
+    EXPECT_EQ(convert(civil_second(1969, 12, 31, 12, 0, 0), utc), tp);
+    EXPECT_FALSE(parse(fmt, "-1", utc, &tp));
+  }
+}
+
+TEST(Parse, ExtendedYears) {
+  const time_zone utc = utc_time_zone();
+  const char e4y_fmt[] = "%E4Y%m%d";  // no separators
+  time_point<absl::time_internal::cctz::seconds> tp;
+
+  // %E4Y consumes exactly four chars, including any sign.
+  EXPECT_TRUE(parse(e4y_fmt, "-9991127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(-999, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "-0991127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(-99, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "-0091127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(-9, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "-0011127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(-1, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "00001127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(0, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "00011127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(1, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "00091127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(9, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "00991127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(99, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "09991127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(999, 11, 27, 0, 0, 0), utc), tp);
+  EXPECT_TRUE(parse(e4y_fmt, "99991127", utc, &tp));
+  EXPECT_EQ(convert(civil_second(9999, 11, 27, 0, 0, 0), utc), tp);
+
+  // When the year is outside [-999:9999], the parse fails.
+  EXPECT_FALSE(parse(e4y_fmt, "-10001127", utc, &tp));
+  EXPECT_FALSE(parse(e4y_fmt, "100001127", utc, &tp));
+}
+
+TEST(Parse, RFC3339Format) {
+  const time_zone tz = utc_time_zone();
+  time_point<chrono::nanoseconds> tp;
+  EXPECT_TRUE(parse(RFC3339_sec, "2014-02-12T20:21:00+00:00", tz, &tp));
+  ExpectTime(tp, tz, 2014, 2, 12, 20, 21, 0, 0, false, "UTC");
+
+  // Check that %Ez also accepts "Z" as a synonym for "+00:00".
+  time_point<chrono::nanoseconds> tp2;
+  EXPECT_TRUE(parse(RFC3339_sec, "2014-02-12T20:21:00Z", tz, &tp2));
+  EXPECT_EQ(tp, tp2);
+}
+
+TEST(Parse, MaxRange) {
+  const time_zone utc = utc_time_zone();
+  time_point<absl::time_internal::cctz::seconds> tp;
+
+  // tests the upper limit using +00:00 offset
+  EXPECT_TRUE(
+      parse(RFC3339_sec, "292277026596-12-04T15:30:07+00:00", utc, &tp));
+  EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::max());
+  EXPECT_FALSE(
+      parse(RFC3339_sec, "292277026596-12-04T15:30:08+00:00", utc, &tp));
+
+  // tests the upper limit using -01:00 offset
+  EXPECT_TRUE(
+      parse(RFC3339_sec, "292277026596-12-04T14:30:07-01:00", utc, &tp));
+  EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::max());
+  EXPECT_FALSE(
+      parse(RFC3339_sec, "292277026596-12-04T15:30:07-01:00", utc, &tp));
+
+  // tests the lower limit using +00:00 offset
+  EXPECT_TRUE(
+      parse(RFC3339_sec, "-292277022657-01-27T08:29:52+00:00", utc, &tp));
+  EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::min());
+  EXPECT_FALSE(
+      parse(RFC3339_sec, "-292277022657-01-27T08:29:51+00:00", utc, &tp));
+
+  // tests the lower limit using +01:00 offset
+  EXPECT_TRUE(
+      parse(RFC3339_sec, "-292277022657-01-27T09:29:52+01:00", utc, &tp));
+  EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::min());
+  EXPECT_FALSE(
+      parse(RFC3339_sec, "-292277022657-01-27T08:29:51+01:00", utc, &tp));
+
+  // tests max/min civil-second overflow
+  EXPECT_FALSE(
+      parse(RFC3339_sec, "9223372036854775807-12-31T23:59:59-00:01", utc, &tp));
+  EXPECT_FALSE(parse(RFC3339_sec, "-9223372036854775808-01-01T00:00:00+00:01",
+                     utc, &tp));
+
+  // TODO: Add tests that parsing times with fractional seconds overflow
+  // appropriately. This can't be done until cctz::parse() properly detects
+  // overflow when combining the chrono seconds and femto.
+}
+
+//
+// Roundtrip test for format()/parse().
+//
+
+TEST(FormatParse, RoundTrip) {
+  time_zone lax;
+  EXPECT_TRUE(load_time_zone("America/Los_Angeles", &lax));
+  const auto in = convert(civil_second(1977, 6, 28, 9, 8, 7), lax);
+  const auto subseconds = chrono::nanoseconds(654321);
+
+  // RFC3339, which renders subseconds.
+  {
+    time_point<chrono::nanoseconds> out;
+    const std::string s = format(RFC3339_full, in + subseconds, lax);
+    EXPECT_TRUE(parse(RFC3339_full, s, lax, &out)) << s;
+    EXPECT_EQ(in + subseconds, out);  // RFC3339_full includes %Ez
+  }
+
+  // RFC1123, which only does whole seconds.
+  {
+    time_point<chrono::nanoseconds> out;
+    const std::string s = format(RFC1123_full, in, lax);
+    EXPECT_TRUE(parse(RFC1123_full, s, lax, &out)) << s;
+    EXPECT_EQ(in, out);  // RFC1123_full includes %z
+  }
+
+#if defined(_WIN32) || defined(_WIN64)
+  // Initial investigations indicate the %c does not roundtrip on Windows.
+  // TODO: Figure out what is going on here (perhaps a locale problem).
+#elif defined(__EMSCRIPTEN__)
+  // strftime() and strptime() use different defintions for "%c" under
+  // emscripten (see https://github.com/kripken/emscripten/pull/7491),
+  // causing its round-trip test to fail.
+#else
+  // Even though we don't know what %c will produce, it should roundtrip,
+  // but only in the 0-offset timezone.
+  {
+    time_point<chrono::nanoseconds> out;
+    time_zone utc = utc_time_zone();
+    const std::string s = format("%c", in, utc);
+    EXPECT_TRUE(parse("%c", s, utc, &out)) << s;
+    EXPECT_EQ(in, out);
+  }
+#endif
+}
+
+TEST(FormatParse, RoundTripDistantFuture) {
+  const time_zone utc = utc_time_zone();
+  const time_point<absl::time_internal::cctz::seconds> in =
+      time_point<absl::time_internal::cctz::seconds>::max();
+  const std::string s = format(RFC3339_full, in, utc);
+  time_point<absl::time_internal::cctz::seconds> out;
+  EXPECT_TRUE(parse(RFC3339_full, s, utc, &out)) << s;
+  EXPECT_EQ(in, out);
+}
+
+TEST(FormatParse, RoundTripDistantPast) {
+  const time_zone utc = utc_time_zone();
+  const time_point<absl::time_internal::cctz::seconds> in =
+      time_point<absl::time_internal::cctz::seconds>::min();
+  const std::string s = format(RFC3339_full, in, utc);
+  time_point<absl::time_internal::cctz::seconds> out;
+  EXPECT_TRUE(parse(RFC3339_full, s, utc, &out)) << s;
+  EXPECT_EQ(in, out);
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_if.cc b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_if.cc
new file mode 100644
index 0000000000..0319b2f98e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_if.cc
@@ -0,0 +1,45 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "time_zone_if.h"
+
+#include "absl/base/config.h"
+#include "time_zone_info.h"
+#include "time_zone_libc.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+std::unique_ptr<TimeZoneIf> TimeZoneIf::Load(const std::string& name) {
+  // Support "libc:localtime" and "libc:*" to access the legacy
+  // localtime and UTC support respectively from the C library.
+  if (name.compare(0, 5, "libc:") == 0) {
+    return std::unique_ptr<TimeZoneIf>(new TimeZoneLibC(name.substr(5)));
+  }
+
+  // Otherwise use the "zoneinfo" implementation by default.
+  std::unique_ptr<TimeZoneInfo> tz(new TimeZoneInfo);
+  if (!tz->Load(name)) tz.reset();
+  return std::unique_ptr<TimeZoneIf>(tz.release());
+}
+
+// Defined out-of-line to avoid emitting a weak vtable in all TUs.
+TimeZoneIf::~TimeZoneIf() {}
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_if.h b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_if.h
new file mode 100644
index 0000000000..32c0891c1e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_if.h
@@ -0,0 +1,76 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IF_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IF_H_
+
+#include <chrono>
+#include <cstdint>
+#include <memory>
+#include <string>
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// A simple interface used to hide time-zone complexities from time_zone::Impl.
+// Subclasses implement the functions for civil-time conversions in the zone.
+class TimeZoneIf {
+ public:
+  // A factory function for TimeZoneIf implementations.
+  static std::unique_ptr<TimeZoneIf> Load(const std::string& name);
+
+  virtual ~TimeZoneIf();
+
+  virtual time_zone::absolute_lookup BreakTime(
+      const time_point<seconds>& tp) const = 0;
+  virtual time_zone::civil_lookup MakeTime(const civil_second& cs) const = 0;
+
+  virtual bool NextTransition(const time_point<seconds>& tp,
+                              time_zone::civil_transition* trans) const = 0;
+  virtual bool PrevTransition(const time_point<seconds>& tp,
+                              time_zone::civil_transition* trans) const = 0;
+
+  virtual std::string Version() const = 0;
+  virtual std::string Description() const = 0;
+
+ protected:
+  TimeZoneIf() {}
+};
+
+// Convert between time_point<seconds> and a count of seconds since the
+// Unix epoch.  We assume that the std::chrono::system_clock and the
+// Unix clock are second aligned, but not that they share an epoch.
+inline std::int_fast64_t ToUnixSeconds(const time_point<seconds>& tp) {
+  return (tp - std::chrono::time_point_cast<seconds>(
+                   std::chrono::system_clock::from_time_t(0)))
+      .count();
+}
+inline time_point<seconds> FromUnixSeconds(std::int_fast64_t t) {
+  return std::chrono::time_point_cast<seconds>(
+             std::chrono::system_clock::from_time_t(0)) +
+         seconds(t);
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IF_H_
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_impl.cc b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_impl.cc
new file mode 100644
index 0000000000..030ae0e19e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_impl.cc
@@ -0,0 +1,121 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "time_zone_impl.h"
+
+#include <deque>
+#include <mutex>
+#include <string>
+#include <unordered_map>
+#include <utility>
+
+#include "absl/base/config.h"
+#include "time_zone_fixed.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+// time_zone::Impls are linked into a map to support fast lookup by name.
+using TimeZoneImplByName =
+    std::unordered_map<std::string, const time_zone::Impl*>;
+TimeZoneImplByName* time_zone_map = nullptr;
+
+// Mutual exclusion for time_zone_map.
+std::mutex& TimeZoneMutex() {
+  // This mutex is intentionally "leaked" to avoid the static deinitialization
+  // order fiasco (std::mutex's destructor is not trivial on many platforms).
+  static std::mutex* time_zone_mutex = new std::mutex;
+  return *time_zone_mutex;
+}
+
+}  // namespace
+
+time_zone time_zone::Impl::UTC() { return time_zone(UTCImpl()); }
+
+bool time_zone::Impl::LoadTimeZone(const std::string& name, time_zone* tz) {
+  const time_zone::Impl* const utc_impl = UTCImpl();
+
+  // First check for UTC (which is never a key in time_zone_map).
+  auto offset = seconds::zero();
+  if (FixedOffsetFromName(name, &offset) && offset == seconds::zero()) {
+    *tz = time_zone(utc_impl);
+    return true;
+  }
+
+  // Then check, under a shared lock, whether the time zone has already
+  // been loaded. This is the common path. TODO: Move to shared_mutex.
+  {
+    std::lock_guard<std::mutex> lock(TimeZoneMutex());
+    if (time_zone_map != nullptr) {
+      TimeZoneImplByName::const_iterator itr = time_zone_map->find(name);
+      if (itr != time_zone_map->end()) {
+        *tz = time_zone(itr->second);
+        return itr->second != utc_impl;
+      }
+    }
+  }
+
+  // Now check again, under an exclusive lock.
+  std::lock_guard<std::mutex> lock(TimeZoneMutex());
+  if (time_zone_map == nullptr) time_zone_map = new TimeZoneImplByName;
+  const Impl*& impl = (*time_zone_map)[name];
+  if (impl == nullptr) {
+    // The first thread in loads the new time zone.
+    Impl* new_impl = new Impl(name);
+    new_impl->zone_ = TimeZoneIf::Load(new_impl->name_);
+    if (new_impl->zone_ == nullptr) {
+      delete new_impl;  // free the nascent Impl
+      impl = utc_impl;  // and fallback to UTC
+    } else {
+      impl = new_impl;  // install new time zone
+    }
+  }
+  *tz = time_zone(impl);
+  return impl != utc_impl;
+}
+
+void time_zone::Impl::ClearTimeZoneMapTestOnly() {
+  std::lock_guard<std::mutex> lock(TimeZoneMutex());
+  if (time_zone_map != nullptr) {
+    // Existing time_zone::Impl* entries are in the wild, so we can't delete
+    // them. Instead, we move them to a private container, where they are
+    // logically unreachable but not "leaked".  Future requests will result
+    // in reloading the data.
+    static auto* cleared = new std::deque<const time_zone::Impl*>;
+    for (const auto& element : *time_zone_map) {
+      cleared->push_back(element.second);
+    }
+    time_zone_map->clear();
+  }
+}
+
+time_zone::Impl::Impl(const std::string& name) : name_(name) {}
+
+const time_zone::Impl* time_zone::Impl::UTCImpl() {
+  static Impl* utc_impl = [] {
+    Impl* impl = new Impl("UTC");
+    impl->zone_ = TimeZoneIf::Load(impl->name_);  // never fails
+    return impl;
+  }();
+  return utc_impl;
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_impl.h b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_impl.h
new file mode 100644
index 0000000000..7d747ba966
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_impl.h
@@ -0,0 +1,93 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IMPL_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IMPL_H_
+
+#include <memory>
+#include <string>
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+#include "time_zone_if.h"
+#include "time_zone_info.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// time_zone::Impl is the internal object referenced by a cctz::time_zone.
+class time_zone::Impl {
+ public:
+  // The UTC time zone. Also used for other time zones that fail to load.
+  static time_zone UTC();
+
+  // Load a named time zone. Returns false if the name is invalid, or if
+  // some other kind of error occurs. Note that loading "UTC" never fails.
+  static bool LoadTimeZone(const std::string& name, time_zone* tz);
+
+  // Clears the map of cached time zones.  Primarily for use in benchmarks
+  // that gauge the performance of loading/parsing the time-zone data.
+  static void ClearTimeZoneMapTestOnly();
+
+  // The primary key is the time-zone ID (e.g., "America/New_York").
+  const std::string& Name() const {
+    // TODO: It would nice if the zoneinfo data included the zone name.
+    return name_;
+  }
+
+  // Breaks a time_point down to civil-time components in this time zone.
+  time_zone::absolute_lookup BreakTime(const time_point<seconds>& tp) const {
+    return zone_->BreakTime(tp);
+  }
+
+  // Converts the civil-time components in this time zone into a time_point.
+  // That is, the opposite of BreakTime(). The requested civil time may be
+  // ambiguous or illegal due to a change of UTC offset.
+  time_zone::civil_lookup MakeTime(const civil_second& cs) const {
+    return zone_->MakeTime(cs);
+  }
+
+  // Finds the time of the next/previous offset change in this time zone.
+  bool NextTransition(const time_point<seconds>& tp,
+                      time_zone::civil_transition* trans) const {
+    return zone_->NextTransition(tp, trans);
+  }
+  bool PrevTransition(const time_point<seconds>& tp,
+                      time_zone::civil_transition* trans) const {
+    return zone_->PrevTransition(tp, trans);
+  }
+
+  // Returns an implementation-defined version string for this time zone.
+  std::string Version() const { return zone_->Version(); }
+
+  // Returns an implementation-defined description of this time zone.
+  std::string Description() const { return zone_->Description(); }
+
+ private:
+  explicit Impl(const std::string& name);
+  static const Impl* UTCImpl();
+
+  const std::string name_;
+  std::unique_ptr<TimeZoneIf> zone_;
+};
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_IMPL_H_
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_info.cc b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_info.cc
new file mode 100644
index 0000000000..665fb424fe
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_info.cc
@@ -0,0 +1,958 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+// This file implements the TimeZoneIf interface using the "zoneinfo"
+// data provided by the IANA Time Zone Database (i.e., the only real game
+// in town).
+//
+// TimeZoneInfo represents the history of UTC-offset changes within a time
+// zone. Most changes are due to daylight-saving rules, but occasionally
+// shifts are made to the time-zone's base offset. The database only attempts
+// to be definitive for times since 1970, so be wary of local-time conversions
+// before that. Also, rule and zone-boundary changes are made at the whim
+// of governments, so the conversion of future times needs to be taken with
+// a grain of salt.
+//
+// For more information see tzfile(5), http://www.iana.org/time-zones, or
+// https://en.wikipedia.org/wiki/Zoneinfo.
+//
+// Note that we assume the proleptic Gregorian calendar and 60-second
+// minutes throughout.
+
+#include "time_zone_info.h"
+
+#include <algorithm>
+#include <cassert>
+#include <chrono>
+#include <cstdint>
+#include <cstdio>
+#include <cstdlib>
+#include <cstring>
+#include <functional>
+#include <iostream>
+#include <memory>
+#include <sstream>
+#include <string>
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "time_zone_fixed.h"
+#include "time_zone_posix.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+inline bool IsLeap(year_t year) {
+  return (year % 4) == 0 && ((year % 100) != 0 || (year % 400) == 0);
+}
+
+// The number of days in non-leap and leap years respectively.
+const std::int_least32_t kDaysPerYear[2] = {365, 366};
+
+// The day offsets of the beginning of each (1-based) month in non-leap and
+// leap years respectively (e.g., 335 days before December in a leap year).
+const std::int_least16_t kMonthOffsets[2][1 + 12 + 1] = {
+    {-1, 0, 31, 59, 90, 120, 151, 181, 212, 243, 273, 304, 334, 365},
+    {-1, 0, 31, 60, 91, 121, 152, 182, 213, 244, 274, 305, 335, 366},
+};
+
+// We reject leap-second encoded zoneinfo and so assume 60-second minutes.
+const std::int_least32_t kSecsPerDay = 24 * 60 * 60;
+
+// 400-year chunks always have 146097 days (20871 weeks).
+const std::int_least64_t kSecsPer400Years = 146097LL * kSecsPerDay;
+
+// Like kDaysPerYear[] but scaled up by a factor of kSecsPerDay.
+const std::int_least32_t kSecsPerYear[2] = {
+    365 * kSecsPerDay,
+    366 * kSecsPerDay,
+};
+
+// Single-byte, unsigned numeric values are encoded directly.
+inline std::uint_fast8_t Decode8(const char* cp) {
+  return static_cast<std::uint_fast8_t>(*cp) & 0xff;
+}
+
+// Multi-byte, numeric values are encoded using a MSB first,
+// twos-complement representation. These helpers decode, from
+// the given address, 4-byte and 8-byte values respectively.
+// Note: If int_fastXX_t == intXX_t and this machine is not
+// twos complement, then there will be at least one input value
+// we cannot represent.
+std::int_fast32_t Decode32(const char* cp) {
+  std::uint_fast32_t v = 0;
+  for (int i = 0; i != (32 / 8); ++i) v = (v << 8) | Decode8(cp++);
+  const std::int_fast32_t s32max = 0x7fffffff;
+  const auto s32maxU = static_cast<std::uint_fast32_t>(s32max);
+  if (v <= s32maxU) return static_cast<std::int_fast32_t>(v);
+  return static_cast<std::int_fast32_t>(v - s32maxU - 1) - s32max - 1;
+}
+
+std::int_fast64_t Decode64(const char* cp) {
+  std::uint_fast64_t v = 0;
+  for (int i = 0; i != (64 / 8); ++i) v = (v << 8) | Decode8(cp++);
+  const std::int_fast64_t s64max = 0x7fffffffffffffff;
+  const auto s64maxU = static_cast<std::uint_fast64_t>(s64max);
+  if (v <= s64maxU) return static_cast<std::int_fast64_t>(v);
+  return static_cast<std::int_fast64_t>(v - s64maxU - 1) - s64max - 1;
+}
+
+// Generate a year-relative offset for a PosixTransition.
+std::int_fast64_t TransOffset(bool leap_year, int jan1_weekday,
+                              const PosixTransition& pt) {
+  std::int_fast64_t days = 0;
+  switch (pt.date.fmt) {
+    case PosixTransition::J: {
+      days = pt.date.j.day;
+      if (!leap_year || days < kMonthOffsets[1][3]) days -= 1;
+      break;
+    }
+    case PosixTransition::N: {
+      days = pt.date.n.day;
+      break;
+    }
+    case PosixTransition::M: {
+      const bool last_week = (pt.date.m.week == 5);
+      days = kMonthOffsets[leap_year][pt.date.m.month + last_week];
+      const std::int_fast64_t weekday = (jan1_weekday + days) % 7;
+      if (last_week) {
+        days -= (weekday + 7 - 1 - pt.date.m.weekday) % 7 + 1;
+      } else {
+        days += (pt.date.m.weekday + 7 - weekday) % 7;
+        days += (pt.date.m.week - 1) * 7;
+      }
+      break;
+    }
+  }
+  return (days * kSecsPerDay) + pt.time.offset;
+}
+
+inline time_zone::civil_lookup MakeUnique(const time_point<seconds>& tp) {
+  time_zone::civil_lookup cl;
+  cl.kind = time_zone::civil_lookup::UNIQUE;
+  cl.pre = cl.trans = cl.post = tp;
+  return cl;
+}
+
+inline time_zone::civil_lookup MakeUnique(std::int_fast64_t unix_time) {
+  return MakeUnique(FromUnixSeconds(unix_time));
+}
+
+inline time_zone::civil_lookup MakeSkipped(const Transition& tr,
+                                           const civil_second& cs) {
+  time_zone::civil_lookup cl;
+  cl.kind = time_zone::civil_lookup::SKIPPED;
+  cl.pre = FromUnixSeconds(tr.unix_time - 1 + (cs - tr.prev_civil_sec));
+  cl.trans = FromUnixSeconds(tr.unix_time);
+  cl.post = FromUnixSeconds(tr.unix_time - (tr.civil_sec - cs));
+  return cl;
+}
+
+inline time_zone::civil_lookup MakeRepeated(const Transition& tr,
+                                            const civil_second& cs) {
+  time_zone::civil_lookup cl;
+  cl.kind = time_zone::civil_lookup::REPEATED;
+  cl.pre = FromUnixSeconds(tr.unix_time - 1 - (tr.prev_civil_sec - cs));
+  cl.trans = FromUnixSeconds(tr.unix_time);
+  cl.post = FromUnixSeconds(tr.unix_time + (cs - tr.civil_sec));
+  return cl;
+}
+
+inline civil_second YearShift(const civil_second& cs, year_t shift) {
+  return civil_second(cs.year() + shift, cs.month(), cs.day(), cs.hour(),
+                      cs.minute(), cs.second());
+}
+
+}  // namespace
+
+// What (no leap-seconds) UTC+seconds zoneinfo would look like.
+bool TimeZoneInfo::ResetToBuiltinUTC(const seconds& offset) {
+  transition_types_.resize(1);
+  TransitionType& tt(transition_types_.back());
+  tt.utc_offset = static_cast<std::int_least32_t>(offset.count());
+  tt.is_dst = false;
+  tt.abbr_index = 0;
+
+  // We temporarily add some redundant, contemporary (2013 through 2023)
+  // transitions for performance reasons.  See TimeZoneInfo::LocalTime().
+  // TODO: Fix the performance issue and remove the extra transitions.
+  transitions_.clear();
+  transitions_.reserve(12);
+  for (const std::int_fast64_t unix_time : {
+           -(1LL << 59),  // BIG_BANG
+           1356998400LL,  // 2013-01-01T00:00:00+00:00
+           1388534400LL,  // 2014-01-01T00:00:00+00:00
+           1420070400LL,  // 2015-01-01T00:00:00+00:00
+           1451606400LL,  // 2016-01-01T00:00:00+00:00
+           1483228800LL,  // 2017-01-01T00:00:00+00:00
+           1514764800LL,  // 2018-01-01T00:00:00+00:00
+           1546300800LL,  // 2019-01-01T00:00:00+00:00
+           1577836800LL,  // 2020-01-01T00:00:00+00:00
+           1609459200LL,  // 2021-01-01T00:00:00+00:00
+           1640995200LL,  // 2022-01-01T00:00:00+00:00
+           1672531200LL,  // 2023-01-01T00:00:00+00:00
+           2147483647LL,  // 2^31 - 1
+       }) {
+    Transition& tr(*transitions_.emplace(transitions_.end()));
+    tr.unix_time = unix_time;
+    tr.type_index = 0;
+    tr.civil_sec = LocalTime(tr.unix_time, tt).cs;
+    tr.prev_civil_sec = tr.civil_sec - 1;
+  }
+
+  default_transition_type_ = 0;
+  abbreviations_ = FixedOffsetToAbbr(offset);
+  abbreviations_.append(1, '\0');  // add NUL
+  future_spec_.clear();            // never needed for a fixed-offset zone
+  extended_ = false;
+
+  tt.civil_max = LocalTime(seconds::max().count(), tt).cs;
+  tt.civil_min = LocalTime(seconds::min().count(), tt).cs;
+
+  transitions_.shrink_to_fit();
+  return true;
+}
+
+// Builds the in-memory header using the raw bytes from the file.
+bool TimeZoneInfo::Header::Build(const tzhead& tzh) {
+  std::int_fast32_t v;
+  if ((v = Decode32(tzh.tzh_timecnt)) < 0) return false;
+  timecnt = static_cast<std::size_t>(v);
+  if ((v = Decode32(tzh.tzh_typecnt)) < 0) return false;
+  typecnt = static_cast<std::size_t>(v);
+  if ((v = Decode32(tzh.tzh_charcnt)) < 0) return false;
+  charcnt = static_cast<std::size_t>(v);
+  if ((v = Decode32(tzh.tzh_leapcnt)) < 0) return false;
+  leapcnt = static_cast<std::size_t>(v);
+  if ((v = Decode32(tzh.tzh_ttisstdcnt)) < 0) return false;
+  ttisstdcnt = static_cast<std::size_t>(v);
+  if ((v = Decode32(tzh.tzh_ttisutcnt)) < 0) return false;
+  ttisutcnt = static_cast<std::size_t>(v);
+  return true;
+}
+
+// How many bytes of data are associated with this header. The result
+// depends upon whether this is a section with 4-byte or 8-byte times.
+std::size_t TimeZoneInfo::Header::DataLength(std::size_t time_len) const {
+  std::size_t len = 0;
+  len += (time_len + 1) * timecnt;  // unix_time + type_index
+  len += (4 + 1 + 1) * typecnt;     // utc_offset + is_dst + abbr_index
+  len += 1 * charcnt;               // abbreviations
+  len += (time_len + 4) * leapcnt;  // leap-time + TAI-UTC
+  len += 1 * ttisstdcnt;            // UTC/local indicators
+  len += 1 * ttisutcnt;             // standard/wall indicators
+  return len;
+}
+
+// Check that the TransitionType has the expected offset/is_dst/abbreviation.
+void TimeZoneInfo::CheckTransition(const std::string& name,
+                                   const TransitionType& tt,
+                                   std::int_fast32_t offset, bool is_dst,
+                                   const std::string& abbr) const {
+  if (tt.utc_offset != offset || tt.is_dst != is_dst ||
+      &abbreviations_[tt.abbr_index] != abbr) {
+    std::clog << name << ": Transition"
+              << " offset=" << tt.utc_offset << "/"
+              << (tt.is_dst ? "DST" : "STD")
+              << "/abbr=" << &abbreviations_[tt.abbr_index]
+              << " does not match POSIX spec '" << future_spec_ << "'\n";
+  }
+}
+
+// zic(8) can generate no-op transitions when a zone changes rules at an
+// instant when there is actually no discontinuity.  So we check whether
+// two transitions have equivalent types (same offset/is_dst/abbr).
+bool TimeZoneInfo::EquivTransitions(std::uint_fast8_t tt1_index,
+                                    std::uint_fast8_t tt2_index) const {
+  if (tt1_index == tt2_index) return true;
+  const TransitionType& tt1(transition_types_[tt1_index]);
+  const TransitionType& tt2(transition_types_[tt2_index]);
+  if (tt1.is_dst != tt2.is_dst) return false;
+  if (tt1.utc_offset != tt2.utc_offset) return false;
+  if (tt1.abbr_index != tt2.abbr_index) return false;
+  return true;
+}
+
+// Use the POSIX-TZ-environment-variable-style string to handle times
+// in years after the last transition stored in the zoneinfo data.
+void TimeZoneInfo::ExtendTransitions(const std::string& name,
+                                     const Header& hdr) {
+  extended_ = false;
+  bool extending = !future_spec_.empty();
+
+  PosixTimeZone posix;
+  if (extending && !ParsePosixSpec(future_spec_, &posix)) {
+    std::clog << name << ": Failed to parse '" << future_spec_ << "'\n";
+    extending = false;
+  }
+
+  if (extending && posix.dst_abbr.empty()) {  // std only
+    // The future specification should match the last/default transition,
+    // and that means that handling the future will fall out naturally.
+    std::uint_fast8_t index = default_transition_type_;
+    if (hdr.timecnt != 0) index = transitions_[hdr.timecnt - 1].type_index;
+    const TransitionType& tt(transition_types_[index]);
+    CheckTransition(name, tt, posix.std_offset, false, posix.std_abbr);
+    extending = false;
+  }
+
+  if (extending && hdr.timecnt < 2) {
+    std::clog << name << ": Too few transitions for POSIX spec\n";
+    extending = false;
+  }
+
+  if (!extending) {
+    // Ensure that there is always a transition in the second half of the
+    // time line (the BIG_BANG transition is in the first half) so that the
+    // signed difference between a civil_second and the civil_second of its
+    // previous transition is always representable, without overflow.
+    const Transition& last(transitions_.back());
+    if (last.unix_time < 0) {
+      const std::uint_fast8_t type_index = last.type_index;
+      Transition& tr(*transitions_.emplace(transitions_.end()));
+      tr.unix_time = 2147483647;  // 2038-01-19T03:14:07+00:00
+      tr.type_index = type_index;
+    }
+    return;  // last transition wins
+  }
+
+  // Extend the transitions for an additional 400 years using the
+  // future specification. Years beyond those can be handled by
+  // mapping back to a cycle-equivalent year within that range.
+  // zic(8) should probably do this so that we don't have to.
+  // TODO: Reduce the extension by the number of compatible
+  // transitions already in place.
+  transitions_.reserve(hdr.timecnt + 400 * 2 + 1);
+  transitions_.resize(hdr.timecnt + 400 * 2);
+  extended_ = true;
+
+  // The future specification should match the last two transitions,
+  // and those transitions should have different is_dst flags.  Note
+  // that nothing says the UTC offset used by the is_dst transition
+  // must be greater than that used by the !is_dst transition.  (See
+  // Europe/Dublin, for example.)
+  const Transition* tr0 = &transitions_[hdr.timecnt - 1];
+  const Transition* tr1 = &transitions_[hdr.timecnt - 2];
+  const TransitionType* tt0 = &transition_types_[tr0->type_index];
+  const TransitionType* tt1 = &transition_types_[tr1->type_index];
+  const TransitionType& dst(tt0->is_dst ? *tt0 : *tt1);
+  const TransitionType& std(tt0->is_dst ? *tt1 : *tt0);
+  CheckTransition(name, dst, posix.dst_offset, true, posix.dst_abbr);
+  CheckTransition(name, std, posix.std_offset, false, posix.std_abbr);
+
+  // Add the transitions to tr1 and back to tr0 for each extra year.
+  last_year_ = LocalTime(tr0->unix_time, *tt0).cs.year();
+  bool leap_year = IsLeap(last_year_);
+  const civil_day jan1(last_year_, 1, 1);
+  std::int_fast64_t jan1_time = civil_second(jan1) - civil_second();
+  int jan1_weekday = (static_cast<int>(get_weekday(jan1)) + 1) % 7;
+  Transition* tr = &transitions_[hdr.timecnt];  // next trans to fill
+  if (LocalTime(tr1->unix_time, *tt1).cs.year() != last_year_) {
+    // Add a single extra transition to align to a calendar year.
+    transitions_.resize(transitions_.size() + 1);
+    assert(tr == &transitions_[hdr.timecnt]);  // no reallocation
+    const PosixTransition& pt1(tt0->is_dst ? posix.dst_end : posix.dst_start);
+    std::int_fast64_t tr1_offset = TransOffset(leap_year, jan1_weekday, pt1);
+    tr->unix_time = jan1_time + tr1_offset - tt0->utc_offset;
+    tr++->type_index = tr1->type_index;
+    tr0 = &transitions_[hdr.timecnt];
+    tr1 = &transitions_[hdr.timecnt - 1];
+    tt0 = &transition_types_[tr0->type_index];
+    tt1 = &transition_types_[tr1->type_index];
+  }
+  const PosixTransition& pt1(tt0->is_dst ? posix.dst_end : posix.dst_start);
+  const PosixTransition& pt0(tt0->is_dst ? posix.dst_start : posix.dst_end);
+  for (const year_t limit = last_year_ + 400; last_year_ < limit;) {
+    last_year_ += 1;  // an additional year of generated transitions
+    jan1_time += kSecsPerYear[leap_year];
+    jan1_weekday = (jan1_weekday + kDaysPerYear[leap_year]) % 7;
+    leap_year = !leap_year && IsLeap(last_year_);
+    std::int_fast64_t tr1_offset = TransOffset(leap_year, jan1_weekday, pt1);
+    tr->unix_time = jan1_time + tr1_offset - tt0->utc_offset;
+    tr++->type_index = tr1->type_index;
+    std::int_fast64_t tr0_offset = TransOffset(leap_year, jan1_weekday, pt0);
+    tr->unix_time = jan1_time + tr0_offset - tt1->utc_offset;
+    tr++->type_index = tr0->type_index;
+  }
+  assert(tr == &transitions_[0] + transitions_.size());
+}
+
+bool TimeZoneInfo::Load(const std::string& name, ZoneInfoSource* zip) {
+  // Read and validate the header.
+  tzhead tzh;
+  if (zip->Read(&tzh, sizeof(tzh)) != sizeof(tzh)) return false;
+  if (strncmp(tzh.tzh_magic, TZ_MAGIC, sizeof(tzh.tzh_magic)) != 0)
+    return false;
+  Header hdr;
+  if (!hdr.Build(tzh)) return false;
+  std::size_t time_len = 4;
+  if (tzh.tzh_version[0] != '\0') {
+    // Skip the 4-byte data.
+    if (zip->Skip(hdr.DataLength(time_len)) != 0) return false;
+    // Read and validate the header for the 8-byte data.
+    if (zip->Read(&tzh, sizeof(tzh)) != sizeof(tzh)) return false;
+    if (strncmp(tzh.tzh_magic, TZ_MAGIC, sizeof(tzh.tzh_magic)) != 0)
+      return false;
+    if (tzh.tzh_version[0] == '\0') return false;
+    if (!hdr.Build(tzh)) return false;
+    time_len = 8;
+  }
+  if (hdr.typecnt == 0) return false;
+  if (hdr.leapcnt != 0) {
+    // This code assumes 60-second minutes so we do not want
+    // the leap-second encoded zoneinfo. We could reverse the
+    // compensation, but the "right" encoding is rarely used
+    // so currently we simply reject such data.
+    return false;
+  }
+  if (hdr.ttisstdcnt != 0 && hdr.ttisstdcnt != hdr.typecnt) return false;
+  if (hdr.ttisutcnt != 0 && hdr.ttisutcnt != hdr.typecnt) return false;
+
+  // Read the data into a local buffer.
+  std::size_t len = hdr.DataLength(time_len);
+  std::vector<char> tbuf(len);
+  if (zip->Read(tbuf.data(), len) != len) return false;
+  const char* bp = tbuf.data();
+
+  // Decode and validate the transitions.
+  transitions_.reserve(hdr.timecnt + 2);  // We might add a couple.
+  transitions_.resize(hdr.timecnt);
+  for (std::size_t i = 0; i != hdr.timecnt; ++i) {
+    transitions_[i].unix_time = (time_len == 4) ? Decode32(bp) : Decode64(bp);
+    bp += time_len;
+    if (i != 0) {
+      // Check that the transitions are ordered by time (as zic guarantees).
+      if (!Transition::ByUnixTime()(transitions_[i - 1], transitions_[i]))
+        return false;  // out of order
+    }
+  }
+  bool seen_type_0 = false;
+  for (std::size_t i = 0; i != hdr.timecnt; ++i) {
+    transitions_[i].type_index = Decode8(bp++);
+    if (transitions_[i].type_index >= hdr.typecnt) return false;
+    if (transitions_[i].type_index == 0) seen_type_0 = true;
+  }
+
+  // Decode and validate the transition types.
+  transition_types_.resize(hdr.typecnt);
+  for (std::size_t i = 0; i != hdr.typecnt; ++i) {
+    transition_types_[i].utc_offset =
+        static_cast<std::int_least32_t>(Decode32(bp));
+    if (transition_types_[i].utc_offset >= kSecsPerDay ||
+        transition_types_[i].utc_offset <= -kSecsPerDay)
+      return false;
+    bp += 4;
+    transition_types_[i].is_dst = (Decode8(bp++) != 0);
+    transition_types_[i].abbr_index = Decode8(bp++);
+    if (transition_types_[i].abbr_index >= hdr.charcnt) return false;
+  }
+
+  // Determine the before-first-transition type.
+  default_transition_type_ = 0;
+  if (seen_type_0 && hdr.timecnt != 0) {
+    std::uint_fast8_t index = 0;
+    if (transition_types_[0].is_dst) {
+      index = transitions_[0].type_index;
+      while (index != 0 && transition_types_[index].is_dst) --index;
+    }
+    while (index != hdr.typecnt && transition_types_[index].is_dst) ++index;
+    if (index != hdr.typecnt) default_transition_type_ = index;
+  }
+
+  // Copy all the abbreviations.
+  abbreviations_.assign(bp, hdr.charcnt);
+  bp += hdr.charcnt;
+
+  // Skip the unused portions. We've already dispensed with leap-second
+  // encoded zoneinfo. The ttisstd/ttisgmt indicators only apply when
+  // interpreting a POSIX spec that does not include start/end rules, and
+  // that isn't the case here (see "zic -p").
+  bp += (8 + 4) * hdr.leapcnt;  // leap-time + TAI-UTC
+  bp += 1 * hdr.ttisstdcnt;     // UTC/local indicators
+  bp += 1 * hdr.ttisutcnt;      // standard/wall indicators
+  assert(bp == tbuf.data() + tbuf.size());
+
+  future_spec_.clear();
+  if (tzh.tzh_version[0] != '\0') {
+    // Snarf up the NL-enclosed future POSIX spec. Note
+    // that version '3' files utilize an extended format.
+    auto get_char = [](ZoneInfoSource* azip) -> int {
+      unsigned char ch;  // all non-EOF results are positive
+      return (azip->Read(&ch, 1) == 1) ? ch : EOF;
+    };
+    if (get_char(zip) != '\n') return false;
+    for (int c = get_char(zip); c != '\n'; c = get_char(zip)) {
+      if (c == EOF) return false;
+      future_spec_.push_back(static_cast<char>(c));
+    }
+  }
+
+  // We don't check for EOF so that we're forwards compatible.
+
+  // If we did not find version information during the standard loading
+  // process (as of tzh_version '3' that is unsupported), then ask the
+  // ZoneInfoSource for any out-of-bound version string it may be privy to.
+  if (version_.empty()) {
+    version_ = zip->Version();
+  }
+
+  // Trim redundant transitions. zic may have added these to work around
+  // differences between the glibc and reference implementations (see
+  // zic.c:dontmerge) and the Qt library (see zic.c:WORK_AROUND_QTBUG_53071).
+  // For us, they just get in the way when we do future_spec_ extension.
+  while (hdr.timecnt > 1) {
+    if (!EquivTransitions(transitions_[hdr.timecnt - 1].type_index,
+                          transitions_[hdr.timecnt - 2].type_index)) {
+      break;
+    }
+    hdr.timecnt -= 1;
+  }
+  transitions_.resize(hdr.timecnt);
+
+  // Ensure that there is always a transition in the first half of the
+  // time line (the second half is handled in ExtendTransitions()) so that
+  // the signed difference between a civil_second and the civil_second of
+  // its previous transition is always representable, without overflow.
+  // A contemporary zic will usually have already done this for us.
+  if (transitions_.empty() || transitions_.front().unix_time >= 0) {
+    Transition& tr(*transitions_.emplace(transitions_.begin()));
+    tr.unix_time = -(1LL << 59);  // see tz/zic.c "BIG_BANG"
+    tr.type_index = default_transition_type_;
+    hdr.timecnt += 1;
+  }
+
+  // Extend the transitions using the future specification.
+  ExtendTransitions(name, hdr);
+
+  // Compute the local civil time for each transition and the preceding
+  // second. These will be used for reverse conversions in MakeTime().
+  const TransitionType* ttp = &transition_types_[default_transition_type_];
+  for (std::size_t i = 0; i != transitions_.size(); ++i) {
+    Transition& tr(transitions_[i]);
+    tr.prev_civil_sec = LocalTime(tr.unix_time, *ttp).cs - 1;
+    ttp = &transition_types_[tr.type_index];
+    tr.civil_sec = LocalTime(tr.unix_time, *ttp).cs;
+    if (i != 0) {
+      // Check that the transitions are ordered by civil time. Essentially
+      // this means that an offset change cannot cross another such change.
+      // No one does this in practice, and we depend on it in MakeTime().
+      if (!Transition::ByCivilTime()(transitions_[i - 1], tr))
+        return false;  // out of order
+    }
+  }
+
+  // Compute the maximum/minimum civil times that can be converted to a
+  // time_point<seconds> for each of the zone's transition types.
+  for (auto& tt : transition_types_) {
+    tt.civil_max = LocalTime(seconds::max().count(), tt).cs;
+    tt.civil_min = LocalTime(seconds::min().count(), tt).cs;
+  }
+
+  transitions_.shrink_to_fit();
+  return true;
+}
+
+namespace {
+
+// fopen(3) adaptor.
+inline FILE* FOpen(const char* path, const char* mode) {
+#if defined(_MSC_VER)
+  FILE* fp;
+  if (fopen_s(&fp, path, mode) != 0) fp = nullptr;
+  return fp;
+#else
+  return fopen(path, mode);  // TODO: Enable the close-on-exec flag.
+#endif
+}
+
+// A stdio(3)-backed implementation of ZoneInfoSource.
+class FileZoneInfoSource : public ZoneInfoSource {
+ public:
+  static std::unique_ptr<ZoneInfoSource> Open(const std::string& name);
+
+  std::size_t Read(void* ptr, std::size_t size) override {
+    size = std::min(size, len_);
+    std::size_t nread = fread(ptr, 1, size, fp_.get());
+    len_ -= nread;
+    return nread;
+  }
+  int Skip(std::size_t offset) override {
+    offset = std::min(offset, len_);
+    int rc = fseek(fp_.get(), static_cast<long>(offset), SEEK_CUR);
+    if (rc == 0) len_ -= offset;
+    return rc;
+  }
+  std::string Version() const override {
+    // TODO: It would nice if the zoneinfo data included the tzdb version.
+    return std::string();
+  }
+
+ protected:
+  explicit FileZoneInfoSource(
+      FILE* fp, std::size_t len = std::numeric_limits<std::size_t>::max())
+      : fp_(fp, fclose), len_(len) {}
+
+ private:
+  std::unique_ptr<FILE, int (*)(FILE*)> fp_;
+  std::size_t len_;
+};
+
+std::unique_ptr<ZoneInfoSource> FileZoneInfoSource::Open(
+    const std::string& name) {
+  // Use of the "file:" prefix is intended for testing purposes only.
+  const std::size_t pos = (name.compare(0, 5, "file:") == 0) ? 5 : 0;
+
+  // Map the time-zone name to a path name.
+  std::string path;
+  if (pos == name.size() || name[pos] != '/') {
+    const char* tzdir = "/usr/share/zoneinfo";
+    char* tzdir_env = nullptr;
+#if defined(_MSC_VER)
+    _dupenv_s(&tzdir_env, nullptr, "TZDIR");
+#else
+    tzdir_env = std::getenv("TZDIR");
+#endif
+    if (tzdir_env && *tzdir_env) tzdir = tzdir_env;
+    path += tzdir;
+    path += '/';
+#if defined(_MSC_VER)
+    free(tzdir_env);
+#endif
+  }
+  path.append(name, pos, std::string::npos);
+
+  // Open the zoneinfo file.
+  FILE* fp = FOpen(path.c_str(), "rb");
+  if (fp == nullptr) return nullptr;
+  std::size_t length = 0;
+  if (fseek(fp, 0, SEEK_END) == 0) {
+    long offset = ftell(fp);
+    if (offset >= 0) {
+      length = static_cast<std::size_t>(offset);
+    }
+    rewind(fp);
+  }
+  return std::unique_ptr<ZoneInfoSource>(new FileZoneInfoSource(fp, length));
+}
+
+class AndroidZoneInfoSource : public FileZoneInfoSource {
+ public:
+  static std::unique_ptr<ZoneInfoSource> Open(const std::string& name);
+  std::string Version() const override { return version_; }
+
+ private:
+  explicit AndroidZoneInfoSource(FILE* fp, std::size_t len, const char* vers)
+      : FileZoneInfoSource(fp, len), version_(vers) {}
+  std::string version_;
+};
+
+std::unique_ptr<ZoneInfoSource> AndroidZoneInfoSource::Open(
+    const std::string& name) {
+  // Use of the "file:" prefix is intended for testing purposes only.
+  const std::size_t pos = (name.compare(0, 5, "file:") == 0) ? 5 : 0;
+
+  // See Android's libc/tzcode/bionic.cpp for additional information.
+  for (const char* tzdata : {"/data/misc/zoneinfo/current/tzdata",
+                             "/system/usr/share/zoneinfo/tzdata"}) {
+    std::unique_ptr<FILE, int (*)(FILE*)> fp(FOpen(tzdata, "rb"), fclose);
+    if (fp.get() == nullptr) continue;
+
+    char hbuf[24];  // covers header.zonetab_offset too
+    if (fread(hbuf, 1, sizeof(hbuf), fp.get()) != sizeof(hbuf)) continue;
+    if (strncmp(hbuf, "tzdata", 6) != 0) continue;
+    const char* vers = (hbuf[11] == '\0') ? hbuf + 6 : "";
+    const std::int_fast32_t index_offset = Decode32(hbuf + 12);
+    const std::int_fast32_t data_offset = Decode32(hbuf + 16);
+    if (index_offset < 0 || data_offset < index_offset) continue;
+    if (fseek(fp.get(), static_cast<long>(index_offset), SEEK_SET) != 0)
+      continue;
+
+    char ebuf[52];  // covers entry.unused too
+    const std::size_t index_size =
+        static_cast<std::size_t>(data_offset - index_offset);
+    const std::size_t zonecnt = index_size / sizeof(ebuf);
+    if (zonecnt * sizeof(ebuf) != index_size) continue;
+    for (std::size_t i = 0; i != zonecnt; ++i) {
+      if (fread(ebuf, 1, sizeof(ebuf), fp.get()) != sizeof(ebuf)) break;
+      const std::int_fast32_t start = data_offset + Decode32(ebuf + 40);
+      const std::int_fast32_t length = Decode32(ebuf + 44);
+      if (start < 0 || length < 0) break;
+      ebuf[40] = '\0';  // ensure zone name is NUL terminated
+      if (strcmp(name.c_str() + pos, ebuf) == 0) {
+        if (fseek(fp.get(), static_cast<long>(start), SEEK_SET) != 0) break;
+        return std::unique_ptr<ZoneInfoSource>(new AndroidZoneInfoSource(
+            fp.release(), static_cast<std::size_t>(length), vers));
+      }
+    }
+  }
+
+  return nullptr;
+}
+
+}  // namespace
+
+bool TimeZoneInfo::Load(const std::string& name) {
+  // We can ensure that the loading of UTC or any other fixed-offset
+  // zone never fails because the simple, fixed-offset state can be
+  // internally generated. Note that this depends on our choice to not
+  // accept leap-second encoded ("right") zoneinfo.
+  auto offset = seconds::zero();
+  if (FixedOffsetFromName(name, &offset)) {
+    return ResetToBuiltinUTC(offset);
+  }
+
+  // Find and use a ZoneInfoSource to load the named zone.
+  auto zip = cctz_extension::zone_info_source_factory(
+      name, [](const std::string& name) -> std::unique_ptr<ZoneInfoSource> {
+        if (auto zip = FileZoneInfoSource::Open(name)) return zip;
+        if (auto zip = AndroidZoneInfoSource::Open(name)) return zip;
+        return nullptr;
+      });
+  return zip != nullptr && Load(name, zip.get());
+}
+
+// BreakTime() translation for a particular transition type.
+time_zone::absolute_lookup TimeZoneInfo::LocalTime(
+    std::int_fast64_t unix_time, const TransitionType& tt) const {
+  // A civil time in "+offset" looks like (time+offset) in UTC.
+  // Note: We perform two additions in the civil_second domain to
+  // sidestep the chance of overflow in (unix_time + tt.utc_offset).
+  return {(civil_second() + unix_time) + tt.utc_offset, tt.utc_offset,
+          tt.is_dst, &abbreviations_[tt.abbr_index]};
+}
+
+// BreakTime() translation for a particular transition.
+time_zone::absolute_lookup TimeZoneInfo::LocalTime(std::int_fast64_t unix_time,
+                                                   const Transition& tr) const {
+  const TransitionType& tt = transition_types_[tr.type_index];
+  // Note: (unix_time - tr.unix_time) will never overflow as we
+  // have ensured that there is always a "nearby" transition.
+  return {tr.civil_sec + (unix_time - tr.unix_time),  // TODO: Optimize.
+          tt.utc_offset, tt.is_dst, &abbreviations_[tt.abbr_index]};
+}
+
+// MakeTime() translation with a conversion-preserving +N * 400-year shift.
+time_zone::civil_lookup TimeZoneInfo::TimeLocal(const civil_second& cs,
+                                                year_t c4_shift) const {
+  assert(last_year_ - 400 < cs.year() && cs.year() <= last_year_);
+  time_zone::civil_lookup cl = MakeTime(cs);
+  if (c4_shift > seconds::max().count() / kSecsPer400Years) {
+    cl.pre = cl.trans = cl.post = time_point<seconds>::max();
+  } else {
+    const auto offset = seconds(c4_shift * kSecsPer400Years);
+    const auto limit = time_point<seconds>::max() - offset;
+    for (auto* tp : {&cl.pre, &cl.trans, &cl.post}) {
+      if (*tp > limit) {
+        *tp = time_point<seconds>::max();
+      } else {
+        *tp += offset;
+      }
+    }
+  }
+  return cl;
+}
+
+time_zone::absolute_lookup TimeZoneInfo::BreakTime(
+    const time_point<seconds>& tp) const {
+  std::int_fast64_t unix_time = ToUnixSeconds(tp);
+  const std::size_t timecnt = transitions_.size();
+  assert(timecnt != 0);  // We always add a transition.
+
+  if (unix_time < transitions_[0].unix_time) {
+    return LocalTime(unix_time, transition_types_[default_transition_type_]);
+  }
+  if (unix_time >= transitions_[timecnt - 1].unix_time) {
+    // After the last transition. If we extended the transitions using
+    // future_spec_, shift back to a supported year using the 400-year
+    // cycle of calendaric equivalence and then compensate accordingly.
+    if (extended_) {
+      const std::int_fast64_t diff =
+          unix_time - transitions_[timecnt - 1].unix_time;
+      const year_t shift = diff / kSecsPer400Years + 1;
+      const auto d = seconds(shift * kSecsPer400Years);
+      time_zone::absolute_lookup al = BreakTime(tp - d);
+      al.cs = YearShift(al.cs, shift * 400);
+      return al;
+    }
+    return LocalTime(unix_time, transitions_[timecnt - 1]);
+  }
+
+  const std::size_t hint = local_time_hint_.load(std::memory_order_relaxed);
+  if (0 < hint && hint < timecnt) {
+    if (transitions_[hint - 1].unix_time <= unix_time) {
+      if (unix_time < transitions_[hint].unix_time) {
+        return LocalTime(unix_time, transitions_[hint - 1]);
+      }
+    }
+  }
+
+  const Transition target = {unix_time, 0, civil_second(), civil_second()};
+  const Transition* begin = &transitions_[0];
+  const Transition* tr = std::upper_bound(begin, begin + timecnt, target,
+                                          Transition::ByUnixTime());
+  local_time_hint_.store(static_cast<std::size_t>(tr - begin),
+                         std::memory_order_relaxed);
+  return LocalTime(unix_time, *--tr);
+}
+
+time_zone::civil_lookup TimeZoneInfo::MakeTime(const civil_second& cs) const {
+  const std::size_t timecnt = transitions_.size();
+  assert(timecnt != 0);  // We always add a transition.
+
+  // Find the first transition after our target civil time.
+  const Transition* tr = nullptr;
+  const Transition* begin = &transitions_[0];
+  const Transition* end = begin + timecnt;
+  if (cs < begin->civil_sec) {
+    tr = begin;
+  } else if (cs >= transitions_[timecnt - 1].civil_sec) {
+    tr = end;
+  } else {
+    const std::size_t hint = time_local_hint_.load(std::memory_order_relaxed);
+    if (0 < hint && hint < timecnt) {
+      if (transitions_[hint - 1].civil_sec <= cs) {
+        if (cs < transitions_[hint].civil_sec) {
+          tr = begin + hint;
+        }
+      }
+    }
+    if (tr == nullptr) {
+      const Transition target = {0, 0, cs, civil_second()};
+      tr = std::upper_bound(begin, end, target, Transition::ByCivilTime());
+      time_local_hint_.store(static_cast<std::size_t>(tr - begin),
+                             std::memory_order_relaxed);
+    }
+  }
+
+  if (tr == begin) {
+    if (tr->prev_civil_sec >= cs) {
+      // Before first transition, so use the default offset.
+      const TransitionType& tt(transition_types_[default_transition_type_]);
+      if (cs < tt.civil_min) return MakeUnique(time_point<seconds>::min());
+      return MakeUnique(cs - (civil_second() + tt.utc_offset));
+    }
+    // tr->prev_civil_sec < cs < tr->civil_sec
+    return MakeSkipped(*tr, cs);
+  }
+
+  if (tr == end) {
+    if (cs > (--tr)->prev_civil_sec) {
+      // After the last transition. If we extended the transitions using
+      // future_spec_, shift back to a supported year using the 400-year
+      // cycle of calendaric equivalence and then compensate accordingly.
+      if (extended_ && cs.year() > last_year_) {
+        const year_t shift = (cs.year() - last_year_ - 1) / 400 + 1;
+        return TimeLocal(YearShift(cs, shift * -400), shift);
+      }
+      const TransitionType& tt(transition_types_[tr->type_index]);
+      if (cs > tt.civil_max) return MakeUnique(time_point<seconds>::max());
+      return MakeUnique(tr->unix_time + (cs - tr->civil_sec));
+    }
+    // tr->civil_sec <= cs <= tr->prev_civil_sec
+    return MakeRepeated(*tr, cs);
+  }
+
+  if (tr->prev_civil_sec < cs) {
+    // tr->prev_civil_sec < cs < tr->civil_sec
+    return MakeSkipped(*tr, cs);
+  }
+
+  if (cs <= (--tr)->prev_civil_sec) {
+    // tr->civil_sec <= cs <= tr->prev_civil_sec
+    return MakeRepeated(*tr, cs);
+  }
+
+  // In between transitions.
+  return MakeUnique(tr->unix_time + (cs - tr->civil_sec));
+}
+
+std::string TimeZoneInfo::Version() const { return version_; }
+
+std::string TimeZoneInfo::Description() const {
+  std::ostringstream oss;
+  oss << "#trans=" << transitions_.size();
+  oss << " #types=" << transition_types_.size();
+  oss << " spec='" << future_spec_ << "'";
+  return oss.str();
+}
+
+bool TimeZoneInfo::NextTransition(const time_point<seconds>& tp,
+                                  time_zone::civil_transition* trans) const {
+  if (transitions_.empty()) return false;
+  const Transition* begin = &transitions_[0];
+  const Transition* end = begin + transitions_.size();
+  if (begin->unix_time <= -(1LL << 59)) {
+    // Do not report the BIG_BANG found in recent zoneinfo data as it is
+    // really a sentinel, not a transition.  See tz/zic.c.
+    ++begin;
+  }
+  std::int_fast64_t unix_time = ToUnixSeconds(tp);
+  const Transition target = {unix_time, 0, civil_second(), civil_second()};
+  const Transition* tr =
+      std::upper_bound(begin, end, target, Transition::ByUnixTime());
+  for (; tr != end; ++tr) {  // skip no-op transitions
+    std::uint_fast8_t prev_type_index =
+        (tr == begin) ? default_transition_type_ : tr[-1].type_index;
+    if (!EquivTransitions(prev_type_index, tr[0].type_index)) break;
+  }
+  // When tr == end we return false, ignoring future_spec_.
+  if (tr == end) return false;
+  trans->from = tr->prev_civil_sec + 1;
+  trans->to = tr->civil_sec;
+  return true;
+}
+
+bool TimeZoneInfo::PrevTransition(const time_point<seconds>& tp,
+                                  time_zone::civil_transition* trans) const {
+  if (transitions_.empty()) return false;
+  const Transition* begin = &transitions_[0];
+  const Transition* end = begin + transitions_.size();
+  if (begin->unix_time <= -(1LL << 59)) {
+    // Do not report the BIG_BANG found in recent zoneinfo data as it is
+    // really a sentinel, not a transition.  See tz/zic.c.
+    ++begin;
+  }
+  std::int_fast64_t unix_time = ToUnixSeconds(tp);
+  if (FromUnixSeconds(unix_time) != tp) {
+    if (unix_time == std::numeric_limits<std::int_fast64_t>::max()) {
+      if (end == begin) return false;  // Ignore future_spec_.
+      trans->from = (--end)->prev_civil_sec + 1;
+      trans->to = end->civil_sec;
+      return true;
+    }
+    unix_time += 1;  // ceils
+  }
+  const Transition target = {unix_time, 0, civil_second(), civil_second()};
+  const Transition* tr =
+      std::lower_bound(begin, end, target, Transition::ByUnixTime());
+  for (; tr != begin; --tr) {  // skip no-op transitions
+    std::uint_fast8_t prev_type_index =
+        (tr - 1 == begin) ? default_transition_type_ : tr[-2].type_index;
+    if (!EquivTransitions(prev_type_index, tr[-1].type_index)) break;
+  }
+  // When tr == end we return the "last" transition, ignoring future_spec_.
+  if (tr == begin) return false;
+  trans->from = (--tr)->prev_civil_sec + 1;
+  trans->to = tr->civil_sec;
+  return true;
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_info.h b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_info.h
new file mode 100644
index 0000000000..2a10c06c77
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_info.h
@@ -0,0 +1,138 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_INFO_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_INFO_H_
+
+#include <atomic>
+#include <cstddef>
+#include <cstdint>
+#include <string>
+#include <vector>
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+#include "absl/time/internal/cctz/include/cctz/zone_info_source.h"
+#include "time_zone_if.h"
+#include "tzfile.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// A transition to a new UTC offset.
+struct Transition {
+  std::int_least64_t unix_time;   // the instant of this transition
+  std::uint_least8_t type_index;  // index of the transition type
+  civil_second civil_sec;         // local civil time of transition
+  civil_second prev_civil_sec;    // local civil time one second earlier
+
+  struct ByUnixTime {
+    inline bool operator()(const Transition& lhs, const Transition& rhs) const {
+      return lhs.unix_time < rhs.unix_time;
+    }
+  };
+  struct ByCivilTime {
+    inline bool operator()(const Transition& lhs, const Transition& rhs) const {
+      return lhs.civil_sec < rhs.civil_sec;
+    }
+  };
+};
+
+// The characteristics of a particular transition.
+struct TransitionType {
+  std::int_least32_t utc_offset;  // the new prevailing UTC offset
+  civil_second civil_max;         // max convertible civil time for offset
+  civil_second civil_min;         // min convertible civil time for offset
+  bool is_dst;                    // did we move into daylight-saving time
+  std::uint_least8_t abbr_index;  // index of the new abbreviation
+};
+
+// A time zone backed by the IANA Time Zone Database (zoneinfo).
+class TimeZoneInfo : public TimeZoneIf {
+ public:
+  TimeZoneInfo() = default;
+  TimeZoneInfo(const TimeZoneInfo&) = delete;
+  TimeZoneInfo& operator=(const TimeZoneInfo&) = delete;
+
+  // Loads the zoneinfo for the given name, returning true if successful.
+  bool Load(const std::string& name);
+
+  // TimeZoneIf implementations.
+  time_zone::absolute_lookup BreakTime(
+      const time_point<seconds>& tp) const override;
+  time_zone::civil_lookup MakeTime(const civil_second& cs) const override;
+  bool NextTransition(const time_point<seconds>& tp,
+                      time_zone::civil_transition* trans) const override;
+  bool PrevTransition(const time_point<seconds>& tp,
+                      time_zone::civil_transition* trans) const override;
+  std::string Version() const override;
+  std::string Description() const override;
+
+ private:
+  struct Header {            // counts of:
+    std::size_t timecnt;     // transition times
+    std::size_t typecnt;     // transition types
+    std::size_t charcnt;     // zone abbreviation characters
+    std::size_t leapcnt;     // leap seconds (we expect none)
+    std::size_t ttisstdcnt;  // UTC/local indicators (unused)
+    std::size_t ttisutcnt;   // standard/wall indicators (unused)
+
+    bool Build(const tzhead& tzh);
+    std::size_t DataLength(std::size_t time_len) const;
+  };
+
+  void CheckTransition(const std::string& name, const TransitionType& tt,
+                       std::int_fast32_t offset, bool is_dst,
+                       const std::string& abbr) const;
+  bool EquivTransitions(std::uint_fast8_t tt1_index,
+                        std::uint_fast8_t tt2_index) const;
+  void ExtendTransitions(const std::string& name, const Header& hdr);
+
+  bool ResetToBuiltinUTC(const seconds& offset);
+  bool Load(const std::string& name, ZoneInfoSource* zip);
+
+  // Helpers for BreakTime() and MakeTime().
+  time_zone::absolute_lookup LocalTime(std::int_fast64_t unix_time,
+                                       const TransitionType& tt) const;
+  time_zone::absolute_lookup LocalTime(std::int_fast64_t unix_time,
+                                       const Transition& tr) const;
+  time_zone::civil_lookup TimeLocal(const civil_second& cs,
+                                    year_t c4_shift) const;
+
+  std::vector<Transition> transitions_;  // ordered by unix_time and civil_sec
+  std::vector<TransitionType> transition_types_;  // distinct transition types
+  std::uint_fast8_t default_transition_type_;     // for before first transition
+  std::string abbreviations_;  // all the NUL-terminated abbreviations
+
+  std::string version_;      // the tzdata version if available
+  std::string future_spec_;  // for after the last zic transition
+  bool extended_;            // future_spec_ was used to generate transitions
+  year_t last_year_;         // the final year of the generated transitions
+
+  // We remember the transitions found during the last BreakTime() and
+  // MakeTime() calls. If the next request is for the same transition we
+  // will avoid re-searching.
+  mutable std::atomic<std::size_t> local_time_hint_ = {};  // BreakTime() hint
+  mutable std::atomic<std::size_t> time_local_hint_ = {};  // MakeTime() hint
+};
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_INFO_H_
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_libc.cc b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_libc.cc
new file mode 100644
index 0000000000..47cf84c663
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_libc.cc
@@ -0,0 +1,308 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#if defined(_WIN32) || defined(_WIN64)
+#define _CRT_SECURE_NO_WARNINGS 1
+#endif
+
+#include "time_zone_libc.h"
+
+#include <chrono>
+#include <ctime>
+#include <limits>
+#include <utility>
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+#if defined(_WIN32) || defined(_WIN64)
+// Uses the globals: '_timezone', '_dstbias' and '_tzname'.
+auto tm_gmtoff(const std::tm& tm) -> decltype(_timezone + _dstbias) {
+  const bool is_dst = tm.tm_isdst > 0;
+  return _timezone + (is_dst ? _dstbias : 0);
+}
+auto tm_zone(const std::tm& tm) -> decltype(_tzname[0]) {
+  const bool is_dst = tm.tm_isdst > 0;
+  return _tzname[is_dst];
+}
+#elif defined(__sun)
+// Uses the globals: 'timezone', 'altzone' and 'tzname'.
+auto tm_gmtoff(const std::tm& tm) -> decltype(timezone) {
+  const bool is_dst = tm.tm_isdst > 0;
+  return is_dst ? altzone : timezone;
+}
+auto tm_zone(const std::tm& tm) -> decltype(tzname[0]) {
+  const bool is_dst = tm.tm_isdst > 0;
+  return tzname[is_dst];
+}
+#elif defined(__native_client__) || defined(__myriad2__) || \
+    defined(__EMSCRIPTEN__)
+// Uses the globals: 'timezone' and 'tzname'.
+auto tm_gmtoff(const std::tm& tm) -> decltype(_timezone + 0) {
+  const bool is_dst = tm.tm_isdst > 0;
+  return _timezone + (is_dst ? 60 * 60 : 0);
+}
+auto tm_zone(const std::tm& tm) -> decltype(tzname[0]) {
+  const bool is_dst = tm.tm_isdst > 0;
+  return tzname[is_dst];
+}
+#else
+// Adapt to different spellings of the struct std::tm extension fields.
+#if defined(tm_gmtoff)
+auto tm_gmtoff(const std::tm& tm) -> decltype(tm.tm_gmtoff) {
+  return tm.tm_gmtoff;
+}
+#elif defined(__tm_gmtoff)
+auto tm_gmtoff(const std::tm& tm) -> decltype(tm.__tm_gmtoff) {
+  return tm.__tm_gmtoff;
+}
+#else
+template <typename T>
+auto tm_gmtoff(const T& tm) -> decltype(tm.tm_gmtoff) {
+  return tm.tm_gmtoff;
+}
+template <typename T>
+auto tm_gmtoff(const T& tm) -> decltype(tm.__tm_gmtoff) {
+  return tm.__tm_gmtoff;
+}
+#endif  // tm_gmtoff
+#if defined(tm_zone)
+auto tm_zone(const std::tm& tm) -> decltype(tm.tm_zone) { return tm.tm_zone; }
+#elif defined(__tm_zone)
+auto tm_zone(const std::tm& tm) -> decltype(tm.__tm_zone) {
+  return tm.__tm_zone;
+}
+#else
+template <typename T>
+auto tm_zone(const T& tm) -> decltype(tm.tm_zone) {
+  return tm.tm_zone;
+}
+template <typename T>
+auto tm_zone(const T& tm) -> decltype(tm.__tm_zone) {
+  return tm.__tm_zone;
+}
+#endif  // tm_zone
+#endif
+
+inline std::tm* gm_time(const std::time_t* timep, std::tm* result) {
+#if defined(_WIN32) || defined(_WIN64)
+  return gmtime_s(result, timep) ? nullptr : result;
+#else
+  return gmtime_r(timep, result);
+#endif
+}
+
+inline std::tm* local_time(const std::time_t* timep, std::tm* result) {
+#if defined(_WIN32) || defined(_WIN64)
+  return localtime_s(result, timep) ? nullptr : result;
+#else
+  return localtime_r(timep, result);
+#endif
+}
+
+// Converts a civil second and "dst" flag into a time_t and UTC offset.
+// Returns false if time_t cannot represent the requested civil second.
+// Caller must have already checked that cs.year() will fit into a tm_year.
+bool make_time(const civil_second& cs, int is_dst, std::time_t* t, int* off) {
+  std::tm tm;
+  tm.tm_year = static_cast<int>(cs.year() - year_t{1900});
+  tm.tm_mon = cs.month() - 1;
+  tm.tm_mday = cs.day();
+  tm.tm_hour = cs.hour();
+  tm.tm_min = cs.minute();
+  tm.tm_sec = cs.second();
+  tm.tm_isdst = is_dst;
+  *t = std::mktime(&tm);
+  if (*t == std::time_t{-1}) {
+    std::tm tm2;
+    const std::tm* tmp = local_time(t, &tm2);
+    if (tmp == nullptr || tmp->tm_year != tm.tm_year ||
+        tmp->tm_mon != tm.tm_mon || tmp->tm_mday != tm.tm_mday ||
+        tmp->tm_hour != tm.tm_hour || tmp->tm_min != tm.tm_min ||
+        tmp->tm_sec != tm.tm_sec) {
+      // A true error (not just one second before the epoch).
+      return false;
+    }
+  }
+  *off = static_cast<int>(tm_gmtoff(tm));
+  return true;
+}
+
+// Find the least time_t in [lo:hi] where local time matches offset, given:
+// (1) lo doesn't match, (2) hi does, and (3) there is only one transition.
+std::time_t find_trans(std::time_t lo, std::time_t hi, int offset) {
+  std::tm tm;
+  while (lo + 1 != hi) {
+    const std::time_t mid = lo + (hi - lo) / 2;
+    if (std::tm* tmp = local_time(&mid, &tm)) {
+      if (tm_gmtoff(*tmp) == offset) {
+        hi = mid;
+      } else {
+        lo = mid;
+      }
+    } else {
+      // If std::tm cannot hold some result we resort to a linear search,
+      // ignoring all failed conversions.  Slow, but never really happens.
+      while (++lo != hi) {
+        if (std::tm* tmp = local_time(&lo, &tm)) {
+          if (tm_gmtoff(*tmp) == offset) break;
+        }
+      }
+      return lo;
+    }
+  }
+  return hi;
+}
+
+}  // namespace
+
+TimeZoneLibC::TimeZoneLibC(const std::string& name)
+    : local_(name == "localtime") {}
+
+time_zone::absolute_lookup TimeZoneLibC::BreakTime(
+    const time_point<seconds>& tp) const {
+  time_zone::absolute_lookup al;
+  al.offset = 0;
+  al.is_dst = false;
+  al.abbr = "-00";
+
+  const std::int_fast64_t s = ToUnixSeconds(tp);
+
+  // If std::time_t cannot hold the input we saturate the output.
+  if (s < std::numeric_limits<std::time_t>::min()) {
+    al.cs = civil_second::min();
+    return al;
+  }
+  if (s > std::numeric_limits<std::time_t>::max()) {
+    al.cs = civil_second::max();
+    return al;
+  }
+
+  const std::time_t t = static_cast<std::time_t>(s);
+  std::tm tm;
+  std::tm* tmp = local_ ? local_time(&t, &tm) : gm_time(&t, &tm);
+
+  // If std::tm cannot hold the result we saturate the output.
+  if (tmp == nullptr) {
+    al.cs = (s < 0) ? civil_second::min() : civil_second::max();
+    return al;
+  }
+
+  const year_t year = tmp->tm_year + year_t{1900};
+  al.cs = civil_second(year, tmp->tm_mon + 1, tmp->tm_mday, tmp->tm_hour,
+                       tmp->tm_min, tmp->tm_sec);
+  al.offset = static_cast<int>(tm_gmtoff(*tmp));
+  al.abbr = local_ ? tm_zone(*tmp) : "UTC";  // as expected by cctz
+  al.is_dst = tmp->tm_isdst > 0;
+  return al;
+}
+
+time_zone::civil_lookup TimeZoneLibC::MakeTime(const civil_second& cs) const {
+  if (!local_) {
+    // If time_point<seconds> cannot hold the result we saturate.
+    static const civil_second min_tp_cs =
+        civil_second() + ToUnixSeconds(time_point<seconds>::min());
+    static const civil_second max_tp_cs =
+        civil_second() + ToUnixSeconds(time_point<seconds>::max());
+    const time_point<seconds> tp =
+        (cs < min_tp_cs)
+            ? time_point<seconds>::min()
+            : (cs > max_tp_cs) ? time_point<seconds>::max()
+                               : FromUnixSeconds(cs - civil_second());
+    return {time_zone::civil_lookup::UNIQUE, tp, tp, tp};
+  }
+
+  // If tm_year cannot hold the requested year we saturate the result.
+  if (cs.year() < 0) {
+    if (cs.year() < std::numeric_limits<int>::min() + year_t{1900}) {
+      const time_point<seconds> tp = time_point<seconds>::min();
+      return {time_zone::civil_lookup::UNIQUE, tp, tp, tp};
+    }
+  } else {
+    if (cs.year() - year_t{1900} > std::numeric_limits<int>::max()) {
+      const time_point<seconds> tp = time_point<seconds>::max();
+      return {time_zone::civil_lookup::UNIQUE, tp, tp, tp};
+    }
+  }
+
+  // We probe with "is_dst" values of 0 and 1 to try to distinguish unique
+  // civil seconds from skipped or repeated ones.  This is not always possible
+  // however, as the "dst" flag does not change over some offset transitions.
+  // We are also subject to the vagaries of mktime() implementations.
+  std::time_t t0, t1;
+  int offset0, offset1;
+  if (make_time(cs, 0, &t0, &offset0) && make_time(cs, 1, &t1, &offset1)) {
+    if (t0 == t1) {
+      // The civil time was singular (pre == trans == post).
+      const time_point<seconds> tp = FromUnixSeconds(t0);
+      return {time_zone::civil_lookup::UNIQUE, tp, tp, tp};
+    }
+
+    if (t0 > t1) {
+      std::swap(t0, t1);
+      std::swap(offset0, offset1);
+    }
+    const std::time_t tt = find_trans(t0, t1, offset1);
+    const time_point<seconds> trans = FromUnixSeconds(tt);
+
+    if (offset0 < offset1) {
+      // The civil time did not exist (pre >= trans > post).
+      const time_point<seconds> pre = FromUnixSeconds(t1);
+      const time_point<seconds> post = FromUnixSeconds(t0);
+      return {time_zone::civil_lookup::SKIPPED, pre, trans, post};
+    }
+
+    // The civil time was ambiguous (pre < trans <= post).
+    const time_point<seconds> pre = FromUnixSeconds(t0);
+    const time_point<seconds> post = FromUnixSeconds(t1);
+    return {time_zone::civil_lookup::REPEATED, pre, trans, post};
+  }
+
+  // make_time() failed somehow so we saturate the result.
+  const time_point<seconds> tp = (cs < civil_second())
+                                     ? time_point<seconds>::min()
+                                     : time_point<seconds>::max();
+  return {time_zone::civil_lookup::UNIQUE, tp, tp, tp};
+}
+
+bool TimeZoneLibC::NextTransition(const time_point<seconds>&,
+                                  time_zone::civil_transition*) const {
+  return false;
+}
+
+bool TimeZoneLibC::PrevTransition(const time_point<seconds>&,
+                                  time_zone::civil_transition*) const {
+  return false;
+}
+
+std::string TimeZoneLibC::Version() const {
+  return std::string();  // unknown
+}
+
+std::string TimeZoneLibC::Description() const {
+  return local_ ? "localtime" : "UTC";
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_libc.h b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_libc.h
new file mode 100644
index 0000000000..1da9039a15
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_libc.h
@@ -0,0 +1,55 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_LIBC_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_LIBC_H_
+
+#include <string>
+
+#include "absl/base/config.h"
+#include "time_zone_if.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// A time zone backed by gmtime_r(3), localtime_r(3), and mktime(3),
+// and which therefore only supports UTC and the local time zone.
+// TODO: Add support for fixed offsets from UTC.
+class TimeZoneLibC : public TimeZoneIf {
+ public:
+  explicit TimeZoneLibC(const std::string& name);
+
+  // TimeZoneIf implementations.
+  time_zone::absolute_lookup BreakTime(
+      const time_point<seconds>& tp) const override;
+  time_zone::civil_lookup MakeTime(const civil_second& cs) const override;
+  bool NextTransition(const time_point<seconds>& tp,
+                      time_zone::civil_transition* trans) const override;
+  bool PrevTransition(const time_point<seconds>& tp,
+                      time_zone::civil_transition* trans) const override;
+  std::string Version() const override;
+  std::string Description() const override;
+
+ private:
+  const bool local_;  // localtime or UTC
+};
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_LIBC_H_
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_lookup.cc b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_lookup.cc
new file mode 100644
index 0000000000..efdea64b4e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_lookup.cc
@@ -0,0 +1,187 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+#if defined(__ANDROID__)
+#include <sys/system_properties.h>
+#if defined(__ANDROID_API__) && __ANDROID_API__ >= 21
+#include <dlfcn.h>
+#endif
+#endif
+
+#if defined(__APPLE__)
+#include <CoreFoundation/CFTimeZone.h>
+
+#include <vector>
+#endif
+
+#include <cstdlib>
+#include <cstring>
+#include <string>
+
+#include "time_zone_fixed.h"
+#include "time_zone_impl.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+#if defined(__ANDROID__) && defined(__ANDROID_API__) && __ANDROID_API__ >= 21
+namespace {
+// Android 'L' removes __system_property_get() from the NDK, however
+// it is still a hidden symbol in libc so we use dlsym() to access it.
+// See Chromium's base/sys_info_android.cc for a similar example.
+
+using property_get_func = int (*)(const char*, char*);
+
+property_get_func LoadSystemPropertyGet() {
+  int flag = RTLD_LAZY | RTLD_GLOBAL;
+#if defined(RTLD_NOLOAD)
+  flag |= RTLD_NOLOAD;  // libc.so should already be resident
+#endif
+  if (void* handle = dlopen("libc.so", flag)) {
+    void* sym = dlsym(handle, "__system_property_get");
+    dlclose(handle);
+    return reinterpret_cast<property_get_func>(sym);
+  }
+  return nullptr;
+}
+
+int __system_property_get(const char* name, char* value) {
+  static property_get_func system_property_get = LoadSystemPropertyGet();
+  return system_property_get ? system_property_get(name, value) : -1;
+}
+
+}  // namespace
+#endif
+
+std::string time_zone::name() const { return effective_impl().Name(); }
+
+time_zone::absolute_lookup time_zone::lookup(
+    const time_point<seconds>& tp) const {
+  return effective_impl().BreakTime(tp);
+}
+
+time_zone::civil_lookup time_zone::lookup(const civil_second& cs) const {
+  return effective_impl().MakeTime(cs);
+}
+
+bool time_zone::next_transition(const time_point<seconds>& tp,
+                                civil_transition* trans) const {
+  return effective_impl().NextTransition(tp, trans);
+}
+
+bool time_zone::prev_transition(const time_point<seconds>& tp,
+                                civil_transition* trans) const {
+  return effective_impl().PrevTransition(tp, trans);
+}
+
+std::string time_zone::version() const { return effective_impl().Version(); }
+
+std::string time_zone::description() const {
+  return effective_impl().Description();
+}
+
+const time_zone::Impl& time_zone::effective_impl() const {
+  if (impl_ == nullptr) {
+    // Dereferencing an implicit-UTC time_zone is expected to be
+    // rare, so we don't mind paying a small synchronization cost.
+    return *time_zone::Impl::UTC().impl_;
+  }
+  return *impl_;
+}
+
+bool load_time_zone(const std::string& name, time_zone* tz) {
+  return time_zone::Impl::LoadTimeZone(name, tz);
+}
+
+time_zone utc_time_zone() {
+  return time_zone::Impl::UTC();  // avoid name lookup
+}
+
+time_zone fixed_time_zone(const seconds& offset) {
+  time_zone tz;
+  load_time_zone(FixedOffsetToName(offset), &tz);
+  return tz;
+}
+
+time_zone local_time_zone() {
+  const char* zone = ":localtime";
+#if defined(__ANDROID__)
+  char sysprop[PROP_VALUE_MAX];
+  if (__system_property_get("persist.sys.timezone", sysprop) > 0) {
+    zone = sysprop;
+  }
+#endif
+#if defined(__APPLE__)
+  std::vector<char> buffer;
+  CFTimeZoneRef tz_default = CFTimeZoneCopyDefault();
+  if (CFStringRef tz_name = CFTimeZoneGetName(tz_default)) {
+    CFStringEncoding encoding = kCFStringEncodingUTF8;
+    CFIndex length = CFStringGetLength(tz_name);
+    buffer.resize(CFStringGetMaximumSizeForEncoding(length, encoding) + 1);
+    if (CFStringGetCString(tz_name, &buffer[0], buffer.size(), encoding)) {
+      zone = &buffer[0];
+    }
+  }
+  CFRelease(tz_default);
+#endif
+
+  // Allow ${TZ} to override to default zone.
+  char* tz_env = nullptr;
+#if defined(_MSC_VER)
+  _dupenv_s(&tz_env, nullptr, "TZ");
+#else
+  tz_env = std::getenv("TZ");
+#endif
+  if (tz_env) zone = tz_env;
+
+  // We only support the "[:]<zone-name>" form.
+  if (*zone == ':') ++zone;
+
+  // Map "localtime" to a system-specific name, but
+  // allow ${LOCALTIME} to override the default name.
+  char* localtime_env = nullptr;
+  if (strcmp(zone, "localtime") == 0) {
+#if defined(_MSC_VER)
+    // System-specific default is just "localtime".
+    _dupenv_s(&localtime_env, nullptr, "LOCALTIME");
+#else
+    zone = "/etc/localtime";  // System-specific default.
+    localtime_env = std::getenv("LOCALTIME");
+#endif
+    if (localtime_env) zone = localtime_env;
+  }
+
+  const std::string name = zone;
+#if defined(_MSC_VER)
+  free(localtime_env);
+  free(tz_env);
+#endif
+
+  time_zone tz;
+  load_time_zone(name, &tz);  // Falls back to UTC.
+  // TODO: Follow the RFC3339 "Unknown Local Offset Convention" and
+  // arrange for %z to generate "-0000" when we don't know the local
+  // offset because the load_time_zone() failed and we're using UTC.
+  return tz;
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_lookup_test.cc b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_lookup_test.cc
new file mode 100644
index 0000000000..0b0c1a3b72
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_lookup_test.cc
@@ -0,0 +1,1438 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include <chrono>
+#include <cstddef>
+#include <cstdlib>
+#include <future>
+#include <limits>
+#include <string>
+#include <thread>
+#include <vector>
+
+#include "gtest/gtest.h"
+#include "absl/base/config.h"
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+namespace chrono = std::chrono;
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+// A list of known time-zone names.
+const char* const kTimeZoneNames[] = {"Africa/Abidjan",
+                                      "Africa/Accra",
+                                      "Africa/Addis_Ababa",
+                                      "Africa/Algiers",
+                                      "Africa/Asmara",
+                                      "Africa/Asmera",
+                                      "Africa/Bamako",
+                                      "Africa/Bangui",
+                                      "Africa/Banjul",
+                                      "Africa/Bissau",
+                                      "Africa/Blantyre",
+                                      "Africa/Brazzaville",
+                                      "Africa/Bujumbura",
+                                      "Africa/Cairo",
+                                      "Africa/Casablanca",
+                                      "Africa/Ceuta",
+                                      "Africa/Conakry",
+                                      "Africa/Dakar",
+                                      "Africa/Dar_es_Salaam",
+                                      "Africa/Djibouti",
+                                      "Africa/Douala",
+                                      "Africa/El_Aaiun",
+                                      "Africa/Freetown",
+                                      "Africa/Gaborone",
+                                      "Africa/Harare",
+                                      "Africa/Johannesburg",
+                                      "Africa/Juba",
+                                      "Africa/Kampala",
+                                      "Africa/Khartoum",
+                                      "Africa/Kigali",
+                                      "Africa/Kinshasa",
+                                      "Africa/Lagos",
+                                      "Africa/Libreville",
+                                      "Africa/Lome",
+                                      "Africa/Luanda",
+                                      "Africa/Lubumbashi",
+                                      "Africa/Lusaka",
+                                      "Africa/Malabo",
+                                      "Africa/Maputo",
+                                      "Africa/Maseru",
+                                      "Africa/Mbabane",
+                                      "Africa/Mogadishu",
+                                      "Africa/Monrovia",
+                                      "Africa/Nairobi",
+                                      "Africa/Ndjamena",
+                                      "Africa/Niamey",
+                                      "Africa/Nouakchott",
+                                      "Africa/Ouagadougou",
+                                      "Africa/Porto-Novo",
+                                      "Africa/Sao_Tome",
+                                      "Africa/Timbuktu",
+                                      "Africa/Tripoli",
+                                      "Africa/Tunis",
+                                      "Africa/Windhoek",
+                                      "America/Adak",
+                                      "America/Anchorage",
+                                      "America/Anguilla",
+                                      "America/Antigua",
+                                      "America/Araguaina",
+                                      "America/Argentina/Buenos_Aires",
+                                      "America/Argentina/Catamarca",
+                                      "America/Argentina/ComodRivadavia",
+                                      "America/Argentina/Cordoba",
+                                      "America/Argentina/Jujuy",
+                                      "America/Argentina/La_Rioja",
+                                      "America/Argentina/Mendoza",
+                                      "America/Argentina/Rio_Gallegos",
+                                      "America/Argentina/Salta",
+                                      "America/Argentina/San_Juan",
+                                      "America/Argentina/San_Luis",
+                                      "America/Argentina/Tucuman",
+                                      "America/Argentina/Ushuaia",
+                                      "America/Aruba",
+                                      "America/Asuncion",
+                                      "America/Atikokan",
+                                      "America/Atka",
+                                      "America/Bahia",
+                                      "America/Bahia_Banderas",
+                                      "America/Barbados",
+                                      "America/Belem",
+                                      "America/Belize",
+                                      "America/Blanc-Sablon",
+                                      "America/Boa_Vista",
+                                      "America/Bogota",
+                                      "America/Boise",
+                                      "America/Buenos_Aires",
+                                      "America/Cambridge_Bay",
+                                      "America/Campo_Grande",
+                                      "America/Cancun",
+                                      "America/Caracas",
+                                      "America/Catamarca",
+                                      "America/Cayenne",
+                                      "America/Cayman",
+                                      "America/Chicago",
+                                      "America/Chihuahua",
+                                      "America/Coral_Harbour",
+                                      "America/Cordoba",
+                                      "America/Costa_Rica",
+                                      "America/Creston",
+                                      "America/Cuiaba",
+                                      "America/Curacao",
+                                      "America/Danmarkshavn",
+                                      "America/Dawson",
+                                      "America/Dawson_Creek",
+                                      "America/Denver",
+                                      "America/Detroit",
+                                      "America/Dominica",
+                                      "America/Edmonton",
+                                      "America/Eirunepe",
+                                      "America/El_Salvador",
+                                      "America/Ensenada",
+                                      "America/Fort_Nelson",
+                                      "America/Fort_Wayne",
+                                      "America/Fortaleza",
+                                      "America/Glace_Bay",
+                                      "America/Godthab",
+                                      "America/Goose_Bay",
+                                      "America/Grand_Turk",
+                                      "America/Grenada",
+                                      "America/Guadeloupe",
+                                      "America/Guatemala",
+                                      "America/Guayaquil",
+                                      "America/Guyana",
+                                      "America/Halifax",
+                                      "America/Havana",
+                                      "America/Hermosillo",
+                                      "America/Indiana/Indianapolis",
+                                      "America/Indiana/Knox",
+                                      "America/Indiana/Marengo",
+                                      "America/Indiana/Petersburg",
+                                      "America/Indiana/Tell_City",
+                                      "America/Indiana/Vevay",
+                                      "America/Indiana/Vincennes",
+                                      "America/Indiana/Winamac",
+                                      "America/Indianapolis",
+                                      "America/Inuvik",
+                                      "America/Iqaluit",
+                                      "America/Jamaica",
+                                      "America/Jujuy",
+                                      "America/Juneau",
+                                      "America/Kentucky/Louisville",
+                                      "America/Kentucky/Monticello",
+                                      "America/Knox_IN",
+                                      "America/Kralendijk",
+                                      "America/La_Paz",
+                                      "America/Lima",
+                                      "America/Los_Angeles",
+                                      "America/Louisville",
+                                      "America/Lower_Princes",
+                                      "America/Maceio",
+                                      "America/Managua",
+                                      "America/Manaus",
+                                      "America/Marigot",
+                                      "America/Martinique",
+                                      "America/Matamoros",
+                                      "America/Mazatlan",
+                                      "America/Mendoza",
+                                      "America/Menominee",
+                                      "America/Merida",
+                                      "America/Metlakatla",
+                                      "America/Mexico_City",
+                                      "America/Miquelon",
+                                      "America/Moncton",
+                                      "America/Monterrey",
+                                      "America/Montevideo",
+                                      "America/Montreal",
+                                      "America/Montserrat",
+                                      "America/Nassau",
+                                      "America/New_York",
+                                      "America/Nipigon",
+                                      "America/Nome",
+                                      "America/Noronha",
+                                      "America/North_Dakota/Beulah",
+                                      "America/North_Dakota/Center",
+                                      "America/North_Dakota/New_Salem",
+                                      "America/Nuuk",
+                                      "America/Ojinaga",
+                                      "America/Panama",
+                                      "America/Pangnirtung",
+                                      "America/Paramaribo",
+                                      "America/Phoenix",
+                                      "America/Port-au-Prince",
+                                      "America/Port_of_Spain",
+                                      "America/Porto_Acre",
+                                      "America/Porto_Velho",
+                                      "America/Puerto_Rico",
+                                      "America/Punta_Arenas",
+                                      "America/Rainy_River",
+                                      "America/Rankin_Inlet",
+                                      "America/Recife",
+                                      "America/Regina",
+                                      "America/Resolute",
+                                      "America/Rio_Branco",
+                                      "America/Rosario",
+                                      "America/Santa_Isabel",
+                                      "America/Santarem",
+                                      "America/Santiago",
+                                      "America/Santo_Domingo",
+                                      "America/Sao_Paulo",
+                                      "America/Scoresbysund",
+                                      "America/Shiprock",
+                                      "America/Sitka",
+                                      "America/St_Barthelemy",
+                                      "America/St_Johns",
+                                      "America/St_Kitts",
+                                      "America/St_Lucia",
+                                      "America/St_Thomas",
+                                      "America/St_Vincent",
+                                      "America/Swift_Current",
+                                      "America/Tegucigalpa",
+                                      "America/Thule",
+                                      "America/Thunder_Bay",
+                                      "America/Tijuana",
+                                      "America/Toronto",
+                                      "America/Tortola",
+                                      "America/Vancouver",
+                                      "America/Virgin",
+                                      "America/Whitehorse",
+                                      "America/Winnipeg",
+                                      "America/Yakutat",
+                                      "America/Yellowknife",
+                                      "Antarctica/Casey",
+                                      "Antarctica/Davis",
+                                      "Antarctica/DumontDUrville",
+                                      "Antarctica/Macquarie",
+                                      "Antarctica/Mawson",
+                                      "Antarctica/McMurdo",
+                                      "Antarctica/Palmer",
+                                      "Antarctica/Rothera",
+                                      "Antarctica/South_Pole",
+                                      "Antarctica/Syowa",
+                                      "Antarctica/Troll",
+                                      "Antarctica/Vostok",
+                                      "Arctic/Longyearbyen",
+                                      "Asia/Aden",
+                                      "Asia/Almaty",
+                                      "Asia/Amman",
+                                      "Asia/Anadyr",
+                                      "Asia/Aqtau",
+                                      "Asia/Aqtobe",
+                                      "Asia/Ashgabat",
+                                      "Asia/Ashkhabad",
+                                      "Asia/Atyrau",
+                                      "Asia/Baghdad",
+                                      "Asia/Bahrain",
+                                      "Asia/Baku",
+                                      "Asia/Bangkok",
+                                      "Asia/Barnaul",
+                                      "Asia/Beirut",
+                                      "Asia/Bishkek",
+                                      "Asia/Brunei",
+                                      "Asia/Calcutta",
+                                      "Asia/Chita",
+                                      "Asia/Choibalsan",
+                                      "Asia/Chongqing",
+                                      "Asia/Chungking",
+                                      "Asia/Colombo",
+                                      "Asia/Dacca",
+                                      "Asia/Damascus",
+                                      "Asia/Dhaka",
+                                      "Asia/Dili",
+                                      "Asia/Dubai",
+                                      "Asia/Dushanbe",
+                                      "Asia/Famagusta",
+                                      "Asia/Gaza",
+                                      "Asia/Harbin",
+                                      "Asia/Hebron",
+                                      "Asia/Ho_Chi_Minh",
+                                      "Asia/Hong_Kong",
+                                      "Asia/Hovd",
+                                      "Asia/Irkutsk",
+                                      "Asia/Istanbul",
+                                      "Asia/Jakarta",
+                                      "Asia/Jayapura",
+                                      "Asia/Jerusalem",
+                                      "Asia/Kabul",
+                                      "Asia/Kamchatka",
+                                      "Asia/Karachi",
+                                      "Asia/Kashgar",
+                                      "Asia/Kathmandu",
+                                      "Asia/Katmandu",
+                                      "Asia/Khandyga",
+                                      "Asia/Kolkata",
+                                      "Asia/Krasnoyarsk",
+                                      "Asia/Kuala_Lumpur",
+                                      "Asia/Kuching",
+                                      "Asia/Kuwait",
+                                      "Asia/Macao",
+                                      "Asia/Macau",
+                                      "Asia/Magadan",
+                                      "Asia/Makassar",
+                                      "Asia/Manila",
+                                      "Asia/Muscat",
+                                      "Asia/Nicosia",
+                                      "Asia/Novokuznetsk",
+                                      "Asia/Novosibirsk",
+                                      "Asia/Omsk",
+                                      "Asia/Oral",
+                                      "Asia/Phnom_Penh",
+                                      "Asia/Pontianak",
+                                      "Asia/Pyongyang",
+                                      "Asia/Qatar",
+                                      "Asia/Qostanay",
+                                      "Asia/Qyzylorda",
+                                      "Asia/Rangoon",
+                                      "Asia/Riyadh",
+                                      "Asia/Saigon",
+                                      "Asia/Sakhalin",
+                                      "Asia/Samarkand",
+                                      "Asia/Seoul",
+                                      "Asia/Shanghai",
+                                      "Asia/Singapore",
+                                      "Asia/Srednekolymsk",
+                                      "Asia/Taipei",
+                                      "Asia/Tashkent",
+                                      "Asia/Tbilisi",
+                                      "Asia/Tehran",
+                                      "Asia/Tel_Aviv",
+                                      "Asia/Thimbu",
+                                      "Asia/Thimphu",
+                                      "Asia/Tokyo",
+                                      "Asia/Tomsk",
+                                      "Asia/Ujung_Pandang",
+                                      "Asia/Ulaanbaatar",
+                                      "Asia/Ulan_Bator",
+                                      "Asia/Urumqi",
+                                      "Asia/Ust-Nera",
+                                      "Asia/Vientiane",
+                                      "Asia/Vladivostok",
+                                      "Asia/Yakutsk",
+                                      "Asia/Yangon",
+                                      "Asia/Yekaterinburg",
+                                      "Asia/Yerevan",
+                                      "Atlantic/Azores",
+                                      "Atlantic/Bermuda",
+                                      "Atlantic/Canary",
+                                      "Atlantic/Cape_Verde",
+                                      "Atlantic/Faeroe",
+                                      "Atlantic/Faroe",
+                                      "Atlantic/Jan_Mayen",
+                                      "Atlantic/Madeira",
+                                      "Atlantic/Reykjavik",
+                                      "Atlantic/South_Georgia",
+                                      "Atlantic/St_Helena",
+                                      "Atlantic/Stanley",
+                                      "Australia/ACT",
+                                      "Australia/Adelaide",
+                                      "Australia/Brisbane",
+                                      "Australia/Broken_Hill",
+                                      "Australia/Canberra",
+                                      "Australia/Currie",
+                                      "Australia/Darwin",
+                                      "Australia/Eucla",
+                                      "Australia/Hobart",
+                                      "Australia/LHI",
+                                      "Australia/Lindeman",
+                                      "Australia/Lord_Howe",
+                                      "Australia/Melbourne",
+                                      "Australia/NSW",
+                                      "Australia/North",
+                                      "Australia/Perth",
+                                      "Australia/Queensland",
+                                      "Australia/South",
+                                      "Australia/Sydney",
+                                      "Australia/Tasmania",
+                                      "Australia/Victoria",
+                                      "Australia/West",
+                                      "Australia/Yancowinna",
+                                      "Brazil/Acre",
+                                      "Brazil/DeNoronha",
+                                      "Brazil/East",
+                                      "Brazil/West",
+                                      "CET",
+                                      "CST6CDT",
+                                      "Canada/Atlantic",
+                                      "Canada/Central",
+                                      "Canada/Eastern",
+                                      "Canada/Mountain",
+                                      "Canada/Newfoundland",
+                                      "Canada/Pacific",
+                                      "Canada/Saskatchewan",
+                                      "Canada/Yukon",
+                                      "Chile/Continental",
+                                      "Chile/EasterIsland",
+                                      "Cuba",
+                                      "EET",
+                                      "EST",
+                                      "EST5EDT",
+                                      "Egypt",
+                                      "Eire",
+                                      "Etc/GMT",
+                                      "Etc/GMT+0",
+                                      "Etc/GMT+1",
+                                      "Etc/GMT+10",
+                                      "Etc/GMT+11",
+                                      "Etc/GMT+12",
+                                      "Etc/GMT+2",
+                                      "Etc/GMT+3",
+                                      "Etc/GMT+4",
+                                      "Etc/GMT+5",
+                                      "Etc/GMT+6",
+                                      "Etc/GMT+7",
+                                      "Etc/GMT+8",
+                                      "Etc/GMT+9",
+                                      "Etc/GMT-0",
+                                      "Etc/GMT-1",
+                                      "Etc/GMT-10",
+                                      "Etc/GMT-11",
+                                      "Etc/GMT-12",
+                                      "Etc/GMT-13",
+                                      "Etc/GMT-14",
+                                      "Etc/GMT-2",
+                                      "Etc/GMT-3",
+                                      "Etc/GMT-4",
+                                      "Etc/GMT-5",
+                                      "Etc/GMT-6",
+                                      "Etc/GMT-7",
+                                      "Etc/GMT-8",
+                                      "Etc/GMT-9",
+                                      "Etc/GMT0",
+                                      "Etc/Greenwich",
+                                      "Etc/UCT",
+                                      "Etc/UTC",
+                                      "Etc/Universal",
+                                      "Etc/Zulu",
+                                      "Europe/Amsterdam",
+                                      "Europe/Andorra",
+                                      "Europe/Astrakhan",
+                                      "Europe/Athens",
+                                      "Europe/Belfast",
+                                      "Europe/Belgrade",
+                                      "Europe/Berlin",
+                                      "Europe/Bratislava",
+                                      "Europe/Brussels",
+                                      "Europe/Bucharest",
+                                      "Europe/Budapest",
+                                      "Europe/Busingen",
+                                      "Europe/Chisinau",
+                                      "Europe/Copenhagen",
+                                      "Europe/Dublin",
+                                      "Europe/Gibraltar",
+                                      "Europe/Guernsey",
+                                      "Europe/Helsinki",
+                                      "Europe/Isle_of_Man",
+                                      "Europe/Istanbul",
+                                      "Europe/Jersey",
+                                      "Europe/Kaliningrad",
+                                      "Europe/Kiev",
+                                      "Europe/Kirov",
+                                      "Europe/Lisbon",
+                                      "Europe/Ljubljana",
+                                      "Europe/London",
+                                      "Europe/Luxembourg",
+                                      "Europe/Madrid",
+                                      "Europe/Malta",
+                                      "Europe/Mariehamn",
+                                      "Europe/Minsk",
+                                      "Europe/Monaco",
+                                      "Europe/Moscow",
+                                      "Europe/Nicosia",
+                                      "Europe/Oslo",
+                                      "Europe/Paris",
+                                      "Europe/Podgorica",
+                                      "Europe/Prague",
+                                      "Europe/Riga",
+                                      "Europe/Rome",
+                                      "Europe/Samara",
+                                      "Europe/San_Marino",
+                                      "Europe/Sarajevo",
+                                      "Europe/Saratov",
+                                      "Europe/Simferopol",
+                                      "Europe/Skopje",
+                                      "Europe/Sofia",
+                                      "Europe/Stockholm",
+                                      "Europe/Tallinn",
+                                      "Europe/Tirane",
+                                      "Europe/Tiraspol",
+                                      "Europe/Ulyanovsk",
+                                      "Europe/Uzhgorod",
+                                      "Europe/Vaduz",
+                                      "Europe/Vatican",
+                                      "Europe/Vienna",
+                                      "Europe/Vilnius",
+                                      "Europe/Volgograd",
+                                      "Europe/Warsaw",
+                                      "Europe/Zagreb",
+                                      "Europe/Zaporozhye",
+                                      "Europe/Zurich",
+                                      "GB",
+                                      "GB-Eire",
+                                      "GMT",
+                                      "GMT+0",
+                                      "GMT-0",
+                                      "GMT0",
+                                      "Greenwich",
+                                      "HST",
+                                      "Hongkong",
+                                      "Iceland",
+                                      "Indian/Antananarivo",
+                                      "Indian/Chagos",
+                                      "Indian/Christmas",
+                                      "Indian/Cocos",
+                                      "Indian/Comoro",
+                                      "Indian/Kerguelen",
+                                      "Indian/Mahe",
+                                      "Indian/Maldives",
+                                      "Indian/Mauritius",
+                                      "Indian/Mayotte",
+                                      "Indian/Reunion",
+                                      "Iran",
+                                      "Israel",
+                                      "Jamaica",
+                                      "Japan",
+                                      "Kwajalein",
+                                      "Libya",
+                                      "MET",
+                                      "MST",
+                                      "MST7MDT",
+                                      "Mexico/BajaNorte",
+                                      "Mexico/BajaSur",
+                                      "Mexico/General",
+                                      "NZ",
+                                      "NZ-CHAT",
+                                      "Navajo",
+                                      "PRC",
+                                      "PST8PDT",
+                                      "Pacific/Apia",
+                                      "Pacific/Auckland",
+                                      "Pacific/Bougainville",
+                                      "Pacific/Chatham",
+                                      "Pacific/Chuuk",
+                                      "Pacific/Easter",
+                                      "Pacific/Efate",
+                                      "Pacific/Enderbury",
+                                      "Pacific/Fakaofo",
+                                      "Pacific/Fiji",
+                                      "Pacific/Funafuti",
+                                      "Pacific/Galapagos",
+                                      "Pacific/Gambier",
+                                      "Pacific/Guadalcanal",
+                                      "Pacific/Guam",
+                                      "Pacific/Honolulu",
+                                      "Pacific/Johnston",
+                                      "Pacific/Kiritimati",
+                                      "Pacific/Kosrae",
+                                      "Pacific/Kwajalein",
+                                      "Pacific/Majuro",
+                                      "Pacific/Marquesas",
+                                      "Pacific/Midway",
+                                      "Pacific/Nauru",
+                                      "Pacific/Niue",
+                                      "Pacific/Norfolk",
+                                      "Pacific/Noumea",
+                                      "Pacific/Pago_Pago",
+                                      "Pacific/Palau",
+                                      "Pacific/Pitcairn",
+                                      "Pacific/Pohnpei",
+                                      "Pacific/Ponape",
+                                      "Pacific/Port_Moresby",
+                                      "Pacific/Rarotonga",
+                                      "Pacific/Saipan",
+                                      "Pacific/Samoa",
+                                      "Pacific/Tahiti",
+                                      "Pacific/Tarawa",
+                                      "Pacific/Tongatapu",
+                                      "Pacific/Truk",
+                                      "Pacific/Wake",
+                                      "Pacific/Wallis",
+                                      "Pacific/Yap",
+                                      "Poland",
+                                      "Portugal",
+                                      "ROC",
+                                      "ROK",
+                                      "Singapore",
+                                      "Turkey",
+                                      "UCT",
+                                      "US/Alaska",
+                                      "US/Aleutian",
+                                      "US/Arizona",
+                                      "US/Central",
+                                      "US/East-Indiana",
+                                      "US/Eastern",
+                                      "US/Hawaii",
+                                      "US/Indiana-Starke",
+                                      "US/Michigan",
+                                      "US/Mountain",
+                                      "US/Pacific",
+                                      "US/Samoa",
+                                      "UTC",
+                                      "Universal",
+                                      "W-SU",
+                                      "WET",
+                                      "Zulu",
+                                      nullptr};
+
+// Helper to return a loaded time zone by value (UTC on error).
+time_zone LoadZone(const std::string& name) {
+  time_zone tz;
+  load_time_zone(name, &tz);
+  return tz;
+}
+
+// This helper is a macro so that failed expectations show up with the
+// correct line numbers.
+#define ExpectTime(tp, tz, y, m, d, hh, mm, ss, off, isdst, zone) \
+  do {                                                            \
+    time_zone::absolute_lookup al = tz.lookup(tp);                \
+    EXPECT_EQ(y, al.cs.year());                                   \
+    EXPECT_EQ(m, al.cs.month());                                  \
+    EXPECT_EQ(d, al.cs.day());                                    \
+    EXPECT_EQ(hh, al.cs.hour());                                  \
+    EXPECT_EQ(mm, al.cs.minute());                                \
+    EXPECT_EQ(ss, al.cs.second());                                \
+    EXPECT_EQ(off, al.offset);                                    \
+    EXPECT_TRUE(isdst == al.is_dst);                              \
+    /* EXPECT_STREQ(zone, al.abbr); */                            \
+  } while (0)
+
+// These tests sometimes run on platforms that have zoneinfo data so old
+// that the transition we are attempting to check does not exist, most
+// notably Android emulators.  Fortunately, AndroidZoneInfoSource supports
+// time_zone::version() so, in cases where we've learned that it matters,
+// we can make the check conditionally.
+int VersionCmp(time_zone tz, const std::string& target) {
+  std::string version = tz.version();
+  if (version.empty() && !target.empty()) return 1;  // unknown > known
+  return version.compare(target);
+}
+
+}  // namespace
+
+#if !defined(__EMSCRIPTEN__)
+TEST(TimeZones, LoadZonesConcurrently) {
+  std::promise<void> ready_promise;
+  std::shared_future<void> ready_future(ready_promise.get_future());
+  auto load_zones = [ready_future](std::promise<void>* started,
+                                   std::set<std::string>* failures) {
+    started->set_value();
+    ready_future.wait();
+    for (const char* const* np = kTimeZoneNames; *np != nullptr; ++np) {
+      std::string zone = *np;
+      time_zone tz;
+      if (load_time_zone(zone, &tz)) {
+        EXPECT_EQ(zone, tz.name());
+      } else {
+        failures->insert(zone);
+      }
+    }
+  };
+
+  const std::size_t n_threads = 128;
+  std::vector<std::thread> threads;
+  std::vector<std::set<std::string>> thread_failures(n_threads);
+  for (std::size_t i = 0; i != n_threads; ++i) {
+    std::promise<void> started;
+    threads.emplace_back(load_zones, &started, &thread_failures[i]);
+    started.get_future().wait();
+  }
+  ready_promise.set_value();
+  for (auto& thread : threads) {
+    thread.join();
+  }
+
+  // Allow a small number of failures to account for skew between
+  // the contents of kTimeZoneNames and the zoneinfo data source.
+#if defined(__ANDROID__)
+  // Cater to the possibility of using an even older zoneinfo data
+  // source when running on Android, where it is difficult to override
+  // the bionic tzdata provided by the test environment.
+  const std::size_t max_failures = 20;
+#else
+  const std::size_t max_failures = 3;
+#endif
+  std::set<std::string> failures;
+  for (const auto& thread_failure : thread_failures) {
+    failures.insert(thread_failure.begin(), thread_failure.end());
+  }
+  EXPECT_LE(failures.size(), max_failures) << testing::PrintToString(failures);
+}
+#endif
+
+TEST(TimeZone, NamedTimeZones) {
+  const time_zone utc = utc_time_zone();
+  EXPECT_EQ("UTC", utc.name());
+  const time_zone nyc = LoadZone("America/New_York");
+  EXPECT_EQ("America/New_York", nyc.name());
+  const time_zone syd = LoadZone("Australia/Sydney");
+  EXPECT_EQ("Australia/Sydney", syd.name());
+  const time_zone fixed0 =
+      fixed_time_zone(absl::time_internal::cctz::seconds::zero());
+  EXPECT_EQ("UTC", fixed0.name());
+  const time_zone fixed_pos = fixed_time_zone(
+      chrono::hours(3) + chrono::minutes(25) + chrono::seconds(45));
+  EXPECT_EQ("Fixed/UTC+03:25:45", fixed_pos.name());
+  const time_zone fixed_neg = fixed_time_zone(
+      -(chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56)));
+  EXPECT_EQ("Fixed/UTC-12:34:56", fixed_neg.name());
+}
+
+TEST(TimeZone, Failures) {
+  time_zone tz;
+  EXPECT_FALSE(load_time_zone(":America/Los_Angeles", &tz));
+
+  tz = LoadZone("America/Los_Angeles");
+  EXPECT_FALSE(load_time_zone("Invalid/TimeZone", &tz));
+  EXPECT_EQ(chrono::system_clock::from_time_t(0),
+            convert(civil_second(1970, 1, 1, 0, 0, 0), tz));  // UTC
+
+  // Ensures that the load still fails on a subsequent attempt.
+  tz = LoadZone("America/Los_Angeles");
+  EXPECT_FALSE(load_time_zone("Invalid/TimeZone", &tz));
+  EXPECT_EQ(chrono::system_clock::from_time_t(0),
+            convert(civil_second(1970, 1, 1, 0, 0, 0), tz));  // UTC
+
+  // Loading an empty string timezone should fail.
+  tz = LoadZone("America/Los_Angeles");
+  EXPECT_FALSE(load_time_zone("", &tz));
+  EXPECT_EQ(chrono::system_clock::from_time_t(0),
+            convert(civil_second(1970, 1, 1, 0, 0, 0), tz));  // UTC
+}
+
+TEST(TimeZone, Equality) {
+  const time_zone a;
+  const time_zone b;
+  EXPECT_EQ(a, b);
+  EXPECT_EQ(a.name(), b.name());
+
+  const time_zone implicit_utc;
+  const time_zone explicit_utc = utc_time_zone();
+  EXPECT_EQ(implicit_utc, explicit_utc);
+  EXPECT_EQ(implicit_utc.name(), explicit_utc.name());
+
+  const time_zone fixed_zero =
+      fixed_time_zone(absl::time_internal::cctz::seconds::zero());
+  EXPECT_EQ(fixed_zero, LoadZone(fixed_zero.name()));
+  EXPECT_EQ(fixed_zero, explicit_utc);
+
+  const time_zone fixed_utc = LoadZone("Fixed/UTC+00:00:00");
+  EXPECT_EQ(fixed_utc, LoadZone(fixed_utc.name()));
+  EXPECT_EQ(fixed_utc, explicit_utc);
+
+  const time_zone fixed_pos = fixed_time_zone(
+      chrono::hours(3) + chrono::minutes(25) + chrono::seconds(45));
+  EXPECT_EQ(fixed_pos, LoadZone(fixed_pos.name()));
+  EXPECT_NE(fixed_pos, explicit_utc);
+  const time_zone fixed_neg = fixed_time_zone(
+      -(chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56)));
+  EXPECT_EQ(fixed_neg, LoadZone(fixed_neg.name()));
+  EXPECT_NE(fixed_neg, explicit_utc);
+
+  const time_zone fixed_lim = fixed_time_zone(chrono::hours(24));
+  EXPECT_EQ(fixed_lim, LoadZone(fixed_lim.name()));
+  EXPECT_NE(fixed_lim, explicit_utc);
+  const time_zone fixed_ovfl =
+      fixed_time_zone(chrono::hours(24) + chrono::seconds(1));
+  EXPECT_EQ(fixed_ovfl, LoadZone(fixed_ovfl.name()));
+  EXPECT_EQ(fixed_ovfl, explicit_utc);
+
+  EXPECT_EQ(fixed_time_zone(chrono::seconds(1)),
+            fixed_time_zone(chrono::seconds(1)));
+
+  const time_zone local = local_time_zone();
+  EXPECT_EQ(local, LoadZone(local.name()));
+
+  time_zone la = LoadZone("America/Los_Angeles");
+  time_zone nyc = LoadZone("America/New_York");
+  EXPECT_NE(la, nyc);
+}
+
+TEST(StdChronoTimePoint, TimeTAlignment) {
+  // Ensures that the Unix epoch and the system clock epoch are an integral
+  // number of seconds apart. This simplifies conversions to/from time_t.
+  auto diff =
+      chrono::system_clock::time_point() - chrono::system_clock::from_time_t(0);
+  EXPECT_EQ(chrono::system_clock::time_point::duration::zero(),
+            diff % chrono::seconds(1));
+}
+
+TEST(BreakTime, TimePointResolution) {
+  const time_zone utc = utc_time_zone();
+  const auto t0 = chrono::system_clock::from_time_t(0);
+
+  ExpectTime(chrono::time_point_cast<chrono::nanoseconds>(t0), utc, 1970, 1, 1,
+             0, 0, 0, 0, false, "UTC");
+  ExpectTime(chrono::time_point_cast<chrono::microseconds>(t0), utc, 1970, 1, 1,
+             0, 0, 0, 0, false, "UTC");
+  ExpectTime(chrono::time_point_cast<chrono::milliseconds>(t0), utc, 1970, 1, 1,
+             0, 0, 0, 0, false, "UTC");
+  ExpectTime(chrono::time_point_cast<chrono::seconds>(t0), utc, 1970, 1, 1, 0,
+             0, 0, 0, false, "UTC");
+  ExpectTime(chrono::time_point_cast<absl::time_internal::cctz::seconds>(t0),
+             utc, 1970, 1, 1, 0, 0, 0, 0, false, "UTC");
+  ExpectTime(chrono::time_point_cast<chrono::minutes>(t0), utc, 1970, 1, 1, 0,
+             0, 0, 0, false, "UTC");
+  ExpectTime(chrono::time_point_cast<chrono::hours>(t0), utc, 1970, 1, 1, 0, 0,
+             0, 0, false, "UTC");
+}
+
+TEST(BreakTime, LocalTimeInUTC) {
+  const time_zone tz = utc_time_zone();
+  const auto tp = chrono::system_clock::from_time_t(0);
+  ExpectTime(tp, tz, 1970, 1, 1, 0, 0, 0, 0, false, "UTC");
+  EXPECT_EQ(weekday::thursday, get_weekday(convert(tp, tz)));
+}
+
+TEST(BreakTime, LocalTimeInUTCUnaligned) {
+  const time_zone tz = utc_time_zone();
+  const auto tp =
+      chrono::system_clock::from_time_t(0) - chrono::milliseconds(500);
+  ExpectTime(tp, tz, 1969, 12, 31, 23, 59, 59, 0, false, "UTC");
+  EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
+}
+
+TEST(BreakTime, LocalTimePosix) {
+  // See IEEE Std 1003.1-1988 B.2.3 General Terms, Epoch.
+  const time_zone tz = utc_time_zone();
+  const auto tp = chrono::system_clock::from_time_t(536457599);
+  ExpectTime(tp, tz, 1986, 12, 31, 23, 59, 59, 0, false, "UTC");
+  EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
+}
+
+TEST(TimeZoneImpl, LocalTimeInFixed) {
+  const absl::time_internal::cctz::seconds offset =
+      -(chrono::hours(8) + chrono::minutes(33) + chrono::seconds(47));
+  const time_zone tz = fixed_time_zone(offset);
+  const auto tp = chrono::system_clock::from_time_t(0);
+  ExpectTime(tp, tz, 1969, 12, 31, 15, 26, 13, offset.count(), false,
+             "-083347");
+  EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
+}
+
+TEST(BreakTime, LocalTimeInNewYork) {
+  const time_zone tz = LoadZone("America/New_York");
+  const auto tp = chrono::system_clock::from_time_t(45);
+  ExpectTime(tp, tz, 1969, 12, 31, 19, 0, 45, -5 * 60 * 60, false, "EST");
+  EXPECT_EQ(weekday::wednesday, get_weekday(convert(tp, tz)));
+}
+
+TEST(BreakTime, LocalTimeInMTV) {
+  const time_zone tz = LoadZone("America/Los_Angeles");
+  const auto tp = chrono::system_clock::from_time_t(1380855729);
+  ExpectTime(tp, tz, 2013, 10, 3, 20, 2, 9, -7 * 60 * 60, true, "PDT");
+  EXPECT_EQ(weekday::thursday, get_weekday(convert(tp, tz)));
+}
+
+TEST(BreakTime, LocalTimeInSydney) {
+  const time_zone tz = LoadZone("Australia/Sydney");
+  const auto tp = chrono::system_clock::from_time_t(90);
+  ExpectTime(tp, tz, 1970, 1, 1, 10, 1, 30, 10 * 60 * 60, false, "AEST");
+  EXPECT_EQ(weekday::thursday, get_weekday(convert(tp, tz)));
+}
+
+TEST(MakeTime, TimePointResolution) {
+  const time_zone utc = utc_time_zone();
+  const time_point<chrono::nanoseconds> tp_ns =
+      convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
+  EXPECT_EQ("04:05", format("%M:%E*S", tp_ns, utc));
+  const time_point<chrono::microseconds> tp_us =
+      convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
+  EXPECT_EQ("04:05", format("%M:%E*S", tp_us, utc));
+  const time_point<chrono::milliseconds> tp_ms =
+      convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
+  EXPECT_EQ("04:05", format("%M:%E*S", tp_ms, utc));
+  const time_point<chrono::seconds> tp_s =
+      convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
+  EXPECT_EQ("04:05", format("%M:%E*S", tp_s, utc));
+  const time_point<absl::time_internal::cctz::seconds> tp_s64 =
+      convert(civil_second(2015, 1, 2, 3, 4, 5), utc);
+  EXPECT_EQ("04:05", format("%M:%E*S", tp_s64, utc));
+
+  // These next two require chrono::time_point_cast because the conversion
+  // from a resolution of seconds (the return value of convert()) to a
+  // coarser resolution requires an explicit cast.
+  const time_point<chrono::minutes> tp_m =
+      chrono::time_point_cast<chrono::minutes>(
+          convert(civil_second(2015, 1, 2, 3, 4, 5), utc));
+  EXPECT_EQ("04:00", format("%M:%E*S", tp_m, utc));
+  const time_point<chrono::hours> tp_h = chrono::time_point_cast<chrono::hours>(
+      convert(civil_second(2015, 1, 2, 3, 4, 5), utc));
+  EXPECT_EQ("00:00", format("%M:%E*S", tp_h, utc));
+}
+
+TEST(MakeTime, Normalization) {
+  const time_zone tz = LoadZone("America/New_York");
+  const auto tp = convert(civil_second(2009, 2, 13, 18, 31, 30), tz);
+  EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp);
+
+  // Now requests for the same time_point but with out-of-range fields.
+  EXPECT_EQ(tp, convert(civil_second(2008, 14, 13, 18, 31, 30), tz));  // month
+  EXPECT_EQ(tp, convert(civil_second(2009, 1, 44, 18, 31, 30), tz));   // day
+  EXPECT_EQ(tp, convert(civil_second(2009, 2, 12, 42, 31, 30), tz));   // hour
+  EXPECT_EQ(tp, convert(civil_second(2009, 2, 13, 17, 91, 30), tz));   // minute
+  EXPECT_EQ(tp, convert(civil_second(2009, 2, 13, 18, 30, 90), tz));   // second
+}
+
+// NOTE: Run this with -ftrapv to detect overflow problems.
+TEST(MakeTime, SysSecondsLimits) {
+  const char RFC3339[] = "%Y-%m-%dT%H:%M:%S%Ez";
+  const time_zone utc = utc_time_zone();
+  const time_zone east = fixed_time_zone(chrono::hours(14));
+  const time_zone west = fixed_time_zone(-chrono::hours(14));
+  time_point<absl::time_internal::cctz::seconds> tp;
+
+  // Approach the maximal time_point<cctz::seconds> value from below.
+  tp = convert(civil_second(292277026596, 12, 4, 15, 30, 6), utc);
+  EXPECT_EQ("292277026596-12-04T15:30:06+00:00", format(RFC3339, tp, utc));
+  tp = convert(civil_second(292277026596, 12, 4, 15, 30, 7), utc);
+  EXPECT_EQ("292277026596-12-04T15:30:07+00:00", format(RFC3339, tp, utc));
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+  tp = convert(civil_second(292277026596, 12, 4, 15, 30, 8), utc);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+  tp = convert(civil_second::max(), utc);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+
+  // Checks that we can also get the maximal value for a far-east zone.
+  tp = convert(civil_second(292277026596, 12, 5, 5, 30, 7), east);
+  EXPECT_EQ("292277026596-12-05T05:30:07+14:00", format(RFC3339, tp, east));
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+  tp = convert(civil_second(292277026596, 12, 5, 5, 30, 8), east);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+  tp = convert(civil_second::max(), east);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+
+  // Checks that we can also get the maximal value for a far-west zone.
+  tp = convert(civil_second(292277026596, 12, 4, 1, 30, 7), west);
+  EXPECT_EQ("292277026596-12-04T01:30:07-14:00", format(RFC3339, tp, west));
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+  tp = convert(civil_second(292277026596, 12, 4, 7, 30, 8), west);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+  tp = convert(civil_second::max(), west);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp);
+
+  // Approach the minimal time_point<cctz::seconds> value from above.
+  tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 53), utc);
+  EXPECT_EQ("-292277022657-01-27T08:29:53+00:00", format(RFC3339, tp, utc));
+  tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 52), utc);
+  EXPECT_EQ("-292277022657-01-27T08:29:52+00:00", format(RFC3339, tp, utc));
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+  tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 51), utc);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+  tp = convert(civil_second::min(), utc);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+
+  // Checks that we can also get the minimal value for a far-east zone.
+  tp = convert(civil_second(-292277022657, 1, 27, 22, 29, 52), east);
+  EXPECT_EQ("-292277022657-01-27T22:29:52+14:00", format(RFC3339, tp, east));
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+  tp = convert(civil_second(-292277022657, 1, 27, 22, 29, 51), east);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+  tp = convert(civil_second::min(), east);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+
+  // Checks that we can also get the minimal value for a far-west zone.
+  tp = convert(civil_second(-292277022657, 1, 26, 18, 29, 52), west);
+  EXPECT_EQ("-292277022657-01-26T18:29:52-14:00", format(RFC3339, tp, west));
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+  tp = convert(civil_second(-292277022657, 1, 26, 18, 29, 51), west);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+  tp = convert(civil_second::min(), west);
+  EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp);
+
+  // Some similar checks for the "libc" time-zone implementation.
+  if (sizeof(std::time_t) >= 8) {
+    // Checks that "tm_year + 1900", as used by the "libc" implementation,
+    // can produce year values beyond the range on an int without overflow.
+#if defined(_WIN32) || defined(_WIN64)
+    // localtime_s() and gmtime_s() don't believe in years outside [1970:3000].
+#else
+    const time_zone utc = LoadZone("libc:UTC");
+    const year_t max_tm_year = year_t{std::numeric_limits<int>::max()} + 1900;
+    tp = convert(civil_second(max_tm_year, 12, 31, 23, 59, 59), utc);
+    EXPECT_EQ("2147485547-12-31T23:59:59+00:00", format(RFC3339, tp, utc));
+    const year_t min_tm_year = year_t{std::numeric_limits<int>::min()} + 1900;
+    tp = convert(civil_second(min_tm_year, 1, 1, 0, 0, 0), utc);
+    EXPECT_EQ("-2147481748-01-01T00:00:00+00:00", format(RFC3339, tp, utc));
+#endif
+  }
+}
+
+TEST(MakeTime, LocalTimeLibC) {
+  // Checks that cctz and libc agree on transition points in [1970:2037].
+  //
+  // We limit this test case to environments where:
+  //  1) we know how to change the time zone used by localtime()/mktime(),
+  //  2) cctz and localtime()/mktime() will use similar-enough tzdata, and
+  //  3) we have some idea about how mktime() behaves during transitions.
+#if defined(__linux__) && !defined(__ANDROID__)
+  const char* const ep = getenv("TZ");
+  std::string tz_name = (ep != nullptr) ? ep : "";
+  for (const char* const* np = kTimeZoneNames; *np != nullptr; ++np) {
+    ASSERT_EQ(0, setenv("TZ", *np, 1));  // change what "localtime" means
+    const auto zi = local_time_zone();
+    const auto lc = LoadZone("libc:localtime");
+    time_zone::civil_transition transition;
+    for (auto tp = zi.lookup(civil_second()).trans;
+         zi.next_transition(tp, &transition);
+         tp = zi.lookup(transition.to).trans) {
+      const auto fcl = zi.lookup(transition.from);
+      const auto tcl = zi.lookup(transition.to);
+      civil_second cs;  // compare cs in zi and lc
+      if (fcl.kind == time_zone::civil_lookup::UNIQUE) {
+        if (tcl.kind == time_zone::civil_lookup::UNIQUE) {
+          // Both unique; must be an is_dst or abbr change.
+          ASSERT_EQ(transition.from, transition.to);
+          const auto trans = fcl.trans;
+          const auto tal = zi.lookup(trans);
+          const auto tprev = trans - absl::time_internal::cctz::seconds(1);
+          const auto pal = zi.lookup(tprev);
+          if (pal.is_dst == tal.is_dst) {
+            ASSERT_STRNE(pal.abbr, tal.abbr);
+          }
+          continue;
+        }
+        ASSERT_EQ(time_zone::civil_lookup::REPEATED, tcl.kind);
+        cs = transition.to;
+      } else {
+        ASSERT_EQ(time_zone::civil_lookup::UNIQUE, tcl.kind);
+        ASSERT_EQ(time_zone::civil_lookup::SKIPPED, fcl.kind);
+        cs = transition.from;
+      }
+      if (cs.year() > 2037) break;  // limit test time (and to 32-bit time_t)
+      const auto cl_zi = zi.lookup(cs);
+      if (zi.lookup(cl_zi.pre).is_dst == zi.lookup(cl_zi.post).is_dst) {
+        // The "libc" implementation cannot correctly classify transitions
+        // that don't change the "tm_isdst" flag.  In Europe/Volgograd, for
+        // example, there is a SKIPPED transition from +03 to +04 with dst=F
+        // on both sides ...
+        //   1540681199 = 2018-10-28 01:59:59 +03:00:00 [dst=F off=10800]
+        //   1540681200 = 2018-10-28 03:00:00 +04:00:00 [dst=F off=14400]
+        // but std::mktime(2018-10-28 02:00:00, tm_isdst=0) fails, unlike,
+        // say, the similar Europe/Chisinau transition from +02 to +03 ...
+        //   1521935999 = 2018-03-25 01:59:59 +02:00:00 [dst=F off=7200]
+        //   1521936000 = 2018-03-25 03:00:00 +03:00:00 [dst=T off=10800]
+        // where std::mktime(2018-03-25 02:00:00, tm_isdst=0) succeeds and
+        // returns 1521936000.
+        continue;
+      }
+      if (cs == civil_second(2037, 10, 4, 2, 0, 0)) {
+        const std::string tzname = *np;
+        if (tzname == "Africa/Casablanca" || tzname == "Africa/El_Aaiun") {
+          // The "libc" implementation gets this transition wrong (at least
+          // until 2018g when it was removed), returning an offset of 3600
+          // instead of 0.  TODO: Revert this when 2018g is ubiquitous.
+          continue;
+        }
+      }
+      const auto cl_lc = lc.lookup(cs);
+      SCOPED_TRACE(testing::Message() << "For " << cs << " in " << *np);
+      EXPECT_EQ(cl_zi.kind, cl_lc.kind);
+      EXPECT_EQ(cl_zi.pre, cl_lc.pre);
+      EXPECT_EQ(cl_zi.trans, cl_lc.trans);
+      EXPECT_EQ(cl_zi.post, cl_lc.post);
+    }
+  }
+  if (ep == nullptr) {
+    ASSERT_EQ(0, unsetenv("TZ"));
+  } else {
+    ASSERT_EQ(0, setenv("TZ", tz_name.c_str(), 1));
+  }
+#endif
+}
+
+TEST(NextTransition, UTC) {
+  const auto tz = utc_time_zone();
+  time_zone::civil_transition trans;
+
+  auto tp = time_point<absl::time_internal::cctz::seconds>::min();
+  EXPECT_FALSE(tz.next_transition(tp, &trans));
+
+  tp = time_point<absl::time_internal::cctz::seconds>::max();
+  EXPECT_FALSE(tz.next_transition(tp, &trans));
+}
+
+TEST(PrevTransition, UTC) {
+  const auto tz = utc_time_zone();
+  time_zone::civil_transition trans;
+
+  auto tp = time_point<absl::time_internal::cctz::seconds>::max();
+  EXPECT_FALSE(tz.prev_transition(tp, &trans));
+
+  tp = time_point<absl::time_internal::cctz::seconds>::min();
+  EXPECT_FALSE(tz.prev_transition(tp, &trans));
+}
+
+TEST(NextTransition, AmericaNewYork) {
+  const auto tz = LoadZone("America/New_York");
+  time_zone::civil_transition trans;
+
+  auto tp = convert(civil_second(2018, 6, 30, 0, 0, 0), tz);
+  EXPECT_TRUE(tz.next_transition(tp, &trans));
+  EXPECT_EQ(civil_second(2018, 11, 4, 2, 0, 0), trans.from);
+  EXPECT_EQ(civil_second(2018, 11, 4, 1, 0, 0), trans.to);
+
+  tp = time_point<absl::time_internal::cctz::seconds>::max();
+  EXPECT_FALSE(tz.next_transition(tp, &trans));
+
+  tp = time_point<absl::time_internal::cctz::seconds>::min();
+  EXPECT_TRUE(tz.next_transition(tp, &trans));
+  if (trans.from == civil_second(1918, 3, 31, 2, 0, 0)) {
+    // It looks like the tzdata is only 32 bit (probably macOS),
+    // which bottoms out at 1901-12-13T20:45:52+00:00.
+    EXPECT_EQ(civil_second(1918, 3, 31, 3, 0, 0), trans.to);
+  } else {
+    EXPECT_EQ(civil_second(1883, 11, 18, 12, 3, 58), trans.from);
+    EXPECT_EQ(civil_second(1883, 11, 18, 12, 0, 0), trans.to);
+  }
+}
+
+TEST(PrevTransition, AmericaNewYork) {
+  const auto tz = LoadZone("America/New_York");
+  time_zone::civil_transition trans;
+
+  auto tp = convert(civil_second(2018, 6, 30, 0, 0, 0), tz);
+  EXPECT_TRUE(tz.prev_transition(tp, &trans));
+  EXPECT_EQ(civil_second(2018, 3, 11, 2, 0, 0), trans.from);
+  EXPECT_EQ(civil_second(2018, 3, 11, 3, 0, 0), trans.to);
+
+  tp = time_point<absl::time_internal::cctz::seconds>::min();
+  EXPECT_FALSE(tz.prev_transition(tp, &trans));
+
+  tp = time_point<absl::time_internal::cctz::seconds>::max();
+  EXPECT_TRUE(tz.prev_transition(tp, &trans));
+  // We have a transition but we don't know which one.
+}
+
+TEST(TimeZoneEdgeCase, AmericaNewYork) {
+  const time_zone tz = LoadZone("America/New_York");
+
+  // Spring 1:59:59 -> 3:00:00
+  auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -5 * 3600, false, "EST");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 3, 10, 3, 0, 0, -4 * 3600, true, "EDT");
+
+  // Fall 1:59:59 -> 1:00:00
+  tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -4 * 3600, true, "EDT");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 11, 3, 1, 0, 0, -5 * 3600, false, "EST");
+}
+
+TEST(TimeZoneEdgeCase, AmericaLosAngeles) {
+  const time_zone tz = LoadZone("America/Los_Angeles");
+
+  // Spring 1:59:59 -> 3:00:00
+  auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -8 * 3600, false, "PST");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 3, 10, 3, 0, 0, -7 * 3600, true, "PDT");
+
+  // Fall 1:59:59 -> 1:00:00
+  tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -7 * 3600, true, "PDT");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 11, 3, 1, 0, 0, -8 * 3600, false, "PST");
+}
+
+TEST(TimeZoneEdgeCase, ArizonaNoTransition) {
+  const time_zone tz = LoadZone("America/Phoenix");
+
+  // No transition in Spring.
+  auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -7 * 3600, false, "MST");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 3, 10, 2, 0, 0, -7 * 3600, false, "MST");
+
+  // No transition in Fall.
+  tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -7 * 3600, false, "MST");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 11, 3, 2, 0, 0, -7 * 3600, false, "MST");
+}
+
+TEST(TimeZoneEdgeCase, AsiaKathmandu) {
+  const time_zone tz = LoadZone("Asia/Kathmandu");
+
+  // A non-DST offset change from +0530 to +0545
+  //
+  //   504901799 == Tue, 31 Dec 1985 23:59:59 +0530 (+0530)
+  //   504901800 == Wed,  1 Jan 1986 00:15:00 +0545 (+0545)
+  auto tp = convert(civil_second(1985, 12, 31, 23, 59, 59), tz);
+  ExpectTime(tp, tz, 1985, 12, 31, 23, 59, 59, 5.5 * 3600, false, "+0530");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 1986, 1, 1, 0, 15, 0, 5.75 * 3600, false, "+0545");
+}
+
+TEST(TimeZoneEdgeCase, PacificChatham) {
+  const time_zone tz = LoadZone("Pacific/Chatham");
+
+  // One-hour DST offset changes, but at atypical values
+  //
+  //   1365256799 == Sun,  7 Apr 2013 03:44:59 +1345 (+1345)
+  //   1365256800 == Sun,  7 Apr 2013 02:45:00 +1245 (+1245)
+  auto tp = convert(civil_second(2013, 4, 7, 3, 44, 59), tz);
+  ExpectTime(tp, tz, 2013, 4, 7, 3, 44, 59, 13.75 * 3600, true, "+1345");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 4, 7, 2, 45, 0, 12.75 * 3600, false, "+1245");
+
+  //   1380376799 == Sun, 29 Sep 2013 02:44:59 +1245 (+1245)
+  //   1380376800 == Sun, 29 Sep 2013 03:45:00 +1345 (+1345)
+  tp = convert(civil_second(2013, 9, 29, 2, 44, 59), tz);
+  ExpectTime(tp, tz, 2013, 9, 29, 2, 44, 59, 12.75 * 3600, false, "+1245");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 9, 29, 3, 45, 0, 13.75 * 3600, true, "+1345");
+}
+
+TEST(TimeZoneEdgeCase, AustraliaLordHowe) {
+  const time_zone tz = LoadZone("Australia/Lord_Howe");
+
+  // Half-hour DST offset changes
+  //
+  //   1365260399 == Sun,  7 Apr 2013 01:59:59 +1100 (+11)
+  //   1365260400 == Sun,  7 Apr 2013 01:30:00 +1030 (+1030)
+  auto tp = convert(civil_second(2013, 4, 7, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 4, 7, 1, 59, 59, 11 * 3600, true, "+11");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 4, 7, 1, 30, 0, 10.5 * 3600, false, "+1030");
+
+  //   1380986999 == Sun,  6 Oct 2013 01:59:59 +1030 (+1030)
+  //   1380987000 == Sun,  6 Oct 2013 02:30:00 +1100 (+11)
+  tp = convert(civil_second(2013, 10, 6, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 2013, 10, 6, 1, 59, 59, 10.5 * 3600, false, "+1030");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2013, 10, 6, 2, 30, 0, 11 * 3600, true, "+11");
+}
+
+TEST(TimeZoneEdgeCase, PacificApia) {
+  const time_zone tz = LoadZone("Pacific/Apia");
+
+  // At the end of December 2011, Samoa jumped forward by one day,
+  // skipping 30 December from the local calendar, when the nation
+  // moved to the west of the International Date Line.
+  //
+  // A one-day, non-DST offset change
+  //
+  //   1325239199 == Thu, 29 Dec 2011 23:59:59 -1000 (-10)
+  //   1325239200 == Sat, 31 Dec 2011 00:00:00 +1400 (+14)
+  auto tp = convert(civil_second(2011, 12, 29, 23, 59, 59), tz);
+  ExpectTime(tp, tz, 2011, 12, 29, 23, 59, 59, -10 * 3600, true, "-10");
+  EXPECT_EQ(363, get_yearday(convert(tp, tz)));
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2011, 12, 31, 0, 0, 0, 14 * 3600, true, "+14");
+  EXPECT_EQ(365, get_yearday(convert(tp, tz)));
+}
+
+TEST(TimeZoneEdgeCase, AfricaCairo) {
+  const time_zone tz = LoadZone("Africa/Cairo");
+
+  if (VersionCmp(tz, "2014c") >= 0) {
+    // An interesting case of midnight not existing.
+    //
+    //   1400191199 == Thu, 15 May 2014 23:59:59 +0200 (EET)
+    //   1400191200 == Fri, 16 May 2014 01:00:00 +0300 (EEST)
+    auto tp = convert(civil_second(2014, 5, 15, 23, 59, 59), tz);
+    ExpectTime(tp, tz, 2014, 5, 15, 23, 59, 59, 2 * 3600, false, "EET");
+    tp += absl::time_internal::cctz::seconds(1);
+    ExpectTime(tp, tz, 2014, 5, 16, 1, 0, 0, 3 * 3600, true, "EEST");
+  }
+}
+
+TEST(TimeZoneEdgeCase, AfricaMonrovia) {
+  const time_zone tz = LoadZone("Africa/Monrovia");
+
+  if (VersionCmp(tz, "2017b") >= 0) {
+    // Strange offset change -00:44:30 -> +00:00:00 (non-DST)
+    //
+    //   63593069 == Thu,  6 Jan 1972 23:59:59 -0044 (MMT)
+    //   63593070 == Fri,  7 Jan 1972 00:44:30 +0000 (GMT)
+    auto tp = convert(civil_second(1972, 1, 6, 23, 59, 59), tz);
+    ExpectTime(tp, tz, 1972, 1, 6, 23, 59, 59, -44.5 * 60, false, "MMT");
+    tp += absl::time_internal::cctz::seconds(1);
+    ExpectTime(tp, tz, 1972, 1, 7, 0, 44, 30, 0 * 60, false, "GMT");
+  }
+}
+
+TEST(TimeZoneEdgeCase, AmericaJamaica) {
+  // Jamaica discontinued DST transitions in 1983, and is now at a
+  // constant -0500.  This makes it an interesting edge-case target.
+  // Note that the 32-bit times used in a (tzh_version == 0) zoneinfo
+  // file cannot represent the abbreviation-only transition of 1890,
+  // so we ignore the abbreviation by expecting what we received.
+  const time_zone tz = LoadZone("America/Jamaica");
+
+  // Before the first transition.
+  if (!tz.version().empty() && VersionCmp(tz, "2018d") >= 0) {
+    // We avoid the expectations on the -18430 offset below unless we are
+    // certain we have commit 907241e (Fix off-by-1 error for Jamaica and
+    // T&C before 1913) from 2018d.  TODO: Remove the "version() not empty"
+    // part when 2018d is generally available from /usr/share/zoneinfo.
+    auto tp = convert(civil_second(1889, 12, 31, 0, 0, 0), tz);
+    ExpectTime(tp, tz, 1889, 12, 31, 0, 0, 0, -18430, false,
+               tz.lookup(tp).abbr);
+
+    // Over the first (abbreviation-change only) transition.
+    //   -2524503170 == Tue, 31 Dec 1889 23:59:59 -0507 (LMT)
+    //   -2524503169 == Wed,  1 Jan 1890 00:00:00 -0507 (KMT)
+    tp = convert(civil_second(1889, 12, 31, 23, 59, 59), tz);
+    ExpectTime(tp, tz, 1889, 12, 31, 23, 59, 59, -18430, false,
+               tz.lookup(tp).abbr);
+    tp += absl::time_internal::cctz::seconds(1);
+    ExpectTime(tp, tz, 1890, 1, 1, 0, 0, 0, -18430, false, "KMT");
+  }
+
+  // Over the last (DST) transition.
+  //     436341599 == Sun, 30 Oct 1983 01:59:59 -0400 (EDT)
+  //     436341600 == Sun, 30 Oct 1983 01:00:00 -0500 (EST)
+  auto tp = convert(civil_second(1983, 10, 30, 1, 59, 59), tz);
+  ExpectTime(tp, tz, 1983, 10, 30, 1, 59, 59, -4 * 3600, true, "EDT");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 1983, 10, 30, 1, 0, 0, -5 * 3600, false, "EST");
+
+  // After the last transition.
+  tp = convert(civil_second(1983, 12, 31, 23, 59, 59), tz);
+  ExpectTime(tp, tz, 1983, 12, 31, 23, 59, 59, -5 * 3600, false, "EST");
+}
+
+TEST(TimeZoneEdgeCase, WET) {
+  // Cover some non-existent times within forward transitions.
+  const time_zone tz = LoadZone("WET");
+
+  // Before the first transition.
+  auto tp = convert(civil_second(1977, 1, 1, 0, 0, 0), tz);
+  ExpectTime(tp, tz, 1977, 1, 1, 0, 0, 0, 0, false, "WET");
+
+  // Over the first transition.
+  //     228877199 == Sun,  3 Apr 1977 00:59:59 +0000 (WET)
+  //     228877200 == Sun,  3 Apr 1977 02:00:00 +0100 (WEST)
+  tp = convert(civil_second(1977, 4, 3, 0, 59, 59), tz);
+  ExpectTime(tp, tz, 1977, 4, 3, 0, 59, 59, 0, false, "WET");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 1977, 4, 3, 2, 0, 0, 1 * 3600, true, "WEST");
+
+  // A non-existent time within the first transition.
+  time_zone::civil_lookup cl1 = tz.lookup(civil_second(1977, 4, 3, 1, 15, 0));
+  EXPECT_EQ(time_zone::civil_lookup::SKIPPED, cl1.kind);
+  ExpectTime(cl1.pre, tz, 1977, 4, 3, 2, 15, 0, 1 * 3600, true, "WEST");
+  ExpectTime(cl1.trans, tz, 1977, 4, 3, 2, 0, 0, 1 * 3600, true, "WEST");
+  ExpectTime(cl1.post, tz, 1977, 4, 3, 0, 15, 0, 0 * 3600, false, "WET");
+
+  // A non-existent time within the second forward transition.
+  time_zone::civil_lookup cl2 = tz.lookup(civil_second(1978, 4, 2, 1, 15, 0));
+  EXPECT_EQ(time_zone::civil_lookup::SKIPPED, cl2.kind);
+  ExpectTime(cl2.pre, tz, 1978, 4, 2, 2, 15, 0, 1 * 3600, true, "WEST");
+  ExpectTime(cl2.trans, tz, 1978, 4, 2, 2, 0, 0, 1 * 3600, true, "WEST");
+  ExpectTime(cl2.post, tz, 1978, 4, 2, 0, 15, 0, 0 * 3600, false, "WET");
+}
+
+TEST(TimeZoneEdgeCase, FixedOffsets) {
+  const time_zone gmtm5 = LoadZone("Etc/GMT+5");  // -0500
+  auto tp = convert(civil_second(1970, 1, 1, 0, 0, 0), gmtm5);
+  ExpectTime(tp, gmtm5, 1970, 1, 1, 0, 0, 0, -5 * 3600, false, "-05");
+  EXPECT_EQ(chrono::system_clock::from_time_t(5 * 3600), tp);
+
+  const time_zone gmtp5 = LoadZone("Etc/GMT-5");  // +0500
+  tp = convert(civil_second(1970, 1, 1, 0, 0, 0), gmtp5);
+  ExpectTime(tp, gmtp5, 1970, 1, 1, 0, 0, 0, 5 * 3600, false, "+05");
+  EXPECT_EQ(chrono::system_clock::from_time_t(-5 * 3600), tp);
+}
+
+TEST(TimeZoneEdgeCase, NegativeYear) {
+  // Tests transition from year 0 (aka 1BCE) to year -1.
+  const time_zone tz = utc_time_zone();
+  auto tp = convert(civil_second(0, 1, 1, 0, 0, 0), tz);
+  ExpectTime(tp, tz, 0, 1, 1, 0, 0, 0, 0 * 3600, false, "UTC");
+  EXPECT_EQ(weekday::saturday, get_weekday(convert(tp, tz)));
+  tp -= absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, -1, 12, 31, 23, 59, 59, 0 * 3600, false, "UTC");
+  EXPECT_EQ(weekday::friday, get_weekday(convert(tp, tz)));
+}
+
+TEST(TimeZoneEdgeCase, UTC32bitLimit) {
+  const time_zone tz = utc_time_zone();
+
+  // Limits of signed 32-bit time_t
+  //
+  //   2147483647 == Tue, 19 Jan 2038 03:14:07 +0000 (UTC)
+  //   2147483648 == Tue, 19 Jan 2038 03:14:08 +0000 (UTC)
+  auto tp = convert(civil_second(2038, 1, 19, 3, 14, 7), tz);
+  ExpectTime(tp, tz, 2038, 1, 19, 3, 14, 7, 0 * 3600, false, "UTC");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 2038, 1, 19, 3, 14, 8, 0 * 3600, false, "UTC");
+}
+
+TEST(TimeZoneEdgeCase, UTC5DigitYear) {
+  const time_zone tz = utc_time_zone();
+
+  // Rollover to 5-digit year
+  //
+  //   253402300799 == Fri, 31 Dec 9999 23:59:59 +0000 (UTC)
+  //   253402300800 == Sat,  1 Jan 1000 00:00:00 +0000 (UTC)
+  auto tp = convert(civil_second(9999, 12, 31, 23, 59, 59), tz);
+  ExpectTime(tp, tz, 9999, 12, 31, 23, 59, 59, 0 * 3600, false, "UTC");
+  tp += absl::time_internal::cctz::seconds(1);
+  ExpectTime(tp, tz, 10000, 1, 1, 0, 0, 0, 0 * 3600, false, "UTC");
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_posix.cc b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_posix.cc
new file mode 100644
index 0000000000..5cdd09e89d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_posix.cc
@@ -0,0 +1,159 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "time_zone_posix.h"
+
+#include <cstddef>
+#include <cstring>
+#include <limits>
+#include <string>
+
+#include "absl/base/config.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+namespace {
+
+const char kDigits[] = "0123456789";
+
+const char* ParseInt(const char* p, int min, int max, int* vp) {
+  int value = 0;
+  const char* op = p;
+  const int kMaxInt = std::numeric_limits<int>::max();
+  for (; const char* dp = strchr(kDigits, *p); ++p) {
+    int d = static_cast<int>(dp - kDigits);
+    if (d >= 10) break;  // '\0'
+    if (value > kMaxInt / 10) return nullptr;
+    value *= 10;
+    if (value > kMaxInt - d) return nullptr;
+    value += d;
+  }
+  if (p == op || value < min || value > max) return nullptr;
+  *vp = value;
+  return p;
+}
+
+// abbr = <.*?> | [^-+,\d]{3,}
+const char* ParseAbbr(const char* p, std::string* abbr) {
+  const char* op = p;
+  if (*p == '<') {  // special zoneinfo <...> form
+    while (*++p != '>') {
+      if (*p == '\0') return nullptr;
+    }
+    abbr->assign(op + 1, static_cast<std::size_t>(p - op) - 1);
+    return ++p;
+  }
+  while (*p != '\0') {
+    if (strchr("-+,", *p)) break;
+    if (strchr(kDigits, *p)) break;
+    ++p;
+  }
+  if (p - op < 3) return nullptr;
+  abbr->assign(op, static_cast<std::size_t>(p - op));
+  return p;
+}
+
+// offset = [+|-]hh[:mm[:ss]] (aggregated into single seconds value)
+const char* ParseOffset(const char* p, int min_hour, int max_hour, int sign,
+                        std::int_fast32_t* offset) {
+  if (p == nullptr) return nullptr;
+  if (*p == '+' || *p == '-') {
+    if (*p++ == '-') sign = -sign;
+  }
+  int hours = 0;
+  int minutes = 0;
+  int seconds = 0;
+
+  p = ParseInt(p, min_hour, max_hour, &hours);
+  if (p == nullptr) return nullptr;
+  if (*p == ':') {
+    p = ParseInt(p + 1, 0, 59, &minutes);
+    if (p == nullptr) return nullptr;
+    if (*p == ':') {
+      p = ParseInt(p + 1, 0, 59, &seconds);
+      if (p == nullptr) return nullptr;
+    }
+  }
+  *offset = sign * ((((hours * 60) + minutes) * 60) + seconds);
+  return p;
+}
+
+// datetime = ( Jn | n | Mm.w.d ) [ / offset ]
+const char* ParseDateTime(const char* p, PosixTransition* res) {
+  if (p != nullptr && *p == ',') {
+    if (*++p == 'M') {
+      int month = 0;
+      if ((p = ParseInt(p + 1, 1, 12, &month)) != nullptr && *p == '.') {
+        int week = 0;
+        if ((p = ParseInt(p + 1, 1, 5, &week)) != nullptr && *p == '.') {
+          int weekday = 0;
+          if ((p = ParseInt(p + 1, 0, 6, &weekday)) != nullptr) {
+            res->date.fmt = PosixTransition::M;
+            res->date.m.month = static_cast<std::int_fast8_t>(month);
+            res->date.m.week = static_cast<std::int_fast8_t>(week);
+            res->date.m.weekday = static_cast<std::int_fast8_t>(weekday);
+          }
+        }
+      }
+    } else if (*p == 'J') {
+      int day = 0;
+      if ((p = ParseInt(p + 1, 1, 365, &day)) != nullptr) {
+        res->date.fmt = PosixTransition::J;
+        res->date.j.day = static_cast<std::int_fast16_t>(day);
+      }
+    } else {
+      int day = 0;
+      if ((p = ParseInt(p, 0, 365, &day)) != nullptr) {
+        res->date.fmt = PosixTransition::N;
+        res->date.n.day = static_cast<std::int_fast16_t>(day);
+      }
+    }
+  }
+  if (p != nullptr) {
+    res->time.offset = 2 * 60 * 60;  // default offset is 02:00:00
+    if (*p == '/') p = ParseOffset(p + 1, -167, 167, 1, &res->time.offset);
+  }
+  return p;
+}
+
+}  // namespace
+
+// spec = std offset [ dst [ offset ] , datetime , datetime ]
+bool ParsePosixSpec(const std::string& spec, PosixTimeZone* res) {
+  const char* p = spec.c_str();
+  if (*p == ':') return false;
+
+  p = ParseAbbr(p, &res->std_abbr);
+  p = ParseOffset(p, 0, 24, -1, &res->std_offset);
+  if (p == nullptr) return false;
+  if (*p == '\0') return true;
+
+  p = ParseAbbr(p, &res->dst_abbr);
+  if (p == nullptr) return false;
+  res->dst_offset = res->std_offset + (60 * 60);  // default
+  if (*p != ',') p = ParseOffset(p, 0, 24, -1, &res->dst_offset);
+
+  p = ParseDateTime(p, &res->dst_start);
+  p = ParseDateTime(p, &res->dst_end);
+
+  return p != nullptr && *p == '\0';
+}
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_posix.h b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_posix.h
new file mode 100644
index 0000000000..0cf29055f5
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/time_zone_posix.h
@@ -0,0 +1,132 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+// Parsing of a POSIX zone spec as described in the TZ part of section 8.3 in
+// http://pubs.opengroup.org/onlinepubs/009695399/basedefs/xbd_chap08.html.
+//
+// The current POSIX spec for America/Los_Angeles is "PST8PDT,M3.2.0,M11.1.0",
+// which would be broken down as ...
+//
+//   PosixTimeZone {
+//     std_abbr = "PST"
+//     std_offset = -28800
+//     dst_abbr = "PDT"
+//     dst_offset = -25200
+//     dst_start = PosixTransition {
+//       date {
+//         m {
+//           month = 3
+//           week = 2
+//           weekday = 0
+//         }
+//       }
+//       time {
+//         offset = 7200
+//       }
+//     }
+//     dst_end = PosixTransition {
+//       date {
+//         m {
+//           month = 11
+//           week = 1
+//           weekday = 0
+//         }
+//       }
+//       time {
+//         offset = 7200
+//       }
+//     }
+//   }
+
+#ifndef ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_POSIX_H_
+#define ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_POSIX_H_
+
+#include <cstdint>
+#include <string>
+
+#include "absl/base/config.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// The date/time of the transition. The date is specified as either:
+// (J) the Nth day of the year (1 <= N <= 365), excluding leap days, or
+// (N) the Nth day of the year (0 <= N <= 365), including leap days, or
+// (M) the Nth weekday of a month (e.g., the 2nd Sunday in March).
+// The time, specified as a day offset, identifies the particular moment
+// of the transition, and may be negative or >= 24h, and in which case
+// it would take us to another day, and perhaps week, or even month.
+struct PosixTransition {
+  enum DateFormat { J, N, M };
+
+  struct Date {
+    struct NonLeapDay {
+      std::int_fast16_t day;  // day of non-leap year [1:365]
+    };
+    struct Day {
+      std::int_fast16_t day;  // day of year [0:365]
+    };
+    struct MonthWeekWeekday {
+      std::int_fast8_t month;    // month of year [1:12]
+      std::int_fast8_t week;     // week of month [1:5] (5==last)
+      std::int_fast8_t weekday;  // 0==Sun, ..., 6=Sat
+    };
+
+    DateFormat fmt;
+
+    union {
+      NonLeapDay j;
+      Day n;
+      MonthWeekWeekday m;
+    };
+  };
+
+  struct Time {
+    std::int_fast32_t offset;  // seconds before/after 00:00:00
+  };
+
+  Date date;
+  Time time;
+};
+
+// The entirety of a POSIX-string specified time-zone rule. The standard
+// abbreviation and offset are always given. If the time zone includes
+// daylight saving, then the daylight abbrevation is non-empty and the
+// remaining fields are also valid. Note that the start/end transitions
+// are not ordered---in the southern hemisphere the transition to end
+// daylight time occurs first in any particular year.
+struct PosixTimeZone {
+  std::string std_abbr;
+  std::int_fast32_t std_offset;
+
+  std::string dst_abbr;
+  std::int_fast32_t dst_offset;
+  PosixTransition dst_start;
+  PosixTransition dst_end;
+};
+
+// Breaks down a POSIX time-zone specification into its constituent pieces,
+// filling in any missing values (DST offset, or start/end transition times)
+// with the standard-defined defaults. Returns false if the specification
+// could not be parsed (although some fields of *res may have been altered).
+bool ParsePosixSpec(const std::string& spec, PosixTimeZone* res);
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_CCTZ_TIME_ZONE_POSIX_H_
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/tzfile.h b/third_party/abseil_cpp/absl/time/internal/cctz/src/tzfile.h
new file mode 100644
index 0000000000..269fa36c53
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/tzfile.h
@@ -0,0 +1,122 @@
+/* Layout and location of TZif files.  */
+
+#ifndef TZFILE_H
+
+#define TZFILE_H
+
+/*
+** This file is in the public domain, so clarified as of
+** 1996-06-05 by Arthur David Olson.
+*/
+
+/*
+** This header is for use ONLY with the time conversion code.
+** There is no guarantee that it will remain unchanged,
+** or that it will remain at all.
+** Do NOT copy it to any system include directory.
+** Thank you!
+*/
+
+/*
+** Information about time zone files.
+*/
+
+#ifndef TZDIR
+#define TZDIR "/usr/share/zoneinfo" /* Time zone object file directory */
+#endif                              /* !defined TZDIR */
+
+#ifndef TZDEFAULT
+#define TZDEFAULT "/etc/localtime"
+#endif /* !defined TZDEFAULT */
+
+#ifndef TZDEFRULES
+#define TZDEFRULES "posixrules"
+#endif /* !defined TZDEFRULES */
+
+/* See Internet RFC 8536 for more details about the following format.  */
+
+/*
+** Each file begins with. . .
+*/
+
+#define TZ_MAGIC "TZif"
+
+struct tzhead {
+  char tzh_magic[4];      /* TZ_MAGIC */
+  char tzh_version[1];    /* '\0' or '2' or '3' as of 2013 */
+  char tzh_reserved[15];  /* reserved; must be zero */
+  char tzh_ttisutcnt[4];  /* coded number of trans. time flags */
+  char tzh_ttisstdcnt[4]; /* coded number of trans. time flags */
+  char tzh_leapcnt[4];    /* coded number of leap seconds */
+  char tzh_timecnt[4];    /* coded number of transition times */
+  char tzh_typecnt[4];    /* coded number of local time types */
+  char tzh_charcnt[4];    /* coded number of abbr. chars */
+};
+
+/*
+** . . .followed by. . .
+**
+**	tzh_timecnt (char [4])s		coded transition times a la time(2)
+**	tzh_timecnt (unsigned char)s	types of local time starting at above
+**	tzh_typecnt repetitions of
+**		one (char [4])		coded UT offset in seconds
+**		one (unsigned char)	used to set tm_isdst
+**		one (unsigned char)	that's an abbreviation list index
+**	tzh_charcnt (char)s		'\0'-terminated zone abbreviations
+**	tzh_leapcnt repetitions of
+**		one (char [4])		coded leap second transition times
+**		one (char [4])		total correction after above
+**	tzh_ttisstdcnt (char)s		indexed by type; if 1, transition
+**					time is standard time, if 0,
+**					transition time is local (wall clock)
+**					time; if absent, transition times are
+**					assumed to be local time
+**	tzh_ttisutcnt (char)s		indexed by type; if 1, transition
+**					time is UT, if 0, transition time is
+**					local time; if absent, transition
+**					times are assumed to be local time.
+**					When this is 1, the corresponding
+**					std/wall indicator must also be 1.
+*/
+
+/*
+** If tzh_version is '2' or greater, the above is followed by a second instance
+** of tzhead and a second instance of the data in which each coded transition
+** time uses 8 rather than 4 chars,
+** then a POSIX-TZ-environment-variable-style string for use in handling
+** instants after the last transition time stored in the file
+** (with nothing between the newlines if there is no POSIX representation for
+** such instants).
+**
+** If tz_version is '3' or greater, the above is extended as follows.
+** First, the POSIX TZ string's hour offset may range from -167
+** through 167 as compared to the POSIX-required 0 through 24.
+** Second, its DST start time may be January 1 at 00:00 and its stop
+** time December 31 at 24:00 plus the difference between DST and
+** standard time, indicating DST all year.
+*/
+
+/*
+** In the current implementation, "tzset()" refuses to deal with files that
+** exceed any of the limits below.
+*/
+
+#ifndef TZ_MAX_TIMES
+#define TZ_MAX_TIMES 2000
+#endif /* !defined TZ_MAX_TIMES */
+
+#ifndef TZ_MAX_TYPES
+/* This must be at least 17 for Europe/Samara and Europe/Vilnius.  */
+#define TZ_MAX_TYPES 256 /* Limited by what (unsigned char)'s can hold */
+#endif                   /* !defined TZ_MAX_TYPES */
+
+#ifndef TZ_MAX_CHARS
+#define TZ_MAX_CHARS 50 /* Maximum number of abbreviation characters */
+                        /* (limited by what unsigned chars can hold) */
+#endif                  /* !defined TZ_MAX_CHARS */
+
+#ifndef TZ_MAX_LEAPS
+#define TZ_MAX_LEAPS 50 /* Maximum number of leap second corrections */
+#endif                  /* !defined TZ_MAX_LEAPS */
+
+#endif /* !defined TZFILE_H */
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/src/zone_info_source.cc b/third_party/abseil_cpp/absl/time/internal/cctz/src/zone_info_source.cc
new file mode 100644
index 0000000000..98ea161267
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/src/zone_info_source.cc
@@ -0,0 +1,115 @@
+// Copyright 2016 Google Inc. All Rights Reserved.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//   https://www.apache.org/licenses/LICENSE-2.0
+//
+//   Unless required by applicable law or agreed to in writing, software
+//   distributed under the License is distributed on an "AS IS" BASIS,
+//   WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+//   See the License for the specific language governing permissions and
+//   limitations under the License.
+
+#include "absl/time/internal/cctz/include/cctz/zone_info_source.h"
+
+#include "absl/base/config.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz {
+
+// Defined out-of-line to avoid emitting a weak vtable in all TUs.
+ZoneInfoSource::~ZoneInfoSource() {}
+std::string ZoneInfoSource::Version() const { return std::string(); }
+
+}  // namespace cctz
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz_extension {
+
+namespace {
+
+// A default for cctz_extension::zone_info_source_factory, which simply
+// defers to the fallback factory.
+std::unique_ptr<absl::time_internal::cctz::ZoneInfoSource> DefaultFactory(
+    const std::string& name,
+    const std::function<
+        std::unique_ptr<absl::time_internal::cctz::ZoneInfoSource>(
+            const std::string& name)>& fallback_factory) {
+  return fallback_factory(name);
+}
+
+}  // namespace
+
+// A "weak" definition for cctz_extension::zone_info_source_factory.
+// The user may override this with their own "strong" definition (see
+// zone_info_source.h).
+#if !defined(__has_attribute)
+#define __has_attribute(x) 0
+#endif
+// MinGW is GCC on Windows, so while it asserts __has_attribute(weak), the
+// Windows linker cannot handle that. Nor does the MinGW compiler know how to
+// pass "#pragma comment(linker, ...)" to the Windows linker.
+#if (__has_attribute(weak) || defined(__GNUC__)) && !defined(__MINGW32__)
+ZoneInfoSourceFactory zone_info_source_factory __attribute__((weak)) =
+    DefaultFactory;
+#elif defined(_MSC_VER) && !defined(__MINGW32__) && !defined(_LIBCPP_VERSION)
+extern ZoneInfoSourceFactory zone_info_source_factory;
+extern ZoneInfoSourceFactory default_factory;
+ZoneInfoSourceFactory default_factory = DefaultFactory;
+#if defined(_M_IX86)
+#pragma comment(                                                                                                         \
+    linker,                                                                                                              \
+    "/alternatename:?zone_info_source_factory@cctz_extension@time_internal@" ABSL_INTERNAL_MANGLED_NS                    \
+    "@@3P6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                                 \
+    "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                                   \
+    "@@@std@@@std@@ABV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@" ABSL_INTERNAL_MANGLED_BACKREFERENCE      \
+    "@ABV?$function@$$A6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                   \
+    "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                                   \
+    "@@@std@@@std@@ABV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@2@@Z@" ABSL_INTERNAL_MANGLED_BACKREFERENCE \
+    "@@ZA=?default_factory@cctz_extension@time_internal@" ABSL_INTERNAL_MANGLED_NS                                       \
+    "@@3P6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                                 \
+    "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                                   \
+    "@@@std@@@std@@ABV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@" ABSL_INTERNAL_MANGLED_BACKREFERENCE      \
+    "@ABV?$function@$$A6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                   \
+    "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                                   \
+    "@@@std@@@std@@ABV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@2@@Z@" ABSL_INTERNAL_MANGLED_BACKREFERENCE \
+    "@@ZA")
+#elif defined(_M_IA_64) || defined(_M_AMD64) || defined(_M_ARM64)
+#pragma comment(                                                                                                          \
+    linker,                                                                                                               \
+    "/alternatename:?zone_info_source_factory@cctz_extension@time_internal@" ABSL_INTERNAL_MANGLED_NS                     \
+    "@@3P6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                                  \
+    "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                                    \
+    "@@@std@@@std@@AEBV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@" ABSL_INTERNAL_MANGLED_BACKREFERENCE      \
+    "@AEBV?$function@$$A6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                   \
+    "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                                    \
+    "@@@std@@@std@@AEBV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@2@@Z@" ABSL_INTERNAL_MANGLED_BACKREFERENCE \
+    "@@ZEA=?default_factory@cctz_extension@time_internal@" ABSL_INTERNAL_MANGLED_NS                                       \
+    "@@3P6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                                  \
+    "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                                    \
+    "@@@std@@@std@@AEBV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@" ABSL_INTERNAL_MANGLED_BACKREFERENCE      \
+    "@AEBV?$function@$$A6A?AV?$unique_ptr@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                   \
+    "@@U?$default_delete@VZoneInfoSource@cctz@time_internal@" ABSL_INTERNAL_MANGLED_NS                                    \
+    "@@@std@@@std@@AEBV?$basic_string@DU?$char_traits@D@std@@V?$allocator@D@2@@2@@Z@" ABSL_INTERNAL_MANGLED_BACKREFERENCE \
+    "@@ZEA")
+#else
+#error Unsupported MSVC platform
+#endif  // _M_<PLATFORM>
+#else
+// Make it a "strong" definition if we have no other choice.
+ZoneInfoSourceFactory zone_info_source_factory = DefaultFactory;
+#endif
+
+}  // namespace cctz_extension
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/README.zoneinfo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/README.zoneinfo
new file mode 100644
index 0000000000..95fb4a91d1
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/README.zoneinfo
@@ -0,0 +1,37 @@
+testdata/zoneinfo contains time-zone data files that may be used with CCTZ.
+Install them in a location referenced by the ${TZDIR} environment variable.
+Symbolic and hard links have been eliminated for portability.
+
+On Linux systems the distribution's versions of these files can probably
+already be found in the default ${TZDIR} location, /usr/share/zoneinfo.
+
+New versions can be generated using the following shell script.
+
+  #!/bin/sh -
+  set -e
+  DESTDIR=$(mktemp -d)
+  trap "rm -fr ${DESTDIR}" 0 2 15
+  (
+    cd ${DESTDIR}
+    git clone https://github.com/eggert/tz.git
+    make --directory=tz \
+        install DESTDIR=${DESTDIR} \
+                DATAFORM=vanguard \
+                TZDIR=/zoneinfo \
+                REDO=posix_only \
+                LOCALTIME=Factory \
+                TZDATA_TEXT= \
+                ZONETABLES=zone1970.tab
+    tar --create --dereference --hard-dereference --file tzfile.tar \
+        --directory=tz tzfile.h
+    tar --create --dereference --hard-dereference --file zoneinfo.tar \
+        --exclude=zoneinfo/posixrules zoneinfo \
+        --directory=tz version
+  )
+  tar --extract --directory src --file ${DESTDIR}/tzfile.tar
+  tar --extract --directory testdata --file ${DESTDIR}/zoneinfo.tar
+  exit 0
+
+To run the CCTZ tests using the testdata/zoneinfo files, execute:
+
+  bazel test --test_env=TZDIR=${PWD}/testdata/zoneinfo ...
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/version b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/version
new file mode 100644
index 0000000000..7f680eec36
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/version
@@ -0,0 +1 @@
+2020a
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Abidjan b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Abidjan
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Abidjan
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Accra b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Accra
new file mode 100644
index 0000000000..697b9933eb
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Accra
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Addis_Ababa b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Addis_Ababa
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Addis_Ababa
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Algiers b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Algiers
new file mode 100644
index 0000000000..ae04342313
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Algiers
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmara b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmara
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmara
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmera b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmera
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Asmera
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bamako b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bamako
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bamako
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bangui b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bangui
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bangui
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Banjul b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Banjul
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Banjul
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bissau b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bissau
new file mode 100644
index 0000000000..82ea5aaf0c
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bissau
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Blantyre b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Blantyre
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Blantyre
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Brazzaville b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Brazzaville
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Brazzaville
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bujumbura b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bujumbura
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Bujumbura
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Cairo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Cairo
new file mode 100644
index 0000000000..d3f819623f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Cairo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Casablanca b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Casablanca
new file mode 100644
index 0000000000..d39016b89d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Casablanca
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ceuta b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ceuta
new file mode 100644
index 0000000000..850c8f06fa
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ceuta
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Conakry b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Conakry
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Conakry
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dakar b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dakar
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dakar
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dar_es_Salaam b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dar_es_Salaam
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Dar_es_Salaam
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Djibouti b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Djibouti
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Djibouti
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Douala b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Douala
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Douala
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/El_Aaiun b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/El_Aaiun
new file mode 100644
index 0000000000..066fbed008
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/El_Aaiun
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Freetown b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Freetown
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Freetown
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Gaborone b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Gaborone
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Gaborone
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Harare b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Harare
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Harare
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Johannesburg b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Johannesburg
new file mode 100644
index 0000000000..b1c425dace
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Johannesburg
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Juba b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Juba
new file mode 100644
index 0000000000..625b1acccf
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Juba
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kampala b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kampala
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kampala
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Khartoum b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Khartoum
new file mode 100644
index 0000000000..8ee8cb92e7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Khartoum
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kigali b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kigali
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kigali
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kinshasa b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kinshasa
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Kinshasa
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lagos b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lagos
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lagos
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Libreville b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Libreville
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Libreville
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lome b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lome
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lome
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Luanda b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Luanda
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Luanda
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lubumbashi b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lubumbashi
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lubumbashi
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lusaka b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lusaka
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Lusaka
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Malabo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Malabo
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Malabo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maputo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maputo
new file mode 100644
index 0000000000..52753c0f87
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maputo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maseru b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maseru
new file mode 100644
index 0000000000..b1c425dace
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Maseru
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mbabane b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mbabane
new file mode 100644
index 0000000000..b1c425dace
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mbabane
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mogadishu b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mogadishu
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Mogadishu
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Monrovia b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Monrovia
new file mode 100644
index 0000000000..6d688502a1
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Monrovia
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nairobi b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nairobi
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nairobi
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ndjamena b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ndjamena
new file mode 100644
index 0000000000..a968845e29
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ndjamena
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Niamey b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Niamey
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Niamey
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nouakchott b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nouakchott
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Nouakchott
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ouagadougou b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ouagadougou
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Ouagadougou
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Porto-Novo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Porto-Novo
new file mode 100644
index 0000000000..0c80137c74
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Porto-Novo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Sao_Tome b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Sao_Tome
new file mode 100644
index 0000000000..59f3759c40
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Sao_Tome
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Timbuktu b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Timbuktu
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Timbuktu
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tripoli b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tripoli
new file mode 100644
index 0000000000..07b393bb7d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tripoli
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tunis b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tunis
new file mode 100644
index 0000000000..427fa56303
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Tunis
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Windhoek b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Windhoek
new file mode 100644
index 0000000000..abecd137b1
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Africa/Windhoek
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Adak b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Adak
new file mode 100644
index 0000000000..43236498f6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Adak
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anchorage b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anchorage
new file mode 100644
index 0000000000..9bbb2fd3b3
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anchorage
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anguilla b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anguilla
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Anguilla
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Antigua b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Antigua
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Antigua
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Araguaina b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Araguaina
new file mode 100644
index 0000000000..49381b4108
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Araguaina
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Buenos_Aires b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Buenos_Aires
new file mode 100644
index 0000000000..260f86a918
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Buenos_Aires
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Catamarca b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Catamarca
new file mode 100644
index 0000000000..0ae222a2f8
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Catamarca
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/ComodRivadavia b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/ComodRivadavia
new file mode 100644
index 0000000000..0ae222a2f8
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/ComodRivadavia
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Cordoba b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Cordoba
new file mode 100644
index 0000000000..da4c23a545
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Cordoba
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Jujuy b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Jujuy
new file mode 100644
index 0000000000..604b856636
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Jujuy
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/La_Rioja b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/La_Rioja
new file mode 100644
index 0000000000..2218e36bfd
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/La_Rioja
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Mendoza b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Mendoza
new file mode 100644
index 0000000000..f9e677f171
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Mendoza
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Rio_Gallegos b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Rio_Gallegos
new file mode 100644
index 0000000000..c36587e1c2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Rio_Gallegos
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Salta b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Salta
new file mode 100644
index 0000000000..0e797f2215
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Salta
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Juan b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Juan
new file mode 100644
index 0000000000..2698495bb3
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Juan
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Luis b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Luis
new file mode 100644
index 0000000000..fe50f6211c
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/San_Luis
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Tucuman b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Tucuman
new file mode 100644
index 0000000000..c954000ba9
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Tucuman
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Ushuaia b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Ushuaia
new file mode 100644
index 0000000000..3643628a24
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Argentina/Ushuaia
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Aruba b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Aruba
new file mode 100644
index 0000000000..f7ab6efcc0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Aruba
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Asuncion b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Asuncion
new file mode 100644
index 0000000000..2f3bbda6d3
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Asuncion
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atikokan b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atikokan
new file mode 100644
index 0000000000..629ed42319
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atikokan
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atka b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atka
new file mode 100644
index 0000000000..43236498f6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Atka
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia
new file mode 100644
index 0000000000..15808d30fb
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia_Banderas b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia_Banderas
new file mode 100644
index 0000000000..896af3f56a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bahia_Banderas
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Barbados b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Barbados
new file mode 100644
index 0000000000..9b90e306a6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Barbados
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belem b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belem
new file mode 100644
index 0000000000..60b5924dc1
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belem
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belize b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belize
new file mode 100644
index 0000000000..851051ae94
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Belize
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Blanc-Sablon b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Blanc-Sablon
new file mode 100644
index 0000000000..f9f13a1679
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Blanc-Sablon
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boa_Vista b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boa_Vista
new file mode 100644
index 0000000000..978c33100f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boa_Vista
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bogota b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bogota
new file mode 100644
index 0000000000..b2647d7a83
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Bogota
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boise b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boise
new file mode 100644
index 0000000000..f8d54e2747
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Boise
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Buenos_Aires b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Buenos_Aires
new file mode 100644
index 0000000000..260f86a918
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Buenos_Aires
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cambridge_Bay b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cambridge_Bay
new file mode 100644
index 0000000000..f8db4b6ebf
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cambridge_Bay
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Campo_Grande b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Campo_Grande
new file mode 100644
index 0000000000..81206247d9
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Campo_Grande
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cancun b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cancun
new file mode 100644
index 0000000000..f907f0a5ba
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cancun
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Caracas b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Caracas
new file mode 100644
index 0000000000..eedf725e8d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Caracas
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Catamarca b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Catamarca
new file mode 100644
index 0000000000..0ae222a2f8
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Catamarca
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cayenne b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cayenne
new file mode 100644
index 0000000000..e5bc06fdbe
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cayenne
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cayman b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cayman
new file mode 100644
index 0000000000..9964b9a334
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cayman
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chicago b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chicago
new file mode 100644
index 0000000000..a5b1617c7f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chicago
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chihuahua b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chihuahua
new file mode 100644
index 0000000000..8ed5f93b02
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Chihuahua
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Coral_Harbour b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Coral_Harbour
new file mode 100644
index 0000000000..629ed42319
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Coral_Harbour
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cordoba b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cordoba
new file mode 100644
index 0000000000..da4c23a545
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cordoba
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Costa_Rica b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Costa_Rica
new file mode 100644
index 0000000000..37cb85e4db
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Costa_Rica
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Creston b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Creston
new file mode 100644
index 0000000000..ca648573e4
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Creston
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cuiaba b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cuiaba
new file mode 100644
index 0000000000..9bea3d4079
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Cuiaba
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Curacao b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Curacao
new file mode 100644
index 0000000000..f7ab6efcc0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Curacao
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Danmarkshavn b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Danmarkshavn
new file mode 100644
index 0000000000..9549adcb65
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Danmarkshavn
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson
new file mode 100644
index 0000000000..2b6c3eeaba
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson_Creek b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson_Creek
new file mode 100644
index 0000000000..db9e339655
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dawson_Creek
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Denver b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Denver
new file mode 100644
index 0000000000..5fbe26b1d9
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Denver
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Detroit b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Detroit
new file mode 100644
index 0000000000..e104faa465
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Detroit
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dominica b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dominica
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Dominica
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Edmonton b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Edmonton
new file mode 100644
index 0000000000..cd78a6f8be
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Edmonton
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Eirunepe b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Eirunepe
new file mode 100644
index 0000000000..39d6daeb9b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Eirunepe
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/El_Salvador b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/El_Salvador
new file mode 100644
index 0000000000..e2f22304aa
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/El_Salvador
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ensenada b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ensenada
new file mode 100644
index 0000000000..ada6bf78b2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ensenada
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Nelson b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Nelson
new file mode 100644
index 0000000000..5a0b7f1ca0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Nelson
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Wayne b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Wayne
new file mode 100644
index 0000000000..09511ccdcf
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fort_Wayne
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fortaleza b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fortaleza
new file mode 100644
index 0000000000..be57dc20b4
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Fortaleza
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Glace_Bay b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Glace_Bay
new file mode 100644
index 0000000000..48412a4cbf
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Glace_Bay
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Godthab b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Godthab
new file mode 100644
index 0000000000..0160308bf6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Godthab
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Goose_Bay b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Goose_Bay
new file mode 100644
index 0000000000..a3f299079a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Goose_Bay
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grand_Turk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grand_Turk
new file mode 100644
index 0000000000..b9bb063b62
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grand_Turk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grenada b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grenada
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Grenada
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guadeloupe b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guadeloupe
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guadeloupe
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guatemala b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guatemala
new file mode 100644
index 0000000000..407138caf9
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guatemala
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guayaquil b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guayaquil
new file mode 100644
index 0000000000..0559a7a4a4
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guayaquil
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guyana b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guyana
new file mode 100644
index 0000000000..d5dab14969
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Guyana
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Halifax b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Halifax
new file mode 100644
index 0000000000..756099abe6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Halifax
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Havana b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Havana
new file mode 100644
index 0000000000..b69ac45107
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Havana
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Hermosillo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Hermosillo
new file mode 100644
index 0000000000..791a9fa2b3
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Hermosillo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Indianapolis b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Indianapolis
new file mode 100644
index 0000000000..09511ccdcf
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Indianapolis
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Knox b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Knox
new file mode 100644
index 0000000000..fcd408d74d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Knox
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Marengo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Marengo
new file mode 100644
index 0000000000..1abf75e7e8
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Marengo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Petersburg b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Petersburg
new file mode 100644
index 0000000000..0133548eca
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Petersburg
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Tell_City b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Tell_City
new file mode 100644
index 0000000000..7bbb653cd7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Tell_City
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vevay b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vevay
new file mode 100644
index 0000000000..d236b7c077
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vevay
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vincennes b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vincennes
new file mode 100644
index 0000000000..c818929d19
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Vincennes
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Winamac b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Winamac
new file mode 100644
index 0000000000..630935c1e1
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indiana/Winamac
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indianapolis b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indianapolis
new file mode 100644
index 0000000000..09511ccdcf
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Indianapolis
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Inuvik b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Inuvik
new file mode 100644
index 0000000000..87bb355295
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Inuvik
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Iqaluit b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Iqaluit
new file mode 100644
index 0000000000..c8138bdbb3
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Iqaluit
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jamaica b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jamaica
new file mode 100644
index 0000000000..2a9b7fd52d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jamaica
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jujuy b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jujuy
new file mode 100644
index 0000000000..604b856636
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Jujuy
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Juneau b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Juneau
new file mode 100644
index 0000000000..451f349009
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Juneau
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Louisville b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Louisville
new file mode 100644
index 0000000000..177836e4fd
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Louisville
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Monticello b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Monticello
new file mode 100644
index 0000000000..438e3eab4a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kentucky/Monticello
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Knox_IN b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Knox_IN
new file mode 100644
index 0000000000..fcd408d74d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Knox_IN
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kralendijk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kralendijk
new file mode 100644
index 0000000000..f7ab6efcc0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Kralendijk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/La_Paz b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/La_Paz
new file mode 100644
index 0000000000..a101372435
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/La_Paz
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Lima b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Lima
new file mode 100644
index 0000000000..3c6529b756
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Lima
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Los_Angeles b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Los_Angeles
new file mode 100644
index 0000000000..9dad4f4c75
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Los_Angeles
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Louisville b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Louisville
new file mode 100644
index 0000000000..177836e4fd
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Louisville
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Lower_Princes b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Lower_Princes
new file mode 100644
index 0000000000..f7ab6efcc0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Lower_Princes
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Maceio b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Maceio
new file mode 100644
index 0000000000..bc8b951d2e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Maceio
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Managua b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Managua
new file mode 100644
index 0000000000..e0242bff6e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Managua
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Manaus b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Manaus
new file mode 100644
index 0000000000..63d58f80f5
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Manaus
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Marigot b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Marigot
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Marigot
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Martinique b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Martinique
new file mode 100644
index 0000000000..8df43dcf1c
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Martinique
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Matamoros b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Matamoros
new file mode 100644
index 0000000000..047968dfff
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Matamoros
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mazatlan b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mazatlan
new file mode 100644
index 0000000000..e4a785743d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mazatlan
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mendoza b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mendoza
new file mode 100644
index 0000000000..f9e677f171
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mendoza
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Menominee b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Menominee
new file mode 100644
index 0000000000..314613866d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Menominee
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Merida b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Merida
new file mode 100644
index 0000000000..ea852da33a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Merida
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Metlakatla b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Metlakatla
new file mode 100644
index 0000000000..1e94be3d55
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Metlakatla
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mexico_City b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mexico_City
new file mode 100644
index 0000000000..e7fb6f2953
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Mexico_City
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Miquelon b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Miquelon
new file mode 100644
index 0000000000..b924b71004
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Miquelon
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Moncton b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Moncton
new file mode 100644
index 0000000000..9df8d0f2ec
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Moncton
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Monterrey b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Monterrey
new file mode 100644
index 0000000000..a8928c8dc9
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Monterrey
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montevideo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montevideo
new file mode 100644
index 0000000000..2f357bcf50
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montevideo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montreal b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montreal
new file mode 100644
index 0000000000..6752c5b052
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montreal
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montserrat b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montserrat
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Montserrat
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nassau b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nassau
new file mode 100644
index 0000000000..33cc6c6265
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nassau
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/New_York b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/New_York
new file mode 100644
index 0000000000..2f75480e06
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/New_York
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nipigon b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nipigon
new file mode 100644
index 0000000000..f6a856e693
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nipigon
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nome b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nome
new file mode 100644
index 0000000000..10998df3bb
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nome
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Noronha b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Noronha
new file mode 100644
index 0000000000..f140726f2a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Noronha
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Beulah b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Beulah
new file mode 100644
index 0000000000..246345dde7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Beulah
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Center b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Center
new file mode 100644
index 0000000000..1fa0703778
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/Center
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/New_Salem b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/New_Salem
new file mode 100644
index 0000000000..123f2aeecf
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/North_Dakota/New_Salem
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nuuk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nuuk
new file mode 100644
index 0000000000..0160308bf6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Nuuk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ojinaga b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ojinaga
new file mode 100644
index 0000000000..fc4a03e369
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Ojinaga
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Panama b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Panama
new file mode 100644
index 0000000000..9964b9a334
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Panama
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Pangnirtung b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Pangnirtung
new file mode 100644
index 0000000000..3e4e0db6ae
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Pangnirtung
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Paramaribo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Paramaribo
new file mode 100644
index 0000000000..bc8a6edf13
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Paramaribo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Phoenix b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Phoenix
new file mode 100644
index 0000000000..ac6bb0c782
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Phoenix
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port-au-Prince b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port-au-Prince
new file mode 100644
index 0000000000..287f143926
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port-au-Prince
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port_of_Spain b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port_of_Spain
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Port_of_Spain
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Acre b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Acre
new file mode 100644
index 0000000000..a374cb43d9
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Acre
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Velho b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Velho
new file mode 100644
index 0000000000..2e873a5aa8
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Porto_Velho
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Puerto_Rico b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Puerto_Rico
new file mode 100644
index 0000000000..a662a57137
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Puerto_Rico
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Punta_Arenas b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Punta_Arenas
new file mode 100644
index 0000000000..a5a8af52c2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Punta_Arenas
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rainy_River b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rainy_River
new file mode 100644
index 0000000000..ea66099155
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rainy_River
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rankin_Inlet b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rankin_Inlet
new file mode 100644
index 0000000000..3a70587472
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rankin_Inlet
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Recife b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Recife
new file mode 100644
index 0000000000..d7abb168a7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Recife
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Regina b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Regina
new file mode 100644
index 0000000000..20c9c84df4
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Regina
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Resolute b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Resolute
new file mode 100644
index 0000000000..0a73b753ba
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Resolute
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rio_Branco b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rio_Branco
new file mode 100644
index 0000000000..a374cb43d9
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rio_Branco
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rosario b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rosario
new file mode 100644
index 0000000000..da4c23a545
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Rosario
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santa_Isabel b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santa_Isabel
new file mode 100644
index 0000000000..ada6bf78b2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santa_Isabel
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santarem b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santarem
new file mode 100644
index 0000000000..c28f36063b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santarem
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santiago b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santiago
new file mode 100644
index 0000000000..816a042818
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santiago
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santo_Domingo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santo_Domingo
new file mode 100644
index 0000000000..4fe36fd4c1
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Santo_Domingo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sao_Paulo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sao_Paulo
new file mode 100644
index 0000000000..13ff083869
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sao_Paulo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Scoresbysund b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Scoresbysund
new file mode 100644
index 0000000000..e20e9e1c42
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Scoresbysund
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Shiprock b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Shiprock
new file mode 100644
index 0000000000..5fbe26b1d9
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Shiprock
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sitka b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sitka
new file mode 100644
index 0000000000..31f7061371
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Sitka
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Barthelemy b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Barthelemy
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Barthelemy
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Johns b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Johns
new file mode 100644
index 0000000000..65a5b0c720
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Johns
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Kitts b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Kitts
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Kitts
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Lucia b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Lucia
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Lucia
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Thomas b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Thomas
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Thomas
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Vincent b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Vincent
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/St_Vincent
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Swift_Current b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Swift_Current
new file mode 100644
index 0000000000..8e9ef255ee
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Swift_Current
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tegucigalpa b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tegucigalpa
new file mode 100644
index 0000000000..2adacb2e50
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tegucigalpa
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thule b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thule
new file mode 100644
index 0000000000..6f802f1c2a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thule
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thunder_Bay b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thunder_Bay
new file mode 100644
index 0000000000..e504c9acf1
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Thunder_Bay
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tijuana b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tijuana
new file mode 100644
index 0000000000..ada6bf78b2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tijuana
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Toronto b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Toronto
new file mode 100644
index 0000000000..6752c5b052
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Toronto
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tortola b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tortola
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Tortola
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Vancouver b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Vancouver
new file mode 100644
index 0000000000..bb60cbced3
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Vancouver
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Virgin b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Virgin
new file mode 100644
index 0000000000..697cf5bcf7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Virgin
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Whitehorse b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Whitehorse
new file mode 100644
index 0000000000..062b58cedc
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Whitehorse
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Winnipeg b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Winnipeg
new file mode 100644
index 0000000000..ac40299f6b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Winnipeg
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yakutat b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yakutat
new file mode 100644
index 0000000000..da209f9f0a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yakutat
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yellowknife b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yellowknife
new file mode 100644
index 0000000000..e6afa390e8
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/America/Yellowknife
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Casey b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Casey
new file mode 100644
index 0000000000..f100f47461
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Casey
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Davis b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Davis
new file mode 100644
index 0000000000..916f2c2592
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Davis
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/DumontDUrville b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/DumontDUrville
new file mode 100644
index 0000000000..a71b39c004
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/DumontDUrville
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Macquarie b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Macquarie
new file mode 100644
index 0000000000..616afd9c83
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Macquarie
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Mawson b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Mawson
new file mode 100644
index 0000000000..b32e7fd6c6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Mawson
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/McMurdo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/McMurdo
new file mode 100644
index 0000000000..6575fdce31
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/McMurdo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Palmer b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Palmer
new file mode 100644
index 0000000000..3dd85f84ff
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Palmer
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Rothera b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Rothera
new file mode 100644
index 0000000000..8b2430a20e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Rothera
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/South_Pole b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/South_Pole
new file mode 100644
index 0000000000..6575fdce31
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/South_Pole
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Syowa b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Syowa
new file mode 100644
index 0000000000..254af7d12f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Syowa
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Troll b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Troll
new file mode 100644
index 0000000000..5e565da2f6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Troll
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Vostok b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Vostok
new file mode 100644
index 0000000000..728305305d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Antarctica/Vostok
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Arctic/Longyearbyen b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Arctic/Longyearbyen
new file mode 100644
index 0000000000..15a34c3ced
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Arctic/Longyearbyen
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aden b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aden
new file mode 100644
index 0000000000..2aea25f8c2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aden
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Almaty b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Almaty
new file mode 100644
index 0000000000..a4b0077900
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Almaty
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Amman b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Amman
new file mode 100644
index 0000000000..c9e8707912
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Amman
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Anadyr b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Anadyr
new file mode 100644
index 0000000000..6ed8b7cb07
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Anadyr
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtau b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtau
new file mode 100644
index 0000000000..e2d0f91954
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtau
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtobe b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtobe
new file mode 100644
index 0000000000..06f0a13a66
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Aqtobe
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashgabat b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashgabat
new file mode 100644
index 0000000000..73891af1ee
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashgabat
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashkhabad b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashkhabad
new file mode 100644
index 0000000000..73891af1ee
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ashkhabad
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Atyrau b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Atyrau
new file mode 100644
index 0000000000..8b5153e054
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Atyrau
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baghdad b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baghdad
new file mode 100644
index 0000000000..f7162edf93
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baghdad
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bahrain b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bahrain
new file mode 100644
index 0000000000..63188b269d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bahrain
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baku b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baku
new file mode 100644
index 0000000000..a0de74b958
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Baku
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bangkok b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bangkok
new file mode 100644
index 0000000000..c292ac5b5f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bangkok
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Barnaul b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Barnaul
new file mode 100644
index 0000000000..759592a255
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Barnaul
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Beirut b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Beirut
new file mode 100644
index 0000000000..fb266ede22
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Beirut
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bishkek b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bishkek
new file mode 100644
index 0000000000..f6e20dd3a8
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Bishkek
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Brunei b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Brunei
new file mode 100644
index 0000000000..3dab0abf4e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Brunei
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Calcutta b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Calcutta
new file mode 100644
index 0000000000..0014046d29
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Calcutta
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chita b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chita
new file mode 100644
index 0000000000..c4149c05ce
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chita
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Choibalsan b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Choibalsan
new file mode 100644
index 0000000000..e48daa8243
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Choibalsan
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chongqing b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chongqing
new file mode 100644
index 0000000000..91f6f8bc2e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chongqing
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chungking b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chungking
new file mode 100644
index 0000000000..91f6f8bc2e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Chungking
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Colombo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Colombo
new file mode 100644
index 0000000000..62c64d85df
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Colombo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dacca b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dacca
new file mode 100644
index 0000000000..b11c928410
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dacca
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Damascus b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Damascus
new file mode 100644
index 0000000000..d9104a7ab8
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Damascus
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dhaka b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dhaka
new file mode 100644
index 0000000000..b11c928410
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dhaka
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dili b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dili
new file mode 100644
index 0000000000..30943bbd0a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dili
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dubai b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dubai
new file mode 100644
index 0000000000..fc0a589e2b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dubai
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dushanbe b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dushanbe
new file mode 100644
index 0000000000..82d85b8c1b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Dushanbe
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Famagusta b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Famagusta
new file mode 100644
index 0000000000..653b146a60
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Famagusta
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Gaza b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Gaza
new file mode 100644
index 0000000000..592b632606
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Gaza
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Harbin b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Harbin
new file mode 100644
index 0000000000..91f6f8bc2e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Harbin
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hebron b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hebron
new file mode 100644
index 0000000000..ae82f9b546
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hebron
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ho_Chi_Minh b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ho_Chi_Minh
new file mode 100644
index 0000000000..e2934e371b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ho_Chi_Minh
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hong_Kong b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hong_Kong
new file mode 100644
index 0000000000..23d0375fba
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hong_Kong
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hovd b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hovd
new file mode 100644
index 0000000000..4cb800a918
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Hovd
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Irkutsk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Irkutsk
new file mode 100644
index 0000000000..4dcbbb7ea2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Irkutsk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Istanbul b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Istanbul
new file mode 100644
index 0000000000..508446bb6a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Istanbul
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jakarta b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jakarta
new file mode 100644
index 0000000000..5baa3a8f2e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jakarta
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jayapura b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jayapura
new file mode 100644
index 0000000000..3002c82022
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jayapura
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jerusalem b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jerusalem
new file mode 100644
index 0000000000..440ef06b5d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Jerusalem
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kabul b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kabul
new file mode 100644
index 0000000000..d19b9bd51d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kabul
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kamchatka b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kamchatka
new file mode 100644
index 0000000000..3e80b4e09f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kamchatka
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Karachi b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Karachi
new file mode 100644
index 0000000000..ba65c0e8d3
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Karachi
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kashgar b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kashgar
new file mode 100644
index 0000000000..faa14d92d5
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kashgar
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kathmandu b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kathmandu
new file mode 100644
index 0000000000..a5d510753f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kathmandu
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Katmandu b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Katmandu
new file mode 100644
index 0000000000..a5d510753f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Katmandu
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Khandyga b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Khandyga
new file mode 100644
index 0000000000..72bea64ba8
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Khandyga
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kolkata b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kolkata
new file mode 100644
index 0000000000..0014046d29
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kolkata
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Krasnoyarsk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Krasnoyarsk
new file mode 100644
index 0000000000..30c6f16505
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Krasnoyarsk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuala_Lumpur b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuala_Lumpur
new file mode 100644
index 0000000000..612b01e71c
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuala_Lumpur
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuching b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuching
new file mode 100644
index 0000000000..c86750cb7d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuching
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuwait b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuwait
new file mode 100644
index 0000000000..2aea25f8c2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Kuwait
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macao b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macao
new file mode 100644
index 0000000000..cac65063d0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macao
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macau b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macau
new file mode 100644
index 0000000000..cac65063d0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Macau
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Magadan b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Magadan
new file mode 100644
index 0000000000..b4fcac18e3
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Magadan
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Makassar b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Makassar
new file mode 100644
index 0000000000..556ba86693
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Makassar
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Manila b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Manila
new file mode 100644
index 0000000000..f4f4b04efa
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Manila
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Muscat b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Muscat
new file mode 100644
index 0000000000..fc0a589e2b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Muscat
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Nicosia b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Nicosia
new file mode 100644
index 0000000000..f7f10ab766
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Nicosia
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novokuznetsk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novokuznetsk
new file mode 100644
index 0000000000..d983276119
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novokuznetsk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novosibirsk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novosibirsk
new file mode 100644
index 0000000000..e0ee5fcea9
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Novosibirsk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Omsk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Omsk
new file mode 100644
index 0000000000..b29b769311
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Omsk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Oral b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Oral
new file mode 100644
index 0000000000..ad1f9ca1ca
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Oral
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Phnom_Penh b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Phnom_Penh
new file mode 100644
index 0000000000..c292ac5b5f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Phnom_Penh
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pontianak b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pontianak
new file mode 100644
index 0000000000..12ce24cbea
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pontianak
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pyongyang b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pyongyang
new file mode 100644
index 0000000000..7ad7e0b2cf
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Pyongyang
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qatar b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qatar
new file mode 100644
index 0000000000..63188b269d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qatar
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qostanay b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qostanay
new file mode 100644
index 0000000000..73b9d963ef
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qostanay
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qyzylorda b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qyzylorda
new file mode 100644
index 0000000000..c2fe4c144c
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Qyzylorda
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Rangoon b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Rangoon
new file mode 100644
index 0000000000..dd77395b05
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Rangoon
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Riyadh b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Riyadh
new file mode 100644
index 0000000000..2aea25f8c2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Riyadh
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Saigon b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Saigon
new file mode 100644
index 0000000000..e2934e371b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Saigon
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Sakhalin b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Sakhalin
new file mode 100644
index 0000000000..485459ce03
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Sakhalin
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Samarkand b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Samarkand
new file mode 100644
index 0000000000..030d47ce07
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Samarkand
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Seoul b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Seoul
new file mode 100644
index 0000000000..96199e73e7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Seoul
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Shanghai b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Shanghai
new file mode 100644
index 0000000000..91f6f8bc2e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Shanghai
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Singapore b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Singapore
new file mode 100644
index 0000000000..2364b2178b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Singapore
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Srednekolymsk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Srednekolymsk
new file mode 100644
index 0000000000..261a9832b3
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Srednekolymsk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Taipei b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Taipei
new file mode 100644
index 0000000000..24c43444b6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Taipei
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tashkent b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tashkent
new file mode 100644
index 0000000000..32a9d7d0c9
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tashkent
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tbilisi b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tbilisi
new file mode 100644
index 0000000000..b608d79748
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tbilisi
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tehran b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tehran
new file mode 100644
index 0000000000..8cec5ad7de
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tehran
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tel_Aviv b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tel_Aviv
new file mode 100644
index 0000000000..440ef06b5d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tel_Aviv
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimbu b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimbu
new file mode 100644
index 0000000000..fe409c7a2a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimbu
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimphu b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimphu
new file mode 100644
index 0000000000..fe409c7a2a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Thimphu
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tokyo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tokyo
new file mode 100644
index 0000000000..26f4d34d67
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tokyo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tomsk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tomsk
new file mode 100644
index 0000000000..670e2ad2ce
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Tomsk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ujung_Pandang b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ujung_Pandang
new file mode 100644
index 0000000000..556ba86693
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ujung_Pandang
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulaanbaatar b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulaanbaatar
new file mode 100644
index 0000000000..2e20cc3a43
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulaanbaatar
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulan_Bator b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulan_Bator
new file mode 100644
index 0000000000..2e20cc3a43
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ulan_Bator
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Urumqi b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Urumqi
new file mode 100644
index 0000000000..faa14d92d5
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Urumqi
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ust-Nera b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ust-Nera
new file mode 100644
index 0000000000..9e4a78f6a5
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Ust-Nera
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vientiane b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vientiane
new file mode 100644
index 0000000000..c292ac5b5f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vientiane
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vladivostok b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vladivostok
new file mode 100644
index 0000000000..8ab253ce73
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Vladivostok
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yakutsk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yakutsk
new file mode 100644
index 0000000000..c815e99b1a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yakutsk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yangon b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yangon
new file mode 100644
index 0000000000..dd77395b05
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yangon
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yekaterinburg b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yekaterinburg
new file mode 100644
index 0000000000..6958d7eddd
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yekaterinburg
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yerevan b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yerevan
new file mode 100644
index 0000000000..250bfe020a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Asia/Yerevan
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Azores b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Azores
new file mode 100644
index 0000000000..56593dbfff
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Azores
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Bermuda b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Bermuda
new file mode 100644
index 0000000000..419c660ba7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Bermuda
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Canary b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Canary
new file mode 100644
index 0000000000..f3192156ff
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Canary
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Cape_Verde b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Cape_Verde
new file mode 100644
index 0000000000..e2a49d248d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Cape_Verde
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faeroe b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faeroe
new file mode 100644
index 0000000000..4dab7ef085
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faeroe
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faroe b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faroe
new file mode 100644
index 0000000000..4dab7ef085
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Faroe
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Jan_Mayen b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Jan_Mayen
new file mode 100644
index 0000000000..15a34c3ced
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Jan_Mayen
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Madeira b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Madeira
new file mode 100644
index 0000000000..5213761f89
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Madeira
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Reykjavik b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Reykjavik
new file mode 100644
index 0000000000..10e0fc8190
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Reykjavik
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/South_Georgia b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/South_Georgia
new file mode 100644
index 0000000000..4466608612
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/South_Georgia
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/St_Helena b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/St_Helena
new file mode 100644
index 0000000000..28b32ab2e0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/St_Helena
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Stanley b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Stanley
new file mode 100644
index 0000000000..88077f1107
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Atlantic/Stanley
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/ACT b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/ACT
new file mode 100644
index 0000000000..7636592aa7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/ACT
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Adelaide b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Adelaide
new file mode 100644
index 0000000000..0b1252abb7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Adelaide
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Brisbane b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Brisbane
new file mode 100644
index 0000000000..3021bdb614
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Brisbane
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Broken_Hill b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Broken_Hill
new file mode 100644
index 0000000000..1ac3fc8f52
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Broken_Hill
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Canberra b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Canberra
new file mode 100644
index 0000000000..7636592aa7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Canberra
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Currie b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Currie
new file mode 100644
index 0000000000..f65a990efe
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Currie
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Darwin b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Darwin
new file mode 100644
index 0000000000..1cf502984a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Darwin
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Eucla b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Eucla
new file mode 100644
index 0000000000..98ae557064
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Eucla
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Hobart b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Hobart
new file mode 100644
index 0000000000..02b07ca232
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Hobart
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/LHI b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/LHI
new file mode 100644
index 0000000000..9e04a80ece
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/LHI
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lindeman b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lindeman
new file mode 100644
index 0000000000..eab0fb998a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lindeman
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lord_Howe b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lord_Howe
new file mode 100644
index 0000000000..9e04a80ece
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Lord_Howe
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Melbourne b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Melbourne
new file mode 100644
index 0000000000..ba457338ba
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Melbourne
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/NSW b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/NSW
new file mode 100644
index 0000000000..7636592aa7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/NSW
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/North b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/North
new file mode 100644
index 0000000000..1cf502984a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/North
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Perth b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Perth
new file mode 100644
index 0000000000..a876b9e785
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Perth
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Queensland b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Queensland
new file mode 100644
index 0000000000..3021bdb614
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Queensland
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/South b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/South
new file mode 100644
index 0000000000..0b1252abb7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/South
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Sydney b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Sydney
new file mode 100644
index 0000000000..7636592aa7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Sydney
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Tasmania b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Tasmania
new file mode 100644
index 0000000000..02b07ca232
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Tasmania
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Victoria b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Victoria
new file mode 100644
index 0000000000..ba457338ba
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Victoria
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/West b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/West
new file mode 100644
index 0000000000..a876b9e785
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/West
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Yancowinna b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Yancowinna
new file mode 100644
index 0000000000..1ac3fc8f52
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Australia/Yancowinna
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/Acre b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/Acre
new file mode 100644
index 0000000000..a374cb43d9
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/Acre
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/DeNoronha b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/DeNoronha
new file mode 100644
index 0000000000..f140726f2a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/DeNoronha
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/East b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/East
new file mode 100644
index 0000000000..13ff083869
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/East
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/West b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/West
new file mode 100644
index 0000000000..63d58f80f5
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Brazil/West
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/CET b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/CET
new file mode 100644
index 0000000000..122e934210
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/CET
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/CST6CDT b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/CST6CDT
new file mode 100644
index 0000000000..ca67929fbe
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/CST6CDT
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Atlantic b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Atlantic
new file mode 100644
index 0000000000..756099abe6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Atlantic
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Central b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Central
new file mode 100644
index 0000000000..ac40299f6b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Central
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Eastern b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Eastern
new file mode 100644
index 0000000000..6752c5b052
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Eastern
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Mountain b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Mountain
new file mode 100644
index 0000000000..cd78a6f8be
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Mountain
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Newfoundland b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Newfoundland
new file mode 100644
index 0000000000..65a5b0c720
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Newfoundland
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Pacific b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Pacific
new file mode 100644
index 0000000000..bb60cbced3
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Pacific
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Saskatchewan b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Saskatchewan
new file mode 100644
index 0000000000..20c9c84df4
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Saskatchewan
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Yukon b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Yukon
new file mode 100644
index 0000000000..062b58cedc
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Canada/Yukon
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/Continental b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/Continental
new file mode 100644
index 0000000000..816a042818
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/Continental
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/EasterIsland b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/EasterIsland
new file mode 100644
index 0000000000..cae3744096
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Chile/EasterIsland
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Cuba b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Cuba
new file mode 100644
index 0000000000..b69ac45107
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Cuba
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/EET b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/EET
new file mode 100644
index 0000000000..cbdb71ddd3
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/EET
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/EST b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/EST
new file mode 100644
index 0000000000..21ebc00b3f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/EST
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/EST5EDT b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/EST5EDT
new file mode 100644
index 0000000000..9bce5007d4
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/EST5EDT
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Egypt b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Egypt
new file mode 100644
index 0000000000..d3f819623f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Egypt
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Eire b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Eire
new file mode 100644
index 0000000000..1d994902db
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Eire
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+0 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+0
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+0
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+1 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+1
new file mode 100644
index 0000000000..4dab6f9005
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+1
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+10 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+10
new file mode 100644
index 0000000000..c749290af2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+10
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+11 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+11
new file mode 100644
index 0000000000..d969982309
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+11
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+12 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+12
new file mode 100644
index 0000000000..cdeec90973
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+12
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+2 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+2
new file mode 100644
index 0000000000..fbd2a941fd
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+2
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+3 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+3
new file mode 100644
index 0000000000..ee246ef56f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+3
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+4 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+4
new file mode 100644
index 0000000000..5a25ff2a6a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+4
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+5 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+5
new file mode 100644
index 0000000000..c0b745f1cc
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+5
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+6 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+6
new file mode 100644
index 0000000000..06e777d57e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+6
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+7 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+7
new file mode 100644
index 0000000000..4e0b53a082
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+7
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+8 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+8
new file mode 100644
index 0000000000..714b0c5628
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+8
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+9 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+9
new file mode 100644
index 0000000000..78b9daa373
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT+9
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-0 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-0
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-0
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-1 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-1
new file mode 100644
index 0000000000..a838bebf5e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-1
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-10 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-10
new file mode 100644
index 0000000000..68ff77db0d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-10
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-11 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-11
new file mode 100644
index 0000000000..66af5a42be
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-11
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-12 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-12
new file mode 100644
index 0000000000..17ba505772
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-12
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-13 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-13
new file mode 100644
index 0000000000..5f3706ce64
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-13
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-14 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-14
new file mode 100644
index 0000000000..7e9f9c465c
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-14
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-2 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-2
new file mode 100644
index 0000000000..fcef6d9acb
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-2
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-3 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-3
new file mode 100644
index 0000000000..27973bc857
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-3
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-4 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-4
new file mode 100644
index 0000000000..1efd841261
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-4
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-5 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-5
new file mode 100644
index 0000000000..1f761844fc
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-5
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-6 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-6
new file mode 100644
index 0000000000..952681ed46
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-6
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-7 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-7
new file mode 100644
index 0000000000..cefc9126c6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-7
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-8 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-8
new file mode 100644
index 0000000000..afb093da00
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-8
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-9 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-9
new file mode 100644
index 0000000000..9265fb7c20
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT-9
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT0 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT0
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/GMT0
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Greenwich b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Greenwich
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Greenwich
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UCT b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UCT
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UCT
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UTC b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UTC
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/UTC
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Universal b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Universal
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Universal
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Zulu b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Zulu
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Etc/Zulu
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Amsterdam b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Amsterdam
new file mode 100644
index 0000000000..c3ff07b436
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Amsterdam
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Andorra b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Andorra
new file mode 100644
index 0000000000..5962550392
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Andorra
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Astrakhan b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Astrakhan
new file mode 100644
index 0000000000..73a4d013fc
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Astrakhan
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Athens b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Athens
new file mode 100644
index 0000000000..9f3a0678d7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Athens
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belfast b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belfast
new file mode 100644
index 0000000000..ac02a81440
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belfast
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belgrade b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belgrade
new file mode 100644
index 0000000000..27de456f16
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Belgrade
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Berlin b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Berlin
new file mode 100644
index 0000000000..7f6d958f86
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Berlin
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bratislava b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bratislava
new file mode 100644
index 0000000000..ce8f433ece
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bratislava
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Brussels b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Brussels
new file mode 100644
index 0000000000..40d7124e53
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Brussels
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bucharest b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bucharest
new file mode 100644
index 0000000000..4303b903e5
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Bucharest
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Budapest b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Budapest
new file mode 100644
index 0000000000..6b94a4f312
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Budapest
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Busingen b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Busingen
new file mode 100644
index 0000000000..ad6cf59281
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Busingen
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Chisinau b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Chisinau
new file mode 100644
index 0000000000..5ee23fe0e5
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Chisinau
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Copenhagen b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Copenhagen
new file mode 100644
index 0000000000..776be6e4a6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Copenhagen
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Dublin b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Dublin
new file mode 100644
index 0000000000..1d994902db
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Dublin
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Gibraltar b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Gibraltar
new file mode 100644
index 0000000000..117aadb836
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Gibraltar
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Guernsey b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Guernsey
new file mode 100644
index 0000000000..ac02a81440
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Guernsey
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Helsinki b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Helsinki
new file mode 100644
index 0000000000..b4f8f9cbb5
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Helsinki
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Isle_of_Man b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Isle_of_Man
new file mode 100644
index 0000000000..ac02a81440
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Isle_of_Man
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Istanbul b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Istanbul
new file mode 100644
index 0000000000..508446bb6a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Istanbul
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Jersey b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Jersey
new file mode 100644
index 0000000000..ac02a81440
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Jersey
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kaliningrad b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kaliningrad
new file mode 100644
index 0000000000..cc99beabe4
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kaliningrad
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kiev b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kiev
new file mode 100644
index 0000000000..9337c9ea27
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kiev
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kirov b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kirov
new file mode 100644
index 0000000000..a3b5320a0b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Kirov
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Lisbon b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Lisbon
new file mode 100644
index 0000000000..355817b52b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Lisbon
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ljubljana b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ljubljana
new file mode 100644
index 0000000000..27de456f16
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ljubljana
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/London b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/London
new file mode 100644
index 0000000000..ac02a81440
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/London
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Luxembourg b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Luxembourg
new file mode 100644
index 0000000000..c4ca733f53
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Luxembourg
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Madrid b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Madrid
new file mode 100644
index 0000000000..16f6420ab7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Madrid
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Malta b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Malta
new file mode 100644
index 0000000000..bf2452da40
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Malta
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Mariehamn b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Mariehamn
new file mode 100644
index 0000000000..b4f8f9cbb5
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Mariehamn
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Minsk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Minsk
new file mode 100644
index 0000000000..453306c075
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Minsk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Monaco b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Monaco
new file mode 100644
index 0000000000..686ae88315
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Monaco
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Moscow b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Moscow
new file mode 100644
index 0000000000..ddb3f4e99a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Moscow
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Nicosia b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Nicosia
new file mode 100644
index 0000000000..f7f10ab766
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Nicosia
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Oslo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Oslo
new file mode 100644
index 0000000000..15a34c3ced
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Oslo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Paris b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Paris
new file mode 100644
index 0000000000..ca85435168
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Paris
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Podgorica b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Podgorica
new file mode 100644
index 0000000000..27de456f16
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Podgorica
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Prague b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Prague
new file mode 100644
index 0000000000..ce8f433ece
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Prague
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Riga b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Riga
new file mode 100644
index 0000000000..8db477d017
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Riga
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Rome b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Rome
new file mode 100644
index 0000000000..ac4c16342b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Rome
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Samara b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Samara
new file mode 100644
index 0000000000..97d5dd9e6e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Samara
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/San_Marino b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/San_Marino
new file mode 100644
index 0000000000..ac4c16342b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/San_Marino
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sarajevo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sarajevo
new file mode 100644
index 0000000000..27de456f16
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sarajevo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Saratov b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Saratov
new file mode 100644
index 0000000000..8fd5f6d4b8
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Saratov
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Simferopol b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Simferopol
new file mode 100644
index 0000000000..432e8315bc
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Simferopol
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Skopje b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Skopje
new file mode 100644
index 0000000000..27de456f16
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Skopje
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sofia b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sofia
new file mode 100644
index 0000000000..0e4d879332
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Sofia
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Stockholm b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Stockholm
new file mode 100644
index 0000000000..f3e0c7f0f2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Stockholm
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tallinn b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tallinn
new file mode 100644
index 0000000000..b5acca3cf5
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tallinn
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tirane b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tirane
new file mode 100644
index 0000000000..0b86017d24
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tirane
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tiraspol b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tiraspol
new file mode 100644
index 0000000000..5ee23fe0e5
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Tiraspol
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ulyanovsk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ulyanovsk
new file mode 100644
index 0000000000..7b61bdc522
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Ulyanovsk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Uzhgorod b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Uzhgorod
new file mode 100644
index 0000000000..66ae8d69e3
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Uzhgorod
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vaduz b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vaduz
new file mode 100644
index 0000000000..ad6cf59281
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vaduz
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vatican b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vatican
new file mode 100644
index 0000000000..ac4c16342b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vatican
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vienna b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vienna
new file mode 100644
index 0000000000..3582bb15cd
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vienna
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vilnius b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vilnius
new file mode 100644
index 0000000000..7abd63fa60
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Vilnius
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Volgograd b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Volgograd
new file mode 100644
index 0000000000..d1cfac0e38
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Volgograd
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Warsaw b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Warsaw
new file mode 100644
index 0000000000..e33cf67171
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Warsaw
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zagreb b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zagreb
new file mode 100644
index 0000000000..27de456f16
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zagreb
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zaporozhye b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zaporozhye
new file mode 100644
index 0000000000..e42edfc850
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zaporozhye
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zurich b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zurich
new file mode 100644
index 0000000000..ad6cf59281
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Europe/Zurich
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Factory b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Factory
new file mode 100644
index 0000000000..60aa2a0d69
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Factory
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GB b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GB
new file mode 100644
index 0000000000..ac02a81440
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GB
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GB-Eire b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GB-Eire
new file mode 100644
index 0000000000..ac02a81440
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GB-Eire
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT+0 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT+0
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT+0
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT-0 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT-0
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT-0
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT0 b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT0
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/GMT0
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Greenwich b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Greenwich
new file mode 100644
index 0000000000..c63474664a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Greenwich
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/HST b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/HST
new file mode 100644
index 0000000000..cccd45eb8c
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/HST
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Hongkong b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Hongkong
new file mode 100644
index 0000000000..23d0375fba
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Hongkong
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Iceland b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Iceland
new file mode 100644
index 0000000000..10e0fc8190
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Iceland
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Antananarivo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Antananarivo
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Antananarivo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Chagos b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Chagos
new file mode 100644
index 0000000000..93d6dda50f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Chagos
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Christmas b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Christmas
new file mode 100644
index 0000000000..d18c3810d9
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Christmas
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Cocos b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Cocos
new file mode 100644
index 0000000000..f8116e7025
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Cocos
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Comoro b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Comoro
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Comoro
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Kerguelen b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Kerguelen
new file mode 100644
index 0000000000..cde4cf7ea7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Kerguelen
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mahe b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mahe
new file mode 100644
index 0000000000..cba7dfe735
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mahe
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Maldives b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Maldives
new file mode 100644
index 0000000000..7c839cfa9b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Maldives
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mauritius b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mauritius
new file mode 100644
index 0000000000..17f2616990
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mauritius
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mayotte b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mayotte
new file mode 100644
index 0000000000..9a2918f404
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Mayotte
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Reunion b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Reunion
new file mode 100644
index 0000000000..dfe08313df
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Indian/Reunion
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Iran b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Iran
new file mode 100644
index 0000000000..8cec5ad7de
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Iran
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Israel b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Israel
new file mode 100644
index 0000000000..440ef06b5d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Israel
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Jamaica b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Jamaica
new file mode 100644
index 0000000000..2a9b7fd52d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Jamaica
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Japan b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Japan
new file mode 100644
index 0000000000..26f4d34d67
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Japan
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Kwajalein b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Kwajalein
new file mode 100644
index 0000000000..1a7975fad7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Kwajalein
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Libya b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Libya
new file mode 100644
index 0000000000..07b393bb7d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Libya
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/MET b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/MET
new file mode 100644
index 0000000000..4a826bb185
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/MET
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/MST b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/MST
new file mode 100644
index 0000000000..c93a58eee8
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/MST
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/MST7MDT b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/MST7MDT
new file mode 100644
index 0000000000..4506a6e150
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/MST7MDT
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaNorte b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaNorte
new file mode 100644
index 0000000000..ada6bf78b2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaNorte
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaSur b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaSur
new file mode 100644
index 0000000000..e4a785743d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/BajaSur
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/General b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/General
new file mode 100644
index 0000000000..e7fb6f2953
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Mexico/General
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/NZ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/NZ
new file mode 100644
index 0000000000..6575fdce31
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/NZ
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/NZ-CHAT b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/NZ-CHAT
new file mode 100644
index 0000000000..c004109882
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/NZ-CHAT
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Navajo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Navajo
new file mode 100644
index 0000000000..5fbe26b1d9
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Navajo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/PRC b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/PRC
new file mode 100644
index 0000000000..91f6f8bc2e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/PRC
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/PST8PDT b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/PST8PDT
new file mode 100644
index 0000000000..99d246baa3
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/PST8PDT
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Apia b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Apia
new file mode 100644
index 0000000000..dab1f3f602
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Apia
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Auckland b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Auckland
new file mode 100644
index 0000000000..6575fdce31
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Auckland
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Bougainville b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Bougainville
new file mode 100644
index 0000000000..2892d26809
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Bougainville
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chatham b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chatham
new file mode 100644
index 0000000000..c004109882
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chatham
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chuuk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chuuk
new file mode 100644
index 0000000000..07c84b7110
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Chuuk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Easter b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Easter
new file mode 100644
index 0000000000..cae3744096
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Easter
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Efate b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Efate
new file mode 100644
index 0000000000..60150175c0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Efate
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Enderbury b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Enderbury
new file mode 100644
index 0000000000..f0b8252362
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Enderbury
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fakaofo b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fakaofo
new file mode 100644
index 0000000000..e40307f6aa
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fakaofo
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fiji b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fiji
new file mode 100644
index 0000000000..d39bf53645
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Fiji
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Funafuti b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Funafuti
new file mode 100644
index 0000000000..ea728637ac
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Funafuti
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Galapagos b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Galapagos
new file mode 100644
index 0000000000..31f0921ea0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Galapagos
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Gambier b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Gambier
new file mode 100644
index 0000000000..e1fc3daa55
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Gambier
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guadalcanal b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guadalcanal
new file mode 100644
index 0000000000..7e9d10a100
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guadalcanal
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guam b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guam
new file mode 100644
index 0000000000..66490d25df
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Guam
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Honolulu b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Honolulu
new file mode 100644
index 0000000000..c7cd060159
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Honolulu
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Johnston b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Johnston
new file mode 100644
index 0000000000..c7cd060159
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Johnston
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kiritimati b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kiritimati
new file mode 100644
index 0000000000..7cae0cb756
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kiritimati
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kosrae b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kosrae
new file mode 100644
index 0000000000..a584aae5eb
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kosrae
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kwajalein b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kwajalein
new file mode 100644
index 0000000000..1a7975fad7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Kwajalein
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Majuro b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Majuro
new file mode 100644
index 0000000000..9ef8374de4
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Majuro
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Marquesas b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Marquesas
new file mode 100644
index 0000000000..74d6792bf6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Marquesas
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Midway b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Midway
new file mode 100644
index 0000000000..cb56709a77
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Midway
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Nauru b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Nauru
new file mode 100644
index 0000000000..acec0429f1
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Nauru
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Niue b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Niue
new file mode 100644
index 0000000000..684b010e8b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Niue
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Norfolk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Norfolk
new file mode 100644
index 0000000000..53c1aad4e0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Norfolk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Noumea b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Noumea
new file mode 100644
index 0000000000..931a1a306f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Noumea
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pago_Pago b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pago_Pago
new file mode 100644
index 0000000000..cb56709a77
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pago_Pago
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Palau b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Palau
new file mode 100644
index 0000000000..146b35152a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Palau
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pitcairn b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pitcairn
new file mode 100644
index 0000000000..ef91b061bb
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pitcairn
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pohnpei b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pohnpei
new file mode 100644
index 0000000000..c298ddd4de
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Pohnpei
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Ponape b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Ponape
new file mode 100644
index 0000000000..c298ddd4de
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Ponape
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Port_Moresby b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Port_Moresby
new file mode 100644
index 0000000000..920ad27e62
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Port_Moresby
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Rarotonga b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Rarotonga
new file mode 100644
index 0000000000..da6b0fadea
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Rarotonga
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Saipan b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Saipan
new file mode 100644
index 0000000000..66490d25df
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Saipan
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Samoa b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Samoa
new file mode 100644
index 0000000000..cb56709a77
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Samoa
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tahiti b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tahiti
new file mode 100644
index 0000000000..442b8eb5a4
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tahiti
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tarawa b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tarawa
new file mode 100644
index 0000000000..3db6c75033
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tarawa
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tongatapu b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tongatapu
new file mode 100644
index 0000000000..5553c6009a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Tongatapu
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Truk b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Truk
new file mode 100644
index 0000000000..07c84b7110
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Truk
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wake b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wake
new file mode 100644
index 0000000000..c9e310670f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wake
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wallis b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wallis
new file mode 100644
index 0000000000..b35344b312
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Wallis
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Yap b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Yap
new file mode 100644
index 0000000000..07c84b7110
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Pacific/Yap
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Poland b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Poland
new file mode 100644
index 0000000000..e33cf67171
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Poland
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Portugal b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Portugal
new file mode 100644
index 0000000000..355817b52b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Portugal
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/ROC b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/ROC
new file mode 100644
index 0000000000..24c43444b6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/ROC
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/ROK b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/ROK
new file mode 100644
index 0000000000..96199e73e7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/ROK
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Singapore b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Singapore
new file mode 100644
index 0000000000..2364b2178b
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Singapore
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Turkey b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Turkey
new file mode 100644
index 0000000000..508446bb6a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Turkey
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/UCT b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/UCT
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/UCT
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Alaska b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Alaska
new file mode 100644
index 0000000000..9bbb2fd3b3
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Alaska
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Aleutian b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Aleutian
new file mode 100644
index 0000000000..43236498f6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Aleutian
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Arizona b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Arizona
new file mode 100644
index 0000000000..ac6bb0c782
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Arizona
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Central b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Central
new file mode 100644
index 0000000000..a5b1617c7f
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Central
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/East-Indiana b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/East-Indiana
new file mode 100644
index 0000000000..09511ccdcf
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/East-Indiana
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Eastern b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Eastern
new file mode 100644
index 0000000000..2f75480e06
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Eastern
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Hawaii b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Hawaii
new file mode 100644
index 0000000000..c7cd060159
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Hawaii
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Indiana-Starke b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Indiana-Starke
new file mode 100644
index 0000000000..fcd408d74d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Indiana-Starke
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Michigan b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Michigan
new file mode 100644
index 0000000000..e104faa465
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Michigan
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Mountain b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Mountain
new file mode 100644
index 0000000000..5fbe26b1d9
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Mountain
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Pacific b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Pacific
new file mode 100644
index 0000000000..9dad4f4c75
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Pacific
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Samoa b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Samoa
new file mode 100644
index 0000000000..cb56709a77
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/US/Samoa
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/UTC b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/UTC
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/UTC
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Universal b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Universal
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Universal
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/W-SU b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/W-SU
new file mode 100644
index 0000000000..ddb3f4e99a
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/W-SU
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/WET b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/WET
new file mode 100644
index 0000000000..c27390b5b6
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/WET
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Zulu b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Zulu
new file mode 100644
index 0000000000..91558be0c2
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/Zulu
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/iso3166.tab b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/iso3166.tab
new file mode 100644
index 0000000000..a4ff61a4d3
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/iso3166.tab
@@ -0,0 +1,274 @@
+# ISO 3166 alpha-2 country codes
+#
+# This file is in the public domain, so clarified as of
+# 2009-05-17 by Arthur David Olson.
+#
+# From Paul Eggert (2015-05-02):
+# This file contains a table of two-letter country codes.  Columns are
+# separated by a single tab.  Lines beginning with '#' are comments.
+# All text uses UTF-8 encoding.  The columns of the table are as follows:
+#
+# 1.  ISO 3166-1 alpha-2 country code, current as of
+#     ISO 3166-1 N976 (2018-11-06).  See: Updates on ISO 3166-1
+#     https://isotc.iso.org/livelink/livelink/Open/16944257
+# 2.  The usual English name for the coded region,
+#     chosen so that alphabetic sorting of subsets produces helpful lists.
+#     This is not the same as the English name in the ISO 3166 tables.
+#
+# The table is sorted by country code.
+#
+# This table is intended as an aid for users, to help them select time
+# zone data appropriate for their practical needs.  It is not intended
+# to take or endorse any position on legal or territorial claims.
+#
+#country-
+#code	name of country, territory, area, or subdivision
+AD	Andorra
+AE	United Arab Emirates
+AF	Afghanistan
+AG	Antigua & Barbuda
+AI	Anguilla
+AL	Albania
+AM	Armenia
+AO	Angola
+AQ	Antarctica
+AR	Argentina
+AS	Samoa (American)
+AT	Austria
+AU	Australia
+AW	Aruba
+AX	ร…land Islands
+AZ	Azerbaijan
+BA	Bosnia & Herzegovina
+BB	Barbados
+BD	Bangladesh
+BE	Belgium
+BF	Burkina Faso
+BG	Bulgaria
+BH	Bahrain
+BI	Burundi
+BJ	Benin
+BL	St Barthelemy
+BM	Bermuda
+BN	Brunei
+BO	Bolivia
+BQ	Caribbean NL
+BR	Brazil
+BS	Bahamas
+BT	Bhutan
+BV	Bouvet Island
+BW	Botswana
+BY	Belarus
+BZ	Belize
+CA	Canada
+CC	Cocos (Keeling) Islands
+CD	Congo (Dem. Rep.)
+CF	Central African Rep.
+CG	Congo (Rep.)
+CH	Switzerland
+CI	Cรดte d'Ivoire
+CK	Cook Islands
+CL	Chile
+CM	Cameroon
+CN	China
+CO	Colombia
+CR	Costa Rica
+CU	Cuba
+CV	Cape Verde
+CW	Curaรงao
+CX	Christmas Island
+CY	Cyprus
+CZ	Czech Republic
+DE	Germany
+DJ	Djibouti
+DK	Denmark
+DM	Dominica
+DO	Dominican Republic
+DZ	Algeria
+EC	Ecuador
+EE	Estonia
+EG	Egypt
+EH	Western Sahara
+ER	Eritrea
+ES	Spain
+ET	Ethiopia
+FI	Finland
+FJ	Fiji
+FK	Falkland Islands
+FM	Micronesia
+FO	Faroe Islands
+FR	France
+GA	Gabon
+GB	Britain (UK)
+GD	Grenada
+GE	Georgia
+GF	French Guiana
+GG	Guernsey
+GH	Ghana
+GI	Gibraltar
+GL	Greenland
+GM	Gambia
+GN	Guinea
+GP	Guadeloupe
+GQ	Equatorial Guinea
+GR	Greece
+GS	South Georgia & the South Sandwich Islands
+GT	Guatemala
+GU	Guam
+GW	Guinea-Bissau
+GY	Guyana
+HK	Hong Kong
+HM	Heard Island & McDonald Islands
+HN	Honduras
+HR	Croatia
+HT	Haiti
+HU	Hungary
+ID	Indonesia
+IE	Ireland
+IL	Israel
+IM	Isle of Man
+IN	India
+IO	British Indian Ocean Territory
+IQ	Iraq
+IR	Iran
+IS	Iceland
+IT	Italy
+JE	Jersey
+JM	Jamaica
+JO	Jordan
+JP	Japan
+KE	Kenya
+KG	Kyrgyzstan
+KH	Cambodia
+KI	Kiribati
+KM	Comoros
+KN	St Kitts & Nevis
+KP	Korea (North)
+KR	Korea (South)
+KW	Kuwait
+KY	Cayman Islands
+KZ	Kazakhstan
+LA	Laos
+LB	Lebanon
+LC	St Lucia
+LI	Liechtenstein
+LK	Sri Lanka
+LR	Liberia
+LS	Lesotho
+LT	Lithuania
+LU	Luxembourg
+LV	Latvia
+LY	Libya
+MA	Morocco
+MC	Monaco
+MD	Moldova
+ME	Montenegro
+MF	St Martin (French)
+MG	Madagascar
+MH	Marshall Islands
+MK	North Macedonia
+ML	Mali
+MM	Myanmar (Burma)
+MN	Mongolia
+MO	Macau
+MP	Northern Mariana Islands
+MQ	Martinique
+MR	Mauritania
+MS	Montserrat
+MT	Malta
+MU	Mauritius
+MV	Maldives
+MW	Malawi
+MX	Mexico
+MY	Malaysia
+MZ	Mozambique
+NA	Namibia
+NC	New Caledonia
+NE	Niger
+NF	Norfolk Island
+NG	Nigeria
+NI	Nicaragua
+NL	Netherlands
+NO	Norway
+NP	Nepal
+NR	Nauru
+NU	Niue
+NZ	New Zealand
+OM	Oman
+PA	Panama
+PE	Peru
+PF	French Polynesia
+PG	Papua New Guinea
+PH	Philippines
+PK	Pakistan
+PL	Poland
+PM	St Pierre & Miquelon
+PN	Pitcairn
+PR	Puerto Rico
+PS	Palestine
+PT	Portugal
+PW	Palau
+PY	Paraguay
+QA	Qatar
+RE	Rรฉunion
+RO	Romania
+RS	Serbia
+RU	Russia
+RW	Rwanda
+SA	Saudi Arabia
+SB	Solomon Islands
+SC	Seychelles
+SD	Sudan
+SE	Sweden
+SG	Singapore
+SH	St Helena
+SI	Slovenia
+SJ	Svalbard & Jan Mayen
+SK	Slovakia
+SL	Sierra Leone
+SM	San Marino
+SN	Senegal
+SO	Somalia
+SR	Suriname
+SS	South Sudan
+ST	Sao Tome & Principe
+SV	El Salvador
+SX	St Maarten (Dutch)
+SY	Syria
+SZ	Eswatini (Swaziland)
+TC	Turks & Caicos Is
+TD	Chad
+TF	French Southern & Antarctic Lands
+TG	Togo
+TH	Thailand
+TJ	Tajikistan
+TK	Tokelau
+TL	East Timor
+TM	Turkmenistan
+TN	Tunisia
+TO	Tonga
+TR	Turkey
+TT	Trinidad & Tobago
+TV	Tuvalu
+TW	Taiwan
+TZ	Tanzania
+UA	Ukraine
+UG	Uganda
+UM	US minor outlying islands
+US	United States
+UY	Uruguay
+UZ	Uzbekistan
+VA	Vatican City
+VC	St Vincent
+VE	Venezuela
+VG	Virgin Islands (UK)
+VI	Virgin Islands (US)
+VN	Vietnam
+VU	Vanuatu
+WF	Wallis & Futuna
+WS	Samoa (western)
+YE	Yemen
+YT	Mayotte
+ZA	South Africa
+ZM	Zambia
+ZW	Zimbabwe
diff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/localtime b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/localtime
new file mode 100644
index 0000000000..afeeb88d06
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/localtime
Binary files differdiff --git a/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/zone1970.tab b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/zone1970.tab
new file mode 100644
index 0000000000..53ee77e88e
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/cctz/testdata/zoneinfo/zone1970.tab
@@ -0,0 +1,384 @@
+# tzdb timezone descriptions
+#
+# This file is in the public domain.
+#
+# From Paul Eggert (2018-06-27):
+# This file contains a table where each row stands for a timezone where
+# civil timestamps have agreed since 1970.  Columns are separated by
+# a single tab.  Lines beginning with '#' are comments.  All text uses
+# UTF-8 encoding.  The columns of the table are as follows:
+#
+# 1.  The countries that overlap the timezone, as a comma-separated list
+#     of ISO 3166 2-character country codes.  See the file 'iso3166.tab'.
+# 2.  Latitude and longitude of the timezone's principal location
+#     in ISO 6709 sign-degrees-minutes-seconds format,
+#     either ยฑDDMMยฑDDDMM or ยฑDDMMSSยฑDDDMMSS,
+#     first latitude (+ is north), then longitude (+ is east).
+# 3.  Timezone name used in value of TZ environment variable.
+#     Please see the theory.html file for how these names are chosen.
+#     If multiple timezones overlap a country, each has a row in the
+#     table, with each column 1 containing the country code.
+# 4.  Comments; present if and only if a country has multiple timezones.
+#
+# If a timezone covers multiple countries, the most-populous city is used,
+# and that country is listed first in column 1; any other countries
+# are listed alphabetically by country code.  The table is sorted
+# first by country code, then (if possible) by an order within the
+# country that (1) makes some geographical sense, and (2) puts the
+# most populous timezones first, where that does not contradict (1).
+#
+# This table is intended as an aid for users, to help them select timezones
+# appropriate for their practical needs.  It is not intended to take or
+# endorse any position on legal or territorial claims.
+#
+#country-
+#codes	coordinates	TZ	comments
+AD	+4230+00131	Europe/Andorra
+AE,OM	+2518+05518	Asia/Dubai
+AF	+3431+06912	Asia/Kabul
+AL	+4120+01950	Europe/Tirane
+AM	+4011+04430	Asia/Yerevan
+AQ	-6617+11031	Antarctica/Casey	Casey
+AQ	-6835+07758	Antarctica/Davis	Davis
+AQ	-6640+14001	Antarctica/DumontDUrville	Dumont-d'Urville
+AQ	-6736+06253	Antarctica/Mawson	Mawson
+AQ	-6448-06406	Antarctica/Palmer	Palmer
+AQ	-6734-06808	Antarctica/Rothera	Rothera
+AQ	-690022+0393524	Antarctica/Syowa	Syowa
+AQ	-720041+0023206	Antarctica/Troll	Troll
+AQ	-7824+10654	Antarctica/Vostok	Vostok
+AR	-3436-05827	America/Argentina/Buenos_Aires	Buenos Aires (BA, CF)
+AR	-3124-06411	America/Argentina/Cordoba	Argentina (most areas: CB, CC, CN, ER, FM, MN, SE, SF)
+AR	-2447-06525	America/Argentina/Salta	Salta (SA, LP, NQ, RN)
+AR	-2411-06518	America/Argentina/Jujuy	Jujuy (JY)
+AR	-2649-06513	America/Argentina/Tucuman	Tucumรกn (TM)
+AR	-2828-06547	America/Argentina/Catamarca	Catamarca (CT); Chubut (CH)
+AR	-2926-06651	America/Argentina/La_Rioja	La Rioja (LR)
+AR	-3132-06831	America/Argentina/San_Juan	San Juan (SJ)
+AR	-3253-06849	America/Argentina/Mendoza	Mendoza (MZ)
+AR	-3319-06621	America/Argentina/San_Luis	San Luis (SL)
+AR	-5138-06913	America/Argentina/Rio_Gallegos	Santa Cruz (SC)
+AR	-5448-06818	America/Argentina/Ushuaia	Tierra del Fuego (TF)
+AS,UM	-1416-17042	Pacific/Pago_Pago	Samoa, Midway
+AT	+4813+01620	Europe/Vienna
+AU	-3133+15905	Australia/Lord_Howe	Lord Howe Island
+AU	-5430+15857	Antarctica/Macquarie	Macquarie Island
+AU	-4253+14719	Australia/Hobart	Tasmania (most areas)
+AU	-3956+14352	Australia/Currie	Tasmania (King Island)
+AU	-3749+14458	Australia/Melbourne	Victoria
+AU	-3352+15113	Australia/Sydney	New South Wales (most areas)
+AU	-3157+14127	Australia/Broken_Hill	New South Wales (Yancowinna)
+AU	-2728+15302	Australia/Brisbane	Queensland (most areas)
+AU	-2016+14900	Australia/Lindeman	Queensland (Whitsunday Islands)
+AU	-3455+13835	Australia/Adelaide	South Australia
+AU	-1228+13050	Australia/Darwin	Northern Territory
+AU	-3157+11551	Australia/Perth	Western Australia (most areas)
+AU	-3143+12852	Australia/Eucla	Western Australia (Eucla)
+AZ	+4023+04951	Asia/Baku
+BB	+1306-05937	America/Barbados
+BD	+2343+09025	Asia/Dhaka
+BE	+5050+00420	Europe/Brussels
+BG	+4241+02319	Europe/Sofia
+BM	+3217-06446	Atlantic/Bermuda
+BN	+0456+11455	Asia/Brunei
+BO	-1630-06809	America/La_Paz
+BR	-0351-03225	America/Noronha	Atlantic islands
+BR	-0127-04829	America/Belem	Parรก (east); Amapรก
+BR	-0343-03830	America/Fortaleza	Brazil (northeast: MA, PI, CE, RN, PB)
+BR	-0803-03454	America/Recife	Pernambuco
+BR	-0712-04812	America/Araguaina	Tocantins
+BR	-0940-03543	America/Maceio	Alagoas, Sergipe
+BR	-1259-03831	America/Bahia	Bahia
+BR	-2332-04637	America/Sao_Paulo	Brazil (southeast: GO, DF, MG, ES, RJ, SP, PR, SC, RS)
+BR	-2027-05437	America/Campo_Grande	Mato Grosso do Sul
+BR	-1535-05605	America/Cuiaba	Mato Grosso
+BR	-0226-05452	America/Santarem	Parรก (west)
+BR	-0846-06354	America/Porto_Velho	Rondรดnia
+BR	+0249-06040	America/Boa_Vista	Roraima
+BR	-0308-06001	America/Manaus	Amazonas (east)
+BR	-0640-06952	America/Eirunepe	Amazonas (west)
+BR	-0958-06748	America/Rio_Branco	Acre
+BS	+2505-07721	America/Nassau
+BT	+2728+08939	Asia/Thimphu
+BY	+5354+02734	Europe/Minsk
+BZ	+1730-08812	America/Belize
+CA	+4734-05243	America/St_Johns	Newfoundland; Labrador (southeast)
+CA	+4439-06336	America/Halifax	Atlantic - NS (most areas); PE
+CA	+4612-05957	America/Glace_Bay	Atlantic - NS (Cape Breton)
+CA	+4606-06447	America/Moncton	Atlantic - New Brunswick
+CA	+5320-06025	America/Goose_Bay	Atlantic - Labrador (most areas)
+CA	+5125-05707	America/Blanc-Sablon	AST - QC (Lower North Shore)
+CA	+4339-07923	America/Toronto	Eastern - ON, QC (most areas)
+CA	+4901-08816	America/Nipigon	Eastern - ON, QC (no DST 1967-73)
+CA	+4823-08915	America/Thunder_Bay	Eastern - ON (Thunder Bay)
+CA	+6344-06828	America/Iqaluit	Eastern - NU (most east areas)
+CA	+6608-06544	America/Pangnirtung	Eastern - NU (Pangnirtung)
+CA	+484531-0913718	America/Atikokan	EST - ON (Atikokan); NU (Coral H)
+CA	+4953-09709	America/Winnipeg	Central - ON (west); Manitoba
+CA	+4843-09434	America/Rainy_River	Central - ON (Rainy R, Ft Frances)
+CA	+744144-0944945	America/Resolute	Central - NU (Resolute)
+CA	+624900-0920459	America/Rankin_Inlet	Central - NU (central)
+CA	+5024-10439	America/Regina	CST - SK (most areas)
+CA	+5017-10750	America/Swift_Current	CST - SK (midwest)
+CA	+5333-11328	America/Edmonton	Mountain - AB; BC (E); SK (W)
+CA	+690650-1050310	America/Cambridge_Bay	Mountain - NU (west)
+CA	+6227-11421	America/Yellowknife	Mountain - NT (central)
+CA	+682059-1334300	America/Inuvik	Mountain - NT (west)
+CA	+4906-11631	America/Creston	MST - BC (Creston)
+CA	+5946-12014	America/Dawson_Creek	MST - BC (Dawson Cr, Ft St John)
+CA	+5848-12242	America/Fort_Nelson	MST - BC (Ft Nelson)
+CA	+4916-12307	America/Vancouver	Pacific - BC (most areas)
+CA	+6043-13503	America/Whitehorse	Pacific - Yukon (east)
+CA	+6404-13925	America/Dawson	Pacific - Yukon (west)
+CC	-1210+09655	Indian/Cocos
+CH,DE,LI	+4723+00832	Europe/Zurich	Swiss time
+CI,BF,GM,GN,ML,MR,SH,SL,SN,TG	+0519-00402	Africa/Abidjan
+CK	-2114-15946	Pacific/Rarotonga
+CL	-3327-07040	America/Santiago	Chile (most areas)
+CL	-5309-07055	America/Punta_Arenas	Region of Magallanes
+CL	-2709-10926	Pacific/Easter	Easter Island
+CN	+3114+12128	Asia/Shanghai	Beijing Time
+CN	+4348+08735	Asia/Urumqi	Xinjiang Time
+CO	+0436-07405	America/Bogota
+CR	+0956-08405	America/Costa_Rica
+CU	+2308-08222	America/Havana
+CV	+1455-02331	Atlantic/Cape_Verde
+CW,AW,BQ,SX	+1211-06900	America/Curacao
+CX	-1025+10543	Indian/Christmas
+CY	+3510+03322	Asia/Nicosia	Cyprus (most areas)
+CY	+3507+03357	Asia/Famagusta	Northern Cyprus
+CZ,SK	+5005+01426	Europe/Prague
+DE	+5230+01322	Europe/Berlin	Germany (most areas)
+DK	+5540+01235	Europe/Copenhagen
+DO	+1828-06954	America/Santo_Domingo
+DZ	+3647+00303	Africa/Algiers
+EC	-0210-07950	America/Guayaquil	Ecuador (mainland)
+EC	-0054-08936	Pacific/Galapagos	Galรกpagos Islands
+EE	+5925+02445	Europe/Tallinn
+EG	+3003+03115	Africa/Cairo
+EH	+2709-01312	Africa/El_Aaiun
+ES	+4024-00341	Europe/Madrid	Spain (mainland)
+ES	+3553-00519	Africa/Ceuta	Ceuta, Melilla
+ES	+2806-01524	Atlantic/Canary	Canary Islands
+FI,AX	+6010+02458	Europe/Helsinki
+FJ	-1808+17825	Pacific/Fiji
+FK	-5142-05751	Atlantic/Stanley
+FM	+0725+15147	Pacific/Chuuk	Chuuk/Truk, Yap
+FM	+0658+15813	Pacific/Pohnpei	Pohnpei/Ponape
+FM	+0519+16259	Pacific/Kosrae	Kosrae
+FO	+6201-00646	Atlantic/Faroe
+FR	+4852+00220	Europe/Paris
+GB,GG,IM,JE	+513030-0000731	Europe/London
+GE	+4143+04449	Asia/Tbilisi
+GF	+0456-05220	America/Cayenne
+GH	+0533-00013	Africa/Accra
+GI	+3608-00521	Europe/Gibraltar
+GL	+6411-05144	America/Nuuk	Greenland (most areas)
+GL	+7646-01840	America/Danmarkshavn	National Park (east coast)
+GL	+7029-02158	America/Scoresbysund	Scoresbysund/Ittoqqortoormiit
+GL	+7634-06847	America/Thule	Thule/Pituffik
+GR	+3758+02343	Europe/Athens
+GS	-5416-03632	Atlantic/South_Georgia
+GT	+1438-09031	America/Guatemala
+GU,MP	+1328+14445	Pacific/Guam
+GW	+1151-01535	Africa/Bissau
+GY	+0648-05810	America/Guyana
+HK	+2217+11409	Asia/Hong_Kong
+HN	+1406-08713	America/Tegucigalpa
+HT	+1832-07220	America/Port-au-Prince
+HU	+4730+01905	Europe/Budapest
+ID	-0610+10648	Asia/Jakarta	Java, Sumatra
+ID	-0002+10920	Asia/Pontianak	Borneo (west, central)
+ID	-0507+11924	Asia/Makassar	Borneo (east, south); Sulawesi/Celebes, Bali, Nusa Tengarra; Timor (west)
+ID	-0232+14042	Asia/Jayapura	New Guinea (West Papua / Irian Jaya); Malukus/Moluccas
+IE	+5320-00615	Europe/Dublin
+IL	+314650+0351326	Asia/Jerusalem
+IN	+2232+08822	Asia/Kolkata
+IO	-0720+07225	Indian/Chagos
+IQ	+3321+04425	Asia/Baghdad
+IR	+3540+05126	Asia/Tehran
+IS	+6409-02151	Atlantic/Reykjavik
+IT,SM,VA	+4154+01229	Europe/Rome
+JM	+175805-0764736	America/Jamaica
+JO	+3157+03556	Asia/Amman
+JP	+353916+1394441	Asia/Tokyo
+KE,DJ,ER,ET,KM,MG,SO,TZ,UG,YT	-0117+03649	Africa/Nairobi
+KG	+4254+07436	Asia/Bishkek
+KI	+0125+17300	Pacific/Tarawa	Gilbert Islands
+KI	-0308-17105	Pacific/Enderbury	Phoenix Islands
+KI	+0152-15720	Pacific/Kiritimati	Line Islands
+KP	+3901+12545	Asia/Pyongyang
+KR	+3733+12658	Asia/Seoul
+KZ	+4315+07657	Asia/Almaty	Kazakhstan (most areas)
+KZ	+4448+06528	Asia/Qyzylorda	Qyzylorda/Kyzylorda/Kzyl-Orda
+KZ	+5312+06337	Asia/Qostanay	Qostanay/Kostanay/Kustanay
+KZ	+5017+05710	Asia/Aqtobe	Aqtรถbe/Aktobe
+KZ	+4431+05016	Asia/Aqtau	Mangghystaลซ/Mankistau
+KZ	+4707+05156	Asia/Atyrau	Atyraลซ/Atirau/Gur'yev
+KZ	+5113+05121	Asia/Oral	West Kazakhstan
+LB	+3353+03530	Asia/Beirut
+LK	+0656+07951	Asia/Colombo
+LR	+0618-01047	Africa/Monrovia
+LT	+5441+02519	Europe/Vilnius
+LU	+4936+00609	Europe/Luxembourg
+LV	+5657+02406	Europe/Riga
+LY	+3254+01311	Africa/Tripoli
+MA	+3339-00735	Africa/Casablanca
+MC	+4342+00723	Europe/Monaco
+MD	+4700+02850	Europe/Chisinau
+MH	+0709+17112	Pacific/Majuro	Marshall Islands (most areas)
+MH	+0905+16720	Pacific/Kwajalein	Kwajalein
+MM	+1647+09610	Asia/Yangon
+MN	+4755+10653	Asia/Ulaanbaatar	Mongolia (most areas)
+MN	+4801+09139	Asia/Hovd	Bayan-ร–lgii, Govi-Altai, Hovd, Uvs, Zavkhan
+MN	+4804+11430	Asia/Choibalsan	Dornod, Sรผkhbaatar
+MO	+221150+1133230	Asia/Macau
+MQ	+1436-06105	America/Martinique
+MT	+3554+01431	Europe/Malta
+MU	-2010+05730	Indian/Mauritius
+MV	+0410+07330	Indian/Maldives
+MX	+1924-09909	America/Mexico_City	Central Time
+MX	+2105-08646	America/Cancun	Eastern Standard Time - Quintana Roo
+MX	+2058-08937	America/Merida	Central Time - Campeche, Yucatรกn
+MX	+2540-10019	America/Monterrey	Central Time - Durango; Coahuila, Nuevo Leรณn, Tamaulipas (most areas)
+MX	+2550-09730	America/Matamoros	Central Time US - Coahuila, Nuevo Leรณn, Tamaulipas (US border)
+MX	+2313-10625	America/Mazatlan	Mountain Time - Baja California Sur, Nayarit, Sinaloa
+MX	+2838-10605	America/Chihuahua	Mountain Time - Chihuahua (most areas)
+MX	+2934-10425	America/Ojinaga	Mountain Time US - Chihuahua (US border)
+MX	+2904-11058	America/Hermosillo	Mountain Standard Time - Sonora
+MX	+3232-11701	America/Tijuana	Pacific Time US - Baja California
+MX	+2048-10515	America/Bahia_Banderas	Central Time - Bahรญa de Banderas
+MY	+0310+10142	Asia/Kuala_Lumpur	Malaysia (peninsula)
+MY	+0133+11020	Asia/Kuching	Sabah, Sarawak
+MZ,BI,BW,CD,MW,RW,ZM,ZW	-2558+03235	Africa/Maputo	Central Africa Time
+NA	-2234+01706	Africa/Windhoek
+NC	-2216+16627	Pacific/Noumea
+NF	-2903+16758	Pacific/Norfolk
+NG,AO,BJ,CD,CF,CG,CM,GA,GQ,NE	+0627+00324	Africa/Lagos	West Africa Time
+NI	+1209-08617	America/Managua
+NL	+5222+00454	Europe/Amsterdam
+NO,SJ	+5955+01045	Europe/Oslo
+NP	+2743+08519	Asia/Kathmandu
+NR	-0031+16655	Pacific/Nauru
+NU	-1901-16955	Pacific/Niue
+NZ,AQ	-3652+17446	Pacific/Auckland	New Zealand time
+NZ	-4357-17633	Pacific/Chatham	Chatham Islands
+PA,KY	+0858-07932	America/Panama
+PE	-1203-07703	America/Lima
+PF	-1732-14934	Pacific/Tahiti	Society Islands
+PF	-0900-13930	Pacific/Marquesas	Marquesas Islands
+PF	-2308-13457	Pacific/Gambier	Gambier Islands
+PG	-0930+14710	Pacific/Port_Moresby	Papua New Guinea (most areas)
+PG	-0613+15534	Pacific/Bougainville	Bougainville
+PH	+1435+12100	Asia/Manila
+PK	+2452+06703	Asia/Karachi
+PL	+5215+02100	Europe/Warsaw
+PM	+4703-05620	America/Miquelon
+PN	-2504-13005	Pacific/Pitcairn
+PR	+182806-0660622	America/Puerto_Rico
+PS	+3130+03428	Asia/Gaza	Gaza Strip
+PS	+313200+0350542	Asia/Hebron	West Bank
+PT	+3843-00908	Europe/Lisbon	Portugal (mainland)
+PT	+3238-01654	Atlantic/Madeira	Madeira Islands
+PT	+3744-02540	Atlantic/Azores	Azores
+PW	+0720+13429	Pacific/Palau
+PY	-2516-05740	America/Asuncion
+QA,BH	+2517+05132	Asia/Qatar
+RE,TF	-2052+05528	Indian/Reunion	Rรฉunion, Crozet, Scattered Islands
+RO	+4426+02606	Europe/Bucharest
+RS,BA,HR,ME,MK,SI	+4450+02030	Europe/Belgrade
+RU	+5443+02030	Europe/Kaliningrad	MSK-01 - Kaliningrad
+RU	+554521+0373704	Europe/Moscow	MSK+00 - Moscow area
+# Mention RU and UA alphabetically.  See "territorial claims" above.
+RU,UA	+4457+03406	Europe/Simferopol	Crimea
+RU	+5836+04939	Europe/Kirov	MSK+00 - Kirov
+RU	+4621+04803	Europe/Astrakhan	MSK+01 - Astrakhan
+RU	+4844+04425	Europe/Volgograd	MSK+01 - Volgograd
+RU	+5134+04602	Europe/Saratov	MSK+01 - Saratov
+RU	+5420+04824	Europe/Ulyanovsk	MSK+01 - Ulyanovsk
+RU	+5312+05009	Europe/Samara	MSK+01 - Samara, Udmurtia
+RU	+5651+06036	Asia/Yekaterinburg	MSK+02 - Urals
+RU	+5500+07324	Asia/Omsk	MSK+03 - Omsk
+RU	+5502+08255	Asia/Novosibirsk	MSK+04 - Novosibirsk
+RU	+5322+08345	Asia/Barnaul	MSK+04 - Altai
+RU	+5630+08458	Asia/Tomsk	MSK+04 - Tomsk
+RU	+5345+08707	Asia/Novokuznetsk	MSK+04 - Kemerovo
+RU	+5601+09250	Asia/Krasnoyarsk	MSK+04 - Krasnoyarsk area
+RU	+5216+10420	Asia/Irkutsk	MSK+05 - Irkutsk, Buryatia
+RU	+5203+11328	Asia/Chita	MSK+06 - Zabaykalsky
+RU	+6200+12940	Asia/Yakutsk	MSK+06 - Lena River
+RU	+623923+1353314	Asia/Khandyga	MSK+06 - Tomponsky, Ust-Maysky
+RU	+4310+13156	Asia/Vladivostok	MSK+07 - Amur River
+RU	+643337+1431336	Asia/Ust-Nera	MSK+07 - Oymyakonsky
+RU	+5934+15048	Asia/Magadan	MSK+08 - Magadan
+RU	+4658+14242	Asia/Sakhalin	MSK+08 - Sakhalin Island
+RU	+6728+15343	Asia/Srednekolymsk	MSK+08 - Sakha (E); North Kuril Is
+RU	+5301+15839	Asia/Kamchatka	MSK+09 - Kamchatka
+RU	+6445+17729	Asia/Anadyr	MSK+09 - Bering Sea
+SA,KW,YE	+2438+04643	Asia/Riyadh
+SB	-0932+16012	Pacific/Guadalcanal
+SC	-0440+05528	Indian/Mahe
+SD	+1536+03232	Africa/Khartoum
+SE	+5920+01803	Europe/Stockholm
+SG	+0117+10351	Asia/Singapore
+SR	+0550-05510	America/Paramaribo
+SS	+0451+03137	Africa/Juba
+ST	+0020+00644	Africa/Sao_Tome
+SV	+1342-08912	America/El_Salvador
+SY	+3330+03618	Asia/Damascus
+TC	+2128-07108	America/Grand_Turk
+TD	+1207+01503	Africa/Ndjamena
+TF	-492110+0701303	Indian/Kerguelen	Kerguelen, St Paul Island, Amsterdam Island
+TH,KH,LA,VN	+1345+10031	Asia/Bangkok	Indochina (most areas)
+TJ	+3835+06848	Asia/Dushanbe
+TK	-0922-17114	Pacific/Fakaofo
+TL	-0833+12535	Asia/Dili
+TM	+3757+05823	Asia/Ashgabat
+TN	+3648+01011	Africa/Tunis
+TO	-2110-17510	Pacific/Tongatapu
+TR	+4101+02858	Europe/Istanbul
+TT,AG,AI,BL,DM,GD,GP,KN,LC,MF,MS,VC,VG,VI	+1039-06131	America/Port_of_Spain
+TV	-0831+17913	Pacific/Funafuti
+TW	+2503+12130	Asia/Taipei
+UA	+5026+03031	Europe/Kiev	Ukraine (most areas)
+UA	+4837+02218	Europe/Uzhgorod	Transcarpathia
+UA	+4750+03510	Europe/Zaporozhye	Zaporozhye and east Lugansk
+UM	+1917+16637	Pacific/Wake	Wake Island
+US	+404251-0740023	America/New_York	Eastern (most areas)
+US	+421953-0830245	America/Detroit	Eastern - MI (most areas)
+US	+381515-0854534	America/Kentucky/Louisville	Eastern - KY (Louisville area)
+US	+364947-0845057	America/Kentucky/Monticello	Eastern - KY (Wayne)
+US	+394606-0860929	America/Indiana/Indianapolis	Eastern - IN (most areas)
+US	+384038-0873143	America/Indiana/Vincennes	Eastern - IN (Da, Du, K, Mn)
+US	+410305-0863611	America/Indiana/Winamac	Eastern - IN (Pulaski)
+US	+382232-0862041	America/Indiana/Marengo	Eastern - IN (Crawford)
+US	+382931-0871643	America/Indiana/Petersburg	Eastern - IN (Pike)
+US	+384452-0850402	America/Indiana/Vevay	Eastern - IN (Switzerland)
+US	+415100-0873900	America/Chicago	Central (most areas)
+US	+375711-0864541	America/Indiana/Tell_City	Central - IN (Perry)
+US	+411745-0863730	America/Indiana/Knox	Central - IN (Starke)
+US	+450628-0873651	America/Menominee	Central - MI (Wisconsin border)
+US	+470659-1011757	America/North_Dakota/Center	Central - ND (Oliver)
+US	+465042-1012439	America/North_Dakota/New_Salem	Central - ND (Morton rural)
+US	+471551-1014640	America/North_Dakota/Beulah	Central - ND (Mercer)
+US	+394421-1045903	America/Denver	Mountain (most areas)
+US	+433649-1161209	America/Boise	Mountain - ID (south); OR (east)
+US	+332654-1120424	America/Phoenix	MST - Arizona (except Navajo)
+US	+340308-1181434	America/Los_Angeles	Pacific
+US	+611305-1495401	America/Anchorage	Alaska (most areas)
+US	+581807-1342511	America/Juneau	Alaska - Juneau area
+US	+571035-1351807	America/Sitka	Alaska - Sitka area
+US	+550737-1313435	America/Metlakatla	Alaska - Annette Island
+US	+593249-1394338	America/Yakutat	Alaska - Yakutat
+US	+643004-1652423	America/Nome	Alaska (west)
+US	+515248-1763929	America/Adak	Aleutian Islands
+US,UM	+211825-1575130	Pacific/Honolulu	Hawaii
+UY	-345433-0561245	America/Montevideo
+UZ	+3940+06648	Asia/Samarkand	Uzbekistan (west)
+UZ	+4120+06918	Asia/Tashkent	Uzbekistan (east)
+VE	+1030-06656	America/Caracas
+VN	+1045+10640	Asia/Ho_Chi_Minh	Vietnam (south)
+VU	-1740+16825	Pacific/Efate
+WF	-1318-17610	Pacific/Wallis
+WS	-1350-17144	Pacific/Apia
+ZA,LS,SZ	-2615+02800	Africa/Johannesburg
diff --git a/third_party/abseil_cpp/absl/time/internal/get_current_time_chrono.inc b/third_party/abseil_cpp/absl/time/internal/get_current_time_chrono.inc
new file mode 100644
index 0000000000..5eeb6406aa
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/get_current_time_chrono.inc
@@ -0,0 +1,31 @@
+// Copyright 2018 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include <chrono>
+#include <cstdint>
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+
+static int64_t GetCurrentTimeNanosFromSystem() {
+  return std::chrono::duration_cast<std::chrono::nanoseconds>(
+             std::chrono::system_clock::now() -
+             std::chrono::system_clock::from_time_t(0))
+      .count();
+}
+
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/get_current_time_posix.inc b/third_party/abseil_cpp/absl/time/internal/get_current_time_posix.inc
new file mode 100644
index 0000000000..42072000ae
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/get_current_time_posix.inc
@@ -0,0 +1,24 @@
+#include "absl/time/clock.h"
+
+#include <sys/time.h>
+#include <ctime>
+#include <cstdint>
+
+#include "absl/base/internal/raw_logging.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+
+static int64_t GetCurrentTimeNanosFromSystem() {
+  const int64_t kNanosPerSecond = 1000 * 1000 * 1000;
+  struct timespec ts;
+  ABSL_RAW_CHECK(clock_gettime(CLOCK_REALTIME, &ts) == 0,
+                 "Failed to read real-time clock.");
+  return (int64_t{ts.tv_sec} * kNanosPerSecond +
+          int64_t{ts.tv_nsec});
+}
+
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/test_util.cc b/third_party/abseil_cpp/absl/time/internal/test_util.cc
new file mode 100644
index 0000000000..9bffe121da
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/test_util.cc
@@ -0,0 +1,130 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/time/internal/test_util.h"
+
+#include <algorithm>
+#include <cstddef>
+#include <cstring>
+
+#include "absl/base/internal/raw_logging.h"
+#include "absl/time/internal/cctz/include/cctz/zone_info_source.h"
+
+namespace cctz = absl::time_internal::cctz;
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+
+TimeZone LoadTimeZone(const std::string& name) {
+  TimeZone tz;
+  ABSL_RAW_CHECK(LoadTimeZone(name, &tz), name.c_str());
+  return tz;
+}
+
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+namespace cctz_extension {
+namespace {
+
+// Embed the zoneinfo data for time zones used during tests and benchmarks.
+// The data was generated using "xxd -i zoneinfo-file".  There is no need
+// to update the data as long as the tests do not depend on recent changes
+// (and the past rules remain the same).
+#include "absl/time/internal/zoneinfo.inc"
+
+const struct ZoneInfo {
+  const char* name;
+  const char* data;
+  std::size_t length;
+} kZoneInfo[] = {
+    // The three real time zones used by :time_test and :time_benchmark.
+    {"America/Los_Angeles",  //
+     reinterpret_cast<char*>(America_Los_Angeles), America_Los_Angeles_len},
+    {"America/New_York",  //
+     reinterpret_cast<char*>(America_New_York), America_New_York_len},
+    {"Australia/Sydney",  //
+     reinterpret_cast<char*>(Australia_Sydney), Australia_Sydney_len},
+
+    // Other zones named in tests but which should fail to load.
+    {"Invalid/TimeZone", nullptr, 0},
+    {"", nullptr, 0},
+
+    // Also allow for loading the local time zone under TZ=US/Pacific.
+    {"US/Pacific",  //
+     reinterpret_cast<char*>(America_Los_Angeles), America_Los_Angeles_len},
+
+    // Allows use of the local time zone from a system-specific location.
+#ifdef _MSC_VER
+    {"localtime",  //
+     reinterpret_cast<char*>(America_Los_Angeles), America_Los_Angeles_len},
+#else
+    {"/etc/localtime",  //
+     reinterpret_cast<char*>(America_Los_Angeles), America_Los_Angeles_len},
+#endif
+};
+
+class TestZoneInfoSource : public cctz::ZoneInfoSource {
+ public:
+  TestZoneInfoSource(const char* data, std::size_t size)
+      : data_(data), end_(data + size) {}
+
+  std::size_t Read(void* ptr, std::size_t size) override {
+    const std::size_t len = std::min<std::size_t>(size, end_ - data_);
+    memcpy(ptr, data_, len);
+    data_ += len;
+    return len;
+  }
+
+  int Skip(std::size_t offset) override {
+    data_ += std::min<std::size_t>(offset, end_ - data_);
+    return 0;
+  }
+
+ private:
+  const char* data_;
+  const char* const end_;
+};
+
+std::unique_ptr<cctz::ZoneInfoSource> TestFactory(
+    const std::string& name,
+    const std::function<std::unique_ptr<cctz::ZoneInfoSource>(
+        const std::string& name)>& /*fallback_factory*/) {
+  for (const ZoneInfo& zoneinfo : kZoneInfo) {
+    if (name == zoneinfo.name) {
+      if (zoneinfo.data == nullptr) return nullptr;
+      return std::unique_ptr<cctz::ZoneInfoSource>(
+          new TestZoneInfoSource(zoneinfo.data, zoneinfo.length));
+    }
+  }
+  ABSL_RAW_LOG(FATAL, "Unexpected time zone \"%s\" in test", name.c_str());
+  return nullptr;
+}
+
+}  // namespace
+
+#if !defined(__MINGW32__)
+// MinGW does not support the weak symbol extension mechanism.
+ZoneInfoSourceFactory zone_info_source_factory = TestFactory;
+#endif
+
+}  // namespace cctz_extension
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/internal/test_util.h b/third_party/abseil_cpp/absl/time/internal/test_util.h
new file mode 100644
index 0000000000..5c4bf1f680
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/test_util.h
@@ -0,0 +1,33 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#ifndef ABSL_TIME_INTERNAL_TEST_UTIL_H_
+#define ABSL_TIME_INTERNAL_TEST_UTIL_H_
+
+#include <string>
+
+#include "absl/time/time.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+namespace time_internal {
+
+// Loads the named timezone, but dies on any failure.
+absl::TimeZone LoadTimeZone(const std::string& name);
+
+}  // namespace time_internal
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+#endif  // ABSL_TIME_INTERNAL_TEST_UTIL_H_
diff --git a/third_party/abseil_cpp/absl/time/internal/zoneinfo.inc b/third_party/abseil_cpp/absl/time/internal/zoneinfo.inc
new file mode 100644
index 0000000000..bfed82990d
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/internal/zoneinfo.inc
@@ -0,0 +1,729 @@
+unsigned char America_Los_Angeles[] = {
+  0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xba,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x14, 0x80, 0x00, 0x00, 0x00,
+  0x9e, 0xa6, 0x48, 0xa0, 0x9f, 0xbb, 0x15, 0x90, 0xa0, 0x86, 0x2a, 0xa0,
+  0xa1, 0x9a, 0xf7, 0x90, 0xcb, 0x89, 0x1a, 0xa0, 0xd2, 0x23, 0xf4, 0x70,
+  0xd2, 0x61, 0x26, 0x10, 0xd6, 0xfe, 0x74, 0x5c, 0xd8, 0x80, 0xad, 0x90,
+  0xda, 0xfe, 0xc3, 0x90, 0xdb, 0xc0, 0x90, 0x10, 0xdc, 0xde, 0xa5, 0x90,
+  0xdd, 0xa9, 0xac, 0x90, 0xde, 0xbe, 0x87, 0x90, 0xdf, 0x89, 0x8e, 0x90,
+  0xe0, 0x9e, 0x69, 0x90, 0xe1, 0x69, 0x70, 0x90, 0xe2, 0x7e, 0x4b, 0x90,
+  0xe3, 0x49, 0x52, 0x90, 0xe4, 0x5e, 0x2d, 0x90, 0xe5, 0x29, 0x34, 0x90,
+  0xe6, 0x47, 0x4a, 0x10, 0xe7, 0x12, 0x51, 0x10, 0xe8, 0x27, 0x2c, 0x10,
+  0xe8, 0xf2, 0x33, 0x10, 0xea, 0x07, 0x0e, 0x10, 0xea, 0xd2, 0x15, 0x10,
+  0xeb, 0xe6, 0xf0, 0x10, 0xec, 0xb1, 0xf7, 0x10, 0xed, 0xc6, 0xd2, 0x10,
+  0xee, 0x91, 0xd9, 0x10, 0xef, 0xaf, 0xee, 0x90, 0xf0, 0x71, 0xbb, 0x10,
+  0xf1, 0x8f, 0xd0, 0x90, 0xf2, 0x7f, 0xc1, 0x90, 0xf3, 0x6f, 0xb2, 0x90,
+  0xf4, 0x5f, 0xa3, 0x90, 0xf5, 0x4f, 0x94, 0x90, 0xf6, 0x3f, 0x85, 0x90,
+  0xf7, 0x2f, 0x76, 0x90, 0xf8, 0x28, 0xa2, 0x10, 0xf9, 0x0f, 0x58, 0x90,
+  0xfa, 0x08, 0x84, 0x10, 0xfa, 0xf8, 0x83, 0x20, 0xfb, 0xe8, 0x66, 0x10,
+  0xfc, 0xd8, 0x65, 0x20, 0xfd, 0xc8, 0x48, 0x10, 0xfe, 0xb8, 0x47, 0x20,
+  0xff, 0xa8, 0x2a, 0x10, 0x00, 0x98, 0x29, 0x20, 0x01, 0x88, 0x0c, 0x10,
+  0x02, 0x78, 0x0b, 0x20, 0x03, 0x71, 0x28, 0x90, 0x04, 0x61, 0x27, 0xa0,
+  0x05, 0x51, 0x0a, 0x90, 0x06, 0x41, 0x09, 0xa0, 0x07, 0x30, 0xec, 0x90,
+  0x07, 0x8d, 0x43, 0xa0, 0x09, 0x10, 0xce, 0x90, 0x09, 0xad, 0xbf, 0x20,
+  0x0a, 0xf0, 0xb0, 0x90, 0x0b, 0xe0, 0xaf, 0xa0, 0x0c, 0xd9, 0xcd, 0x10,
+  0x0d, 0xc0, 0x91, 0xa0, 0x0e, 0xb9, 0xaf, 0x10, 0x0f, 0xa9, 0xae, 0x20,
+  0x10, 0x99, 0x91, 0x10, 0x11, 0x89, 0x90, 0x20, 0x12, 0x79, 0x73, 0x10,
+  0x13, 0x69, 0x72, 0x20, 0x14, 0x59, 0x55, 0x10, 0x15, 0x49, 0x54, 0x20,
+  0x16, 0x39, 0x37, 0x10, 0x17, 0x29, 0x36, 0x20, 0x18, 0x22, 0x53, 0x90,
+  0x19, 0x09, 0x18, 0x20, 0x1a, 0x02, 0x35, 0x90, 0x1a, 0xf2, 0x34, 0xa0,
+  0x1b, 0xe2, 0x17, 0x90, 0x1c, 0xd2, 0x16, 0xa0, 0x1d, 0xc1, 0xf9, 0x90,
+  0x1e, 0xb1, 0xf8, 0xa0, 0x1f, 0xa1, 0xdb, 0x90, 0x20, 0x76, 0x2b, 0x20,
+  0x21, 0x81, 0xbd, 0x90, 0x22, 0x56, 0x0d, 0x20, 0x23, 0x6a, 0xda, 0x10,
+  0x24, 0x35, 0xef, 0x20, 0x25, 0x4a, 0xbc, 0x10, 0x26, 0x15, 0xd1, 0x20,
+  0x27, 0x2a, 0x9e, 0x10, 0x27, 0xfe, 0xed, 0xa0, 0x29, 0x0a, 0x80, 0x10,
+  0x29, 0xde, 0xcf, 0xa0, 0x2a, 0xea, 0x62, 0x10, 0x2b, 0xbe, 0xb1, 0xa0,
+  0x2c, 0xd3, 0x7e, 0x90, 0x2d, 0x9e, 0x93, 0xa0, 0x2e, 0xb3, 0x60, 0x90,
+  0x2f, 0x7e, 0x75, 0xa0, 0x30, 0x93, 0x42, 0x90, 0x31, 0x67, 0x92, 0x20,
+  0x32, 0x73, 0x24, 0x90, 0x33, 0x47, 0x74, 0x20, 0x34, 0x53, 0x06, 0x90,
+  0x35, 0x27, 0x56, 0x20, 0x36, 0x32, 0xe8, 0x90, 0x37, 0x07, 0x38, 0x20,
+  0x38, 0x1c, 0x05, 0x10, 0x38, 0xe7, 0x1a, 0x20, 0x39, 0xfb, 0xe7, 0x10,
+  0x3a, 0xc6, 0xfc, 0x20, 0x3b, 0xdb, 0xc9, 0x10, 0x3c, 0xb0, 0x18, 0xa0,
+  0x3d, 0xbb, 0xab, 0x10, 0x3e, 0x8f, 0xfa, 0xa0, 0x3f, 0x9b, 0x8d, 0x10,
+  0x40, 0x6f, 0xdc, 0xa0, 0x41, 0x84, 0xa9, 0x90, 0x42, 0x4f, 0xbe, 0xa0,
+  0x43, 0x64, 0x8b, 0x90, 0x44, 0x2f, 0xa0, 0xa0, 0x45, 0x44, 0x6d, 0x90,
+  0x45, 0xf3, 0xd3, 0x20, 0x47, 0x2d, 0x8a, 0x10, 0x47, 0xd3, 0xb5, 0x20,
+  0x49, 0x0d, 0x6c, 0x10, 0x49, 0xb3, 0x97, 0x20, 0x4a, 0xed, 0x4e, 0x10,
+  0x4b, 0x9c, 0xb3, 0xa0, 0x4c, 0xd6, 0x6a, 0x90, 0x4d, 0x7c, 0x95, 0xa0,
+  0x4e, 0xb6, 0x4c, 0x90, 0x4f, 0x5c, 0x77, 0xa0, 0x50, 0x96, 0x2e, 0x90,
+  0x51, 0x3c, 0x59, 0xa0, 0x52, 0x76, 0x10, 0x90, 0x53, 0x1c, 0x3b, 0xa0,
+  0x54, 0x55, 0xf2, 0x90, 0x54, 0xfc, 0x1d, 0xa0, 0x56, 0x35, 0xd4, 0x90,
+  0x56, 0xe5, 0x3a, 0x20, 0x58, 0x1e, 0xf1, 0x10, 0x58, 0xc5, 0x1c, 0x20,
+  0x59, 0xfe, 0xd3, 0x10, 0x5a, 0xa4, 0xfe, 0x20, 0x5b, 0xde, 0xb5, 0x10,
+  0x5c, 0x84, 0xe0, 0x20, 0x5d, 0xbe, 0x97, 0x10, 0x5e, 0x64, 0xc2, 0x20,
+  0x5f, 0x9e, 0x79, 0x10, 0x60, 0x4d, 0xde, 0xa0, 0x61, 0x87, 0x95, 0x90,
+  0x62, 0x2d, 0xc0, 0xa0, 0x63, 0x67, 0x77, 0x90, 0x64, 0x0d, 0xa2, 0xa0,
+  0x65, 0x47, 0x59, 0x90, 0x65, 0xed, 0x84, 0xa0, 0x67, 0x27, 0x3b, 0x90,
+  0x67, 0xcd, 0x66, 0xa0, 0x69, 0x07, 0x1d, 0x90, 0x69, 0xad, 0x48, 0xa0,
+  0x6a, 0xe6, 0xff, 0x90, 0x6b, 0x96, 0x65, 0x20, 0x6c, 0xd0, 0x1c, 0x10,
+  0x6d, 0x76, 0x47, 0x20, 0x6e, 0xaf, 0xfe, 0x10, 0x6f, 0x56, 0x29, 0x20,
+  0x70, 0x8f, 0xe0, 0x10, 0x71, 0x36, 0x0b, 0x20, 0x72, 0x6f, 0xc2, 0x10,
+  0x73, 0x15, 0xed, 0x20, 0x74, 0x4f, 0xa4, 0x10, 0x74, 0xff, 0x09, 0xa0,
+  0x76, 0x38, 0xc0, 0x90, 0x76, 0xde, 0xeb, 0xa0, 0x78, 0x18, 0xa2, 0x90,
+  0x78, 0xbe, 0xcd, 0xa0, 0x79, 0xf8, 0x84, 0x90, 0x7a, 0x9e, 0xaf, 0xa0,
+  0x7b, 0xd8, 0x66, 0x90, 0x7c, 0x7e, 0x91, 0xa0, 0x7d, 0xb8, 0x48, 0x90,
+  0x7e, 0x5e, 0x73, 0xa0, 0x7f, 0x98, 0x2a, 0x90, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x03, 0x04, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0xff, 0xff, 0x91, 0x26, 0x00, 0x00, 0xff, 0xff, 0x9d, 0x90,
+  0x01, 0x04, 0xff, 0xff, 0x8f, 0x80, 0x00, 0x08, 0xff, 0xff, 0x9d, 0x90,
+  0x01, 0x0c, 0xff, 0xff, 0x9d, 0x90, 0x01, 0x10, 0x4c, 0x4d, 0x54, 0x00,
+  0x50, 0x44, 0x54, 0x00, 0x50, 0x53, 0x54, 0x00, 0x50, 0x57, 0x54, 0x00,
+  0x50, 0x50, 0x54, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x01, 0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x05, 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0xbb, 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x14, 0xf8, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0x5e, 0x04,
+  0x1a, 0xc0, 0xff, 0xff, 0xff, 0xff, 0x9e, 0xa6, 0x48, 0xa0, 0xff, 0xff,
+  0xff, 0xff, 0x9f, 0xbb, 0x15, 0x90, 0xff, 0xff, 0xff, 0xff, 0xa0, 0x86,
+  0x2a, 0xa0, 0xff, 0xff, 0xff, 0xff, 0xa1, 0x9a, 0xf7, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xcb, 0x89, 0x1a, 0xa0, 0xff, 0xff, 0xff, 0xff, 0xd2, 0x23,
+  0xf4, 0x70, 0xff, 0xff, 0xff, 0xff, 0xd2, 0x61, 0x26, 0x10, 0xff, 0xff,
+  0xff, 0xff, 0xd6, 0xfe, 0x74, 0x5c, 0xff, 0xff, 0xff, 0xff, 0xd8, 0x80,
+  0xad, 0x90, 0xff, 0xff, 0xff, 0xff, 0xda, 0xfe, 0xc3, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xdb, 0xc0, 0x90, 0x10, 0xff, 0xff, 0xff, 0xff, 0xdc, 0xde,
+  0xa5, 0x90, 0xff, 0xff, 0xff, 0xff, 0xdd, 0xa9, 0xac, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xde, 0xbe, 0x87, 0x90, 0xff, 0xff, 0xff, 0xff, 0xdf, 0x89,
+  0x8e, 0x90, 0xff, 0xff, 0xff, 0xff, 0xe0, 0x9e, 0x69, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xe1, 0x69, 0x70, 0x90, 0xff, 0xff, 0xff, 0xff, 0xe2, 0x7e,
+  0x4b, 0x90, 0xff, 0xff, 0xff, 0xff, 0xe3, 0x49, 0x52, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xe4, 0x5e, 0x2d, 0x90, 0xff, 0xff, 0xff, 0xff, 0xe5, 0x29,
+  0x34, 0x90, 0xff, 0xff, 0xff, 0xff, 0xe6, 0x47, 0x4a, 0x10, 0xff, 0xff,
+  0xff, 0xff, 0xe7, 0x12, 0x51, 0x10, 0xff, 0xff, 0xff, 0xff, 0xe8, 0x27,
+  0x2c, 0x10, 0xff, 0xff, 0xff, 0xff, 0xe8, 0xf2, 0x33, 0x10, 0xff, 0xff,
+  0xff, 0xff, 0xea, 0x07, 0x0e, 0x10, 0xff, 0xff, 0xff, 0xff, 0xea, 0xd2,
+  0x15, 0x10, 0xff, 0xff, 0xff, 0xff, 0xeb, 0xe6, 0xf0, 0x10, 0xff, 0xff,
+  0xff, 0xff, 0xec, 0xb1, 0xf7, 0x10, 0xff, 0xff, 0xff, 0xff, 0xed, 0xc6,
+  0xd2, 0x10, 0xff, 0xff, 0xff, 0xff, 0xee, 0x91, 0xd9, 0x10, 0xff, 0xff,
+  0xff, 0xff, 0xef, 0xaf, 0xee, 0x90, 0xff, 0xff, 0xff, 0xff, 0xf0, 0x71,
+  0xbb, 0x10, 0xff, 0xff, 0xff, 0xff, 0xf1, 0x8f, 0xd0, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xf2, 0x7f, 0xc1, 0x90, 0xff, 0xff, 0xff, 0xff, 0xf3, 0x6f,
+  0xb2, 0x90, 0xff, 0xff, 0xff, 0xff, 0xf4, 0x5f, 0xa3, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xf5, 0x4f, 0x94, 0x90, 0xff, 0xff, 0xff, 0xff, 0xf6, 0x3f,
+  0x85, 0x90, 0xff, 0xff, 0xff, 0xff, 0xf7, 0x2f, 0x76, 0x90, 0xff, 0xff,
+  0xff, 0xff, 0xf8, 0x28, 0xa2, 0x10, 0xff, 0xff, 0xff, 0xff, 0xf9, 0x0f,
+  0x58, 0x90, 0xff, 0xff, 0xff, 0xff, 0xfa, 0x08, 0x84, 0x10, 0xff, 0xff,
+  0xff, 0xff, 0xfa, 0xf8, 0x83, 0x20, 0xff, 0xff, 0xff, 0xff, 0xfb, 0xe8,
+  0x66, 0x10, 0xff, 0xff, 0xff, 0xff, 0xfc, 0xd8, 0x65, 0x20, 0xff, 0xff,
+  0xff, 0xff, 0xfd, 0xc8, 0x48, 0x10, 0xff, 0xff, 0xff, 0xff, 0xfe, 0xb8,
+  0x47, 0x20, 0xff, 0xff, 0xff, 0xff, 0xff, 0xa8, 0x2a, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x98, 0x29, 0x20, 0x00, 0x00, 0x00, 0x00, 0x01, 0x88,
+  0x0c, 0x10, 0x00, 0x00, 0x00, 0x00, 0x02, 0x78, 0x0b, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x03, 0x71, 0x28, 0x90, 0x00, 0x00, 0x00, 0x00, 0x04, 0x61,
+  0x27, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x05, 0x51, 0x0a, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x06, 0x41, 0x09, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x07, 0x30,
+  0xec, 0x90, 0x00, 0x00, 0x00, 0x00, 0x07, 0x8d, 0x43, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x09, 0x10, 0xce, 0x90, 0x00, 0x00, 0x00, 0x00, 0x09, 0xad,
+  0xbf, 0x20, 0x00, 0x00, 0x00, 0x00, 0x0a, 0xf0, 0xb0, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x0b, 0xe0, 0xaf, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x0c, 0xd9,
+  0xcd, 0x10, 0x00, 0x00, 0x00, 0x00, 0x0d, 0xc0, 0x91, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x0e, 0xb9, 0xaf, 0x10, 0x00, 0x00, 0x00, 0x00, 0x0f, 0xa9,
+  0xae, 0x20, 0x00, 0x00, 0x00, 0x00, 0x10, 0x99, 0x91, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x11, 0x89, 0x90, 0x20, 0x00, 0x00, 0x00, 0x00, 0x12, 0x79,
+  0x73, 0x10, 0x00, 0x00, 0x00, 0x00, 0x13, 0x69, 0x72, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x14, 0x59, 0x55, 0x10, 0x00, 0x00, 0x00, 0x00, 0x15, 0x49,
+  0x54, 0x20, 0x00, 0x00, 0x00, 0x00, 0x16, 0x39, 0x37, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x17, 0x29, 0x36, 0x20, 0x00, 0x00, 0x00, 0x00, 0x18, 0x22,
+  0x53, 0x90, 0x00, 0x00, 0x00, 0x00, 0x19, 0x09, 0x18, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x1a, 0x02, 0x35, 0x90, 0x00, 0x00, 0x00, 0x00, 0x1a, 0xf2,
+  0x34, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x1b, 0xe2, 0x17, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x1c, 0xd2, 0x16, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x1d, 0xc1,
+  0xf9, 0x90, 0x00, 0x00, 0x00, 0x00, 0x1e, 0xb1, 0xf8, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x1f, 0xa1, 0xdb, 0x90, 0x00, 0x00, 0x00, 0x00, 0x20, 0x76,
+  0x2b, 0x20, 0x00, 0x00, 0x00, 0x00, 0x21, 0x81, 0xbd, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x22, 0x56, 0x0d, 0x20, 0x00, 0x00, 0x00, 0x00, 0x23, 0x6a,
+  0xda, 0x10, 0x00, 0x00, 0x00, 0x00, 0x24, 0x35, 0xef, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x25, 0x4a, 0xbc, 0x10, 0x00, 0x00, 0x00, 0x00, 0x26, 0x15,
+  0xd1, 0x20, 0x00, 0x00, 0x00, 0x00, 0x27, 0x2a, 0x9e, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x27, 0xfe, 0xed, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x29, 0x0a,
+  0x80, 0x10, 0x00, 0x00, 0x00, 0x00, 0x29, 0xde, 0xcf, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x2a, 0xea, 0x62, 0x10, 0x00, 0x00, 0x00, 0x00, 0x2b, 0xbe,
+  0xb1, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x2c, 0xd3, 0x7e, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x2d, 0x9e, 0x93, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x2e, 0xb3,
+  0x60, 0x90, 0x00, 0x00, 0x00, 0x00, 0x2f, 0x7e, 0x75, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x30, 0x93, 0x42, 0x90, 0x00, 0x00, 0x00, 0x00, 0x31, 0x67,
+  0x92, 0x20, 0x00, 0x00, 0x00, 0x00, 0x32, 0x73, 0x24, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x33, 0x47, 0x74, 0x20, 0x00, 0x00, 0x00, 0x00, 0x34, 0x53,
+  0x06, 0x90, 0x00, 0x00, 0x00, 0x00, 0x35, 0x27, 0x56, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x36, 0x32, 0xe8, 0x90, 0x00, 0x00, 0x00, 0x00, 0x37, 0x07,
+  0x38, 0x20, 0x00, 0x00, 0x00, 0x00, 0x38, 0x1c, 0x05, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x38, 0xe7, 0x1a, 0x20, 0x00, 0x00, 0x00, 0x00, 0x39, 0xfb,
+  0xe7, 0x10, 0x00, 0x00, 0x00, 0x00, 0x3a, 0xc6, 0xfc, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x3b, 0xdb, 0xc9, 0x10, 0x00, 0x00, 0x00, 0x00, 0x3c, 0xb0,
+  0x18, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x3d, 0xbb, 0xab, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x3e, 0x8f, 0xfa, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x3f, 0x9b,
+  0x8d, 0x10, 0x00, 0x00, 0x00, 0x00, 0x40, 0x6f, 0xdc, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x41, 0x84, 0xa9, 0x90, 0x00, 0x00, 0x00, 0x00, 0x42, 0x4f,
+  0xbe, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x43, 0x64, 0x8b, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x44, 0x2f, 0xa0, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x45, 0x44,
+  0x6d, 0x90, 0x00, 0x00, 0x00, 0x00, 0x45, 0xf3, 0xd3, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x47, 0x2d, 0x8a, 0x10, 0x00, 0x00, 0x00, 0x00, 0x47, 0xd3,
+  0xb5, 0x20, 0x00, 0x00, 0x00, 0x00, 0x49, 0x0d, 0x6c, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x49, 0xb3, 0x97, 0x20, 0x00, 0x00, 0x00, 0x00, 0x4a, 0xed,
+  0x4e, 0x10, 0x00, 0x00, 0x00, 0x00, 0x4b, 0x9c, 0xb3, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x4c, 0xd6, 0x6a, 0x90, 0x00, 0x00, 0x00, 0x00, 0x4d, 0x7c,
+  0x95, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x4e, 0xb6, 0x4c, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x4f, 0x5c, 0x77, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x50, 0x96,
+  0x2e, 0x90, 0x00, 0x00, 0x00, 0x00, 0x51, 0x3c, 0x59, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x52, 0x76, 0x10, 0x90, 0x00, 0x00, 0x00, 0x00, 0x53, 0x1c,
+  0x3b, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x54, 0x55, 0xf2, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x54, 0xfc, 0x1d, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x56, 0x35,
+  0xd4, 0x90, 0x00, 0x00, 0x00, 0x00, 0x56, 0xe5, 0x3a, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x58, 0x1e, 0xf1, 0x10, 0x00, 0x00, 0x00, 0x00, 0x58, 0xc5,
+  0x1c, 0x20, 0x00, 0x00, 0x00, 0x00, 0x59, 0xfe, 0xd3, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x5a, 0xa4, 0xfe, 0x20, 0x00, 0x00, 0x00, 0x00, 0x5b, 0xde,
+  0xb5, 0x10, 0x00, 0x00, 0x00, 0x00, 0x5c, 0x84, 0xe0, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x5d, 0xbe, 0x97, 0x10, 0x00, 0x00, 0x00, 0x00, 0x5e, 0x64,
+  0xc2, 0x20, 0x00, 0x00, 0x00, 0x00, 0x5f, 0x9e, 0x79, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x60, 0x4d, 0xde, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x61, 0x87,
+  0x95, 0x90, 0x00, 0x00, 0x00, 0x00, 0x62, 0x2d, 0xc0, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x63, 0x67, 0x77, 0x90, 0x00, 0x00, 0x00, 0x00, 0x64, 0x0d,
+  0xa2, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x65, 0x47, 0x59, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x65, 0xed, 0x84, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x67, 0x27,
+  0x3b, 0x90, 0x00, 0x00, 0x00, 0x00, 0x67, 0xcd, 0x66, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x69, 0x07, 0x1d, 0x90, 0x00, 0x00, 0x00, 0x00, 0x69, 0xad,
+  0x48, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x6a, 0xe6, 0xff, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x6b, 0x96, 0x65, 0x20, 0x00, 0x00, 0x00, 0x00, 0x6c, 0xd0,
+  0x1c, 0x10, 0x00, 0x00, 0x00, 0x00, 0x6d, 0x76, 0x47, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x6e, 0xaf, 0xfe, 0x10, 0x00, 0x00, 0x00, 0x00, 0x6f, 0x56,
+  0x29, 0x20, 0x00, 0x00, 0x00, 0x00, 0x70, 0x8f, 0xe0, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x71, 0x36, 0x0b, 0x20, 0x00, 0x00, 0x00, 0x00, 0x72, 0x6f,
+  0xc2, 0x10, 0x00, 0x00, 0x00, 0x00, 0x73, 0x15, 0xed, 0x20, 0x00, 0x00,
+  0x00, 0x00, 0x74, 0x4f, 0xa4, 0x10, 0x00, 0x00, 0x00, 0x00, 0x74, 0xff,
+  0x09, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x76, 0x38, 0xc0, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x76, 0xde, 0xeb, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x78, 0x18,
+  0xa2, 0x90, 0x00, 0x00, 0x00, 0x00, 0x78, 0xbe, 0xcd, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x79, 0xf8, 0x84, 0x90, 0x00, 0x00, 0x00, 0x00, 0x7a, 0x9e,
+  0xaf, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x7b, 0xd8, 0x66, 0x90, 0x00, 0x00,
+  0x00, 0x00, 0x7c, 0x7e, 0x91, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x7d, 0xb8,
+  0x48, 0x90, 0x00, 0x00, 0x00, 0x00, 0x7e, 0x5e, 0x73, 0xa0, 0x00, 0x00,
+  0x00, 0x00, 0x7f, 0x98, 0x2a, 0x90, 0x00, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x03, 0x04, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0xff, 0xff, 0x91, 0x26, 0x00, 0x00, 0xff, 0xff, 0x9d, 0x90, 0x01,
+  0x04, 0xff, 0xff, 0x8f, 0x80, 0x00, 0x08, 0xff, 0xff, 0x9d, 0x90, 0x01,
+  0x0c, 0xff, 0xff, 0x9d, 0x90, 0x01, 0x10, 0x4c, 0x4d, 0x54, 0x00, 0x50,
+  0x44, 0x54, 0x00, 0x50, 0x53, 0x54, 0x00, 0x50, 0x57, 0x54, 0x00, 0x50,
+  0x50, 0x54, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x00,
+  0x01, 0x0a, 0x50, 0x53, 0x54, 0x38, 0x50, 0x44, 0x54, 0x2c, 0x4d, 0x33,
+  0x2e, 0x32, 0x2e, 0x30, 0x2c, 0x4d, 0x31, 0x31, 0x2e, 0x31, 0x2e, 0x30,
+  0x0a
+};
+unsigned int America_Los_Angeles_len = 2845;
+unsigned char America_New_York[] = {
+  0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xec,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x14, 0x80, 0x00, 0x00, 0x00,
+  0x9e, 0xa6, 0x1e, 0x70, 0x9f, 0xba, 0xeb, 0x60, 0xa0, 0x86, 0x00, 0x70,
+  0xa1, 0x9a, 0xcd, 0x60, 0xa2, 0x65, 0xe2, 0x70, 0xa3, 0x83, 0xe9, 0xe0,
+  0xa4, 0x6a, 0xae, 0x70, 0xa5, 0x35, 0xa7, 0x60, 0xa6, 0x53, 0xca, 0xf0,
+  0xa7, 0x15, 0x89, 0x60, 0xa8, 0x33, 0xac, 0xf0, 0xa8, 0xfe, 0xa5, 0xe0,
+  0xaa, 0x13, 0x8e, 0xf0, 0xaa, 0xde, 0x87, 0xe0, 0xab, 0xf3, 0x70, 0xf0,
+  0xac, 0xbe, 0x69, 0xe0, 0xad, 0xd3, 0x52, 0xf0, 0xae, 0x9e, 0x4b, 0xe0,
+  0xaf, 0xb3, 0x34, 0xf0, 0xb0, 0x7e, 0x2d, 0xe0, 0xb1, 0x9c, 0x51, 0x70,
+  0xb2, 0x67, 0x4a, 0x60, 0xb3, 0x7c, 0x33, 0x70, 0xb4, 0x47, 0x2c, 0x60,
+  0xb5, 0x5c, 0x15, 0x70, 0xb6, 0x27, 0x0e, 0x60, 0xb7, 0x3b, 0xf7, 0x70,
+  0xb8, 0x06, 0xf0, 0x60, 0xb9, 0x1b, 0xd9, 0x70, 0xb9, 0xe6, 0xd2, 0x60,
+  0xbb, 0x04, 0xf5, 0xf0, 0xbb, 0xc6, 0xb4, 0x60, 0xbc, 0xe4, 0xd7, 0xf0,
+  0xbd, 0xaf, 0xd0, 0xe0, 0xbe, 0xc4, 0xb9, 0xf0, 0xbf, 0x8f, 0xb2, 0xe0,
+  0xc0, 0xa4, 0x9b, 0xf0, 0xc1, 0x6f, 0x94, 0xe0, 0xc2, 0x84, 0x7d, 0xf0,
+  0xc3, 0x4f, 0x76, 0xe0, 0xc4, 0x64, 0x5f, 0xf0, 0xc5, 0x2f, 0x58, 0xe0,
+  0xc6, 0x4d, 0x7c, 0x70, 0xc7, 0x0f, 0x3a, 0xe0, 0xc8, 0x2d, 0x5e, 0x70,
+  0xc8, 0xf8, 0x57, 0x60, 0xca, 0x0d, 0x40, 0x70, 0xca, 0xd8, 0x39, 0x60,
+  0xcb, 0x88, 0xf0, 0x70, 0xd2, 0x23, 0xf4, 0x70, 0xd2, 0x60, 0xfb, 0xe0,
+  0xd3, 0x75, 0xe4, 0xf0, 0xd4, 0x40, 0xdd, 0xe0, 0xd5, 0x55, 0xc6, 0xf0,
+  0xd6, 0x20, 0xbf, 0xe0, 0xd7, 0x35, 0xa8, 0xf0, 0xd8, 0x00, 0xa1, 0xe0,
+  0xd9, 0x15, 0x8a, 0xf0, 0xd9, 0xe0, 0x83, 0xe0, 0xda, 0xfe, 0xa7, 0x70,
+  0xdb, 0xc0, 0x65, 0xe0, 0xdc, 0xde, 0x89, 0x70, 0xdd, 0xa9, 0x82, 0x60,
+  0xde, 0xbe, 0x6b, 0x70, 0xdf, 0x89, 0x64, 0x60, 0xe0, 0x9e, 0x4d, 0x70,
+  0xe1, 0x69, 0x46, 0x60, 0xe2, 0x7e, 0x2f, 0x70, 0xe3, 0x49, 0x28, 0x60,
+  0xe4, 0x5e, 0x11, 0x70, 0xe5, 0x57, 0x2e, 0xe0, 0xe6, 0x47, 0x2d, 0xf0,
+  0xe7, 0x37, 0x10, 0xe0, 0xe8, 0x27, 0x0f, 0xf0, 0xe9, 0x16, 0xf2, 0xe0,
+  0xea, 0x06, 0xf1, 0xf0, 0xea, 0xf6, 0xd4, 0xe0, 0xeb, 0xe6, 0xd3, 0xf0,
+  0xec, 0xd6, 0xb6, 0xe0, 0xed, 0xc6, 0xb5, 0xf0, 0xee, 0xbf, 0xd3, 0x60,
+  0xef, 0xaf, 0xd2, 0x70, 0xf0, 0x9f, 0xb5, 0x60, 0xf1, 0x8f, 0xb4, 0x70,
+  0xf2, 0x7f, 0x97, 0x60, 0xf3, 0x6f, 0x96, 0x70, 0xf4, 0x5f, 0x79, 0x60,
+  0xf5, 0x4f, 0x78, 0x70, 0xf6, 0x3f, 0x5b, 0x60, 0xf7, 0x2f, 0x5a, 0x70,
+  0xf8, 0x28, 0x77, 0xe0, 0xf9, 0x0f, 0x3c, 0x70, 0xfa, 0x08, 0x59, 0xe0,
+  0xfa, 0xf8, 0x58, 0xf0, 0xfb, 0xe8, 0x3b, 0xe0, 0xfc, 0xd8, 0x3a, 0xf0,
+  0xfd, 0xc8, 0x1d, 0xe0, 0xfe, 0xb8, 0x1c, 0xf0, 0xff, 0xa7, 0xff, 0xe0,
+  0x00, 0x97, 0xfe, 0xf0, 0x01, 0x87, 0xe1, 0xe0, 0x02, 0x77, 0xe0, 0xf0,
+  0x03, 0x70, 0xfe, 0x60, 0x04, 0x60, 0xfd, 0x70, 0x05, 0x50, 0xe0, 0x60,
+  0x06, 0x40, 0xdf, 0x70, 0x07, 0x30, 0xc2, 0x60, 0x07, 0x8d, 0x19, 0x70,
+  0x09, 0x10, 0xa4, 0x60, 0x09, 0xad, 0x94, 0xf0, 0x0a, 0xf0, 0x86, 0x60,
+  0x0b, 0xe0, 0x85, 0x70, 0x0c, 0xd9, 0xa2, 0xe0, 0x0d, 0xc0, 0x67, 0x70,
+  0x0e, 0xb9, 0x84, 0xe0, 0x0f, 0xa9, 0x83, 0xf0, 0x10, 0x99, 0x66, 0xe0,
+  0x11, 0x89, 0x65, 0xf0, 0x12, 0x79, 0x48, 0xe0, 0x13, 0x69, 0x47, 0xf0,
+  0x14, 0x59, 0x2a, 0xe0, 0x15, 0x49, 0x29, 0xf0, 0x16, 0x39, 0x0c, 0xe0,
+  0x17, 0x29, 0x0b, 0xf0, 0x18, 0x22, 0x29, 0x60, 0x19, 0x08, 0xed, 0xf0,
+  0x1a, 0x02, 0x0b, 0x60, 0x1a, 0xf2, 0x0a, 0x70, 0x1b, 0xe1, 0xed, 0x60,
+  0x1c, 0xd1, 0xec, 0x70, 0x1d, 0xc1, 0xcf, 0x60, 0x1e, 0xb1, 0xce, 0x70,
+  0x1f, 0xa1, 0xb1, 0x60, 0x20, 0x76, 0x00, 0xf0, 0x21, 0x81, 0x93, 0x60,
+  0x22, 0x55, 0xe2, 0xf0, 0x23, 0x6a, 0xaf, 0xe0, 0x24, 0x35, 0xc4, 0xf0,
+  0x25, 0x4a, 0x91, 0xe0, 0x26, 0x15, 0xa6, 0xf0, 0x27, 0x2a, 0x73, 0xe0,
+  0x27, 0xfe, 0xc3, 0x70, 0x29, 0x0a, 0x55, 0xe0, 0x29, 0xde, 0xa5, 0x70,
+  0x2a, 0xea, 0x37, 0xe0, 0x2b, 0xbe, 0x87, 0x70, 0x2c, 0xd3, 0x54, 0x60,
+  0x2d, 0x9e, 0x69, 0x70, 0x2e, 0xb3, 0x36, 0x60, 0x2f, 0x7e, 0x4b, 0x70,
+  0x30, 0x93, 0x18, 0x60, 0x31, 0x67, 0x67, 0xf0, 0x32, 0x72, 0xfa, 0x60,
+  0x33, 0x47, 0x49, 0xf0, 0x34, 0x52, 0xdc, 0x60, 0x35, 0x27, 0x2b, 0xf0,
+  0x36, 0x32, 0xbe, 0x60, 0x37, 0x07, 0x0d, 0xf0, 0x38, 0x1b, 0xda, 0xe0,
+  0x38, 0xe6, 0xef, 0xf0, 0x39, 0xfb, 0xbc, 0xe0, 0x3a, 0xc6, 0xd1, 0xf0,
+  0x3b, 0xdb, 0x9e, 0xe0, 0x3c, 0xaf, 0xee, 0x70, 0x3d, 0xbb, 0x80, 0xe0,
+  0x3e, 0x8f, 0xd0, 0x70, 0x3f, 0x9b, 0x62, 0xe0, 0x40, 0x6f, 0xb2, 0x70,
+  0x41, 0x84, 0x7f, 0x60, 0x42, 0x4f, 0x94, 0x70, 0x43, 0x64, 0x61, 0x60,
+  0x44, 0x2f, 0x76, 0x70, 0x45, 0x44, 0x43, 0x60, 0x45, 0xf3, 0xa8, 0xf0,
+  0x47, 0x2d, 0x5f, 0xe0, 0x47, 0xd3, 0x8a, 0xf0, 0x49, 0x0d, 0x41, 0xe0,
+  0x49, 0xb3, 0x6c, 0xf0, 0x4a, 0xed, 0x23, 0xe0, 0x4b, 0x9c, 0x89, 0x70,
+  0x4c, 0xd6, 0x40, 0x60, 0x4d, 0x7c, 0x6b, 0x70, 0x4e, 0xb6, 0x22, 0x60,
+  0x4f, 0x5c, 0x4d, 0x70, 0x50, 0x96, 0x04, 0x60, 0x51, 0x3c, 0x2f, 0x70,
+  0x52, 0x75, 0xe6, 0x60, 0x53, 0x1c, 0x11, 0x70, 0x54, 0x55, 0xc8, 0x60,
+  0x54, 0xfb, 0xf3, 0x70, 0x56, 0x35, 0xaa, 0x60, 0x56, 0xe5, 0x0f, 0xf0,
+  0x58, 0x1e, 0xc6, 0xe0, 0x58, 0xc4, 0xf1, 0xf0, 0x59, 0xfe, 0xa8, 0xe0,
+  0x5a, 0xa4, 0xd3, 0xf0, 0x5b, 0xde, 0x8a, 0xe0, 0x5c, 0x84, 0xb5, 0xf0,
+  0x5d, 0xbe, 0x6c, 0xe0, 0x5e, 0x64, 0x97, 0xf0, 0x5f, 0x9e, 0x4e, 0xe0,
+  0x60, 0x4d, 0xb4, 0x70, 0x61, 0x87, 0x6b, 0x60, 0x62, 0x2d, 0x96, 0x70,
+  0x63, 0x67, 0x4d, 0x60, 0x64, 0x0d, 0x78, 0x70, 0x65, 0x47, 0x2f, 0x60,
+  0x65, 0xed, 0x5a, 0x70, 0x67, 0x27, 0x11, 0x60, 0x67, 0xcd, 0x3c, 0x70,
+  0x69, 0x06, 0xf3, 0x60, 0x69, 0xad, 0x1e, 0x70, 0x6a, 0xe6, 0xd5, 0x60,
+  0x6b, 0x96, 0x3a, 0xf0, 0x6c, 0xcf, 0xf1, 0xe0, 0x6d, 0x76, 0x1c, 0xf0,
+  0x6e, 0xaf, 0xd3, 0xe0, 0x6f, 0x55, 0xfe, 0xf0, 0x70, 0x8f, 0xb5, 0xe0,
+  0x71, 0x35, 0xe0, 0xf0, 0x72, 0x6f, 0x97, 0xe0, 0x73, 0x15, 0xc2, 0xf0,
+  0x74, 0x4f, 0x79, 0xe0, 0x74, 0xfe, 0xdf, 0x70, 0x76, 0x38, 0x96, 0x60,
+  0x76, 0xde, 0xc1, 0x70, 0x78, 0x18, 0x78, 0x60, 0x78, 0xbe, 0xa3, 0x70,
+  0x79, 0xf8, 0x5a, 0x60, 0x7a, 0x9e, 0x85, 0x70, 0x7b, 0xd8, 0x3c, 0x60,
+  0x7c, 0x7e, 0x67, 0x70, 0x7d, 0xb8, 0x1e, 0x60, 0x7e, 0x5e, 0x49, 0x70,
+  0x7f, 0x98, 0x00, 0x60, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x03, 0x04, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0xff, 0xff, 0xba, 0x9e, 0x00, 0x00, 0xff, 0xff, 0xc7, 0xc0, 0x01, 0x04,
+  0xff, 0xff, 0xb9, 0xb0, 0x00, 0x08, 0xff, 0xff, 0xc7, 0xc0, 0x01, 0x0c,
+  0xff, 0xff, 0xc7, 0xc0, 0x01, 0x10, 0x4c, 0x4d, 0x54, 0x00, 0x45, 0x44,
+  0x54, 0x00, 0x45, 0x53, 0x54, 0x00, 0x45, 0x57, 0x54, 0x00, 0x45, 0x50,
+  0x54, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xed,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x14, 0xf8, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0x5e, 0x03, 0xf0, 0x90,
+  0xff, 0xff, 0xff, 0xff, 0x9e, 0xa6, 0x1e, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0x9f, 0xba, 0xeb, 0x60, 0xff, 0xff, 0xff, 0xff, 0xa0, 0x86, 0x00, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xa1, 0x9a, 0xcd, 0x60, 0xff, 0xff, 0xff, 0xff,
+  0xa2, 0x65, 0xe2, 0x70, 0xff, 0xff, 0xff, 0xff, 0xa3, 0x83, 0xe9, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xa4, 0x6a, 0xae, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xa5, 0x35, 0xa7, 0x60, 0xff, 0xff, 0xff, 0xff, 0xa6, 0x53, 0xca, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xa7, 0x15, 0x89, 0x60, 0xff, 0xff, 0xff, 0xff,
+  0xa8, 0x33, 0xac, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xa8, 0xfe, 0xa5, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xaa, 0x13, 0x8e, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xaa, 0xde, 0x87, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xab, 0xf3, 0x70, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xac, 0xbe, 0x69, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xad, 0xd3, 0x52, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xae, 0x9e, 0x4b, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xaf, 0xb3, 0x34, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xb0, 0x7e, 0x2d, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xb1, 0x9c, 0x51, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xb2, 0x67, 0x4a, 0x60, 0xff, 0xff, 0xff, 0xff,
+  0xb3, 0x7c, 0x33, 0x70, 0xff, 0xff, 0xff, 0xff, 0xb4, 0x47, 0x2c, 0x60,
+  0xff, 0xff, 0xff, 0xff, 0xb5, 0x5c, 0x15, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xb6, 0x27, 0x0e, 0x60, 0xff, 0xff, 0xff, 0xff, 0xb7, 0x3b, 0xf7, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xb8, 0x06, 0xf0, 0x60, 0xff, 0xff, 0xff, 0xff,
+  0xb9, 0x1b, 0xd9, 0x70, 0xff, 0xff, 0xff, 0xff, 0xb9, 0xe6, 0xd2, 0x60,
+  0xff, 0xff, 0xff, 0xff, 0xbb, 0x04, 0xf5, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xbb, 0xc6, 0xb4, 0x60, 0xff, 0xff, 0xff, 0xff, 0xbc, 0xe4, 0xd7, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xbd, 0xaf, 0xd0, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xbe, 0xc4, 0xb9, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xbf, 0x8f, 0xb2, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xc0, 0xa4, 0x9b, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xc1, 0x6f, 0x94, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xc2, 0x84, 0x7d, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xc3, 0x4f, 0x76, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xc4, 0x64, 0x5f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xc5, 0x2f, 0x58, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xc6, 0x4d, 0x7c, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xc7, 0x0f, 0x3a, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xc8, 0x2d, 0x5e, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xc8, 0xf8, 0x57, 0x60, 0xff, 0xff, 0xff, 0xff,
+  0xca, 0x0d, 0x40, 0x70, 0xff, 0xff, 0xff, 0xff, 0xca, 0xd8, 0x39, 0x60,
+  0xff, 0xff, 0xff, 0xff, 0xcb, 0x88, 0xf0, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xd2, 0x23, 0xf4, 0x70, 0xff, 0xff, 0xff, 0xff, 0xd2, 0x60, 0xfb, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xd3, 0x75, 0xe4, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xd4, 0x40, 0xdd, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xd5, 0x55, 0xc6, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xd6, 0x20, 0xbf, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xd7, 0x35, 0xa8, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xd8, 0x00, 0xa1, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xd9, 0x15, 0x8a, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xd9, 0xe0, 0x83, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xda, 0xfe, 0xa7, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xdb, 0xc0, 0x65, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xdc, 0xde, 0x89, 0x70, 0xff, 0xff, 0xff, 0xff, 0xdd, 0xa9, 0x82, 0x60,
+  0xff, 0xff, 0xff, 0xff, 0xde, 0xbe, 0x6b, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xdf, 0x89, 0x64, 0x60, 0xff, 0xff, 0xff, 0xff, 0xe0, 0x9e, 0x4d, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xe1, 0x69, 0x46, 0x60, 0xff, 0xff, 0xff, 0xff,
+  0xe2, 0x7e, 0x2f, 0x70, 0xff, 0xff, 0xff, 0xff, 0xe3, 0x49, 0x28, 0x60,
+  0xff, 0xff, 0xff, 0xff, 0xe4, 0x5e, 0x11, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xe5, 0x57, 0x2e, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xe6, 0x47, 0x2d, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xe7, 0x37, 0x10, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xe8, 0x27, 0x0f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xe9, 0x16, 0xf2, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xea, 0x06, 0xf1, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xea, 0xf6, 0xd4, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xeb, 0xe6, 0xd3, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xec, 0xd6, 0xb6, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xed, 0xc6, 0xb5, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xee, 0xbf, 0xd3, 0x60,
+  0xff, 0xff, 0xff, 0xff, 0xef, 0xaf, 0xd2, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xf0, 0x9f, 0xb5, 0x60, 0xff, 0xff, 0xff, 0xff, 0xf1, 0x8f, 0xb4, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xf2, 0x7f, 0x97, 0x60, 0xff, 0xff, 0xff, 0xff,
+  0xf3, 0x6f, 0x96, 0x70, 0xff, 0xff, 0xff, 0xff, 0xf4, 0x5f, 0x79, 0x60,
+  0xff, 0xff, 0xff, 0xff, 0xf5, 0x4f, 0x78, 0x70, 0xff, 0xff, 0xff, 0xff,
+  0xf6, 0x3f, 0x5b, 0x60, 0xff, 0xff, 0xff, 0xff, 0xf7, 0x2f, 0x5a, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xf8, 0x28, 0x77, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xf9, 0x0f, 0x3c, 0x70, 0xff, 0xff, 0xff, 0xff, 0xfa, 0x08, 0x59, 0xe0,
+  0xff, 0xff, 0xff, 0xff, 0xfa, 0xf8, 0x58, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xfb, 0xe8, 0x3b, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xfc, 0xd8, 0x3a, 0xf0,
+  0xff, 0xff, 0xff, 0xff, 0xfd, 0xc8, 0x1d, 0xe0, 0xff, 0xff, 0xff, 0xff,
+  0xfe, 0xb8, 0x1c, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xa7, 0xff, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x97, 0xfe, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x01, 0x87, 0xe1, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x02, 0x77, 0xe0, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x03, 0x70, 0xfe, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x04, 0x60, 0xfd, 0x70, 0x00, 0x00, 0x00, 0x00, 0x05, 0x50, 0xe0, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x06, 0x40, 0xdf, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x07, 0x30, 0xc2, 0x60, 0x00, 0x00, 0x00, 0x00, 0x07, 0x8d, 0x19, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x09, 0x10, 0xa4, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x09, 0xad, 0x94, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x0a, 0xf0, 0x86, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x0b, 0xe0, 0x85, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x0c, 0xd9, 0xa2, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x0d, 0xc0, 0x67, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x0e, 0xb9, 0x84, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x0f, 0xa9, 0x83, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x10, 0x99, 0x66, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x11, 0x89, 0x65, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x12, 0x79, 0x48, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x13, 0x69, 0x47, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x14, 0x59, 0x2a, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x15, 0x49, 0x29, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x16, 0x39, 0x0c, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x17, 0x29, 0x0b, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x18, 0x22, 0x29, 0x60, 0x00, 0x00, 0x00, 0x00, 0x19, 0x08, 0xed, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x1a, 0x02, 0x0b, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x1a, 0xf2, 0x0a, 0x70, 0x00, 0x00, 0x00, 0x00, 0x1b, 0xe1, 0xed, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x1c, 0xd1, 0xec, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x1d, 0xc1, 0xcf, 0x60, 0x00, 0x00, 0x00, 0x00, 0x1e, 0xb1, 0xce, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x1f, 0xa1, 0xb1, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x20, 0x76, 0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x21, 0x81, 0x93, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x22, 0x55, 0xe2, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x23, 0x6a, 0xaf, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x24, 0x35, 0xc4, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x25, 0x4a, 0x91, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x26, 0x15, 0xa6, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x27, 0x2a, 0x73, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x27, 0xfe, 0xc3, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x29, 0x0a, 0x55, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x29, 0xde, 0xa5, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x2a, 0xea, 0x37, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x2b, 0xbe, 0x87, 0x70, 0x00, 0x00, 0x00, 0x00, 0x2c, 0xd3, 0x54, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x2d, 0x9e, 0x69, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x2e, 0xb3, 0x36, 0x60, 0x00, 0x00, 0x00, 0x00, 0x2f, 0x7e, 0x4b, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x30, 0x93, 0x18, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x31, 0x67, 0x67, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x32, 0x72, 0xfa, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x33, 0x47, 0x49, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x34, 0x52, 0xdc, 0x60, 0x00, 0x00, 0x00, 0x00, 0x35, 0x27, 0x2b, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x36, 0x32, 0xbe, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x37, 0x07, 0x0d, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x1b, 0xda, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x38, 0xe6, 0xef, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x39, 0xfb, 0xbc, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x3a, 0xc6, 0xd1, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x3b, 0xdb, 0x9e, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x3c, 0xaf, 0xee, 0x70, 0x00, 0x00, 0x00, 0x00, 0x3d, 0xbb, 0x80, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x3e, 0x8f, 0xd0, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x3f, 0x9b, 0x62, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x40, 0x6f, 0xb2, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x41, 0x84, 0x7f, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x42, 0x4f, 0x94, 0x70, 0x00, 0x00, 0x00, 0x00, 0x43, 0x64, 0x61, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x44, 0x2f, 0x76, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x45, 0x44, 0x43, 0x60, 0x00, 0x00, 0x00, 0x00, 0x45, 0xf3, 0xa8, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x47, 0x2d, 0x5f, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x47, 0xd3, 0x8a, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x49, 0x0d, 0x41, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x49, 0xb3, 0x6c, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x4a, 0xed, 0x23, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x4b, 0x9c, 0x89, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x4c, 0xd6, 0x40, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x4d, 0x7c, 0x6b, 0x70, 0x00, 0x00, 0x00, 0x00, 0x4e, 0xb6, 0x22, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x4f, 0x5c, 0x4d, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x50, 0x96, 0x04, 0x60, 0x00, 0x00, 0x00, 0x00, 0x51, 0x3c, 0x2f, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x52, 0x75, 0xe6, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x53, 0x1c, 0x11, 0x70, 0x00, 0x00, 0x00, 0x00, 0x54, 0x55, 0xc8, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x54, 0xfb, 0xf3, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x56, 0x35, 0xaa, 0x60, 0x00, 0x00, 0x00, 0x00, 0x56, 0xe5, 0x0f, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x58, 0x1e, 0xc6, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x58, 0xc4, 0xf1, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x59, 0xfe, 0xa8, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x5a, 0xa4, 0xd3, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x5b, 0xde, 0x8a, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x5c, 0x84, 0xb5, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x5d, 0xbe, 0x6c, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x5e, 0x64, 0x97, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x5f, 0x9e, 0x4e, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x60, 0x4d, 0xb4, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x61, 0x87, 0x6b, 0x60, 0x00, 0x00, 0x00, 0x00, 0x62, 0x2d, 0x96, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x63, 0x67, 0x4d, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x64, 0x0d, 0x78, 0x70, 0x00, 0x00, 0x00, 0x00, 0x65, 0x47, 0x2f, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x65, 0xed, 0x5a, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x67, 0x27, 0x11, 0x60, 0x00, 0x00, 0x00, 0x00, 0x67, 0xcd, 0x3c, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x69, 0x06, 0xf3, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x69, 0xad, 0x1e, 0x70, 0x00, 0x00, 0x00, 0x00, 0x6a, 0xe6, 0xd5, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x6b, 0x96, 0x3a, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x6c, 0xcf, 0xf1, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x6d, 0x76, 0x1c, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x6e, 0xaf, 0xd3, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x6f, 0x55, 0xfe, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x70, 0x8f, 0xb5, 0xe0,
+  0x00, 0x00, 0x00, 0x00, 0x71, 0x35, 0xe0, 0xf0, 0x00, 0x00, 0x00, 0x00,
+  0x72, 0x6f, 0x97, 0xe0, 0x00, 0x00, 0x00, 0x00, 0x73, 0x15, 0xc2, 0xf0,
+  0x00, 0x00, 0x00, 0x00, 0x74, 0x4f, 0x79, 0xe0, 0x00, 0x00, 0x00, 0x00,
+  0x74, 0xfe, 0xdf, 0x70, 0x00, 0x00, 0x00, 0x00, 0x76, 0x38, 0x96, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x76, 0xde, 0xc1, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x78, 0x18, 0x78, 0x60, 0x00, 0x00, 0x00, 0x00, 0x78, 0xbe, 0xa3, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x79, 0xf8, 0x5a, 0x60, 0x00, 0x00, 0x00, 0x00,
+  0x7a, 0x9e, 0x85, 0x70, 0x00, 0x00, 0x00, 0x00, 0x7b, 0xd8, 0x3c, 0x60,
+  0x00, 0x00, 0x00, 0x00, 0x7c, 0x7e, 0x67, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x7d, 0xb8, 0x1e, 0x60, 0x00, 0x00, 0x00, 0x00, 0x7e, 0x5e, 0x49, 0x70,
+  0x00, 0x00, 0x00, 0x00, 0x7f, 0x98, 0x00, 0x60, 0x00, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x03, 0x04,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0xff, 0xff, 0xba, 0x9e, 0x00, 0x00, 0xff,
+  0xff, 0xc7, 0xc0, 0x01, 0x04, 0xff, 0xff, 0xb9, 0xb0, 0x00, 0x08, 0xff,
+  0xff, 0xc7, 0xc0, 0x01, 0x0c, 0xff, 0xff, 0xc7, 0xc0, 0x01, 0x10, 0x4c,
+  0x4d, 0x54, 0x00, 0x45, 0x44, 0x54, 0x00, 0x45, 0x53, 0x54, 0x00, 0x45,
+  0x57, 0x54, 0x00, 0x45, 0x50, 0x54, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x00, 0x00, 0x00, 0x00, 0x01, 0x0a, 0x45, 0x53, 0x54, 0x35, 0x45, 0x44,
+  0x54, 0x2c, 0x4d, 0x33, 0x2e, 0x32, 0x2e, 0x30, 0x2c, 0x4d, 0x31, 0x31,
+  0x2e, 0x31, 0x2e, 0x30, 0x0a
+};
+unsigned int America_New_York_len = 3545;
+unsigned char Australia_Sydney[] = {
+  0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x8e,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x0e, 0x80, 0x00, 0x00, 0x00,
+  0x9c, 0x4e, 0xa6, 0x9c, 0x9c, 0xbc, 0x20, 0xf0, 0xcb, 0x54, 0xb3, 0x00,
+  0xcb, 0xc7, 0x57, 0x70, 0xcc, 0xb7, 0x56, 0x80, 0xcd, 0xa7, 0x39, 0x70,
+  0xce, 0xa0, 0x73, 0x00, 0xcf, 0x87, 0x1b, 0x70, 0x03, 0x70, 0x39, 0x80,
+  0x04, 0x0d, 0x1c, 0x00, 0x05, 0x50, 0x1b, 0x80, 0x05, 0xf6, 0x38, 0x80,
+  0x07, 0x2f, 0xfd, 0x80, 0x07, 0xd6, 0x1a, 0x80, 0x09, 0x0f, 0xdf, 0x80,
+  0x09, 0xb5, 0xfc, 0x80, 0x0a, 0xef, 0xc1, 0x80, 0x0b, 0x9f, 0x19, 0x00,
+  0x0c, 0xd8, 0xde, 0x00, 0x0d, 0x7e, 0xfb, 0x00, 0x0e, 0xb8, 0xc0, 0x00,
+  0x0f, 0x5e, 0xdd, 0x00, 0x10, 0x98, 0xa2, 0x00, 0x11, 0x3e, 0xbf, 0x00,
+  0x12, 0x78, 0x84, 0x00, 0x13, 0x1e, 0xa1, 0x00, 0x14, 0x58, 0x66, 0x00,
+  0x14, 0xfe, 0x83, 0x00, 0x16, 0x38, 0x48, 0x00, 0x17, 0x0c, 0x89, 0x80,
+  0x18, 0x21, 0x64, 0x80, 0x18, 0xc7, 0x81, 0x80, 0x1a, 0x01, 0x46, 0x80,
+  0x1a, 0xa7, 0x63, 0x80, 0x1b, 0xe1, 0x28, 0x80, 0x1c, 0x87, 0x45, 0x80,
+  0x1d, 0xc1, 0x0a, 0x80, 0x1e, 0x79, 0x9c, 0x80, 0x1f, 0x97, 0xb2, 0x00,
+  0x20, 0x59, 0x7e, 0x80, 0x21, 0x80, 0xce, 0x80, 0x22, 0x42, 0x9b, 0x00,
+  0x23, 0x69, 0xeb, 0x00, 0x24, 0x22, 0x7d, 0x00, 0x25, 0x49, 0xcd, 0x00,
+  0x25, 0xef, 0xea, 0x00, 0x27, 0x29, 0xaf, 0x00, 0x27, 0xcf, 0xcc, 0x00,
+  0x29, 0x09, 0x91, 0x00, 0x29, 0xaf, 0xae, 0x00, 0x2a, 0xe9, 0x73, 0x00,
+  0x2b, 0x98, 0xca, 0x80, 0x2c, 0xd2, 0x8f, 0x80, 0x2d, 0x78, 0xac, 0x80,
+  0x2e, 0xb2, 0x71, 0x80, 0x2f, 0x58, 0x8e, 0x80, 0x30, 0x92, 0x53, 0x80,
+  0x31, 0x5d, 0x5a, 0x80, 0x32, 0x72, 0x35, 0x80, 0x33, 0x3d, 0x3c, 0x80,
+  0x34, 0x52, 0x17, 0x80, 0x35, 0x1d, 0x1e, 0x80, 0x36, 0x31, 0xf9, 0x80,
+  0x36, 0xfd, 0x00, 0x80, 0x38, 0x1b, 0x16, 0x00, 0x38, 0xdc, 0xe2, 0x80,
+  0x39, 0xa7, 0xe9, 0x80, 0x3a, 0xbc, 0xc4, 0x80, 0x3b, 0xda, 0xda, 0x00,
+  0x3c, 0xa5, 0xe1, 0x00, 0x3d, 0xba, 0xbc, 0x00, 0x3e, 0x85, 0xc3, 0x00,
+  0x3f, 0x9a, 0x9e, 0x00, 0x40, 0x65, 0xa5, 0x00, 0x41, 0x83, 0xba, 0x80,
+  0x42, 0x45, 0x87, 0x00, 0x43, 0x63, 0x9c, 0x80, 0x44, 0x2e, 0xa3, 0x80,
+  0x45, 0x43, 0x7e, 0x80, 0x46, 0x05, 0x4b, 0x00, 0x47, 0x23, 0x60, 0x80,
+  0x47, 0xf7, 0xa2, 0x00, 0x48, 0xe7, 0x93, 0x00, 0x49, 0xd7, 0x84, 0x00,
+  0x4a, 0xc7, 0x75, 0x00, 0x4b, 0xb7, 0x66, 0x00, 0x4c, 0xa7, 0x57, 0x00,
+  0x4d, 0x97, 0x48, 0x00, 0x4e, 0x87, 0x39, 0x00, 0x4f, 0x77, 0x2a, 0x00,
+  0x50, 0x70, 0x55, 0x80, 0x51, 0x60, 0x46, 0x80, 0x52, 0x50, 0x37, 0x80,
+  0x53, 0x40, 0x28, 0x80, 0x54, 0x30, 0x19, 0x80, 0x55, 0x20, 0x0a, 0x80,
+  0x56, 0x0f, 0xfb, 0x80, 0x56, 0xff, 0xec, 0x80, 0x57, 0xef, 0xdd, 0x80,
+  0x58, 0xdf, 0xce, 0x80, 0x59, 0xcf, 0xbf, 0x80, 0x5a, 0xbf, 0xb0, 0x80,
+  0x5b, 0xb8, 0xdc, 0x00, 0x5c, 0xa8, 0xcd, 0x00, 0x5d, 0x98, 0xbe, 0x00,
+  0x5e, 0x88, 0xaf, 0x00, 0x5f, 0x78, 0xa0, 0x00, 0x60, 0x68, 0x91, 0x00,
+  0x61, 0x58, 0x82, 0x00, 0x62, 0x48, 0x73, 0x00, 0x63, 0x38, 0x64, 0x00,
+  0x64, 0x28, 0x55, 0x00, 0x65, 0x18, 0x46, 0x00, 0x66, 0x11, 0x71, 0x80,
+  0x67, 0x01, 0x62, 0x80, 0x67, 0xf1, 0x53, 0x80, 0x68, 0xe1, 0x44, 0x80,
+  0x69, 0xd1, 0x35, 0x80, 0x6a, 0xc1, 0x26, 0x80, 0x6b, 0xb1, 0x17, 0x80,
+  0x6c, 0xa1, 0x08, 0x80, 0x6d, 0x90, 0xf9, 0x80, 0x6e, 0x80, 0xea, 0x80,
+  0x6f, 0x70, 0xdb, 0x80, 0x70, 0x6a, 0x07, 0x00, 0x71, 0x59, 0xf8, 0x00,
+  0x72, 0x49, 0xe9, 0x00, 0x73, 0x39, 0xda, 0x00, 0x74, 0x29, 0xcb, 0x00,
+  0x75, 0x19, 0xbc, 0x00, 0x76, 0x09, 0xad, 0x00, 0x76, 0xf9, 0x9e, 0x00,
+  0x77, 0xe9, 0x8f, 0x00, 0x78, 0xd9, 0x80, 0x00, 0x79, 0xc9, 0x71, 0x00,
+  0x7a, 0xb9, 0x62, 0x00, 0x7b, 0xb2, 0x8d, 0x80, 0x7c, 0xa2, 0x7e, 0x80,
+  0x7d, 0x92, 0x6f, 0x80, 0x7e, 0x82, 0x60, 0x80, 0x7f, 0x72, 0x51, 0x80,
+  0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03,
+  0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x00, 0x00,
+  0x8d, 0xc4, 0x00, 0x00, 0x00, 0x00, 0x9a, 0xb0, 0x01, 0x04, 0x00, 0x00,
+  0x8c, 0xa0, 0x00, 0x09, 0x00, 0x00, 0x9a, 0xb0, 0x01, 0x04, 0x00, 0x00,
+  0x8c, 0xa0, 0x00, 0x09, 0x4c, 0x4d, 0x54, 0x00, 0x41, 0x45, 0x44, 0x54,
+  0x00, 0x41, 0x45, 0x53, 0x54, 0x00, 0x00, 0x00, 0x00, 0x01, 0x01, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x54, 0x5a, 0x69, 0x66, 0x32, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8f, 0x00, 0x00, 0x00, 0x05, 0x00, 0x00, 0x00, 0x0e,
+  0xf8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff,
+  0x73, 0x16, 0x7f, 0x3c, 0xff, 0xff, 0xff, 0xff, 0x9c, 0x4e, 0xa6, 0x9c,
+  0xff, 0xff, 0xff, 0xff, 0x9c, 0xbc, 0x20, 0xf0, 0xff, 0xff, 0xff, 0xff,
+  0xcb, 0x54, 0xb3, 0x00, 0xff, 0xff, 0xff, 0xff, 0xcb, 0xc7, 0x57, 0x70,
+  0xff, 0xff, 0xff, 0xff, 0xcc, 0xb7, 0x56, 0x80, 0xff, 0xff, 0xff, 0xff,
+  0xcd, 0xa7, 0x39, 0x70, 0xff, 0xff, 0xff, 0xff, 0xce, 0xa0, 0x73, 0x00,
+  0xff, 0xff, 0xff, 0xff, 0xcf, 0x87, 0x1b, 0x70, 0x00, 0x00, 0x00, 0x00,
+  0x03, 0x70, 0x39, 0x80, 0x00, 0x00, 0x00, 0x00, 0x04, 0x0d, 0x1c, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x05, 0x50, 0x1b, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x05, 0xf6, 0x38, 0x80, 0x00, 0x00, 0x00, 0x00, 0x07, 0x2f, 0xfd, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x07, 0xd6, 0x1a, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x09, 0x0f, 0xdf, 0x80, 0x00, 0x00, 0x00, 0x00, 0x09, 0xb5, 0xfc, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x0a, 0xef, 0xc1, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x0b, 0x9f, 0x19, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0c, 0xd8, 0xde, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x0d, 0x7e, 0xfb, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x0e, 0xb8, 0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x5e, 0xdd, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x10, 0x98, 0xa2, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x11, 0x3e, 0xbf, 0x00, 0x00, 0x00, 0x00, 0x00, 0x12, 0x78, 0x84, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x13, 0x1e, 0xa1, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x14, 0x58, 0x66, 0x00, 0x00, 0x00, 0x00, 0x00, 0x14, 0xfe, 0x83, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x16, 0x38, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x17, 0x0c, 0x89, 0x80, 0x00, 0x00, 0x00, 0x00, 0x18, 0x21, 0x64, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x18, 0xc7, 0x81, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x1a, 0x01, 0x46, 0x80, 0x00, 0x00, 0x00, 0x00, 0x1a, 0xa7, 0x63, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x1b, 0xe1, 0x28, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x1c, 0x87, 0x45, 0x80, 0x00, 0x00, 0x00, 0x00, 0x1d, 0xc1, 0x0a, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x1e, 0x79, 0x9c, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x1f, 0x97, 0xb2, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x59, 0x7e, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x21, 0x80, 0xce, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x22, 0x42, 0x9b, 0x00, 0x00, 0x00, 0x00, 0x00, 0x23, 0x69, 0xeb, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x24, 0x22, 0x7d, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x25, 0x49, 0xcd, 0x00, 0x00, 0x00, 0x00, 0x00, 0x25, 0xef, 0xea, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x27, 0x29, 0xaf, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x27, 0xcf, 0xcc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x29, 0x09, 0x91, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x29, 0xaf, 0xae, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x2a, 0xe9, 0x73, 0x00, 0x00, 0x00, 0x00, 0x00, 0x2b, 0x98, 0xca, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x2c, 0xd2, 0x8f, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x2d, 0x78, 0xac, 0x80, 0x00, 0x00, 0x00, 0x00, 0x2e, 0xb2, 0x71, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x2f, 0x58, 0x8e, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x30, 0x92, 0x53, 0x80, 0x00, 0x00, 0x00, 0x00, 0x31, 0x5d, 0x5a, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x32, 0x72, 0x35, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x33, 0x3d, 0x3c, 0x80, 0x00, 0x00, 0x00, 0x00, 0x34, 0x52, 0x17, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x35, 0x1d, 0x1e, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x36, 0x31, 0xf9, 0x80, 0x00, 0x00, 0x00, 0x00, 0x36, 0xfd, 0x00, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x38, 0x1b, 0x16, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x38, 0xdc, 0xe2, 0x80, 0x00, 0x00, 0x00, 0x00, 0x39, 0xa7, 0xe9, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x3a, 0xbc, 0xc4, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x3b, 0xda, 0xda, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c, 0xa5, 0xe1, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x3d, 0xba, 0xbc, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x3e, 0x85, 0xc3, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3f, 0x9a, 0x9e, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x40, 0x65, 0xa5, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x41, 0x83, 0xba, 0x80, 0x00, 0x00, 0x00, 0x00, 0x42, 0x45, 0x87, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x43, 0x63, 0x9c, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x44, 0x2e, 0xa3, 0x80, 0x00, 0x00, 0x00, 0x00, 0x45, 0x43, 0x7e, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x46, 0x05, 0x4b, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x47, 0x23, 0x60, 0x80, 0x00, 0x00, 0x00, 0x00, 0x47, 0xf7, 0xa2, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x48, 0xe7, 0x93, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x49, 0xd7, 0x84, 0x00, 0x00, 0x00, 0x00, 0x00, 0x4a, 0xc7, 0x75, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x4b, 0xb7, 0x66, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x4c, 0xa7, 0x57, 0x00, 0x00, 0x00, 0x00, 0x00, 0x4d, 0x97, 0x48, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x4e, 0x87, 0x39, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x4f, 0x77, 0x2a, 0x00, 0x00, 0x00, 0x00, 0x00, 0x50, 0x70, 0x55, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x51, 0x60, 0x46, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x52, 0x50, 0x37, 0x80, 0x00, 0x00, 0x00, 0x00, 0x53, 0x40, 0x28, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x54, 0x30, 0x19, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x55, 0x20, 0x0a, 0x80, 0x00, 0x00, 0x00, 0x00, 0x56, 0x0f, 0xfb, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x56, 0xff, 0xec, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x57, 0xef, 0xdd, 0x80, 0x00, 0x00, 0x00, 0x00, 0x58, 0xdf, 0xce, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x59, 0xcf, 0xbf, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x5a, 0xbf, 0xb0, 0x80, 0x00, 0x00, 0x00, 0x00, 0x5b, 0xb8, 0xdc, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x5c, 0xa8, 0xcd, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x5d, 0x98, 0xbe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x5e, 0x88, 0xaf, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x5f, 0x78, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x60, 0x68, 0x91, 0x00, 0x00, 0x00, 0x00, 0x00, 0x61, 0x58, 0x82, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x62, 0x48, 0x73, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x63, 0x38, 0x64, 0x00, 0x00, 0x00, 0x00, 0x00, 0x64, 0x28, 0x55, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x65, 0x18, 0x46, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x66, 0x11, 0x71, 0x80, 0x00, 0x00, 0x00, 0x00, 0x67, 0x01, 0x62, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x67, 0xf1, 0x53, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x68, 0xe1, 0x44, 0x80, 0x00, 0x00, 0x00, 0x00, 0x69, 0xd1, 0x35, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x6a, 0xc1, 0x26, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x6b, 0xb1, 0x17, 0x80, 0x00, 0x00, 0x00, 0x00, 0x6c, 0xa1, 0x08, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x6d, 0x90, 0xf9, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x6e, 0x80, 0xea, 0x80, 0x00, 0x00, 0x00, 0x00, 0x6f, 0x70, 0xdb, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x70, 0x6a, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x71, 0x59, 0xf8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x72, 0x49, 0xe9, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x73, 0x39, 0xda, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x74, 0x29, 0xcb, 0x00, 0x00, 0x00, 0x00, 0x00, 0x75, 0x19, 0xbc, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x76, 0x09, 0xad, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x76, 0xf9, 0x9e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x77, 0xe9, 0x8f, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x78, 0xd9, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x79, 0xc9, 0x71, 0x00, 0x00, 0x00, 0x00, 0x00, 0x7a, 0xb9, 0x62, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x7b, 0xb2, 0x8d, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x7c, 0xa2, 0x7e, 0x80, 0x00, 0x00, 0x00, 0x00, 0x7d, 0x92, 0x6f, 0x80,
+  0x00, 0x00, 0x00, 0x00, 0x7e, 0x82, 0x60, 0x80, 0x00, 0x00, 0x00, 0x00,
+  0x7f, 0x72, 0x51, 0x80, 0x00, 0x02, 0x01, 0x02, 0x01, 0x02, 0x01, 0x02,
+  0x01, 0x02, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04, 0x03, 0x04,
+  0x03, 0x04, 0x03, 0x00, 0x00, 0x8d, 0xc4, 0x00, 0x00, 0x00, 0x00, 0x9a,
+  0xb0, 0x01, 0x04, 0x00, 0x00, 0x8c, 0xa0, 0x00, 0x09, 0x00, 0x00, 0x9a,
+  0xb0, 0x01, 0x04, 0x00, 0x00, 0x8c, 0xa0, 0x00, 0x09, 0x4c, 0x4d, 0x54,
+  0x00, 0x41, 0x45, 0x44, 0x54, 0x00, 0x41, 0x45, 0x53, 0x54, 0x00, 0x00,
+  0x00, 0x00, 0x01, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0a, 0x41, 0x45,
+  0x53, 0x54, 0x2d, 0x31, 0x30, 0x41, 0x45, 0x44, 0x54, 0x2c, 0x4d, 0x31,
+  0x30, 0x2e, 0x31, 0x2e, 0x30, 0x2c, 0x4d, 0x34, 0x2e, 0x31, 0x2e, 0x30,
+  0x2f, 0x33, 0x0a
+};
+unsigned int Australia_Sydney_len = 2223;
diff --git a/third_party/abseil_cpp/absl/time/time.cc b/third_party/abseil_cpp/absl/time/time.cc
new file mode 100644
index 0000000000..6bb36cb3e7
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/time.cc
@@ -0,0 +1,499 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+// The implementation of the absl::Time class, which is declared in
+// //absl/time.h.
+//
+// The representation for an absl::Time is an absl::Duration offset from the
+// epoch.  We use the traditional Unix epoch (1970-01-01 00:00:00 +0000)
+// for convenience, but this is not exposed in the API and could be changed.
+//
+// NOTE: To keep type verbosity to a minimum, the following variable naming
+// conventions are used throughout this file.
+//
+// tz: An absl::TimeZone
+// ci: An absl::TimeZone::CivilInfo
+// ti: An absl::TimeZone::TimeInfo
+// cd: An absl::CivilDay or a cctz::civil_day
+// cs: An absl::CivilSecond or a cctz::civil_second
+// bd: An absl::Time::Breakdown
+// cl: A cctz::time_zone::civil_lookup
+// al: A cctz::time_zone::absolute_lookup
+
+#include "absl/time/time.h"
+
+#if defined(_MSC_VER)
+#include <winsock2.h>  // for timeval
+#endif
+
+#include <cstring>
+#include <ctime>
+#include <limits>
+
+#include "absl/time/internal/cctz/include/cctz/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+namespace cctz = absl::time_internal::cctz;
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+
+namespace {
+
+inline cctz::time_point<cctz::seconds> unix_epoch() {
+  return std::chrono::time_point_cast<cctz::seconds>(
+      std::chrono::system_clock::from_time_t(0));
+}
+
+// Floors d to the next unit boundary closer to negative infinity.
+inline int64_t FloorToUnit(absl::Duration d, absl::Duration unit) {
+  absl::Duration rem;
+  int64_t q = absl::IDivDuration(d, unit, &rem);
+  return (q > 0 ||
+          rem >= ZeroDuration() ||
+          q == std::numeric_limits<int64_t>::min()) ? q : q - 1;
+}
+
+inline absl::Time::Breakdown InfiniteFutureBreakdown() {
+  absl::Time::Breakdown bd;
+  bd.year = std::numeric_limits<int64_t>::max();
+  bd.month = 12;
+  bd.day = 31;
+  bd.hour = 23;
+  bd.minute = 59;
+  bd.second = 59;
+  bd.subsecond = absl::InfiniteDuration();
+  bd.weekday = 4;
+  bd.yearday = 365;
+  bd.offset = 0;
+  bd.is_dst = false;
+  bd.zone_abbr = "-00";
+  return bd;
+}
+
+inline absl::Time::Breakdown InfinitePastBreakdown() {
+  Time::Breakdown bd;
+  bd.year = std::numeric_limits<int64_t>::min();
+  bd.month = 1;
+  bd.day = 1;
+  bd.hour = 0;
+  bd.minute = 0;
+  bd.second = 0;
+  bd.subsecond = -absl::InfiniteDuration();
+  bd.weekday = 7;
+  bd.yearday = 1;
+  bd.offset = 0;
+  bd.is_dst = false;
+  bd.zone_abbr = "-00";
+  return bd;
+}
+
+inline absl::TimeZone::CivilInfo InfiniteFutureCivilInfo() {
+  TimeZone::CivilInfo ci;
+  ci.cs = CivilSecond::max();
+  ci.subsecond = InfiniteDuration();
+  ci.offset = 0;
+  ci.is_dst = false;
+  ci.zone_abbr = "-00";
+  return ci;
+}
+
+inline absl::TimeZone::CivilInfo InfinitePastCivilInfo() {
+  TimeZone::CivilInfo ci;
+  ci.cs = CivilSecond::min();
+  ci.subsecond = -InfiniteDuration();
+  ci.offset = 0;
+  ci.is_dst = false;
+  ci.zone_abbr = "-00";
+  return ci;
+}
+
+inline absl::TimeConversion InfiniteFutureTimeConversion() {
+  absl::TimeConversion tc;
+  tc.pre = tc.trans = tc.post = absl::InfiniteFuture();
+  tc.kind = absl::TimeConversion::UNIQUE;
+  tc.normalized = true;
+  return tc;
+}
+
+inline TimeConversion InfinitePastTimeConversion() {
+  absl::TimeConversion tc;
+  tc.pre = tc.trans = tc.post = absl::InfinitePast();
+  tc.kind = absl::TimeConversion::UNIQUE;
+  tc.normalized = true;
+  return tc;
+}
+
+// Makes a Time from sec, overflowing to InfiniteFuture/InfinitePast as
+// necessary. If sec is min/max, then consult cs+tz to check for overlow.
+Time MakeTimeWithOverflow(const cctz::time_point<cctz::seconds>& sec,
+                          const cctz::civil_second& cs,
+                          const cctz::time_zone& tz,
+                          bool* normalized = nullptr) {
+  const auto max = cctz::time_point<cctz::seconds>::max();
+  const auto min = cctz::time_point<cctz::seconds>::min();
+  if (sec == max) {
+    const auto al = tz.lookup(max);
+    if (cs > al.cs) {
+      if (normalized) *normalized = true;
+      return absl::InfiniteFuture();
+    }
+  }
+  if (sec == min) {
+    const auto al = tz.lookup(min);
+    if (cs < al.cs) {
+      if (normalized) *normalized = true;
+      return absl::InfinitePast();
+    }
+  }
+  const auto hi = (sec - unix_epoch()).count();
+  return time_internal::FromUnixDuration(time_internal::MakeDuration(hi));
+}
+
+// Returns Mon=1..Sun=7.
+inline int MapWeekday(const cctz::weekday& wd) {
+  switch (wd) {
+    case cctz::weekday::monday:
+      return 1;
+    case cctz::weekday::tuesday:
+      return 2;
+    case cctz::weekday::wednesday:
+      return 3;
+    case cctz::weekday::thursday:
+      return 4;
+    case cctz::weekday::friday:
+      return 5;
+    case cctz::weekday::saturday:
+      return 6;
+    case cctz::weekday::sunday:
+      return 7;
+  }
+  return 1;
+}
+
+bool FindTransition(const cctz::time_zone& tz,
+                    bool (cctz::time_zone::*find_transition)(
+                        const cctz::time_point<cctz::seconds>& tp,
+                        cctz::time_zone::civil_transition* trans) const,
+                    Time t, TimeZone::CivilTransition* trans) {
+  // Transitions are second-aligned, so we can discard any fractional part.
+  const auto tp = unix_epoch() + cctz::seconds(ToUnixSeconds(t));
+  cctz::time_zone::civil_transition tr;
+  if (!(tz.*find_transition)(tp, &tr)) return false;
+  trans->from = CivilSecond(tr.from);
+  trans->to = CivilSecond(tr.to);
+  return true;
+}
+
+}  // namespace
+
+//
+// Time
+//
+
+absl::Time::Breakdown Time::In(absl::TimeZone tz) const {
+  if (*this == absl::InfiniteFuture()) return InfiniteFutureBreakdown();
+  if (*this == absl::InfinitePast()) return InfinitePastBreakdown();
+
+  const auto tp = unix_epoch() + cctz::seconds(time_internal::GetRepHi(rep_));
+  const auto al = cctz::time_zone(tz).lookup(tp);
+  const auto cs = al.cs;
+  const auto cd = cctz::civil_day(cs);
+
+  absl::Time::Breakdown bd;
+  bd.year = cs.year();
+  bd.month = cs.month();
+  bd.day = cs.day();
+  bd.hour = cs.hour();
+  bd.minute = cs.minute();
+  bd.second = cs.second();
+  bd.subsecond = time_internal::MakeDuration(0, time_internal::GetRepLo(rep_));
+  bd.weekday = MapWeekday(cctz::get_weekday(cd));
+  bd.yearday = cctz::get_yearday(cd);
+  bd.offset = al.offset;
+  bd.is_dst = al.is_dst;
+  bd.zone_abbr = al.abbr;
+  return bd;
+}
+
+//
+// Conversions from/to other time types.
+//
+
+absl::Time FromUDate(double udate) {
+  return time_internal::FromUnixDuration(absl::Milliseconds(udate));
+}
+
+absl::Time FromUniversal(int64_t universal) {
+  return absl::UniversalEpoch() + 100 * absl::Nanoseconds(universal);
+}
+
+int64_t ToUnixNanos(Time t) {
+  if (time_internal::GetRepHi(time_internal::ToUnixDuration(t)) >= 0 &&
+      time_internal::GetRepHi(time_internal::ToUnixDuration(t)) >> 33 == 0) {
+    return (time_internal::GetRepHi(time_internal::ToUnixDuration(t)) *
+            1000 * 1000 * 1000) +
+           (time_internal::GetRepLo(time_internal::ToUnixDuration(t)) / 4);
+  }
+  return FloorToUnit(time_internal::ToUnixDuration(t), absl::Nanoseconds(1));
+}
+
+int64_t ToUnixMicros(Time t) {
+  if (time_internal::GetRepHi(time_internal::ToUnixDuration(t)) >= 0 &&
+      time_internal::GetRepHi(time_internal::ToUnixDuration(t)) >> 43 == 0) {
+    return (time_internal::GetRepHi(time_internal::ToUnixDuration(t)) *
+            1000 * 1000) +
+           (time_internal::GetRepLo(time_internal::ToUnixDuration(t)) / 4000);
+  }
+  return FloorToUnit(time_internal::ToUnixDuration(t), absl::Microseconds(1));
+}
+
+int64_t ToUnixMillis(Time t) {
+  if (time_internal::GetRepHi(time_internal::ToUnixDuration(t)) >= 0 &&
+      time_internal::GetRepHi(time_internal::ToUnixDuration(t)) >> 53 == 0) {
+    return (time_internal::GetRepHi(time_internal::ToUnixDuration(t)) * 1000) +
+           (time_internal::GetRepLo(time_internal::ToUnixDuration(t)) /
+            (4000 * 1000));
+  }
+  return FloorToUnit(time_internal::ToUnixDuration(t), absl::Milliseconds(1));
+}
+
+int64_t ToUnixSeconds(Time t) {
+  return time_internal::GetRepHi(time_internal::ToUnixDuration(t));
+}
+
+time_t ToTimeT(Time t) { return absl::ToTimespec(t).tv_sec; }
+
+double ToUDate(Time t) {
+  return absl::FDivDuration(time_internal::ToUnixDuration(t),
+                            absl::Milliseconds(1));
+}
+
+int64_t ToUniversal(absl::Time t) {
+  return absl::FloorToUnit(t - absl::UniversalEpoch(), absl::Nanoseconds(100));
+}
+
+absl::Time TimeFromTimespec(timespec ts) {
+  return time_internal::FromUnixDuration(absl::DurationFromTimespec(ts));
+}
+
+absl::Time TimeFromTimeval(timeval tv) {
+  return time_internal::FromUnixDuration(absl::DurationFromTimeval(tv));
+}
+
+timespec ToTimespec(Time t) {
+  timespec ts;
+  absl::Duration d = time_internal::ToUnixDuration(t);
+  if (!time_internal::IsInfiniteDuration(d)) {
+    ts.tv_sec = time_internal::GetRepHi(d);
+    if (ts.tv_sec == time_internal::GetRepHi(d)) {  // no time_t narrowing
+      ts.tv_nsec = time_internal::GetRepLo(d) / 4;  // floor
+      return ts;
+    }
+  }
+  if (d >= absl::ZeroDuration()) {
+    ts.tv_sec = std::numeric_limits<time_t>::max();
+    ts.tv_nsec = 1000 * 1000 * 1000 - 1;
+  } else {
+    ts.tv_sec = std::numeric_limits<time_t>::min();
+    ts.tv_nsec = 0;
+  }
+  return ts;
+}
+
+timeval ToTimeval(Time t) {
+  timeval tv;
+  timespec ts = absl::ToTimespec(t);
+  tv.tv_sec = ts.tv_sec;
+  if (tv.tv_sec != ts.tv_sec) {  // narrowing
+    if (ts.tv_sec < 0) {
+      tv.tv_sec = std::numeric_limits<decltype(tv.tv_sec)>::min();
+      tv.tv_usec = 0;
+    } else {
+      tv.tv_sec = std::numeric_limits<decltype(tv.tv_sec)>::max();
+      tv.tv_usec = 1000 * 1000 - 1;
+    }
+    return tv;
+  }
+  tv.tv_usec = static_cast<int>(ts.tv_nsec / 1000);  // suseconds_t
+  return tv;
+}
+
+Time FromChrono(const std::chrono::system_clock::time_point& tp) {
+  return time_internal::FromUnixDuration(time_internal::FromChrono(
+      tp - std::chrono::system_clock::from_time_t(0)));
+}
+
+std::chrono::system_clock::time_point ToChronoTime(absl::Time t) {
+  using D = std::chrono::system_clock::duration;
+  auto d = time_internal::ToUnixDuration(t);
+  if (d < ZeroDuration()) d = Floor(d, FromChrono(D{1}));
+  return std::chrono::system_clock::from_time_t(0) +
+         time_internal::ToChronoDuration<D>(d);
+}
+
+//
+// TimeZone
+//
+
+absl::TimeZone::CivilInfo TimeZone::At(Time t) const {
+  if (t == absl::InfiniteFuture()) return InfiniteFutureCivilInfo();
+  if (t == absl::InfinitePast()) return InfinitePastCivilInfo();
+
+  const auto ud = time_internal::ToUnixDuration(t);
+  const auto tp = unix_epoch() + cctz::seconds(time_internal::GetRepHi(ud));
+  const auto al = cz_.lookup(tp);
+
+  TimeZone::CivilInfo ci;
+  ci.cs = CivilSecond(al.cs);
+  ci.subsecond = time_internal::MakeDuration(0, time_internal::GetRepLo(ud));
+  ci.offset = al.offset;
+  ci.is_dst = al.is_dst;
+  ci.zone_abbr = al.abbr;
+  return ci;
+}
+
+absl::TimeZone::TimeInfo TimeZone::At(CivilSecond ct) const {
+  const cctz::civil_second cs(ct);
+  const auto cl = cz_.lookup(cs);
+
+  TimeZone::TimeInfo ti;
+  switch (cl.kind) {
+    case cctz::time_zone::civil_lookup::UNIQUE:
+      ti.kind = TimeZone::TimeInfo::UNIQUE;
+      break;
+    case cctz::time_zone::civil_lookup::SKIPPED:
+      ti.kind = TimeZone::TimeInfo::SKIPPED;
+      break;
+    case cctz::time_zone::civil_lookup::REPEATED:
+      ti.kind = TimeZone::TimeInfo::REPEATED;
+      break;
+  }
+  ti.pre = MakeTimeWithOverflow(cl.pre, cs, cz_);
+  ti.trans = MakeTimeWithOverflow(cl.trans, cs, cz_);
+  ti.post = MakeTimeWithOverflow(cl.post, cs, cz_);
+  return ti;
+}
+
+bool TimeZone::NextTransition(Time t, CivilTransition* trans) const {
+  return FindTransition(cz_, &cctz::time_zone::next_transition, t, trans);
+}
+
+bool TimeZone::PrevTransition(Time t, CivilTransition* trans) const {
+  return FindTransition(cz_, &cctz::time_zone::prev_transition, t, trans);
+}
+
+//
+// Conversions involving time zones.
+//
+
+absl::TimeConversion ConvertDateTime(int64_t year, int mon, int day, int hour,
+                                     int min, int sec, TimeZone tz) {
+  // Avoids years that are too extreme for CivilSecond to normalize.
+  if (year > 300000000000) return InfiniteFutureTimeConversion();
+  if (year < -300000000000) return InfinitePastTimeConversion();
+
+  const CivilSecond cs(year, mon, day, hour, min, sec);
+  const auto ti = tz.At(cs);
+
+  TimeConversion tc;
+  tc.pre = ti.pre;
+  tc.trans = ti.trans;
+  tc.post = ti.post;
+  switch (ti.kind) {
+    case TimeZone::TimeInfo::UNIQUE:
+      tc.kind = TimeConversion::UNIQUE;
+      break;
+    case TimeZone::TimeInfo::SKIPPED:
+      tc.kind = TimeConversion::SKIPPED;
+      break;
+    case TimeZone::TimeInfo::REPEATED:
+      tc.kind = TimeConversion::REPEATED;
+      break;
+  }
+  tc.normalized = false;
+  if (year != cs.year() || mon != cs.month() || day != cs.day() ||
+      hour != cs.hour() || min != cs.minute() || sec != cs.second()) {
+    tc.normalized = true;
+  }
+  return tc;
+}
+
+absl::Time FromTM(const struct tm& tm, absl::TimeZone tz) {
+  civil_year_t tm_year = tm.tm_year;
+  // Avoids years that are too extreme for CivilSecond to normalize.
+  if (tm_year > 300000000000ll) return InfiniteFuture();
+  if (tm_year < -300000000000ll) return InfinitePast();
+  int tm_mon = tm.tm_mon;
+  if (tm_mon == std::numeric_limits<int>::max()) {
+    tm_mon -= 12;
+    tm_year += 1;
+  }
+  const auto ti = tz.At(CivilSecond(tm_year + 1900, tm_mon + 1, tm.tm_mday,
+                                    tm.tm_hour, tm.tm_min, tm.tm_sec));
+  return tm.tm_isdst == 0 ? ti.post : ti.pre;
+}
+
+struct tm ToTM(absl::Time t, absl::TimeZone tz) {
+  struct tm tm = {};
+
+  const auto ci = tz.At(t);
+  const auto& cs = ci.cs;
+  tm.tm_sec = cs.second();
+  tm.tm_min = cs.minute();
+  tm.tm_hour = cs.hour();
+  tm.tm_mday = cs.day();
+  tm.tm_mon = cs.month() - 1;
+
+  // Saturates tm.tm_year in cases of over/underflow, accounting for the fact
+  // that tm.tm_year is years since 1900.
+  if (cs.year() < std::numeric_limits<int>::min() + 1900) {
+    tm.tm_year = std::numeric_limits<int>::min();
+  } else if (cs.year() > std::numeric_limits<int>::max()) {
+    tm.tm_year = std::numeric_limits<int>::max() - 1900;
+  } else {
+    tm.tm_year = static_cast<int>(cs.year() - 1900);
+  }
+
+  switch (GetWeekday(cs)) {
+    case Weekday::sunday:
+      tm.tm_wday = 0;
+      break;
+    case Weekday::monday:
+      tm.tm_wday = 1;
+      break;
+    case Weekday::tuesday:
+      tm.tm_wday = 2;
+      break;
+    case Weekday::wednesday:
+      tm.tm_wday = 3;
+      break;
+    case Weekday::thursday:
+      tm.tm_wday = 4;
+      break;
+    case Weekday::friday:
+      tm.tm_wday = 5;
+      break;
+    case Weekday::saturday:
+      tm.tm_wday = 6;
+      break;
+  }
+  tm.tm_yday = GetYearDay(cs) - 1;
+  tm.tm_isdst = ci.is_dst ? 1 : 0;
+
+  return tm;
+}
+
+ABSL_NAMESPACE_END
+}  // namespace absl
diff --git a/third_party/abseil_cpp/absl/time/time.h b/third_party/abseil_cpp/absl/time/time.h
new file mode 100644
index 0000000000..b456a13e85
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/time.h
@@ -0,0 +1,1584 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+//
+// -----------------------------------------------------------------------------
+// File: time.h
+// -----------------------------------------------------------------------------
+//
+// This header file defines abstractions for computing with absolute points
+// in time, durations of time, and formatting and parsing time within a given
+// time zone. The following abstractions are defined:
+//
+//  * `absl::Time` defines an absolute, specific instance in time
+//  * `absl::Duration` defines a signed, fixed-length span of time
+//  * `absl::TimeZone` defines geopolitical time zone regions (as collected
+//     within the IANA Time Zone database (https://www.iana.org/time-zones)).
+//
+// Note: Absolute times are distinct from civil times, which refer to the
+// human-scale time commonly represented by `YYYY-MM-DD hh:mm:ss`. The mapping
+// between absolute and civil times can be specified by use of time zones
+// (`absl::TimeZone` within this API). That is:
+//
+//   Civil Time = F(Absolute Time, Time Zone)
+//   Absolute Time = G(Civil Time, Time Zone)
+//
+// See civil_time.h for abstractions related to constructing and manipulating
+// civil time.
+//
+// Example:
+//
+//   absl::TimeZone nyc;
+//   // LoadTimeZone() may fail so it's always better to check for success.
+//   if (!absl::LoadTimeZone("America/New_York", &nyc)) {
+//      // handle error case
+//   }
+//
+//   // My flight leaves NYC on Jan 2, 2017 at 03:04:05
+//   absl::CivilSecond cs(2017, 1, 2, 3, 4, 5);
+//   absl::Time takeoff = absl::FromCivil(cs, nyc);
+//
+//   absl::Duration flight_duration = absl::Hours(21) + absl::Minutes(35);
+//   absl::Time landing = takeoff + flight_duration;
+//
+//   absl::TimeZone syd;
+//   if (!absl::LoadTimeZone("Australia/Sydney", &syd)) {
+//      // handle error case
+//   }
+//   std::string s = absl::FormatTime(
+//       "My flight will land in Sydney on %Y-%m-%d at %H:%M:%S",
+//       landing, syd);
+
+#ifndef ABSL_TIME_TIME_H_
+#define ABSL_TIME_TIME_H_
+
+#if !defined(_MSC_VER)
+#include <sys/time.h>
+#else
+// We don't include `winsock2.h` because it drags in `windows.h` and friends,
+// and they define conflicting macros like OPAQUE, ERROR, and more. This has the
+// potential to break Abseil users.
+//
+// Instead we only forward declare `timeval` and require Windows users include
+// `winsock2.h` themselves. This is both inconsistent and troublesome, but so is
+// including 'windows.h' so we are picking the lesser of two evils here.
+struct timeval;
+#endif
+#include <chrono>  // NOLINT(build/c++11)
+#include <cmath>
+#include <cstdint>
+#include <ctime>
+#include <ostream>
+#include <string>
+#include <type_traits>
+#include <utility>
+
+#include "absl/base/macros.h"
+#include "absl/strings/string_view.h"
+#include "absl/time/civil_time.h"
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+namespace absl {
+ABSL_NAMESPACE_BEGIN
+
+class Duration;  // Defined below
+class Time;      // Defined below
+class TimeZone;  // Defined below
+
+namespace time_internal {
+int64_t IDivDuration(bool satq, Duration num, Duration den, Duration* rem);
+constexpr Time FromUnixDuration(Duration d);
+constexpr Duration ToUnixDuration(Time t);
+constexpr int64_t GetRepHi(Duration d);
+constexpr uint32_t GetRepLo(Duration d);
+constexpr Duration MakeDuration(int64_t hi, uint32_t lo);
+constexpr Duration MakeDuration(int64_t hi, int64_t lo);
+inline Duration MakePosDoubleDuration(double n);
+constexpr int64_t kTicksPerNanosecond = 4;
+constexpr int64_t kTicksPerSecond = 1000 * 1000 * 1000 * kTicksPerNanosecond;
+template <std::intmax_t N>
+constexpr Duration FromInt64(int64_t v, std::ratio<1, N>);
+constexpr Duration FromInt64(int64_t v, std::ratio<60>);
+constexpr Duration FromInt64(int64_t v, std::ratio<3600>);
+template <typename T>
+using EnableIfIntegral = typename std::enable_if<
+    std::is_integral<T>::value || std::is_enum<T>::value, int>::type;
+template <typename T>
+using EnableIfFloat =
+    typename std::enable_if<std::is_floating_point<T>::value, int>::type;
+}  // namespace time_internal
+
+// Duration
+//
+// The `absl::Duration` class represents a signed, fixed-length span of time.
+// A `Duration` is generated using a unit-specific factory function, or is
+// the result of subtracting one `absl::Time` from another. Durations behave
+// like unit-safe integers and they support all the natural integer-like
+// arithmetic operations. Arithmetic overflows and saturates at +/- infinity.
+// `Duration` should be passed by value rather than const reference.
+//
+// Factory functions `Nanoseconds()`, `Microseconds()`, `Milliseconds()`,
+// `Seconds()`, `Minutes()`, `Hours()` and `InfiniteDuration()` allow for
+// creation of constexpr `Duration` values
+//
+// Examples:
+//
+//   constexpr absl::Duration ten_ns = absl::Nanoseconds(10);
+//   constexpr absl::Duration min = absl::Minutes(1);
+//   constexpr absl::Duration hour = absl::Hours(1);
+//   absl::Duration dur = 60 * min;  // dur == hour
+//   absl::Duration half_sec = absl::Milliseconds(500);
+//   absl::Duration quarter_sec = 0.25 * absl::Seconds(1);
+//
+// `Duration` values can be easily converted to an integral number of units
+// using the division operator.
+//
+// Example:
+//
+//   constexpr absl::Duration dur = absl::Milliseconds(1500);
+//   int64_t ns = dur / absl::Nanoseconds(1);   // ns == 1500000000
+//   int64_t ms = dur / absl::Milliseconds(1);  // ms == 1500
+//   int64_t sec = dur / absl::Seconds(1);    // sec == 1 (subseconds truncated)
+//   int64_t min = dur / absl::Minutes(1);    // min == 0
+//
+// See the `IDivDuration()` and `FDivDuration()` functions below for details on
+// how to access the fractional parts of the quotient.
+//
+// Alternatively, conversions can be performed using helpers such as
+// `ToInt64Microseconds()` and `ToDoubleSeconds()`.
+class Duration {
+ public:
+  // Value semantics.
+  constexpr Duration() : rep_hi_(0), rep_lo_(0) {}  // zero-length duration
+
+  // Copyable.
+#if !defined(__clang__) && defined(_MSC_VER) && _MSC_VER < 1910
+  // Explicitly defining the constexpr copy constructor avoids an MSVC bug.
+  constexpr Duration(const Duration& d)
+      : rep_hi_(d.rep_hi_), rep_lo_(d.rep_lo_) {}
+#else
+  constexpr Duration(const Duration& d) = default;
+#endif
+  Duration& operator=(const Duration& d) = default;
+
+  // Compound assignment operators.
+  Duration& operator+=(Duration d);
+  Duration& operator-=(Duration d);
+  Duration& operator*=(int64_t r);
+  Duration& operator*=(double r);
+  Duration& operator/=(int64_t r);
+  Duration& operator/=(double r);
+  Duration& operator%=(Duration rhs);
+
+  // Overloads that forward to either the int64_t or double overloads above.
+  // Integer operands must be representable as int64_t.
+  template <typename T>
+  Duration& operator*=(T r) {
+    int64_t x = r;
+    return *this *= x;
+  }
+  template <typename T>
+  Duration& operator/=(T r) {
+    int64_t x = r;
+    return *this /= x;
+  }
+  Duration& operator*=(float r) { return *this *= static_cast<double>(r); }
+  Duration& operator/=(float r) { return *this /= static_cast<double>(r); }
+
+  template <typename H>
+  friend H AbslHashValue(H h, Duration d) {
+    return H::combine(std::move(h), d.rep_hi_, d.rep_lo_);
+  }
+
+ private:
+  friend constexpr int64_t time_internal::GetRepHi(Duration d);
+  friend constexpr uint32_t time_internal::GetRepLo(Duration d);
+  friend constexpr Duration time_internal::MakeDuration(int64_t hi,
+                                                        uint32_t lo);
+  constexpr Duration(int64_t hi, uint32_t lo) : rep_hi_(hi), rep_lo_(lo) {}
+  int64_t rep_hi_;
+  uint32_t rep_lo_;
+};
+
+// Relational Operators
+constexpr bool operator<(Duration lhs, Duration rhs);
+constexpr bool operator>(Duration lhs, Duration rhs) { return rhs < lhs; }
+constexpr bool operator>=(Duration lhs, Duration rhs) { return !(lhs < rhs); }
+constexpr bool operator<=(Duration lhs, Duration rhs) { return !(rhs < lhs); }
+constexpr bool operator==(Duration lhs, Duration rhs);
+constexpr bool operator!=(Duration lhs, Duration rhs) { return !(lhs == rhs); }
+
+// Additive Operators
+constexpr Duration operator-(Duration d);
+inline Duration operator+(Duration lhs, Duration rhs) { return lhs += rhs; }
+inline Duration operator-(Duration lhs, Duration rhs) { return lhs -= rhs; }
+
+// Multiplicative Operators
+// Integer operands must be representable as int64_t.
+template <typename T>
+Duration operator*(Duration lhs, T rhs) {
+  return lhs *= rhs;
+}
+template <typename T>
+Duration operator*(T lhs, Duration rhs) {
+  return rhs *= lhs;
+}
+template <typename T>
+Duration operator/(Duration lhs, T rhs) {
+  return lhs /= rhs;
+}
+inline int64_t operator/(Duration lhs, Duration rhs) {
+  return time_internal::IDivDuration(true, lhs, rhs,
+                                     &lhs);  // trunc towards zero
+}
+inline Duration operator%(Duration lhs, Duration rhs) { return lhs %= rhs; }
+
+// IDivDuration()
+//
+// Divides a numerator `Duration` by a denominator `Duration`, returning the
+// quotient and remainder. The remainder always has the same sign as the
+// numerator. The returned quotient and remainder respect the identity:
+//
+//   numerator = denominator * quotient + remainder
+//
+// Returned quotients are capped to the range of `int64_t`, with the difference
+// spilling into the remainder to uphold the above identity. This means that the
+// remainder returned could differ from the remainder returned by
+// `Duration::operator%` for huge quotients.
+//
+// See also the notes on `InfiniteDuration()` below regarding the behavior of
+// division involving zero and infinite durations.
+//
+// Example:
+//
+//   constexpr absl::Duration a =
+//       absl::Seconds(std::numeric_limits<int64_t>::max());  // big
+//   constexpr absl::Duration b = absl::Nanoseconds(1);       // small
+//
+//   absl::Duration rem = a % b;
+//   // rem == absl::ZeroDuration()
+//
+//   // Here, q would overflow int64_t, so rem accounts for the difference.
+//   int64_t q = absl::IDivDuration(a, b, &rem);
+//   // q == std::numeric_limits<int64_t>::max(), rem == a - b * q
+inline int64_t IDivDuration(Duration num, Duration den, Duration* rem) {
+  return time_internal::IDivDuration(true, num, den,
+                                     rem);  // trunc towards zero
+}
+
+// FDivDuration()
+//
+// Divides a `Duration` numerator into a fractional number of units of a
+// `Duration` denominator.
+//
+// See also the notes on `InfiniteDuration()` below regarding the behavior of
+// division involving zero and infinite durations.
+//
+// Example:
+//
+//   double d = absl::FDivDuration(absl::Milliseconds(1500), absl::Seconds(1));
+//   // d == 1.5
+double FDivDuration(Duration num, Duration den);
+
+// ZeroDuration()
+//
+// Returns a zero-length duration. This function behaves just like the default
+// constructor, but the name helps make the semantics clear at call sites.
+constexpr Duration ZeroDuration() { return Duration(); }
+
+// AbsDuration()
+//
+// Returns the absolute value of a duration.
+inline Duration AbsDuration(Duration d) {
+  return (d < ZeroDuration()) ? -d : d;
+}
+
+// Trunc()
+//
+// Truncates a duration (toward zero) to a multiple of a non-zero unit.
+//
+// Example:
+//
+//   absl::Duration d = absl::Nanoseconds(123456789);
+//   absl::Duration a = absl::Trunc(d, absl::Microseconds(1));  // 123456us
+Duration Trunc(Duration d, Duration unit);
+
+// Floor()
+//
+// Floors a duration using the passed duration unit to its largest value not
+// greater than the duration.
+//
+// Example:
+//
+//   absl::Duration d = absl::Nanoseconds(123456789);
+//   absl::Duration b = absl::Floor(d, absl::Microseconds(1));  // 123456us
+Duration Floor(Duration d, Duration unit);
+
+// Ceil()
+//
+// Returns the ceiling of a duration using the passed duration unit to its
+// smallest value not less than the duration.
+//
+// Example:
+//
+//   absl::Duration d = absl::Nanoseconds(123456789);
+//   absl::Duration c = absl::Ceil(d, absl::Microseconds(1));   // 123457us
+Duration Ceil(Duration d, Duration unit);
+
+// InfiniteDuration()
+//
+// Returns an infinite `Duration`.  To get a `Duration` representing negative
+// infinity, use `-InfiniteDuration()`.
+//
+// Duration arithmetic overflows to +/- infinity and saturates. In general,
+// arithmetic with `Duration` infinities is similar to IEEE 754 infinities
+// except where IEEE 754 NaN would be involved, in which case +/-
+// `InfiniteDuration()` is used in place of a "nan" Duration.
+//
+// Examples:
+//
+//   constexpr absl::Duration inf = absl::InfiniteDuration();
+//   const absl::Duration d = ... any finite duration ...
+//
+//   inf == inf + inf
+//   inf == inf + d
+//   inf == inf - inf
+//   -inf == d - inf
+//
+//   inf == d * 1e100
+//   inf == inf / 2
+//   0 == d / inf
+//   INT64_MAX == inf / d
+//
+//   d < inf
+//   -inf < d
+//
+//   // Division by zero returns infinity, or INT64_MIN/MAX where appropriate.
+//   inf == d / 0
+//   INT64_MAX == d / absl::ZeroDuration()
+//
+// The examples involving the `/` operator above also apply to `IDivDuration()`
+// and `FDivDuration()`.
+constexpr Duration InfiniteDuration();
+
+// Nanoseconds()
+// Microseconds()
+// Milliseconds()
+// Seconds()
+// Minutes()
+// Hours()
+//
+// Factory functions for constructing `Duration` values from an integral number
+// of the unit indicated by the factory function's name. The number must be
+// representable as int64_t.
+//
+// NOTE: no "Days()" factory function exists because "a day" is ambiguous.
+// Civil days are not always 24 hours long, and a 24-hour duration often does
+// not correspond with a civil day. If a 24-hour duration is needed, use
+// `absl::Hours(24)`. If you actually want a civil day, use absl::CivilDay
+// from civil_time.h.
+//
+// Example:
+//
+//   absl::Duration a = absl::Seconds(60);
+//   absl::Duration b = absl::Minutes(1);  // b == a
+constexpr Duration Nanoseconds(int64_t n);
+constexpr Duration Microseconds(int64_t n);
+constexpr Duration Milliseconds(int64_t n);
+constexpr Duration Seconds(int64_t n);
+constexpr Duration Minutes(int64_t n);
+constexpr Duration Hours(int64_t n);
+
+// Factory overloads for constructing `Duration` values from a floating-point
+// number of the unit indicated by the factory function's name. These functions
+// exist for convenience, but they are not as efficient as the integral
+// factories, which should be preferred.
+//
+// Example:
+//
+//   auto a = absl::Seconds(1.5);        // OK
+//   auto b = absl::Milliseconds(1500);  // BETTER
+template <typename T, time_internal::EnableIfFloat<T> = 0>
+Duration Nanoseconds(T n) {
+  return n * Nanoseconds(1);
+}
+template <typename T, time_internal::EnableIfFloat<T> = 0>
+Duration Microseconds(T n) {
+  return n * Microseconds(1);
+}
+template <typename T, time_internal::EnableIfFloat<T> = 0>
+Duration Milliseconds(T n) {
+  return n * Milliseconds(1);
+}
+template <typename T, time_internal::EnableIfFloat<T> = 0>
+Duration Seconds(T n) {
+  if (n >= 0) {  // Note: `NaN >= 0` is false.
+    if (n >= static_cast<T>((std::numeric_limits<int64_t>::max)())) {
+      return InfiniteDuration();
+    }
+    return time_internal::MakePosDoubleDuration(n);
+  } else {
+    if (std::isnan(n))
+      return std::signbit(n) ? -InfiniteDuration() : InfiniteDuration();
+    if (n <= (std::numeric_limits<int64_t>::min)()) return -InfiniteDuration();
+    return -time_internal::MakePosDoubleDuration(-n);
+  }
+}
+template <typename T, time_internal::EnableIfFloat<T> = 0>
+Duration Minutes(T n) {
+  return n * Minutes(1);
+}
+template <typename T, time_internal::EnableIfFloat<T> = 0>
+Duration Hours(T n) {
+  return n * Hours(1);
+}
+
+// ToInt64Nanoseconds()
+// ToInt64Microseconds()
+// ToInt64Milliseconds()
+// ToInt64Seconds()
+// ToInt64Minutes()
+// ToInt64Hours()
+//
+// Helper functions that convert a Duration to an integral count of the
+// indicated unit. These functions are shorthand for the `IDivDuration()`
+// function above; see its documentation for details about overflow, etc.
+//
+// Example:
+//
+//   absl::Duration d = absl::Milliseconds(1500);
+//   int64_t isec = absl::ToInt64Seconds(d);  // isec == 1
+int64_t ToInt64Nanoseconds(Duration d);
+int64_t ToInt64Microseconds(Duration d);
+int64_t ToInt64Milliseconds(Duration d);
+int64_t ToInt64Seconds(Duration d);
+int64_t ToInt64Minutes(Duration d);
+int64_t ToInt64Hours(Duration d);
+
+// ToDoubleNanoSeconds()
+// ToDoubleMicroseconds()
+// ToDoubleMilliseconds()
+// ToDoubleSeconds()
+// ToDoubleMinutes()
+// ToDoubleHours()
+//
+// Helper functions that convert a Duration to a floating point count of the
+// indicated unit. These functions are shorthand for the `FDivDuration()`
+// function above; see its documentation for details about overflow, etc.
+//
+// Example:
+//
+//   absl::Duration d = absl::Milliseconds(1500);
+//   double dsec = absl::ToDoubleSeconds(d);  // dsec == 1.5
+double ToDoubleNanoseconds(Duration d);
+double ToDoubleMicroseconds(Duration d);
+double ToDoubleMilliseconds(Duration d);
+double ToDoubleSeconds(Duration d);
+double ToDoubleMinutes(Duration d);
+double ToDoubleHours(Duration d);
+
+// FromChrono()
+//
+// Converts any of the pre-defined std::chrono durations to an absl::Duration.
+//
+// Example:
+//
+//   std::chrono::milliseconds ms(123);
+//   absl::Duration d = absl::FromChrono(ms);
+constexpr Duration FromChrono(const std::chrono::nanoseconds& d);
+constexpr Duration FromChrono(const std::chrono::microseconds& d);
+constexpr Duration FromChrono(const std::chrono::milliseconds& d);
+constexpr Duration FromChrono(const std::chrono::seconds& d);
+constexpr Duration FromChrono(const std::chrono::minutes& d);
+constexpr Duration FromChrono(const std::chrono::hours& d);
+
+// ToChronoNanoseconds()
+// ToChronoMicroseconds()
+// ToChronoMilliseconds()
+// ToChronoSeconds()
+// ToChronoMinutes()
+// ToChronoHours()
+//
+// Converts an absl::Duration to any of the pre-defined std::chrono durations.
+// If overflow would occur, the returned value will saturate at the min/max
+// chrono duration value instead.
+//
+// Example:
+//
+//   absl::Duration d = absl::Microseconds(123);
+//   auto x = absl::ToChronoMicroseconds(d);
+//   auto y = absl::ToChronoNanoseconds(d);  // x == y
+//   auto z = absl::ToChronoSeconds(absl::InfiniteDuration());
+//   // z == std::chrono::seconds::max()
+std::chrono::nanoseconds ToChronoNanoseconds(Duration d);
+std::chrono::microseconds ToChronoMicroseconds(Duration d);
+std::chrono::milliseconds ToChronoMilliseconds(Duration d);
+std::chrono::seconds ToChronoSeconds(Duration d);
+std::chrono::minutes ToChronoMinutes(Duration d);
+std::chrono::hours ToChronoHours(Duration d);
+
+// FormatDuration()
+//
+// Returns a string representing the duration in the form "72h3m0.5s".
+// Returns "inf" or "-inf" for +/- `InfiniteDuration()`.
+std::string FormatDuration(Duration d);
+
+// Output stream operator.
+inline std::ostream& operator<<(std::ostream& os, Duration d) {
+  return os << FormatDuration(d);
+}
+
+// ParseDuration()
+//
+// Parses a duration string consisting of a possibly signed sequence of
+// decimal numbers, each with an optional fractional part and a unit
+// suffix.  The valid suffixes are "ns", "us" "ms", "s", "m", and "h".
+// Simple examples include "300ms", "-1.5h", and "2h45m".  Parses "0" as
+// `ZeroDuration()`. Parses "inf" and "-inf" as +/- `InfiniteDuration()`.
+bool ParseDuration(absl::string_view dur_string, Duration* d);
+
+// Support for flag values of type Duration. Duration flags must be specified
+// in a format that is valid input for absl::ParseDuration().
+bool AbslParseFlag(absl::string_view text, Duration* dst, std::string* error);
+std::string AbslUnparseFlag(Duration d);
+ABSL_DEPRECATED("Use AbslParseFlag() instead.")
+bool ParseFlag(const std::string& text, Duration* dst, std::string* error);
+ABSL_DEPRECATED("Use AbslUnparseFlag() instead.")
+std::string UnparseFlag(Duration d);
+
+// Time
+//
+// An `absl::Time` represents a specific instant in time. Arithmetic operators
+// are provided for naturally expressing time calculations. Instances are
+// created using `absl::Now()` and the `absl::From*()` factory functions that
+// accept the gamut of other time representations. Formatting and parsing
+// functions are provided for conversion to and from strings.  `absl::Time`
+// should be passed by value rather than const reference.
+//
+// `absl::Time` assumes there are 60 seconds in a minute, which means the
+// underlying time scales must be "smeared" to eliminate leap seconds.
+// See https://developers.google.com/time/smear.
+//
+// Even though `absl::Time` supports a wide range of timestamps, exercise
+// caution when using values in the distant past. `absl::Time` uses the
+// Proleptic Gregorian calendar, which extends the Gregorian calendar backward
+// to dates before its introduction in 1582.
+// See https://en.wikipedia.org/wiki/Proleptic_Gregorian_calendar
+// for more information. Use the ICU calendar classes to convert a date in
+// some other calendar (http://userguide.icu-project.org/datetime/calendar).
+//
+// Similarly, standardized time zones are a reasonably recent innovation, with
+// the Greenwich prime meridian being established in 1884. The TZ database
+// itself does not profess accurate offsets for timestamps prior to 1970. The
+// breakdown of future timestamps is subject to the whim of regional
+// governments.
+//
+// The `absl::Time` class represents an instant in time as a count of clock
+// ticks of some granularity (resolution) from some starting point (epoch).
+//
+// `absl::Time` uses a resolution that is high enough to avoid loss in
+// precision, and a range that is wide enough to avoid overflow, when
+// converting between tick counts in most Google time scales (i.e., resolution
+// of at least one nanosecond, and range +/-100 billion years).  Conversions
+// between the time scales are performed by truncating (towards negative
+// infinity) to the nearest representable point.
+//
+// Examples:
+//
+//   absl::Time t1 = ...;
+//   absl::Time t2 = t1 + absl::Minutes(2);
+//   absl::Duration d = t2 - t1;  // == absl::Minutes(2)
+//
+class Time {
+ public:
+  // Value semantics.
+
+  // Returns the Unix epoch.  However, those reading your code may not know
+  // or expect the Unix epoch as the default value, so make your code more
+  // readable by explicitly initializing all instances before use.
+  //
+  // Example:
+  //   absl::Time t = absl::UnixEpoch();
+  //   absl::Time t = absl::Now();
+  //   absl::Time t = absl::TimeFromTimeval(tv);
+  //   absl::Time t = absl::InfinitePast();
+  constexpr Time() = default;
+
+  // Copyable.
+  constexpr Time(const Time& t) = default;
+  Time& operator=(const Time& t) = default;
+
+  // Assignment operators.
+  Time& operator+=(Duration d) {
+    rep_ += d;
+    return *this;
+  }
+  Time& operator-=(Duration d) {
+    rep_ -= d;
+    return *this;
+  }
+
+  // Time::Breakdown
+  //
+  // The calendar and wall-clock (aka "civil time") components of an
+  // `absl::Time` in a certain `absl::TimeZone`. This struct is not
+  // intended to represent an instant in time. So, rather than passing
+  // a `Time::Breakdown` to a function, pass an `absl::Time` and an
+  // `absl::TimeZone`.
+  //
+  // Deprecated. Use `absl::TimeZone::CivilInfo`.
+  struct
+      Breakdown {
+    int64_t year;          // year (e.g., 2013)
+    int month;           // month of year [1:12]
+    int day;             // day of month [1:31]
+    int hour;            // hour of day [0:23]
+    int minute;          // minute of hour [0:59]
+    int second;          // second of minute [0:59]
+    Duration subsecond;  // [Seconds(0):Seconds(1)) if finite
+    int weekday;         // 1==Mon, ..., 7=Sun
+    int yearday;         // day of year [1:366]
+
+    // Note: The following fields exist for backward compatibility
+    // with older APIs.  Accessing these fields directly is a sign of
+    // imprudent logic in the calling code.  Modern time-related code
+    // should only access this data indirectly by way of FormatTime().
+    // These fields are undefined for InfiniteFuture() and InfinitePast().
+    int offset;             // seconds east of UTC
+    bool is_dst;            // is offset non-standard?
+    const char* zone_abbr;  // time-zone abbreviation (e.g., "PST")
+  };
+
+  // Time::In()
+  //
+  // Returns the breakdown of this instant in the given TimeZone.
+  //
+  // Deprecated. Use `absl::TimeZone::At(Time)`.
+  Breakdown In(TimeZone tz) const;
+
+  template <typename H>
+  friend H AbslHashValue(H h, Time t) {
+    return H::combine(std::move(h), t.rep_);
+  }
+
+ private:
+  friend constexpr Time time_internal::FromUnixDuration(Duration d);
+  friend constexpr Duration time_internal::ToUnixDuration(Time t);
+  friend constexpr bool operator<(Time lhs, Time rhs);
+  friend constexpr bool operator==(Time lhs, Time rhs);
+  friend Duration operator-(Time lhs, Time rhs);
+  friend constexpr Time UniversalEpoch();
+  friend constexpr Time InfiniteFuture();
+  friend constexpr Time InfinitePast();
+  constexpr explicit Time(Duration rep) : rep_(rep) {}
+  Duration rep_;
+};
+
+// Relational Operators
+constexpr bool operator<(Time lhs, Time rhs) { return lhs.rep_ < rhs.rep_; }
+constexpr bool operator>(Time lhs, Time rhs) { return rhs < lhs; }
+constexpr bool operator>=(Time lhs, Time rhs) { return !(lhs < rhs); }
+constexpr bool operator<=(Time lhs, Time rhs) { return !(rhs < lhs); }
+constexpr bool operator==(Time lhs, Time rhs) { return lhs.rep_ == rhs.rep_; }
+constexpr bool operator!=(Time lhs, Time rhs) { return !(lhs == rhs); }
+
+// Additive Operators
+inline Time operator+(Time lhs, Duration rhs) { return lhs += rhs; }
+inline Time operator+(Duration lhs, Time rhs) { return rhs += lhs; }
+inline Time operator-(Time lhs, Duration rhs) { return lhs -= rhs; }
+inline Duration operator-(Time lhs, Time rhs) { return lhs.rep_ - rhs.rep_; }
+
+// UnixEpoch()
+//
+// Returns the `absl::Time` representing "1970-01-01 00:00:00.0 +0000".
+constexpr Time UnixEpoch() { return Time(); }
+
+// UniversalEpoch()
+//
+// Returns the `absl::Time` representing "0001-01-01 00:00:00.0 +0000", the
+// epoch of the ICU Universal Time Scale.
+constexpr Time UniversalEpoch() {
+  // 719162 is the number of days from 0001-01-01 to 1970-01-01,
+  // assuming the Gregorian calendar.
+  return Time(time_internal::MakeDuration(-24 * 719162 * int64_t{3600}, 0U));
+}
+
+// InfiniteFuture()
+//
+// Returns an `absl::Time` that is infinitely far in the future.
+constexpr Time InfiniteFuture() {
+  return Time(
+      time_internal::MakeDuration((std::numeric_limits<int64_t>::max)(), ~0U));
+}
+
+// InfinitePast()
+//
+// Returns an `absl::Time` that is infinitely far in the past.
+constexpr Time InfinitePast() {
+  return Time(
+      time_internal::MakeDuration((std::numeric_limits<int64_t>::min)(), ~0U));
+}
+
+// FromUnixNanos()
+// FromUnixMicros()
+// FromUnixMillis()
+// FromUnixSeconds()
+// FromTimeT()
+// FromUDate()
+// FromUniversal()
+//
+// Creates an `absl::Time` from a variety of other representations.
+constexpr Time FromUnixNanos(int64_t ns);
+constexpr Time FromUnixMicros(int64_t us);
+constexpr Time FromUnixMillis(int64_t ms);
+constexpr Time FromUnixSeconds(int64_t s);
+constexpr Time FromTimeT(time_t t);
+Time FromUDate(double udate);
+Time FromUniversal(int64_t universal);
+
+// ToUnixNanos()
+// ToUnixMicros()
+// ToUnixMillis()
+// ToUnixSeconds()
+// ToTimeT()
+// ToUDate()
+// ToUniversal()
+//
+// Converts an `absl::Time` to a variety of other representations.  Note that
+// these operations round down toward negative infinity where necessary to
+// adjust to the resolution of the result type.  Beware of possible time_t
+// over/underflow in ToTime{T,val,spec}() on 32-bit platforms.
+int64_t ToUnixNanos(Time t);
+int64_t ToUnixMicros(Time t);
+int64_t ToUnixMillis(Time t);
+int64_t ToUnixSeconds(Time t);
+time_t ToTimeT(Time t);
+double ToUDate(Time t);
+int64_t ToUniversal(Time t);
+
+// DurationFromTimespec()
+// DurationFromTimeval()
+// ToTimespec()
+// ToTimeval()
+// TimeFromTimespec()
+// TimeFromTimeval()
+// ToTimespec()
+// ToTimeval()
+//
+// Some APIs use a timespec or a timeval as a Duration (e.g., nanosleep(2)
+// and select(2)), while others use them as a Time (e.g. clock_gettime(2)
+// and gettimeofday(2)), so conversion functions are provided for both cases.
+// The "to timespec/val" direction is easily handled via overloading, but
+// for "from timespec/val" the desired type is part of the function name.
+Duration DurationFromTimespec(timespec ts);
+Duration DurationFromTimeval(timeval tv);
+timespec ToTimespec(Duration d);
+timeval ToTimeval(Duration d);
+Time TimeFromTimespec(timespec ts);
+Time TimeFromTimeval(timeval tv);
+timespec ToTimespec(Time t);
+timeval ToTimeval(Time t);
+
+// FromChrono()
+//
+// Converts a std::chrono::system_clock::time_point to an absl::Time.
+//
+// Example:
+//
+//   auto tp = std::chrono::system_clock::from_time_t(123);
+//   absl::Time t = absl::FromChrono(tp);
+//   // t == absl::FromTimeT(123)
+Time FromChrono(const std::chrono::system_clock::time_point& tp);
+
+// ToChronoTime()
+//
+// Converts an absl::Time to a std::chrono::system_clock::time_point. If
+// overflow would occur, the returned value will saturate at the min/max time
+// point value instead.
+//
+// Example:
+//
+//   absl::Time t = absl::FromTimeT(123);
+//   auto tp = absl::ToChronoTime(t);
+//   // tp == std::chrono::system_clock::from_time_t(123);
+std::chrono::system_clock::time_point ToChronoTime(Time);
+
+// Support for flag values of type Time. Time flags must be specified in a
+// format that matches absl::RFC3339_full. For example:
+//
+//   --start_time=2016-01-02T03:04:05.678+08:00
+//
+// Note: A UTC offset (or 'Z' indicating a zero-offset from UTC) is required.
+//
+// Additionally, if you'd like to specify a time as a count of
+// seconds/milliseconds/etc from the Unix epoch, use an absl::Duration flag
+// and add that duration to absl::UnixEpoch() to get an absl::Time.
+bool AbslParseFlag(absl::string_view text, Time* t, std::string* error);
+std::string AbslUnparseFlag(Time t);
+ABSL_DEPRECATED("Use AbslParseFlag() instead.")
+bool ParseFlag(const std::string& text, Time* t, std::string* error);
+ABSL_DEPRECATED("Use AbslUnparseFlag() instead.")
+std::string UnparseFlag(Time t);
+
+// TimeZone
+//
+// The `absl::TimeZone` is an opaque, small, value-type class representing a
+// geo-political region within which particular rules are used for converting
+// between absolute and civil times (see https://git.io/v59Ly). `absl::TimeZone`
+// values are named using the TZ identifiers from the IANA Time Zone Database,
+// such as "America/Los_Angeles" or "Australia/Sydney". `absl::TimeZone` values
+// are created from factory functions such as `absl::LoadTimeZone()`. Note:
+// strings like "PST" and "EDT" are not valid TZ identifiers. Prefer to pass by
+// value rather than const reference.
+//
+// For more on the fundamental concepts of time zones, absolute times, and civil
+// times, see https://github.com/google/cctz#fundamental-concepts
+//
+// Examples:
+//
+//   absl::TimeZone utc = absl::UTCTimeZone();
+//   absl::TimeZone pst = absl::FixedTimeZone(-8 * 60 * 60);
+//   absl::TimeZone loc = absl::LocalTimeZone();
+//   absl::TimeZone lax;
+//   if (!absl::LoadTimeZone("America/Los_Angeles", &lax)) {
+//     // handle error case
+//   }
+//
+// See also:
+// - https://github.com/google/cctz
+// - https://www.iana.org/time-zones
+// - https://en.wikipedia.org/wiki/Zoneinfo
+class TimeZone {
+ public:
+  explicit TimeZone(time_internal::cctz::time_zone tz) : cz_(tz) {}
+  TimeZone() = default;  // UTC, but prefer UTCTimeZone() to be explicit.
+
+  // Copyable.
+  TimeZone(const TimeZone&) = default;
+  TimeZone& operator=(const TimeZone&) = default;
+
+  explicit operator time_internal::cctz::time_zone() const { return cz_; }
+
+  std::string name() const { return cz_.name(); }
+
+  // TimeZone::CivilInfo
+  //
+  // Information about the civil time corresponding to an absolute time.
+  // This struct is not intended to represent an instant in time. So, rather
+  // than passing a `TimeZone::CivilInfo` to a function, pass an `absl::Time`
+  // and an `absl::TimeZone`.
+  struct CivilInfo {
+    CivilSecond cs;
+    Duration subsecond;
+
+    // Note: The following fields exist for backward compatibility
+    // with older APIs.  Accessing these fields directly is a sign of
+    // imprudent logic in the calling code.  Modern time-related code
+    // should only access this data indirectly by way of FormatTime().
+    // These fields are undefined for InfiniteFuture() and InfinitePast().
+    int offset;             // seconds east of UTC
+    bool is_dst;            // is offset non-standard?
+    const char* zone_abbr;  // time-zone abbreviation (e.g., "PST")
+  };
+
+  // TimeZone::At(Time)
+  //
+  // Returns the civil time for this TimeZone at a certain `absl::Time`.
+  // If the input time is infinite, the output civil second will be set to
+  // CivilSecond::max() or min(), and the subsecond will be infinite.
+  //
+  // Example:
+  //
+  //   const auto epoch = lax.At(absl::UnixEpoch());
+  //   // epoch.cs == 1969-12-31 16:00:00
+  //   // epoch.subsecond == absl::ZeroDuration()
+  //   // epoch.offset == -28800
+  //   // epoch.is_dst == false
+  //   // epoch.abbr == "PST"
+  CivilInfo At(Time t) const;
+
+  // TimeZone::TimeInfo
+  //
+  // Information about the absolute times corresponding to a civil time.
+  // (Subseconds must be handled separately.)
+  //
+  // It is possible for a caller to pass a civil-time value that does
+  // not represent an actual or unique instant in time (due to a shift
+  // in UTC offset in the TimeZone, which results in a discontinuity in
+  // the civil-time components). For example, a daylight-saving-time
+  // transition skips or repeats civil times---in the United States,
+  // March 13, 2011 02:15 never occurred, while November 6, 2011 01:15
+  // occurred twice---so requests for such times are not well-defined.
+  // To account for these possibilities, `absl::TimeZone::TimeInfo` is
+  // richer than just a single `absl::Time`.
+  struct TimeInfo {
+    enum CivilKind {
+      UNIQUE,    // the civil time was singular (pre == trans == post)
+      SKIPPED,   // the civil time did not exist (pre >= trans > post)
+      REPEATED,  // the civil time was ambiguous (pre < trans <= post)
+    } kind;
+    Time pre;    // time calculated using the pre-transition offset
+    Time trans;  // when the civil-time discontinuity occurred
+    Time post;   // time calculated using the post-transition offset
+  };
+
+  // TimeZone::At(CivilSecond)
+  //
+  // Returns an `absl::TimeInfo` containing the absolute time(s) for this
+  // TimeZone at an `absl::CivilSecond`. When the civil time is skipped or
+  // repeated, returns times calculated using the pre-transition and post-
+  // transition UTC offsets, plus the transition time itself.
+  //
+  // Examples:
+  //
+  //   // A unique civil time
+  //   const auto jan01 = lax.At(absl::CivilSecond(2011, 1, 1, 0, 0, 0));
+  //   // jan01.kind == TimeZone::TimeInfo::UNIQUE
+  //   // jan01.pre    is 2011-01-01 00:00:00 -0800
+  //   // jan01.trans  is 2011-01-01 00:00:00 -0800
+  //   // jan01.post   is 2011-01-01 00:00:00 -0800
+  //
+  //   // A Spring DST transition, when there is a gap in civil time
+  //   const auto mar13 = lax.At(absl::CivilSecond(2011, 3, 13, 2, 15, 0));
+  //   // mar13.kind == TimeZone::TimeInfo::SKIPPED
+  //   // mar13.pre   is 2011-03-13 03:15:00 -0700
+  //   // mar13.trans is 2011-03-13 03:00:00 -0700
+  //   // mar13.post  is 2011-03-13 01:15:00 -0800
+  //
+  //   // A Fall DST transition, when civil times are repeated
+  //   const auto nov06 = lax.At(absl::CivilSecond(2011, 11, 6, 1, 15, 0));
+  //   // nov06.kind == TimeZone::TimeInfo::REPEATED
+  //   // nov06.pre   is 2011-11-06 01:15:00 -0700
+  //   // nov06.trans is 2011-11-06 01:00:00 -0800
+  //   // nov06.post  is 2011-11-06 01:15:00 -0800
+  TimeInfo At(CivilSecond ct) const;
+
+  // TimeZone::NextTransition()
+  // TimeZone::PrevTransition()
+  //
+  // Finds the time of the next/previous offset change in this time zone.
+  //
+  // By definition, `NextTransition(t, &trans)` returns false when `t` is
+  // `InfiniteFuture()`, and `PrevTransition(t, &trans)` returns false
+  // when `t` is `InfinitePast()`. If the zone has no transitions, the
+  // result will also be false no matter what the argument.
+  //
+  // Otherwise, when `t` is `InfinitePast()`, `NextTransition(t, &trans)`
+  // returns true and sets `trans` to the first recorded transition. Chains
+  // of calls to `NextTransition()/PrevTransition()` will eventually return
+  // false, but it is unspecified exactly when `NextTransition(t, &trans)`
+  // jumps to false, or what time is set by `PrevTransition(t, &trans)` for
+  // a very distant `t`.
+  //
+  // Note: Enumeration of time-zone transitions is for informational purposes
+  // only. Modern time-related code should not care about when offset changes
+  // occur.
+  //
+  // Example:
+  //   absl::TimeZone nyc;
+  //   if (!absl::LoadTimeZone("America/New_York", &nyc)) { ... }
+  //   const auto now = absl::Now();
+  //   auto t = absl::InfinitePast();
+  //   absl::TimeZone::CivilTransition trans;
+  //   while (t <= now && nyc.NextTransition(t, &trans)) {
+  //     // transition: trans.from -> trans.to
+  //     t = nyc.At(trans.to).trans;
+  //   }
+  struct CivilTransition {
+    CivilSecond from;  // the civil time we jump from
+    CivilSecond to;    // the civil time we jump to
+  };
+  bool NextTransition(Time t, CivilTransition* trans) const;
+  bool PrevTransition(Time t, CivilTransition* trans) const;
+
+  template <typename H>
+  friend H AbslHashValue(H h, TimeZone tz) {
+    return H::combine(std::move(h), tz.cz_);
+  }
+
+ private:
+  friend bool operator==(TimeZone a, TimeZone b) { return a.cz_ == b.cz_; }
+  friend bool operator!=(TimeZone a, TimeZone b) { return a.cz_ != b.cz_; }
+  friend std::ostream& operator<<(std::ostream& os, TimeZone tz) {
+    return os << tz.name();
+  }
+
+  time_internal::cctz::time_zone cz_;
+};
+
+// LoadTimeZone()
+//
+// Loads the named zone. May perform I/O on the initial load of the named
+// zone. If the name is invalid, or some other kind of error occurs, returns
+// `false` and `*tz` is set to the UTC time zone.
+inline bool LoadTimeZone(absl::string_view name, TimeZone* tz) {
+  if (name == "localtime") {
+    *tz = TimeZone(time_internal::cctz::local_time_zone());
+    return true;
+  }
+  time_internal::cctz::time_zone cz;
+  const bool b = time_internal::cctz::load_time_zone(std::string(name), &cz);
+  *tz = TimeZone(cz);
+  return b;
+}
+
+// FixedTimeZone()
+//
+// Returns a TimeZone that is a fixed offset (seconds east) from UTC.
+// Note: If the absolute value of the offset is greater than 24 hours
+// you'll get UTC (i.e., no offset) instead.
+inline TimeZone FixedTimeZone(int seconds) {
+  return TimeZone(
+      time_internal::cctz::fixed_time_zone(std::chrono::seconds(seconds)));
+}
+
+// UTCTimeZone()
+//
+// Convenience method returning the UTC time zone.
+inline TimeZone UTCTimeZone() {
+  return TimeZone(time_internal::cctz::utc_time_zone());
+}
+
+// LocalTimeZone()
+//
+// Convenience method returning the local time zone, or UTC if there is
+// no configured local zone.  Warning: Be wary of using LocalTimeZone(),
+// and particularly so in a server process, as the zone configured for the
+// local machine should be irrelevant.  Prefer an explicit zone name.
+inline TimeZone LocalTimeZone() {
+  return TimeZone(time_internal::cctz::local_time_zone());
+}
+
+// ToCivilSecond()
+// ToCivilMinute()
+// ToCivilHour()
+// ToCivilDay()
+// ToCivilMonth()
+// ToCivilYear()
+//
+// Helpers for TimeZone::At(Time) to return particularly aligned civil times.
+//
+// Example:
+//
+//   absl::Time t = ...;
+//   absl::TimeZone tz = ...;
+//   const auto cd = absl::ToCivilDay(t, tz);
+inline CivilSecond ToCivilSecond(Time t, TimeZone tz) {
+  return tz.At(t).cs;  // already a CivilSecond
+}
+inline CivilMinute ToCivilMinute(Time t, TimeZone tz) {
+  return CivilMinute(tz.At(t).cs);
+}
+inline CivilHour ToCivilHour(Time t, TimeZone tz) {
+  return CivilHour(tz.At(t).cs);
+}
+inline CivilDay ToCivilDay(Time t, TimeZone tz) {
+  return CivilDay(tz.At(t).cs);
+}
+inline CivilMonth ToCivilMonth(Time t, TimeZone tz) {
+  return CivilMonth(tz.At(t).cs);
+}
+inline CivilYear ToCivilYear(Time t, TimeZone tz) {
+  return CivilYear(tz.At(t).cs);
+}
+
+// FromCivil()
+//
+// Helper for TimeZone::At(CivilSecond) that provides "order-preserving
+// semantics." If the civil time maps to a unique time, that time is
+// returned. If the civil time is repeated in the given time zone, the
+// time using the pre-transition offset is returned. Otherwise, the
+// civil time is skipped in the given time zone, and the transition time
+// is returned. This means that for any two civil times, ct1 and ct2,
+// (ct1 < ct2) => (FromCivil(ct1) <= FromCivil(ct2)), the equal case
+// being when two non-existent civil times map to the same transition time.
+//
+// Note: Accepts civil times of any alignment.
+inline Time FromCivil(CivilSecond ct, TimeZone tz) {
+  const auto ti = tz.At(ct);
+  if (ti.kind == TimeZone::TimeInfo::SKIPPED) return ti.trans;
+  return ti.pre;
+}
+
+// TimeConversion
+//
+// An `absl::TimeConversion` represents the conversion of year, month, day,
+// hour, minute, and second values (i.e., a civil time), in a particular
+// `absl::TimeZone`, to a time instant (an absolute time), as returned by
+// `absl::ConvertDateTime()`. Legacy version of `absl::TimeZone::TimeInfo`.
+//
+// Deprecated. Use `absl::TimeZone::TimeInfo`.
+struct
+    TimeConversion {
+  Time pre;    // time calculated using the pre-transition offset
+  Time trans;  // when the civil-time discontinuity occurred
+  Time post;   // time calculated using the post-transition offset
+
+  enum Kind {
+    UNIQUE,    // the civil time was singular (pre == trans == post)
+    SKIPPED,   // the civil time did not exist
+    REPEATED,  // the civil time was ambiguous
+  };
+  Kind kind;
+
+  bool normalized;  // input values were outside their valid ranges
+};
+
+// ConvertDateTime()
+//
+// Legacy version of `absl::TimeZone::At(absl::CivilSecond)` that takes
+// the civil time as six, separate values (YMDHMS).
+//
+// The input month, day, hour, minute, and second values can be outside
+// of their valid ranges, in which case they will be "normalized" during
+// the conversion.
+//
+// Example:
+//
+//   // "October 32" normalizes to "November 1".
+//   absl::TimeConversion tc =
+//       absl::ConvertDateTime(2013, 10, 32, 8, 30, 0, lax);
+//   // tc.kind == TimeConversion::UNIQUE && tc.normalized == true
+//   // absl::ToCivilDay(tc.pre, tz).month() == 11
+//   // absl::ToCivilDay(tc.pre, tz).day() == 1
+//
+// Deprecated. Use `absl::TimeZone::At(CivilSecond)`.
+TimeConversion ConvertDateTime(int64_t year, int mon, int day, int hour,
+                               int min, int sec, TimeZone tz);
+
+// FromDateTime()
+//
+// A convenience wrapper for `absl::ConvertDateTime()` that simply returns
+// the "pre" `absl::Time`.  That is, the unique result, or the instant that
+// is correct using the pre-transition offset (as if the transition never
+// happened).
+//
+// Example:
+//
+//   absl::Time t = absl::FromDateTime(2017, 9, 26, 9, 30, 0, lax);
+//   // t = 2017-09-26 09:30:00 -0700
+//
+// Deprecated. Use `absl::FromCivil(CivilSecond, TimeZone)`. Note that the
+// behavior of `FromCivil()` differs from `FromDateTime()` for skipped civil
+// times. If you care about that see `absl::TimeZone::At(absl::CivilSecond)`.
+inline Time FromDateTime(int64_t year, int mon, int day, int hour,
+                         int min, int sec, TimeZone tz) {
+  return ConvertDateTime(year, mon, day, hour, min, sec, tz).pre;
+}
+
+// FromTM()
+//
+// Converts the `tm_year`, `tm_mon`, `tm_mday`, `tm_hour`, `tm_min`, and
+// `tm_sec` fields to an `absl::Time` using the given time zone. See ctime(3)
+// for a description of the expected values of the tm fields. If the indicated
+// time instant is not unique (see `absl::TimeZone::At(absl::CivilSecond)`
+// above), the `tm_isdst` field is consulted to select the desired instant
+// (`tm_isdst` > 0 means DST, `tm_isdst` == 0 means no DST, `tm_isdst` < 0
+// means use the post-transition offset).
+Time FromTM(const struct tm& tm, TimeZone tz);
+
+// ToTM()
+//
+// Converts the given `absl::Time` to a struct tm using the given time zone.
+// See ctime(3) for a description of the values of the tm fields.
+struct tm ToTM(Time t, TimeZone tz);
+
+// RFC3339_full
+// RFC3339_sec
+//
+// FormatTime()/ParseTime() format specifiers for RFC3339 date/time strings,
+// with trailing zeros trimmed or with fractional seconds omitted altogether.
+//
+// Note that RFC3339_sec[] matches an ISO 8601 extended format for date and
+// time with UTC offset.  Also note the use of "%Y": RFC3339 mandates that
+// years have exactly four digits, but we allow them to take their natural
+// width.
+ABSL_DLL extern const char
+    RFC3339_full[];  // %Y-%m-%dT%H:%M:%E*S%Ez
+ABSL_DLL extern const char RFC3339_sec[];  // %Y-%m-%dT%H:%M:%S%Ez
+
+// RFC1123_full
+// RFC1123_no_wday
+//
+// FormatTime()/ParseTime() format specifiers for RFC1123 date/time strings.
+ABSL_DLL extern const char
+    RFC1123_full[];  // %a, %d %b %E4Y %H:%M:%S %z
+ABSL_DLL extern const char
+    RFC1123_no_wday[];  // %d %b %E4Y %H:%M:%S %z
+
+// FormatTime()
+//
+// Formats the given `absl::Time` in the `absl::TimeZone` according to the
+// provided format string. Uses strftime()-like formatting options, with
+// the following extensions:
+//
+//   - %Ez  - RFC3339-compatible numeric UTC offset (+hh:mm or -hh:mm)
+//   - %E*z - Full-resolution numeric UTC offset (+hh:mm:ss or -hh:mm:ss)
+//   - %E#S - Seconds with # digits of fractional precision
+//   - %E*S - Seconds with full fractional precision (a literal '*')
+//   - %E#f - Fractional seconds with # digits of precision
+//   - %E*f - Fractional seconds with full precision (a literal '*')
+//   - %E4Y - Four-character years (-999 ... -001, 0000, 0001 ... 9999)
+//
+// Note that %E0S behaves like %S, and %E0f produces no characters.  In
+// contrast %E*f always produces at least one digit, which may be '0'.
+//
+// Note that %Y produces as many characters as it takes to fully render the
+// year.  A year outside of [-999:9999] when formatted with %E4Y will produce
+// more than four characters, just like %Y.
+//
+// We recommend that format strings include the UTC offset (%z, %Ez, or %E*z)
+// so that the result uniquely identifies a time instant.
+//
+// Example:
+//
+//   absl::CivilSecond cs(2013, 1, 2, 3, 4, 5);
+//   absl::Time t = absl::FromCivil(cs, lax);
+//   std::string f = absl::FormatTime("%H:%M:%S", t, lax);  // "03:04:05"
+//   f = absl::FormatTime("%H:%M:%E3S", t, lax);  // "03:04:05.000"
+//
+// Note: If the given `absl::Time` is `absl::InfiniteFuture()`, the returned
+// string will be exactly "infinite-future". If the given `absl::Time` is
+// `absl::InfinitePast()`, the returned string will be exactly "infinite-past".
+// In both cases the given format string and `absl::TimeZone` are ignored.
+//
+std::string FormatTime(absl::string_view format, Time t, TimeZone tz);
+
+// Convenience functions that format the given time using the RFC3339_full
+// format.  The first overload uses the provided TimeZone, while the second
+// uses LocalTimeZone().
+std::string FormatTime(Time t, TimeZone tz);
+std::string FormatTime(Time t);
+
+// Output stream operator.
+inline std::ostream& operator<<(std::ostream& os, Time t) {
+  return os << FormatTime(t);
+}
+
+// ParseTime()
+//
+// Parses an input string according to the provided format string and
+// returns the corresponding `absl::Time`. Uses strftime()-like formatting
+// options, with the same extensions as FormatTime(), but with the
+// exceptions that %E#S is interpreted as %E*S, and %E#f as %E*f.  %Ez
+// and %E*z also accept the same inputs.
+//
+// %Y consumes as many numeric characters as it can, so the matching data
+// should always be terminated with a non-numeric.  %E4Y always consumes
+// exactly four characters, including any sign.
+//
+// Unspecified fields are taken from the default date and time of ...
+//
+//   "1970-01-01 00:00:00.0 +0000"
+//
+// For example, parsing a string of "15:45" (%H:%M) will return an absl::Time
+// that represents "1970-01-01 15:45:00.0 +0000".
+//
+// Note that since ParseTime() returns time instants, it makes the most sense
+// to parse fully-specified date/time strings that include a UTC offset (%z,
+// %Ez, or %E*z).
+//
+// Note also that `absl::ParseTime()` only heeds the fields year, month, day,
+// hour, minute, (fractional) second, and UTC offset.  Other fields, like
+// weekday (%a or %A), while parsed for syntactic validity, are ignored
+// in the conversion.
+//
+// Date and time fields that are out-of-range will be treated as errors
+// rather than normalizing them like `absl::CivilSecond` does.  For example,
+// it is an error to parse the date "Oct 32, 2013" because 32 is out of range.
+//
+// A leap second of ":60" is normalized to ":00" of the following minute
+// with fractional seconds discarded.  The following table shows how the
+// given seconds and subseconds will be parsed:
+//
+//   "59.x" -> 59.x  // exact
+//   "60.x" -> 00.0  // normalized
+//   "00.x" -> 00.x  // exact
+//
+// Errors are indicated by returning false and assigning an error message
+// to the "err" out param if it is non-null.
+//
+// Note: If the input string is exactly "infinite-future", the returned
+// `absl::Time` will be `absl::InfiniteFuture()` and `true` will be returned.
+// If the input string is "infinite-past", the returned `absl::Time` will be
+// `absl::InfinitePast()` and `true` will be returned.
+//
+bool ParseTime(absl::string_view format, absl::string_view input, Time* time,
+               std::string* err);
+
+// Like ParseTime() above, but if the format string does not contain a UTC
+// offset specification (%z/%Ez/%E*z) then the input is interpreted in the
+// given TimeZone.  This means that the input, by itself, does not identify a
+// unique instant.  Being time-zone dependent, it also admits the possibility
+// of ambiguity or non-existence, in which case the "pre" time (as defined
+// by TimeZone::TimeInfo) is returned.  For these reasons we recommend that
+// all date/time strings include a UTC offset so they're context independent.
+bool ParseTime(absl::string_view format, absl::string_view input, TimeZone tz,
+               Time* time, std::string* err);
+
+// ============================================================================
+// Implementation Details Follow
+// ============================================================================
+
+namespace time_internal {
+
+// Creates a Duration with a given representation.
+// REQUIRES: hi,lo is a valid representation of a Duration as specified
+// in time/duration.cc.
+constexpr Duration MakeDuration(int64_t hi, uint32_t lo = 0) {
+  return Duration(hi, lo);
+}
+
+constexpr Duration MakeDuration(int64_t hi, int64_t lo) {
+  return MakeDuration(hi, static_cast<uint32_t>(lo));
+}
+
+// Make a Duration value from a floating-point number, as long as that number
+// is in the range [ 0 .. numeric_limits<int64_t>::max ), that is, as long as
+// it's positive and can be converted to int64_t without risk of UB.
+inline Duration MakePosDoubleDuration(double n) {
+  const int64_t int_secs = static_cast<int64_t>(n);
+  const uint32_t ticks = static_cast<uint32_t>(
+      (n - static_cast<double>(int_secs)) * kTicksPerSecond + 0.5);
+  return ticks < kTicksPerSecond
+             ? MakeDuration(int_secs, ticks)
+             : MakeDuration(int_secs + 1, ticks - kTicksPerSecond);
+}
+
+// Creates a normalized Duration from an almost-normalized (sec,ticks)
+// pair. sec may be positive or negative.  ticks must be in the range
+// -kTicksPerSecond < *ticks < kTicksPerSecond.  If ticks is negative it
+// will be normalized to a positive value in the resulting Duration.
+constexpr Duration MakeNormalizedDuration(int64_t sec, int64_t ticks) {
+  return (ticks < 0) ? MakeDuration(sec - 1, ticks + kTicksPerSecond)
+                     : MakeDuration(sec, ticks);
+}
+
+// Provide access to the Duration representation.
+constexpr int64_t GetRepHi(Duration d) { return d.rep_hi_; }
+constexpr uint32_t GetRepLo(Duration d) { return d.rep_lo_; }
+
+// Returns true iff d is positive or negative infinity.
+constexpr bool IsInfiniteDuration(Duration d) { return GetRepLo(d) == ~0U; }
+
+// Returns an infinite Duration with the opposite sign.
+// REQUIRES: IsInfiniteDuration(d)
+constexpr Duration OppositeInfinity(Duration d) {
+  return GetRepHi(d) < 0
+             ? MakeDuration((std::numeric_limits<int64_t>::max)(), ~0U)
+             : MakeDuration((std::numeric_limits<int64_t>::min)(), ~0U);
+}
+
+// Returns (-n)-1 (equivalently -(n+1)) without avoidable overflow.
+constexpr int64_t NegateAndSubtractOne(int64_t n) {
+  // Note: Good compilers will optimize this expression to ~n when using
+  // a two's-complement representation (which is required for int64_t).
+  return (n < 0) ? -(n + 1) : (-n) - 1;
+}
+
+// Map between a Time and a Duration since the Unix epoch.  Note that these
+// functions depend on the above mentioned choice of the Unix epoch for the
+// Time representation (and both need to be Time friends).  Without this
+// knowledge, we would need to add-in/subtract-out UnixEpoch() respectively.
+constexpr Time FromUnixDuration(Duration d) { return Time(d); }
+constexpr Duration ToUnixDuration(Time t) { return t.rep_; }
+
+template <std::intmax_t N>
+constexpr Duration FromInt64(int64_t v, std::ratio<1, N>) {
+  static_assert(0 < N && N <= 1000 * 1000 * 1000, "Unsupported ratio");
+  // Subsecond ratios cannot overflow.
+  return MakeNormalizedDuration(
+      v / N, v % N * kTicksPerNanosecond * 1000 * 1000 * 1000 / N);
+}
+constexpr Duration FromInt64(int64_t v, std::ratio<60>) {
+  return (v <= (std::numeric_limits<int64_t>::max)() / 60 &&
+          v >= (std::numeric_limits<int64_t>::min)() / 60)
+             ? MakeDuration(v * 60)
+             : v > 0 ? InfiniteDuration() : -InfiniteDuration();
+}
+constexpr Duration FromInt64(int64_t v, std::ratio<3600>) {
+  return (v <= (std::numeric_limits<int64_t>::max)() / 3600 &&
+          v >= (std::numeric_limits<int64_t>::min)() / 3600)
+             ? MakeDuration(v * 3600)
+             : v > 0 ? InfiniteDuration() : -InfiniteDuration();
+}
+
+// IsValidRep64<T>(0) is true if the expression `int64_t{std::declval<T>()}` is
+// valid. That is, if a T can be assigned to an int64_t without narrowing.
+template <typename T>
+constexpr auto IsValidRep64(int) -> decltype(int64_t{std::declval<T>()} == 0) {
+  return true;
+}
+template <typename T>
+constexpr auto IsValidRep64(char) -> bool {
+  return false;
+}
+
+// Converts a std::chrono::duration to an absl::Duration.
+template <typename Rep, typename Period>
+constexpr Duration FromChrono(const std::chrono::duration<Rep, Period>& d) {
+  static_assert(IsValidRep64<Rep>(0), "duration::rep is invalid");
+  return FromInt64(int64_t{d.count()}, Period{});
+}
+
+template <typename Ratio>
+int64_t ToInt64(Duration d, Ratio) {
+  // Note: This may be used on MSVC, which may have a system_clock period of
+  // std::ratio<1, 10 * 1000 * 1000>
+  return ToInt64Seconds(d * Ratio::den / Ratio::num);
+}
+// Fastpath implementations for the 6 common duration units.
+inline int64_t ToInt64(Duration d, std::nano) {
+  return ToInt64Nanoseconds(d);
+}
+inline int64_t ToInt64(Duration d, std::micro) {
+  return ToInt64Microseconds(d);
+}
+inline int64_t ToInt64(Duration d, std::milli) {
+  return ToInt64Milliseconds(d);
+}
+inline int64_t ToInt64(Duration d, std::ratio<1>) {
+  return ToInt64Seconds(d);
+}
+inline int64_t ToInt64(Duration d, std::ratio<60>) {
+  return ToInt64Minutes(d);
+}
+inline int64_t ToInt64(Duration d, std::ratio<3600>) {
+  return ToInt64Hours(d);
+}
+
+// Converts an absl::Duration to a chrono duration of type T.
+template <typename T>
+T ToChronoDuration(Duration d) {
+  using Rep = typename T::rep;
+  using Period = typename T::period;
+  static_assert(IsValidRep64<Rep>(0), "duration::rep is invalid");
+  if (time_internal::IsInfiniteDuration(d))
+    return d < ZeroDuration() ? (T::min)() : (T::max)();
+  const auto v = ToInt64(d, Period{});
+  if (v > (std::numeric_limits<Rep>::max)()) return (T::max)();
+  if (v < (std::numeric_limits<Rep>::min)()) return (T::min)();
+  return T{v};
+}
+
+}  // namespace time_internal
+
+constexpr Duration Nanoseconds(int64_t n) {
+  return time_internal::FromInt64(n, std::nano{});
+}
+constexpr Duration Microseconds(int64_t n) {
+  return time_internal::FromInt64(n, std::micro{});
+}
+constexpr Duration Milliseconds(int64_t n) {
+  return time_internal::FromInt64(n, std::milli{});
+}
+constexpr Duration Seconds(int64_t n) {
+  return time_internal::FromInt64(n, std::ratio<1>{});
+}
+constexpr Duration Minutes(int64_t n) {
+  return time_internal::FromInt64(n, std::ratio<60>{});
+}
+constexpr Duration Hours(int64_t n) {
+  return time_internal::FromInt64(n, std::ratio<3600>{});
+}
+
+constexpr bool operator<(Duration lhs, Duration rhs) {
+  return time_internal::GetRepHi(lhs) != time_internal::GetRepHi(rhs)
+             ? time_internal::GetRepHi(lhs) < time_internal::GetRepHi(rhs)
+             : time_internal::GetRepHi(lhs) ==
+                       (std::numeric_limits<int64_t>::min)()
+                   ? time_internal::GetRepLo(lhs) + 1 <
+                         time_internal::GetRepLo(rhs) + 1
+                   : time_internal::GetRepLo(lhs) <
+                         time_internal::GetRepLo(rhs);
+}
+
+constexpr bool operator==(Duration lhs, Duration rhs) {
+  return time_internal::GetRepHi(lhs) == time_internal::GetRepHi(rhs) &&
+         time_internal::GetRepLo(lhs) == time_internal::GetRepLo(rhs);
+}
+
+constexpr Duration operator-(Duration d) {
+  // This is a little interesting because of the special cases.
+  //
+  // If rep_lo_ is zero, we have it easy; it's safe to negate rep_hi_, we're
+  // dealing with an integral number of seconds, and the only special case is
+  // the maximum negative finite duration, which can't be negated.
+  //
+  // Infinities stay infinite, and just change direction.
+  //
+  // Finally we're in the case where rep_lo_ is non-zero, and we can borrow
+  // a second's worth of ticks and avoid overflow (as negating int64_t-min + 1
+  // is safe).
+  return time_internal::GetRepLo(d) == 0
+             ? time_internal::GetRepHi(d) ==
+                       (std::numeric_limits<int64_t>::min)()
+                   ? InfiniteDuration()
+                   : time_internal::MakeDuration(-time_internal::GetRepHi(d))
+             : time_internal::IsInfiniteDuration(d)
+                   ? time_internal::OppositeInfinity(d)
+                   : time_internal::MakeDuration(
+                         time_internal::NegateAndSubtractOne(
+                             time_internal::GetRepHi(d)),
+                         time_internal::kTicksPerSecond -
+                             time_internal::GetRepLo(d));
+}
+
+constexpr Duration InfiniteDuration() {
+  return time_internal::MakeDuration((std::numeric_limits<int64_t>::max)(),
+                                     ~0U);
+}
+
+constexpr Duration FromChrono(const std::chrono::nanoseconds& d) {
+  return time_internal::FromChrono(d);
+}
+constexpr Duration FromChrono(const std::chrono::microseconds& d) {
+  return time_internal::FromChrono(d);
+}
+constexpr Duration FromChrono(const std::chrono::milliseconds& d) {
+  return time_internal::FromChrono(d);
+}
+constexpr Duration FromChrono(const std::chrono::seconds& d) {
+  return time_internal::FromChrono(d);
+}
+constexpr Duration FromChrono(const std::chrono::minutes& d) {
+  return time_internal::FromChrono(d);
+}
+constexpr Duration FromChrono(const std::chrono::hours& d) {
+  return time_internal::FromChrono(d);
+}
+
+constexpr Time FromUnixNanos(int64_t ns) {
+  return time_internal::FromUnixDuration(Nanoseconds(ns));
+}
+
+constexpr Time FromUnixMicros(int64_t us) {
+  return time_internal::FromUnixDuration(Microseconds(us));
+}
+
+constexpr Time FromUnixMillis(int64_t ms) {
+  return time_internal::FromUnixDuration(Milliseconds(ms));
+}
+
+constexpr Time FromUnixSeconds(int64_t s) {
+  return time_internal::FromUnixDuration(Seconds(s));
+}
+
+constexpr Time FromTimeT(time_t t) {
+  return time_internal::FromUnixDuration(Seconds(t));
+}
+
+ABSL_NAMESPACE_END
+}  // namespace absl
+
+#endif  // ABSL_TIME_TIME_H_
diff --git a/third_party/abseil_cpp/absl/time/time_benchmark.cc b/third_party/abseil_cpp/absl/time/time_benchmark.cc
new file mode 100644
index 0000000000..99e6279984
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/time_benchmark.cc
@@ -0,0 +1,316 @@
+// Copyright 2018 The Abseil Authors.
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/time/time.h"
+
+#if !defined(_WIN32)
+#include <sys/time.h>
+#endif  // _WIN32
+#include <algorithm>
+#include <cmath>
+#include <cstddef>
+#include <cstring>
+#include <ctime>
+#include <memory>
+#include <string>
+
+#include "absl/time/clock.h"
+#include "absl/time/internal/test_util.h"
+#include "benchmark/benchmark.h"
+
+namespace {
+
+//
+// Addition/Subtraction of a duration
+//
+
+void BM_Time_Arithmetic(benchmark::State& state) {
+  const absl::Duration nano = absl::Nanoseconds(1);
+  const absl::Duration sec = absl::Seconds(1);
+  absl::Time t = absl::UnixEpoch();
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(t += nano);
+    benchmark::DoNotOptimize(t -= sec);
+  }
+}
+BENCHMARK(BM_Time_Arithmetic);
+
+//
+// Time difference
+//
+
+void BM_Time_Difference(benchmark::State& state) {
+  absl::Time start = absl::Now();
+  absl::Time end = start + absl::Nanoseconds(1);
+  absl::Duration diff;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(diff += end - start);
+  }
+}
+BENCHMARK(BM_Time_Difference);
+
+//
+// ToDateTime
+//
+// In each "ToDateTime" benchmark we switch between two instants
+// separated by at least one transition in order to defeat any
+// internal caching of previous results (e.g., see local_time_hint_).
+//
+// The "UTC" variants use UTC instead of the Google/local time zone.
+//
+
+void BM_Time_ToDateTime_Absl(benchmark::State& state) {
+  const absl::TimeZone tz =
+      absl::time_internal::LoadTimeZone("America/Los_Angeles");
+  absl::Time t = absl::FromUnixSeconds(1384569027);
+  absl::Time t2 = absl::FromUnixSeconds(1418962578);
+  while (state.KeepRunning()) {
+    std::swap(t, t2);
+    t += absl::Seconds(1);
+    benchmark::DoNotOptimize(t.In(tz));
+  }
+}
+BENCHMARK(BM_Time_ToDateTime_Absl);
+
+void BM_Time_ToDateTime_Libc(benchmark::State& state) {
+  // No timezone support, so just use localtime.
+  time_t t = 1384569027;
+  time_t t2 = 1418962578;
+  while (state.KeepRunning()) {
+    std::swap(t, t2);
+    t += 1;
+    struct tm tm;
+#if !defined(_WIN32)
+    benchmark::DoNotOptimize(localtime_r(&t, &tm));
+#else   // _WIN32
+    benchmark::DoNotOptimize(localtime_s(&tm, &t));
+#endif  // _WIN32
+  }
+}
+BENCHMARK(BM_Time_ToDateTime_Libc);
+
+void BM_Time_ToDateTimeUTC_Absl(benchmark::State& state) {
+  const absl::TimeZone tz = absl::UTCTimeZone();
+  absl::Time t = absl::FromUnixSeconds(1384569027);
+  while (state.KeepRunning()) {
+    t += absl::Seconds(1);
+    benchmark::DoNotOptimize(t.In(tz));
+  }
+}
+BENCHMARK(BM_Time_ToDateTimeUTC_Absl);
+
+void BM_Time_ToDateTimeUTC_Libc(benchmark::State& state) {
+  time_t t = 1384569027;
+  while (state.KeepRunning()) {
+    t += 1;
+    struct tm tm;
+#if !defined(_WIN32)
+    benchmark::DoNotOptimize(gmtime_r(&t, &tm));
+#else   // _WIN32
+    benchmark::DoNotOptimize(gmtime_s(&tm, &t));
+#endif  // _WIN32
+  }
+}
+BENCHMARK(BM_Time_ToDateTimeUTC_Libc);
+
+//
+// FromUnixMicros
+//
+
+void BM_Time_FromUnixMicros(benchmark::State& state) {
+  int i = 0;
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::FromUnixMicros(i));
+    ++i;
+  }
+}
+BENCHMARK(BM_Time_FromUnixMicros);
+
+void BM_Time_ToUnixNanos(benchmark::State& state) {
+  const absl::Time t = absl::UnixEpoch() + absl::Seconds(123);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(ToUnixNanos(t));
+  }
+}
+BENCHMARK(BM_Time_ToUnixNanos);
+
+void BM_Time_ToUnixMicros(benchmark::State& state) {
+  const absl::Time t = absl::UnixEpoch() + absl::Seconds(123);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(ToUnixMicros(t));
+  }
+}
+BENCHMARK(BM_Time_ToUnixMicros);
+
+void BM_Time_ToUnixMillis(benchmark::State& state) {
+  const absl::Time t = absl::UnixEpoch() + absl::Seconds(123);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(ToUnixMillis(t));
+  }
+}
+BENCHMARK(BM_Time_ToUnixMillis);
+
+void BM_Time_ToUnixSeconds(benchmark::State& state) {
+  const absl::Time t = absl::UnixEpoch() + absl::Seconds(123);
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::ToUnixSeconds(t));
+  }
+}
+BENCHMARK(BM_Time_ToUnixSeconds);
+
+//
+// FromCivil
+//
+// In each "FromCivil" benchmark we switch between two YMDhms values
+// separated by at least one transition in order to defeat any internal
+// caching of previous results (e.g., see time_local_hint_).
+//
+// The "UTC" variants use UTC instead of the Google/local time zone.
+// The "Day0" variants require normalization of the day of month.
+//
+
+void BM_Time_FromCivil_Absl(benchmark::State& state) {
+  const absl::TimeZone tz =
+      absl::time_internal::LoadTimeZone("America/Los_Angeles");
+  int i = 0;
+  while (state.KeepRunning()) {
+    if ((i & 1) == 0) {
+      absl::FromCivil(absl::CivilSecond(2014, 12, 18, 20, 16, 18), tz);
+    } else {
+      absl::FromCivil(absl::CivilSecond(2013, 11, 15, 18, 30, 27), tz);
+    }
+    ++i;
+  }
+}
+BENCHMARK(BM_Time_FromCivil_Absl);
+
+void BM_Time_FromCivil_Libc(benchmark::State& state) {
+  // No timezone support, so just use localtime.
+  int i = 0;
+  while (state.KeepRunning()) {
+    struct tm tm;
+    if ((i & 1) == 0) {
+      tm.tm_year = 2014 - 1900;
+      tm.tm_mon = 12 - 1;
+      tm.tm_mday = 18;
+      tm.tm_hour = 20;
+      tm.tm_min = 16;
+      tm.tm_sec = 18;
+    } else {
+      tm.tm_year = 2013 - 1900;
+      tm.tm_mon = 11 - 1;
+      tm.tm_mday = 15;
+      tm.tm_hour = 18;
+      tm.tm_min = 30;
+      tm.tm_sec = 27;
+    }
+    tm.tm_isdst = -1;
+    mktime(&tm);
+    ++i;
+  }
+}
+BENCHMARK(BM_Time_FromCivil_Libc);
+
+void BM_Time_FromCivilUTC_Absl(benchmark::State& state) {
+  const absl::TimeZone tz = absl::UTCTimeZone();
+  while (state.KeepRunning()) {
+    absl::FromCivil(absl::CivilSecond(2014, 12, 18, 20, 16, 18), tz);
+  }
+}
+BENCHMARK(BM_Time_FromCivilUTC_Absl);
+
+void BM_Time_FromCivilDay0_Absl(benchmark::State& state) {
+  const absl::TimeZone tz =
+      absl::time_internal::LoadTimeZone("America/Los_Angeles");
+  int i = 0;
+  while (state.KeepRunning()) {
+    if ((i & 1) == 0) {
+      absl::FromCivil(absl::CivilSecond(2014, 12, 0, 20, 16, 18), tz);
+    } else {
+      absl::FromCivil(absl::CivilSecond(2013, 11, 0, 18, 30, 27), tz);
+    }
+    ++i;
+  }
+}
+BENCHMARK(BM_Time_FromCivilDay0_Absl);
+
+void BM_Time_FromCivilDay0_Libc(benchmark::State& state) {
+  // No timezone support, so just use localtime.
+  int i = 0;
+  while (state.KeepRunning()) {
+    struct tm tm;
+    if ((i & 1) == 0) {
+      tm.tm_year = 2014 - 1900;
+      tm.tm_mon = 12 - 1;
+      tm.tm_mday = 0;
+      tm.tm_hour = 20;
+      tm.tm_min = 16;
+      tm.tm_sec = 18;
+    } else {
+      tm.tm_year = 2013 - 1900;
+      tm.tm_mon = 11 - 1;
+      tm.tm_mday = 0;
+      tm.tm_hour = 18;
+      tm.tm_min = 30;
+      tm.tm_sec = 27;
+    }
+    tm.tm_isdst = -1;
+    mktime(&tm);
+    ++i;
+  }
+}
+BENCHMARK(BM_Time_FromCivilDay0_Libc);
+
+//
+// To/FromTimespec
+//
+
+void BM_Time_ToTimespec(benchmark::State& state) {
+  absl::Time now = absl::Now();
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::ToTimespec(now));
+  }
+}
+BENCHMARK(BM_Time_ToTimespec);
+
+void BM_Time_FromTimespec(benchmark::State& state) {
+  timespec ts = absl::ToTimespec(absl::Now());
+  while (state.KeepRunning()) {
+    if (++ts.tv_nsec == 1000 * 1000 * 1000) {
+      ++ts.tv_sec;
+      ts.tv_nsec = 0;
+    }
+    benchmark::DoNotOptimize(absl::TimeFromTimespec(ts));
+  }
+}
+BENCHMARK(BM_Time_FromTimespec);
+
+//
+// Comparison with InfiniteFuture/Past
+//
+
+void BM_Time_InfiniteFuture(benchmark::State& state) {
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::InfiniteFuture());
+  }
+}
+BENCHMARK(BM_Time_InfiniteFuture);
+
+void BM_Time_InfinitePast(benchmark::State& state) {
+  while (state.KeepRunning()) {
+    benchmark::DoNotOptimize(absl::InfinitePast());
+  }
+}
+BENCHMARK(BM_Time_InfinitePast);
+
+}  // namespace
diff --git a/third_party/abseil_cpp/absl/time/time_test.cc b/third_party/abseil_cpp/absl/time/time_test.cc
new file mode 100644
index 0000000000..6f89672c66
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/time_test.cc
@@ -0,0 +1,1274 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/time/time.h"
+
+#if defined(_MSC_VER)
+#include <winsock2.h>  // for timeval
+#endif
+
+#include <chrono>  // NOLINT(build/c++11)
+#include <cstring>
+#include <ctime>
+#include <iomanip>
+#include <limits>
+#include <string>
+
+#include "gmock/gmock.h"
+#include "gtest/gtest.h"
+#include "absl/numeric/int128.h"
+#include "absl/time/clock.h"
+#include "absl/time/internal/test_util.h"
+
+namespace {
+
+#if defined(GTEST_USES_SIMPLE_RE) && GTEST_USES_SIMPLE_RE
+const char kZoneAbbrRE[] = ".*";  // just punt
+#else
+const char kZoneAbbrRE[] = "[A-Za-z]{3,4}|[-+][0-9]{2}([0-9]{2})?";
+#endif
+
+// This helper is a macro so that failed expectations show up with the
+// correct line numbers.
+#define EXPECT_CIVIL_INFO(ci, y, m, d, h, min, s, off, isdst)      \
+  do {                                                             \
+    EXPECT_EQ(y, ci.cs.year());                                    \
+    EXPECT_EQ(m, ci.cs.month());                                   \
+    EXPECT_EQ(d, ci.cs.day());                                     \
+    EXPECT_EQ(h, ci.cs.hour());                                    \
+    EXPECT_EQ(min, ci.cs.minute());                                \
+    EXPECT_EQ(s, ci.cs.second());                                  \
+    EXPECT_EQ(off, ci.offset);                                     \
+    EXPECT_EQ(isdst, ci.is_dst);                                   \
+    EXPECT_THAT(ci.zone_abbr, testing::MatchesRegex(kZoneAbbrRE)); \
+  } while (0)
+
+// A gMock matcher to match timespec values. Use this matcher like:
+// timespec ts1, ts2;
+// EXPECT_THAT(ts1, TimespecMatcher(ts2));
+MATCHER_P(TimespecMatcher, ts, "") {
+  if (ts.tv_sec == arg.tv_sec && ts.tv_nsec == arg.tv_nsec)
+    return true;
+  *result_listener << "expected: {" << ts.tv_sec << ", " << ts.tv_nsec << "} ";
+  *result_listener << "actual: {" << arg.tv_sec << ", " << arg.tv_nsec << "}";
+  return false;
+}
+
+// A gMock matcher to match timeval values. Use this matcher like:
+// timeval tv1, tv2;
+// EXPECT_THAT(tv1, TimevalMatcher(tv2));
+MATCHER_P(TimevalMatcher, tv, "") {
+  if (tv.tv_sec == arg.tv_sec && tv.tv_usec == arg.tv_usec)
+    return true;
+  *result_listener << "expected: {" << tv.tv_sec << ", " << tv.tv_usec << "} ";
+  *result_listener << "actual: {" << arg.tv_sec << ", " << arg.tv_usec << "}";
+  return false;
+}
+
+TEST(Time, ConstExpr) {
+  constexpr absl::Time t0 = absl::UnixEpoch();
+  static_assert(t0 == absl::Time(), "UnixEpoch");
+  constexpr absl::Time t1 = absl::InfiniteFuture();
+  static_assert(t1 != absl::Time(), "InfiniteFuture");
+  constexpr absl::Time t2 = absl::InfinitePast();
+  static_assert(t2 != absl::Time(), "InfinitePast");
+  constexpr absl::Time t3 = absl::FromUnixNanos(0);
+  static_assert(t3 == absl::Time(), "FromUnixNanos");
+  constexpr absl::Time t4 = absl::FromUnixMicros(0);
+  static_assert(t4 == absl::Time(), "FromUnixMicros");
+  constexpr absl::Time t5 = absl::FromUnixMillis(0);
+  static_assert(t5 == absl::Time(), "FromUnixMillis");
+  constexpr absl::Time t6 = absl::FromUnixSeconds(0);
+  static_assert(t6 == absl::Time(), "FromUnixSeconds");
+  constexpr absl::Time t7 = absl::FromTimeT(0);
+  static_assert(t7 == absl::Time(), "FromTimeT");
+}
+
+TEST(Time, ValueSemantics) {
+  absl::Time a;      // Default construction
+  absl::Time b = a;  // Copy construction
+  EXPECT_EQ(a, b);
+  absl::Time c(a);  // Copy construction (again)
+  EXPECT_EQ(a, b);
+  EXPECT_EQ(a, c);
+  EXPECT_EQ(b, c);
+  b = c;       // Assignment
+  EXPECT_EQ(a, b);
+  EXPECT_EQ(a, c);
+  EXPECT_EQ(b, c);
+}
+
+TEST(Time, UnixEpoch) {
+  const auto ci = absl::UTCTimeZone().At(absl::UnixEpoch());
+  EXPECT_EQ(absl::CivilSecond(1970, 1, 1, 0, 0, 0), ci.cs);
+  EXPECT_EQ(absl::ZeroDuration(), ci.subsecond);
+  EXPECT_EQ(absl::Weekday::thursday, absl::GetWeekday(ci.cs));
+}
+
+TEST(Time, Breakdown) {
+  absl::TimeZone tz = absl::time_internal::LoadTimeZone("America/New_York");
+  absl::Time t = absl::UnixEpoch();
+
+  // The Unix epoch as seen in NYC.
+  auto ci = tz.At(t);
+  EXPECT_CIVIL_INFO(ci, 1969, 12, 31, 19, 0, 0, -18000, false);
+  EXPECT_EQ(absl::ZeroDuration(), ci.subsecond);
+  EXPECT_EQ(absl::Weekday::wednesday, absl::GetWeekday(ci.cs));
+
+  // Just before the epoch.
+  t -= absl::Nanoseconds(1);
+  ci = tz.At(t);
+  EXPECT_CIVIL_INFO(ci, 1969, 12, 31, 18, 59, 59, -18000, false);
+  EXPECT_EQ(absl::Nanoseconds(999999999), ci.subsecond);
+  EXPECT_EQ(absl::Weekday::wednesday, absl::GetWeekday(ci.cs));
+
+  // Some time later.
+  t += absl::Hours(24) * 2735;
+  t += absl::Hours(18) + absl::Minutes(30) + absl::Seconds(15) +
+       absl::Nanoseconds(9);
+  ci = tz.At(t);
+  EXPECT_CIVIL_INFO(ci, 1977, 6, 28, 14, 30, 15, -14400, true);
+  EXPECT_EQ(8, ci.subsecond / absl::Nanoseconds(1));
+  EXPECT_EQ(absl::Weekday::tuesday, absl::GetWeekday(ci.cs));
+}
+
+TEST(Time, AdditiveOperators) {
+  const absl::Duration d = absl::Nanoseconds(1);
+  const absl::Time t0;
+  const absl::Time t1 = t0 + d;
+
+  EXPECT_EQ(d, t1 - t0);
+  EXPECT_EQ(-d, t0 - t1);
+  EXPECT_EQ(t0, t1 - d);
+
+  absl::Time t(t0);
+  EXPECT_EQ(t0, t);
+  t += d;
+  EXPECT_EQ(t0 + d, t);
+  EXPECT_EQ(d, t - t0);
+  t -= d;
+  EXPECT_EQ(t0, t);
+
+  // Tests overflow between subseconds and seconds.
+  t = absl::UnixEpoch();
+  t += absl::Milliseconds(500);
+  EXPECT_EQ(absl::UnixEpoch() + absl::Milliseconds(500), t);
+  t += absl::Milliseconds(600);
+  EXPECT_EQ(absl::UnixEpoch() + absl::Milliseconds(1100), t);
+  t -= absl::Milliseconds(600);
+  EXPECT_EQ(absl::UnixEpoch() + absl::Milliseconds(500), t);
+  t -= absl::Milliseconds(500);
+  EXPECT_EQ(absl::UnixEpoch(), t);
+}
+
+TEST(Time, RelationalOperators) {
+  constexpr absl::Time t1 = absl::FromUnixNanos(0);
+  constexpr absl::Time t2 = absl::FromUnixNanos(1);
+  constexpr absl::Time t3 = absl::FromUnixNanos(2);
+
+  static_assert(absl::Time() == t1, "");
+  static_assert(t1 == t1, "");
+  static_assert(t2 == t2, "");
+  static_assert(t3 == t3, "");
+
+  static_assert(t1 < t2, "");
+  static_assert(t2 < t3, "");
+  static_assert(t1 < t3, "");
+
+  static_assert(t1 <= t1, "");
+  static_assert(t1 <= t2, "");
+  static_assert(t2 <= t2, "");
+  static_assert(t2 <= t3, "");
+  static_assert(t3 <= t3, "");
+  static_assert(t1 <= t3, "");
+
+  static_assert(t2 > t1, "");
+  static_assert(t3 > t2, "");
+  static_assert(t3 > t1, "");
+
+  static_assert(t2 >= t2, "");
+  static_assert(t2 >= t1, "");
+  static_assert(t3 >= t3, "");
+  static_assert(t3 >= t2, "");
+  static_assert(t1 >= t1, "");
+  static_assert(t3 >= t1, "");
+}
+
+TEST(Time, Infinity) {
+  constexpr absl::Time ifuture = absl::InfiniteFuture();
+  constexpr absl::Time ipast = absl::InfinitePast();
+
+  static_assert(ifuture == ifuture, "");
+  static_assert(ipast == ipast, "");
+  static_assert(ipast < ifuture, "");
+  static_assert(ifuture > ipast, "");
+
+  // Arithmetic saturates
+  EXPECT_EQ(ifuture, ifuture + absl::Seconds(1));
+  EXPECT_EQ(ifuture, ifuture - absl::Seconds(1));
+  EXPECT_EQ(ipast, ipast + absl::Seconds(1));
+  EXPECT_EQ(ipast, ipast - absl::Seconds(1));
+
+  EXPECT_EQ(absl::InfiniteDuration(), ifuture - ifuture);
+  EXPECT_EQ(absl::InfiniteDuration(), ifuture - ipast);
+  EXPECT_EQ(-absl::InfiniteDuration(), ipast - ifuture);
+  EXPECT_EQ(-absl::InfiniteDuration(), ipast - ipast);
+
+  constexpr absl::Time t = absl::UnixEpoch();  // Any finite time.
+  static_assert(t < ifuture, "");
+  static_assert(t > ipast, "");
+}
+
+TEST(Time, FloorConversion) {
+#define TEST_FLOOR_CONVERSION(TO, FROM) \
+  EXPECT_EQ(1, TO(FROM(1001)));         \
+  EXPECT_EQ(1, TO(FROM(1000)));         \
+  EXPECT_EQ(0, TO(FROM(999)));          \
+  EXPECT_EQ(0, TO(FROM(1)));            \
+  EXPECT_EQ(0, TO(FROM(0)));            \
+  EXPECT_EQ(-1, TO(FROM(-1)));          \
+  EXPECT_EQ(-1, TO(FROM(-999)));        \
+  EXPECT_EQ(-1, TO(FROM(-1000)));       \
+  EXPECT_EQ(-2, TO(FROM(-1001)));
+
+  TEST_FLOOR_CONVERSION(absl::ToUnixMicros, absl::FromUnixNanos);
+  TEST_FLOOR_CONVERSION(absl::ToUnixMillis, absl::FromUnixMicros);
+  TEST_FLOOR_CONVERSION(absl::ToUnixSeconds, absl::FromUnixMillis);
+  TEST_FLOOR_CONVERSION(absl::ToTimeT, absl::FromUnixMillis);
+
+#undef TEST_FLOOR_CONVERSION
+
+  // Tests ToUnixNanos.
+  EXPECT_EQ(1, absl::ToUnixNanos(absl::UnixEpoch() + absl::Nanoseconds(3) / 2));
+  EXPECT_EQ(1, absl::ToUnixNanos(absl::UnixEpoch() + absl::Nanoseconds(1)));
+  EXPECT_EQ(0, absl::ToUnixNanos(absl::UnixEpoch() + absl::Nanoseconds(1) / 2));
+  EXPECT_EQ(0, absl::ToUnixNanos(absl::UnixEpoch() + absl::Nanoseconds(0)));
+  EXPECT_EQ(-1,
+            absl::ToUnixNanos(absl::UnixEpoch() - absl::Nanoseconds(1) / 2));
+  EXPECT_EQ(-1, absl::ToUnixNanos(absl::UnixEpoch() - absl::Nanoseconds(1)));
+  EXPECT_EQ(-2,
+            absl::ToUnixNanos(absl::UnixEpoch() - absl::Nanoseconds(3) / 2));
+
+  // Tests ToUniversal, which uses a different epoch than the tests above.
+  EXPECT_EQ(1,
+            absl::ToUniversal(absl::UniversalEpoch() + absl::Nanoseconds(101)));
+  EXPECT_EQ(1,
+            absl::ToUniversal(absl::UniversalEpoch() + absl::Nanoseconds(100)));
+  EXPECT_EQ(0,
+            absl::ToUniversal(absl::UniversalEpoch() + absl::Nanoseconds(99)));
+  EXPECT_EQ(0,
+            absl::ToUniversal(absl::UniversalEpoch() + absl::Nanoseconds(1)));
+  EXPECT_EQ(0,
+            absl::ToUniversal(absl::UniversalEpoch() + absl::Nanoseconds(0)));
+  EXPECT_EQ(-1,
+            absl::ToUniversal(absl::UniversalEpoch() + absl::Nanoseconds(-1)));
+  EXPECT_EQ(-1,
+            absl::ToUniversal(absl::UniversalEpoch() + absl::Nanoseconds(-99)));
+  EXPECT_EQ(
+      -1, absl::ToUniversal(absl::UniversalEpoch() + absl::Nanoseconds(-100)));
+  EXPECT_EQ(
+      -2, absl::ToUniversal(absl::UniversalEpoch() + absl::Nanoseconds(-101)));
+
+  // Tests ToTimespec()/TimeFromTimespec()
+  const struct {
+    absl::Time t;
+    timespec ts;
+  } to_ts[] = {
+      {absl::FromUnixSeconds(1) + absl::Nanoseconds(1), {1, 1}},
+      {absl::FromUnixSeconds(1) + absl::Nanoseconds(1) / 2, {1, 0}},
+      {absl::FromUnixSeconds(1) + absl::Nanoseconds(0), {1, 0}},
+      {absl::FromUnixSeconds(0) + absl::Nanoseconds(0), {0, 0}},
+      {absl::FromUnixSeconds(0) - absl::Nanoseconds(1) / 2, {-1, 999999999}},
+      {absl::FromUnixSeconds(0) - absl::Nanoseconds(1), {-1, 999999999}},
+      {absl::FromUnixSeconds(-1) + absl::Nanoseconds(1), {-1, 1}},
+      {absl::FromUnixSeconds(-1) + absl::Nanoseconds(1) / 2, {-1, 0}},
+      {absl::FromUnixSeconds(-1) + absl::Nanoseconds(0), {-1, 0}},
+      {absl::FromUnixSeconds(-1) - absl::Nanoseconds(1) / 2, {-2, 999999999}},
+  };
+  for (const auto& test : to_ts) {
+    EXPECT_THAT(absl::ToTimespec(test.t), TimespecMatcher(test.ts));
+  }
+  const struct {
+    timespec ts;
+    absl::Time t;
+  } from_ts[] = {
+      {{1, 1}, absl::FromUnixSeconds(1) + absl::Nanoseconds(1)},
+      {{1, 0}, absl::FromUnixSeconds(1) + absl::Nanoseconds(0)},
+      {{0, 0}, absl::FromUnixSeconds(0) + absl::Nanoseconds(0)},
+      {{0, -1}, absl::FromUnixSeconds(0) - absl::Nanoseconds(1)},
+      {{-1, 999999999}, absl::FromUnixSeconds(0) - absl::Nanoseconds(1)},
+      {{-1, 1}, absl::FromUnixSeconds(-1) + absl::Nanoseconds(1)},
+      {{-1, 0}, absl::FromUnixSeconds(-1) + absl::Nanoseconds(0)},
+      {{-1, -1}, absl::FromUnixSeconds(-1) - absl::Nanoseconds(1)},
+      {{-2, 999999999}, absl::FromUnixSeconds(-1) - absl::Nanoseconds(1)},
+  };
+  for (const auto& test : from_ts) {
+    EXPECT_EQ(test.t, absl::TimeFromTimespec(test.ts));
+  }
+
+  // Tests ToTimeval()/TimeFromTimeval() (same as timespec above)
+  const struct {
+    absl::Time t;
+    timeval tv;
+  } to_tv[] = {
+      {absl::FromUnixSeconds(1) + absl::Microseconds(1), {1, 1}},
+      {absl::FromUnixSeconds(1) + absl::Microseconds(1) / 2, {1, 0}},
+      {absl::FromUnixSeconds(1) + absl::Microseconds(0), {1, 0}},
+      {absl::FromUnixSeconds(0) + absl::Microseconds(0), {0, 0}},
+      {absl::FromUnixSeconds(0) - absl::Microseconds(1) / 2, {-1, 999999}},
+      {absl::FromUnixSeconds(0) - absl::Microseconds(1), {-1, 999999}},
+      {absl::FromUnixSeconds(-1) + absl::Microseconds(1), {-1, 1}},
+      {absl::FromUnixSeconds(-1) + absl::Microseconds(1) / 2, {-1, 0}},
+      {absl::FromUnixSeconds(-1) + absl::Microseconds(0), {-1, 0}},
+      {absl::FromUnixSeconds(-1) - absl::Microseconds(1) / 2, {-2, 999999}},
+  };
+  for (const auto& test : to_tv) {
+    EXPECT_THAT(ToTimeval(test.t), TimevalMatcher(test.tv));
+  }
+  const struct {
+    timeval tv;
+    absl::Time t;
+  } from_tv[] = {
+      {{1, 1}, absl::FromUnixSeconds(1) + absl::Microseconds(1)},
+      {{1, 0}, absl::FromUnixSeconds(1) + absl::Microseconds(0)},
+      {{0, 0}, absl::FromUnixSeconds(0) + absl::Microseconds(0)},
+      {{0, -1}, absl::FromUnixSeconds(0) - absl::Microseconds(1)},
+      {{-1, 999999}, absl::FromUnixSeconds(0) - absl::Microseconds(1)},
+      {{-1, 1}, absl::FromUnixSeconds(-1) + absl::Microseconds(1)},
+      {{-1, 0}, absl::FromUnixSeconds(-1) + absl::Microseconds(0)},
+      {{-1, -1}, absl::FromUnixSeconds(-1) - absl::Microseconds(1)},
+      {{-2, 999999}, absl::FromUnixSeconds(-1) - absl::Microseconds(1)},
+  };
+  for (const auto& test : from_tv) {
+    EXPECT_EQ(test.t, absl::TimeFromTimeval(test.tv));
+  }
+
+  // Tests flooring near negative infinity.
+  const int64_t min_plus_1 = std::numeric_limits<int64_t>::min() + 1;
+  EXPECT_EQ(min_plus_1, absl::ToUnixSeconds(absl::FromUnixSeconds(min_plus_1)));
+  EXPECT_EQ(std::numeric_limits<int64_t>::min(),
+            absl::ToUnixSeconds(
+                absl::FromUnixSeconds(min_plus_1) - absl::Nanoseconds(1) / 2));
+
+  // Tests flooring near positive infinity.
+  EXPECT_EQ(std::numeric_limits<int64_t>::max(),
+            absl::ToUnixSeconds(absl::FromUnixSeconds(
+                std::numeric_limits<int64_t>::max()) + absl::Nanoseconds(1) / 2));
+  EXPECT_EQ(std::numeric_limits<int64_t>::max(),
+            absl::ToUnixSeconds(
+                absl::FromUnixSeconds(std::numeric_limits<int64_t>::max())));
+  EXPECT_EQ(std::numeric_limits<int64_t>::max() - 1,
+            absl::ToUnixSeconds(absl::FromUnixSeconds(
+                std::numeric_limits<int64_t>::max()) - absl::Nanoseconds(1) / 2));
+}
+
+TEST(Time, RoundtripConversion) {
+#define TEST_CONVERSION_ROUND_TRIP(SOURCE, FROM, TO, MATCHER) \
+  EXPECT_THAT(TO(FROM(SOURCE)), MATCHER(SOURCE))
+
+  // FromUnixNanos() and ToUnixNanos()
+  int64_t now_ns = absl::GetCurrentTimeNanos();
+  TEST_CONVERSION_ROUND_TRIP(-1, absl::FromUnixNanos, absl::ToUnixNanos,
+                             testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(0, absl::FromUnixNanos, absl::ToUnixNanos,
+                             testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(1, absl::FromUnixNanos, absl::ToUnixNanos,
+                             testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(now_ns, absl::FromUnixNanos, absl::ToUnixNanos,
+                             testing::Eq)
+      << now_ns;
+
+  // FromUnixMicros() and ToUnixMicros()
+  int64_t now_us = absl::GetCurrentTimeNanos() / 1000;
+  TEST_CONVERSION_ROUND_TRIP(-1, absl::FromUnixMicros, absl::ToUnixMicros,
+                             testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(0, absl::FromUnixMicros, absl::ToUnixMicros,
+                             testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(1, absl::FromUnixMicros, absl::ToUnixMicros,
+                             testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(now_us, absl::FromUnixMicros, absl::ToUnixMicros,
+                             testing::Eq)
+      << now_us;
+
+  // FromUnixMillis() and ToUnixMillis()
+  int64_t now_ms = absl::GetCurrentTimeNanos() / 1000000;
+  TEST_CONVERSION_ROUND_TRIP(-1, absl::FromUnixMillis, absl::ToUnixMillis,
+                             testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(0, absl::FromUnixMillis, absl::ToUnixMillis,
+                             testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(1, absl::FromUnixMillis, absl::ToUnixMillis,
+                             testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(now_ms, absl::FromUnixMillis, absl::ToUnixMillis,
+                             testing::Eq)
+      << now_ms;
+
+  // FromUnixSeconds() and ToUnixSeconds()
+  int64_t now_s = std::time(nullptr);
+  TEST_CONVERSION_ROUND_TRIP(-1, absl::FromUnixSeconds, absl::ToUnixSeconds,
+                             testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(0, absl::FromUnixSeconds, absl::ToUnixSeconds,
+                             testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(1, absl::FromUnixSeconds, absl::ToUnixSeconds,
+                             testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(now_s, absl::FromUnixSeconds, absl::ToUnixSeconds,
+                             testing::Eq)
+      << now_s;
+
+  // FromTimeT() and ToTimeT()
+  time_t now_time_t = std::time(nullptr);
+  TEST_CONVERSION_ROUND_TRIP(-1, absl::FromTimeT, absl::ToTimeT, testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(0, absl::FromTimeT, absl::ToTimeT, testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(1, absl::FromTimeT, absl::ToTimeT, testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(now_time_t, absl::FromTimeT, absl::ToTimeT,
+                             testing::Eq)
+      << now_time_t;
+
+  // TimeFromTimeval() and ToTimeval()
+  timeval tv;
+  tv.tv_sec = -1;
+  tv.tv_usec = 0;
+  TEST_CONVERSION_ROUND_TRIP(tv, absl::TimeFromTimeval, absl::ToTimeval,
+                             TimevalMatcher);
+  tv.tv_sec = -1;
+  tv.tv_usec = 999999;
+  TEST_CONVERSION_ROUND_TRIP(tv, absl::TimeFromTimeval, absl::ToTimeval,
+                             TimevalMatcher);
+  tv.tv_sec = 0;
+  tv.tv_usec = 0;
+  TEST_CONVERSION_ROUND_TRIP(tv, absl::TimeFromTimeval, absl::ToTimeval,
+                             TimevalMatcher);
+  tv.tv_sec = 0;
+  tv.tv_usec = 1;
+  TEST_CONVERSION_ROUND_TRIP(tv, absl::TimeFromTimeval, absl::ToTimeval,
+                             TimevalMatcher);
+  tv.tv_sec = 1;
+  tv.tv_usec = 0;
+  TEST_CONVERSION_ROUND_TRIP(tv, absl::TimeFromTimeval, absl::ToTimeval,
+                             TimevalMatcher);
+
+  // TimeFromTimespec() and ToTimespec()
+  timespec ts;
+  ts.tv_sec = -1;
+  ts.tv_nsec = 0;
+  TEST_CONVERSION_ROUND_TRIP(ts, absl::TimeFromTimespec, absl::ToTimespec,
+                             TimespecMatcher);
+  ts.tv_sec = -1;
+  ts.tv_nsec = 999999999;
+  TEST_CONVERSION_ROUND_TRIP(ts, absl::TimeFromTimespec, absl::ToTimespec,
+                             TimespecMatcher);
+  ts.tv_sec = 0;
+  ts.tv_nsec = 0;
+  TEST_CONVERSION_ROUND_TRIP(ts, absl::TimeFromTimespec, absl::ToTimespec,
+                             TimespecMatcher);
+  ts.tv_sec = 0;
+  ts.tv_nsec = 1;
+  TEST_CONVERSION_ROUND_TRIP(ts, absl::TimeFromTimespec, absl::ToTimespec,
+                             TimespecMatcher);
+  ts.tv_sec = 1;
+  ts.tv_nsec = 0;
+  TEST_CONVERSION_ROUND_TRIP(ts, absl::TimeFromTimespec, absl::ToTimespec,
+                             TimespecMatcher);
+
+  // FromUDate() and ToUDate()
+  double now_ud = absl::GetCurrentTimeNanos() / 1000000;
+  TEST_CONVERSION_ROUND_TRIP(-1.5, absl::FromUDate, absl::ToUDate,
+                             testing::DoubleEq);
+  TEST_CONVERSION_ROUND_TRIP(-1, absl::FromUDate, absl::ToUDate,
+                             testing::DoubleEq);
+  TEST_CONVERSION_ROUND_TRIP(-0.5, absl::FromUDate, absl::ToUDate,
+                             testing::DoubleEq);
+  TEST_CONVERSION_ROUND_TRIP(0, absl::FromUDate, absl::ToUDate,
+                             testing::DoubleEq);
+  TEST_CONVERSION_ROUND_TRIP(0.5, absl::FromUDate, absl::ToUDate,
+                             testing::DoubleEq);
+  TEST_CONVERSION_ROUND_TRIP(1, absl::FromUDate, absl::ToUDate,
+                             testing::DoubleEq);
+  TEST_CONVERSION_ROUND_TRIP(1.5, absl::FromUDate, absl::ToUDate,
+                             testing::DoubleEq);
+  TEST_CONVERSION_ROUND_TRIP(now_ud, absl::FromUDate, absl::ToUDate,
+                             testing::DoubleEq)
+      << std::fixed << std::setprecision(17) << now_ud;
+
+  // FromUniversal() and ToUniversal()
+  int64_t now_uni = ((719162LL * (24 * 60 * 60)) * (1000 * 1000 * 10)) +
+                    (absl::GetCurrentTimeNanos() / 100);
+  TEST_CONVERSION_ROUND_TRIP(-1, absl::FromUniversal, absl::ToUniversal,
+                             testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(0, absl::FromUniversal, absl::ToUniversal,
+                             testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(1, absl::FromUniversal, absl::ToUniversal,
+                             testing::Eq);
+  TEST_CONVERSION_ROUND_TRIP(now_uni, absl::FromUniversal, absl::ToUniversal,
+                             testing::Eq)
+      << now_uni;
+
+#undef TEST_CONVERSION_ROUND_TRIP
+}
+
+template <typename Duration>
+std::chrono::system_clock::time_point MakeChronoUnixTime(const Duration& d) {
+  return std::chrono::system_clock::from_time_t(0) + d;
+}
+
+TEST(Time, FromChrono) {
+  EXPECT_EQ(absl::FromTimeT(-1),
+            absl::FromChrono(std::chrono::system_clock::from_time_t(-1)));
+  EXPECT_EQ(absl::FromTimeT(0),
+            absl::FromChrono(std::chrono::system_clock::from_time_t(0)));
+  EXPECT_EQ(absl::FromTimeT(1),
+            absl::FromChrono(std::chrono::system_clock::from_time_t(1)));
+
+  EXPECT_EQ(
+      absl::FromUnixMillis(-1),
+      absl::FromChrono(MakeChronoUnixTime(std::chrono::milliseconds(-1))));
+  EXPECT_EQ(absl::FromUnixMillis(0),
+            absl::FromChrono(MakeChronoUnixTime(std::chrono::milliseconds(0))));
+  EXPECT_EQ(absl::FromUnixMillis(1),
+            absl::FromChrono(MakeChronoUnixTime(std::chrono::milliseconds(1))));
+
+  // Chrono doesn't define exactly its range and precision (neither does
+  // absl::Time), so let's simply test +/- ~100 years to make sure things work.
+  const auto century_sec = 60 * 60 * 24 * 365 * int64_t{100};
+  const auto century = std::chrono::seconds(century_sec);
+  const auto chrono_future = MakeChronoUnixTime(century);
+  const auto chrono_past = MakeChronoUnixTime(-century);
+  EXPECT_EQ(absl::FromUnixSeconds(century_sec),
+            absl::FromChrono(chrono_future));
+  EXPECT_EQ(absl::FromUnixSeconds(-century_sec), absl::FromChrono(chrono_past));
+
+  // Roundtrip them both back to chrono.
+  EXPECT_EQ(chrono_future,
+            absl::ToChronoTime(absl::FromUnixSeconds(century_sec)));
+  EXPECT_EQ(chrono_past,
+            absl::ToChronoTime(absl::FromUnixSeconds(-century_sec)));
+}
+
+TEST(Time, ToChronoTime) {
+  EXPECT_EQ(std::chrono::system_clock::from_time_t(-1),
+            absl::ToChronoTime(absl::FromTimeT(-1)));
+  EXPECT_EQ(std::chrono::system_clock::from_time_t(0),
+            absl::ToChronoTime(absl::FromTimeT(0)));
+  EXPECT_EQ(std::chrono::system_clock::from_time_t(1),
+            absl::ToChronoTime(absl::FromTimeT(1)));
+
+  EXPECT_EQ(MakeChronoUnixTime(std::chrono::milliseconds(-1)),
+            absl::ToChronoTime(absl::FromUnixMillis(-1)));
+  EXPECT_EQ(MakeChronoUnixTime(std::chrono::milliseconds(0)),
+            absl::ToChronoTime(absl::FromUnixMillis(0)));
+  EXPECT_EQ(MakeChronoUnixTime(std::chrono::milliseconds(1)),
+            absl::ToChronoTime(absl::FromUnixMillis(1)));
+
+  // Time before the Unix epoch should floor, not trunc.
+  const auto tick = absl::Nanoseconds(1) / 4;
+  EXPECT_EQ(std::chrono::system_clock::from_time_t(0) -
+                std::chrono::system_clock::duration(1),
+            absl::ToChronoTime(absl::UnixEpoch() - tick));
+}
+
+// Check that absl::int128 works as a std::chrono::duration representation.
+TEST(Time, Chrono128) {
+  // Define a std::chrono::time_point type whose time[sic]_since_epoch() is
+  // a signed 128-bit count of attoseconds. This has a range and resolution
+  // (currently) beyond those of absl::Time, and undoubtedly also beyond those
+  // of std::chrono::system_clock::time_point.
+  //
+  // Note: The to/from-chrono support should probably be updated to handle
+  // such wide representations.
+  using Timestamp =
+      std::chrono::time_point<std::chrono::system_clock,
+                              std::chrono::duration<absl::int128, std::atto>>;
+
+  // Expect that we can round-trip the std::chrono::system_clock::time_point
+  // extremes through both absl::Time and Timestamp, and that Timestamp can
+  // handle the (current) absl::Time extremes.
+  //
+  // Note: We should use std::chrono::floor() instead of time_point_cast(),
+  // but floor() is only available since c++17.
+  for (const auto tp : {std::chrono::system_clock::time_point::min(),
+                        std::chrono::system_clock::time_point::max()}) {
+    EXPECT_EQ(tp, absl::ToChronoTime(absl::FromChrono(tp)));
+    EXPECT_EQ(tp, std::chrono::time_point_cast<
+                      std::chrono::system_clock::time_point::duration>(
+                      std::chrono::time_point_cast<Timestamp::duration>(tp)));
+  }
+  Timestamp::duration::rep v = std::numeric_limits<int64_t>::min();
+  v *= Timestamp::duration::period::den;
+  auto ts = Timestamp(Timestamp::duration(v));
+  ts += std::chrono::duration<int64_t, std::atto>(0);
+  EXPECT_EQ(std::numeric_limits<int64_t>::min(),
+            ts.time_since_epoch().count() / Timestamp::duration::period::den);
+  EXPECT_EQ(0,
+            ts.time_since_epoch().count() % Timestamp::duration::period::den);
+  v = std::numeric_limits<int64_t>::max();
+  v *= Timestamp::duration::period::den;
+  ts = Timestamp(Timestamp::duration(v));
+  ts += std::chrono::duration<int64_t, std::atto>(999999999750000000);
+  EXPECT_EQ(std::numeric_limits<int64_t>::max(),
+            ts.time_since_epoch().count() / Timestamp::duration::period::den);
+  EXPECT_EQ(999999999750000000,
+            ts.time_since_epoch().count() % Timestamp::duration::period::den);
+}
+
+TEST(Time, TimeZoneAt) {
+  const absl::TimeZone nyc =
+      absl::time_internal::LoadTimeZone("America/New_York");
+  const std::string fmt = "%a, %e %b %Y %H:%M:%S %z (%Z)";
+
+  // A non-transition where the civil time is unique.
+  absl::CivilSecond nov01(2013, 11, 1, 8, 30, 0);
+  const auto nov01_ci = nyc.At(nov01);
+  EXPECT_EQ(absl::TimeZone::TimeInfo::UNIQUE, nov01_ci.kind);
+  EXPECT_EQ("Fri,  1 Nov 2013 08:30:00 -0400 (EDT)",
+            absl::FormatTime(fmt, nov01_ci.pre, nyc));
+  EXPECT_EQ(nov01_ci.pre, nov01_ci.trans);
+  EXPECT_EQ(nov01_ci.pre, nov01_ci.post);
+  EXPECT_EQ(nov01_ci.pre, absl::FromCivil(nov01, nyc));
+
+  // A Spring DST transition, when there is a gap in civil time
+  // and we prefer the later of the possible interpretations of a
+  // non-existent time.
+  absl::CivilSecond mar13(2011, 3, 13, 2, 15, 0);
+  const auto mar_ci = nyc.At(mar13);
+  EXPECT_EQ(absl::TimeZone::TimeInfo::SKIPPED, mar_ci.kind);
+  EXPECT_EQ("Sun, 13 Mar 2011 03:15:00 -0400 (EDT)",
+            absl::FormatTime(fmt, mar_ci.pre, nyc));
+  EXPECT_EQ("Sun, 13 Mar 2011 03:00:00 -0400 (EDT)",
+            absl::FormatTime(fmt, mar_ci.trans, nyc));
+  EXPECT_EQ("Sun, 13 Mar 2011 01:15:00 -0500 (EST)",
+            absl::FormatTime(fmt, mar_ci.post, nyc));
+  EXPECT_EQ(mar_ci.trans, absl::FromCivil(mar13, nyc));
+
+  // A Fall DST transition, when civil times are repeated and
+  // we prefer the earlier of the possible interpretations of an
+  // ambiguous time.
+  absl::CivilSecond nov06(2011, 11, 6, 1, 15, 0);
+  const auto nov06_ci = nyc.At(nov06);
+  EXPECT_EQ(absl::TimeZone::TimeInfo::REPEATED, nov06_ci.kind);
+  EXPECT_EQ("Sun,  6 Nov 2011 01:15:00 -0400 (EDT)",
+            absl::FormatTime(fmt, nov06_ci.pre, nyc));
+  EXPECT_EQ("Sun,  6 Nov 2011 01:00:00 -0500 (EST)",
+            absl::FormatTime(fmt, nov06_ci.trans, nyc));
+  EXPECT_EQ("Sun,  6 Nov 2011 01:15:00 -0500 (EST)",
+            absl::FormatTime(fmt, nov06_ci.post, nyc));
+  EXPECT_EQ(nov06_ci.pre, absl::FromCivil(nov06, nyc));
+
+  // Check that (time_t) -1 is handled correctly.
+  absl::CivilSecond minus1(1969, 12, 31, 18, 59, 59);
+  const auto minus1_cl = nyc.At(minus1);
+  EXPECT_EQ(absl::TimeZone::TimeInfo::UNIQUE, minus1_cl.kind);
+  EXPECT_EQ(-1, absl::ToTimeT(minus1_cl.pre));
+  EXPECT_EQ("Wed, 31 Dec 1969 18:59:59 -0500 (EST)",
+            absl::FormatTime(fmt, minus1_cl.pre, nyc));
+  EXPECT_EQ("Wed, 31 Dec 1969 23:59:59 +0000 (UTC)",
+            absl::FormatTime(fmt, minus1_cl.pre, absl::UTCTimeZone()));
+}
+
+// FromCivil(CivilSecond(year, mon, day, hour, min, sec), UTCTimeZone())
+// has a specialized fastpath implementation, which we exercise here.
+TEST(Time, FromCivilUTC) {
+  const absl::TimeZone utc = absl::UTCTimeZone();
+  const std::string fmt = "%a, %e %b %Y %H:%M:%S %z (%Z)";
+  const int kMax = std::numeric_limits<int>::max();
+  const int kMin = std::numeric_limits<int>::min();
+  absl::Time t;
+
+  // 292091940881 is the last positive year to use the fastpath.
+  t = absl::FromCivil(
+      absl::CivilSecond(292091940881, kMax, kMax, kMax, kMax, kMax), utc);
+  EXPECT_EQ("Fri, 25 Nov 292277026596 12:21:07 +0000 (UTC)",
+            absl::FormatTime(fmt, t, utc));
+  t = absl::FromCivil(
+      absl::CivilSecond(292091940882, kMax, kMax, kMax, kMax, kMax), utc);
+  EXPECT_EQ("infinite-future", absl::FormatTime(fmt, t, utc));  // no overflow
+
+  // -292091936940 is the last negative year to use the fastpath.
+  t = absl::FromCivil(
+      absl::CivilSecond(-292091936940, kMin, kMin, kMin, kMin, kMin), utc);
+  EXPECT_EQ("Fri,  1 Nov -292277022657 10:37:52 +0000 (UTC)",
+            absl::FormatTime(fmt, t, utc));
+  t = absl::FromCivil(
+      absl::CivilSecond(-292091936941, kMin, kMin, kMin, kMin, kMin), utc);
+  EXPECT_EQ("infinite-past", absl::FormatTime(fmt, t, utc));  // no underflow
+
+  // Check that we're counting leap years correctly.
+  t = absl::FromCivil(absl::CivilSecond(1900, 2, 28, 23, 59, 59), utc);
+  EXPECT_EQ("Wed, 28 Feb 1900 23:59:59 +0000 (UTC)",
+            absl::FormatTime(fmt, t, utc));
+  t = absl::FromCivil(absl::CivilSecond(1900, 3, 1, 0, 0, 0), utc);
+  EXPECT_EQ("Thu,  1 Mar 1900 00:00:00 +0000 (UTC)",
+            absl::FormatTime(fmt, t, utc));
+  t = absl::FromCivil(absl::CivilSecond(2000, 2, 29, 23, 59, 59), utc);
+  EXPECT_EQ("Tue, 29 Feb 2000 23:59:59 +0000 (UTC)",
+            absl::FormatTime(fmt, t, utc));
+  t = absl::FromCivil(absl::CivilSecond(2000, 3, 1, 0, 0, 0), utc);
+  EXPECT_EQ("Wed,  1 Mar 2000 00:00:00 +0000 (UTC)",
+            absl::FormatTime(fmt, t, utc));
+}
+
+TEST(Time, ToTM) {
+  const absl::TimeZone utc = absl::UTCTimeZone();
+
+  // Compares the results of ToTM() to gmtime_r() for lots of times over the
+  // course of a few days.
+  const absl::Time start =
+      absl::FromCivil(absl::CivilSecond(2014, 1, 2, 3, 4, 5), utc);
+  const absl::Time end =
+      absl::FromCivil(absl::CivilSecond(2014, 1, 5, 3, 4, 5), utc);
+  for (absl::Time t = start; t < end; t += absl::Seconds(30)) {
+    const struct tm tm_bt = ToTM(t, utc);
+    const time_t tt = absl::ToTimeT(t);
+    struct tm tm_lc;
+#ifdef _WIN32
+    gmtime_s(&tm_lc, &tt);
+#else
+    gmtime_r(&tt, &tm_lc);
+#endif
+    EXPECT_EQ(tm_lc.tm_year, tm_bt.tm_year);
+    EXPECT_EQ(tm_lc.tm_mon, tm_bt.tm_mon);
+    EXPECT_EQ(tm_lc.tm_mday, tm_bt.tm_mday);
+    EXPECT_EQ(tm_lc.tm_hour, tm_bt.tm_hour);
+    EXPECT_EQ(tm_lc.tm_min, tm_bt.tm_min);
+    EXPECT_EQ(tm_lc.tm_sec, tm_bt.tm_sec);
+    EXPECT_EQ(tm_lc.tm_wday, tm_bt.tm_wday);
+    EXPECT_EQ(tm_lc.tm_yday, tm_bt.tm_yday);
+    EXPECT_EQ(tm_lc.tm_isdst, tm_bt.tm_isdst);
+
+    ASSERT_FALSE(HasFailure());
+  }
+
+  // Checks that the tm_isdst field is correct when in standard time.
+  const absl::TimeZone nyc =
+      absl::time_internal::LoadTimeZone("America/New_York");
+  absl::Time t = absl::FromCivil(absl::CivilSecond(2014, 3, 1, 0, 0, 0), nyc);
+  struct tm tm = ToTM(t, nyc);
+  EXPECT_FALSE(tm.tm_isdst);
+
+  // Checks that the tm_isdst field is correct when in daylight time.
+  t = absl::FromCivil(absl::CivilSecond(2014, 4, 1, 0, 0, 0), nyc);
+  tm = ToTM(t, nyc);
+  EXPECT_TRUE(tm.tm_isdst);
+
+  // Checks overflow.
+  tm = ToTM(absl::InfiniteFuture(), nyc);
+  EXPECT_EQ(std::numeric_limits<int>::max() - 1900, tm.tm_year);
+  EXPECT_EQ(11, tm.tm_mon);
+  EXPECT_EQ(31, tm.tm_mday);
+  EXPECT_EQ(23, tm.tm_hour);
+  EXPECT_EQ(59, tm.tm_min);
+  EXPECT_EQ(59, tm.tm_sec);
+  EXPECT_EQ(4, tm.tm_wday);
+  EXPECT_EQ(364, tm.tm_yday);
+  EXPECT_FALSE(tm.tm_isdst);
+
+  // Checks underflow.
+  tm = ToTM(absl::InfinitePast(), nyc);
+  EXPECT_EQ(std::numeric_limits<int>::min(), tm.tm_year);
+  EXPECT_EQ(0, tm.tm_mon);
+  EXPECT_EQ(1, tm.tm_mday);
+  EXPECT_EQ(0, tm.tm_hour);
+  EXPECT_EQ(0, tm.tm_min);
+  EXPECT_EQ(0, tm.tm_sec);
+  EXPECT_EQ(0, tm.tm_wday);
+  EXPECT_EQ(0, tm.tm_yday);
+  EXPECT_FALSE(tm.tm_isdst);
+}
+
+TEST(Time, FromTM) {
+  const absl::TimeZone nyc =
+      absl::time_internal::LoadTimeZone("America/New_York");
+
+  // Verifies that tm_isdst doesn't affect anything when the time is unique.
+  struct tm tm;
+  std::memset(&tm, 0, sizeof(tm));
+  tm.tm_year = 2014 - 1900;
+  tm.tm_mon = 6 - 1;
+  tm.tm_mday = 28;
+  tm.tm_hour = 1;
+  tm.tm_min = 2;
+  tm.tm_sec = 3;
+  tm.tm_isdst = -1;
+  absl::Time t = FromTM(tm, nyc);
+  EXPECT_EQ("2014-06-28T01:02:03-04:00", absl::FormatTime(t, nyc));  // DST
+  tm.tm_isdst = 0;
+  t = FromTM(tm, nyc);
+  EXPECT_EQ("2014-06-28T01:02:03-04:00", absl::FormatTime(t, nyc));  // DST
+  tm.tm_isdst = 1;
+  t = FromTM(tm, nyc);
+  EXPECT_EQ("2014-06-28T01:02:03-04:00", absl::FormatTime(t, nyc));  // DST
+
+  // Adjusts tm to refer to an ambiguous time.
+  tm.tm_year = 2014 - 1900;
+  tm.tm_mon = 11 - 1;
+  tm.tm_mday = 2;
+  tm.tm_hour = 1;
+  tm.tm_min = 30;
+  tm.tm_sec = 42;
+  tm.tm_isdst = -1;
+  t = FromTM(tm, nyc);
+  EXPECT_EQ("2014-11-02T01:30:42-04:00", absl::FormatTime(t, nyc));  // DST
+  tm.tm_isdst = 0;
+  t = FromTM(tm, nyc);
+  EXPECT_EQ("2014-11-02T01:30:42-05:00", absl::FormatTime(t, nyc));  // STD
+  tm.tm_isdst = 1;
+  t = FromTM(tm, nyc);
+  EXPECT_EQ("2014-11-02T01:30:42-04:00", absl::FormatTime(t, nyc));  // DST
+
+  // Adjusts tm to refer to a skipped time.
+  tm.tm_year = 2014 - 1900;
+  tm.tm_mon = 3 - 1;
+  tm.tm_mday = 9;
+  tm.tm_hour = 2;
+  tm.tm_min = 30;
+  tm.tm_sec = 42;
+  tm.tm_isdst = -1;
+  t = FromTM(tm, nyc);
+  EXPECT_EQ("2014-03-09T03:30:42-04:00", absl::FormatTime(t, nyc));  // DST
+  tm.tm_isdst = 0;
+  t = FromTM(tm, nyc);
+  EXPECT_EQ("2014-03-09T01:30:42-05:00", absl::FormatTime(t, nyc));  // STD
+  tm.tm_isdst = 1;
+  t = FromTM(tm, nyc);
+  EXPECT_EQ("2014-03-09T03:30:42-04:00", absl::FormatTime(t, nyc));  // DST
+
+  // Adjusts tm to refer to a time with a year larger than 2147483647.
+  tm.tm_year = 2147483647 - 1900 + 1;
+  tm.tm_mon = 6 - 1;
+  tm.tm_mday = 28;
+  tm.tm_hour = 1;
+  tm.tm_min = 2;
+  tm.tm_sec = 3;
+  tm.tm_isdst = -1;
+  t = FromTM(tm, absl::UTCTimeZone());
+  EXPECT_EQ("2147483648-06-28T01:02:03+00:00",
+            absl::FormatTime(t, absl::UTCTimeZone()));
+
+  // Adjusts tm to refer to a time with a very large month.
+  tm.tm_year = 2019 - 1900;
+  tm.tm_mon = 2147483647;
+  tm.tm_mday = 28;
+  tm.tm_hour = 1;
+  tm.tm_min = 2;
+  tm.tm_sec = 3;
+  tm.tm_isdst = -1;
+  t = FromTM(tm, absl::UTCTimeZone());
+  EXPECT_EQ("178958989-08-28T01:02:03+00:00",
+            absl::FormatTime(t, absl::UTCTimeZone()));
+}
+
+TEST(Time, TMRoundTrip) {
+  const absl::TimeZone nyc =
+      absl::time_internal::LoadTimeZone("America/New_York");
+
+  // Test round-tripping across a skipped transition
+  absl::Time start = absl::FromCivil(absl::CivilHour(2014, 3, 9, 0), nyc);
+  absl::Time end = absl::FromCivil(absl::CivilHour(2014, 3, 9, 4), nyc);
+  for (absl::Time t = start; t < end; t += absl::Minutes(1)) {
+    struct tm tm = ToTM(t, nyc);
+    absl::Time rt = FromTM(tm, nyc);
+    EXPECT_EQ(rt, t);
+  }
+
+  // Test round-tripping across an ambiguous transition
+  start = absl::FromCivil(absl::CivilHour(2014, 11, 2, 0), nyc);
+  end = absl::FromCivil(absl::CivilHour(2014, 11, 2, 4), nyc);
+  for (absl::Time t = start; t < end; t += absl::Minutes(1)) {
+    struct tm tm = ToTM(t, nyc);
+    absl::Time rt = FromTM(tm, nyc);
+    EXPECT_EQ(rt, t);
+  }
+
+  // Test round-tripping of unique instants crossing a day boundary
+  start = absl::FromCivil(absl::CivilHour(2014, 6, 27, 22), nyc);
+  end = absl::FromCivil(absl::CivilHour(2014, 6, 28, 4), nyc);
+  for (absl::Time t = start; t < end; t += absl::Minutes(1)) {
+    struct tm tm = ToTM(t, nyc);
+    absl::Time rt = FromTM(tm, nyc);
+    EXPECT_EQ(rt, t);
+  }
+}
+
+TEST(Time, Range) {
+  // The API's documented range is +/- 100 billion years.
+  const absl::Duration range = absl::Hours(24) * 365.2425 * 100000000000;
+
+  // Arithmetic and comparison still works at +/-range around base values.
+  absl::Time bases[2] = {absl::UnixEpoch(), absl::Now()};
+  for (const auto base : bases) {
+    absl::Time bottom = base - range;
+    EXPECT_GT(bottom, bottom - absl::Nanoseconds(1));
+    EXPECT_LT(bottom, bottom + absl::Nanoseconds(1));
+    absl::Time top = base + range;
+    EXPECT_GT(top, top - absl::Nanoseconds(1));
+    EXPECT_LT(top, top + absl::Nanoseconds(1));
+    absl::Duration full_range = 2 * range;
+    EXPECT_EQ(full_range, top - bottom);
+    EXPECT_EQ(-full_range, bottom - top);
+  }
+}
+
+TEST(Time, Limits) {
+  // It is an implementation detail that Time().rep_ == ZeroDuration(),
+  // and that the resolution of a Duration is 1/4 of a nanosecond.
+  const absl::Time zero;
+  const absl::Time max =
+      zero + absl::Seconds(std::numeric_limits<int64_t>::max()) +
+      absl::Nanoseconds(999999999) + absl::Nanoseconds(3) / 4;
+  const absl::Time min =
+      zero + absl::Seconds(std::numeric_limits<int64_t>::min());
+
+  // Some simple max/min bounds checks.
+  EXPECT_LT(max, absl::InfiniteFuture());
+  EXPECT_GT(min, absl::InfinitePast());
+  EXPECT_LT(zero, max);
+  EXPECT_GT(zero, min);
+  EXPECT_GE(absl::UnixEpoch(), min);
+  EXPECT_LT(absl::UnixEpoch(), max);
+
+  // Check sign of Time differences.
+  EXPECT_LT(absl::ZeroDuration(), max - zero);
+  EXPECT_LT(absl::ZeroDuration(),
+            zero - absl::Nanoseconds(1) / 4 - min);  // avoid zero - min
+
+  // Arithmetic works at max - 0.25ns and min + 0.25ns.
+  EXPECT_GT(max, max - absl::Nanoseconds(1) / 4);
+  EXPECT_LT(min, min + absl::Nanoseconds(1) / 4);
+}
+
+TEST(Time, ConversionSaturation) {
+  const absl::TimeZone utc = absl::UTCTimeZone();
+  absl::Time t;
+
+  const auto max_time_t = std::numeric_limits<time_t>::max();
+  const auto min_time_t = std::numeric_limits<time_t>::min();
+  time_t tt = max_time_t - 1;
+  t = absl::FromTimeT(tt);
+  tt = absl::ToTimeT(t);
+  EXPECT_EQ(max_time_t - 1, tt);
+  t += absl::Seconds(1);
+  tt = absl::ToTimeT(t);
+  EXPECT_EQ(max_time_t, tt);
+  t += absl::Seconds(1);  // no effect
+  tt = absl::ToTimeT(t);
+  EXPECT_EQ(max_time_t, tt);
+
+  tt = min_time_t + 1;
+  t = absl::FromTimeT(tt);
+  tt = absl::ToTimeT(t);
+  EXPECT_EQ(min_time_t + 1, tt);
+  t -= absl::Seconds(1);
+  tt = absl::ToTimeT(t);
+  EXPECT_EQ(min_time_t, tt);
+  t -= absl::Seconds(1);  // no effect
+  tt = absl::ToTimeT(t);
+  EXPECT_EQ(min_time_t, tt);
+
+  const auto max_timeval_sec =
+      std::numeric_limits<decltype(timeval::tv_sec)>::max();
+  const auto min_timeval_sec =
+      std::numeric_limits<decltype(timeval::tv_sec)>::min();
+  timeval tv;
+  tv.tv_sec = max_timeval_sec;
+  tv.tv_usec = 999998;
+  t = absl::TimeFromTimeval(tv);
+  tv = ToTimeval(t);
+  EXPECT_EQ(max_timeval_sec, tv.tv_sec);
+  EXPECT_EQ(999998, tv.tv_usec);
+  t += absl::Microseconds(1);
+  tv = ToTimeval(t);
+  EXPECT_EQ(max_timeval_sec, tv.tv_sec);
+  EXPECT_EQ(999999, tv.tv_usec);
+  t += absl::Microseconds(1);  // no effect
+  tv = ToTimeval(t);
+  EXPECT_EQ(max_timeval_sec, tv.tv_sec);
+  EXPECT_EQ(999999, tv.tv_usec);
+
+  tv.tv_sec = min_timeval_sec;
+  tv.tv_usec = 1;
+  t = absl::TimeFromTimeval(tv);
+  tv = ToTimeval(t);
+  EXPECT_EQ(min_timeval_sec, tv.tv_sec);
+  EXPECT_EQ(1, tv.tv_usec);
+  t -= absl::Microseconds(1);
+  tv = ToTimeval(t);
+  EXPECT_EQ(min_timeval_sec, tv.tv_sec);
+  EXPECT_EQ(0, tv.tv_usec);
+  t -= absl::Microseconds(1);  // no effect
+  tv = ToTimeval(t);
+  EXPECT_EQ(min_timeval_sec, tv.tv_sec);
+  EXPECT_EQ(0, tv.tv_usec);
+
+  const auto max_timespec_sec =
+      std::numeric_limits<decltype(timespec::tv_sec)>::max();
+  const auto min_timespec_sec =
+      std::numeric_limits<decltype(timespec::tv_sec)>::min();
+  timespec ts;
+  ts.tv_sec = max_timespec_sec;
+  ts.tv_nsec = 999999998;
+  t = absl::TimeFromTimespec(ts);
+  ts = absl::ToTimespec(t);
+  EXPECT_EQ(max_timespec_sec, ts.tv_sec);
+  EXPECT_EQ(999999998, ts.tv_nsec);
+  t += absl::Nanoseconds(1);
+  ts = absl::ToTimespec(t);
+  EXPECT_EQ(max_timespec_sec, ts.tv_sec);
+  EXPECT_EQ(999999999, ts.tv_nsec);
+  t += absl::Nanoseconds(1);  // no effect
+  ts = absl::ToTimespec(t);
+  EXPECT_EQ(max_timespec_sec, ts.tv_sec);
+  EXPECT_EQ(999999999, ts.tv_nsec);
+
+  ts.tv_sec = min_timespec_sec;
+  ts.tv_nsec = 1;
+  t = absl::TimeFromTimespec(ts);
+  ts = absl::ToTimespec(t);
+  EXPECT_EQ(min_timespec_sec, ts.tv_sec);
+  EXPECT_EQ(1, ts.tv_nsec);
+  t -= absl::Nanoseconds(1);
+  ts = absl::ToTimespec(t);
+  EXPECT_EQ(min_timespec_sec, ts.tv_sec);
+  EXPECT_EQ(0, ts.tv_nsec);
+  t -= absl::Nanoseconds(1);  // no effect
+  ts = absl::ToTimespec(t);
+  EXPECT_EQ(min_timespec_sec, ts.tv_sec);
+  EXPECT_EQ(0, ts.tv_nsec);
+
+  // Checks how TimeZone::At() saturates on infinities.
+  auto ci = utc.At(absl::InfiniteFuture());
+  EXPECT_CIVIL_INFO(ci, std::numeric_limits<int64_t>::max(), 12, 31, 23,
+                            59, 59, 0, false);
+  EXPECT_EQ(absl::InfiniteDuration(), ci.subsecond);
+  EXPECT_EQ(absl::Weekday::thursday, absl::GetWeekday(ci.cs));
+  EXPECT_EQ(365, absl::GetYearDay(ci.cs));
+  EXPECT_STREQ("-00", ci.zone_abbr);  // artifact of TimeZone::At()
+  ci = utc.At(absl::InfinitePast());
+  EXPECT_CIVIL_INFO(ci, std::numeric_limits<int64_t>::min(), 1, 1, 0, 0,
+                            0, 0, false);
+  EXPECT_EQ(-absl::InfiniteDuration(), ci.subsecond);
+  EXPECT_EQ(absl::Weekday::sunday, absl::GetWeekday(ci.cs));
+  EXPECT_EQ(1, absl::GetYearDay(ci.cs));
+  EXPECT_STREQ("-00", ci.zone_abbr);  // artifact of TimeZone::At()
+
+  // Approach the maximal Time value from below.
+  t = absl::FromCivil(absl::CivilSecond(292277026596, 12, 4, 15, 30, 6), utc);
+  EXPECT_EQ("292277026596-12-04T15:30:06+00:00",
+            absl::FormatTime(absl::RFC3339_full, t, utc));
+  t = absl::FromCivil(absl::CivilSecond(292277026596, 12, 4, 15, 30, 7), utc);
+  EXPECT_EQ("292277026596-12-04T15:30:07+00:00",
+            absl::FormatTime(absl::RFC3339_full, t, utc));
+  EXPECT_EQ(
+      absl::UnixEpoch() + absl::Seconds(std::numeric_limits<int64_t>::max()), t);
+
+  // Checks that we can also get the maximal Time value for a far-east zone.
+  const absl::TimeZone plus14 = absl::FixedTimeZone(14 * 60 * 60);
+  t = absl::FromCivil(absl::CivilSecond(292277026596, 12, 5, 5, 30, 7), plus14);
+  EXPECT_EQ("292277026596-12-05T05:30:07+14:00",
+            absl::FormatTime(absl::RFC3339_full, t, plus14));
+  EXPECT_EQ(
+      absl::UnixEpoch() + absl::Seconds(std::numeric_limits<int64_t>::max()), t);
+
+  // One second later should push us to infinity.
+  t = absl::FromCivil(absl::CivilSecond(292277026596, 12, 4, 15, 30, 8), utc);
+  EXPECT_EQ("infinite-future", absl::FormatTime(absl::RFC3339_full, t, utc));
+
+  // Approach the minimal Time value from above.
+  t = absl::FromCivil(absl::CivilSecond(-292277022657, 1, 27, 8, 29, 53), utc);
+  EXPECT_EQ("-292277022657-01-27T08:29:53+00:00",
+            absl::FormatTime(absl::RFC3339_full, t, utc));
+  t = absl::FromCivil(absl::CivilSecond(-292277022657, 1, 27, 8, 29, 52), utc);
+  EXPECT_EQ("-292277022657-01-27T08:29:52+00:00",
+            absl::FormatTime(absl::RFC3339_full, t, utc));
+  EXPECT_EQ(
+      absl::UnixEpoch() + absl::Seconds(std::numeric_limits<int64_t>::min()), t);
+
+  // Checks that we can also get the minimal Time value for a far-west zone.
+  const absl::TimeZone minus12 = absl::FixedTimeZone(-12 * 60 * 60);
+  t = absl::FromCivil(absl::CivilSecond(-292277022657, 1, 26, 20, 29, 52),
+                      minus12);
+  EXPECT_EQ("-292277022657-01-26T20:29:52-12:00",
+            absl::FormatTime(absl::RFC3339_full, t, minus12));
+  EXPECT_EQ(
+      absl::UnixEpoch() + absl::Seconds(std::numeric_limits<int64_t>::min()), t);
+
+  // One second before should push us to -infinity.
+  t = absl::FromCivil(absl::CivilSecond(-292277022657, 1, 27, 8, 29, 51), utc);
+  EXPECT_EQ("infinite-past", absl::FormatTime(absl::RFC3339_full, t, utc));
+}
+
+// In zones with POSIX-style recurring rules we use special logic to
+// handle conversions in the distant future.  Here we check the limits
+// of those conversions, particularly with respect to integer overflow.
+TEST(Time, ExtendedConversionSaturation) {
+  const absl::TimeZone syd =
+      absl::time_internal::LoadTimeZone("Australia/Sydney");
+  const absl::TimeZone nyc =
+      absl::time_internal::LoadTimeZone("America/New_York");
+  const absl::Time max =
+      absl::FromUnixSeconds(std::numeric_limits<int64_t>::max());
+  absl::TimeZone::CivilInfo ci;
+  absl::Time t;
+
+  // The maximal time converted in each zone.
+  ci = syd.At(max);
+  EXPECT_CIVIL_INFO(ci, 292277026596, 12, 5, 2, 30, 7, 39600, true);
+  t = absl::FromCivil(absl::CivilSecond(292277026596, 12, 5, 2, 30, 7), syd);
+  EXPECT_EQ(max, t);
+  ci = nyc.At(max);
+  EXPECT_CIVIL_INFO(ci, 292277026596, 12, 4, 10, 30, 7, -18000, false);
+  t = absl::FromCivil(absl::CivilSecond(292277026596, 12, 4, 10, 30, 7), nyc);
+  EXPECT_EQ(max, t);
+
+  // One second later should push us to infinity.
+  t = absl::FromCivil(absl::CivilSecond(292277026596, 12, 5, 2, 30, 8), syd);
+  EXPECT_EQ(absl::InfiniteFuture(), t);
+  t = absl::FromCivil(absl::CivilSecond(292277026596, 12, 4, 10, 30, 8), nyc);
+  EXPECT_EQ(absl::InfiniteFuture(), t);
+
+  // And we should stick there.
+  t = absl::FromCivil(absl::CivilSecond(292277026596, 12, 5, 2, 30, 9), syd);
+  EXPECT_EQ(absl::InfiniteFuture(), t);
+  t = absl::FromCivil(absl::CivilSecond(292277026596, 12, 4, 10, 30, 9), nyc);
+  EXPECT_EQ(absl::InfiniteFuture(), t);
+
+  // All the way up to a saturated date/time, without overflow.
+  t = absl::FromCivil(absl::CivilSecond::max(), syd);
+  EXPECT_EQ(absl::InfiniteFuture(), t);
+  t = absl::FromCivil(absl::CivilSecond::max(), nyc);
+  EXPECT_EQ(absl::InfiniteFuture(), t);
+}
+
+TEST(Time, FromCivilAlignment) {
+  const absl::TimeZone utc = absl::UTCTimeZone();
+  const absl::CivilSecond cs(2015, 2, 3, 4, 5, 6);
+  absl::Time t = absl::FromCivil(cs, utc);
+  EXPECT_EQ("2015-02-03T04:05:06+00:00", absl::FormatTime(t, utc));
+  t = absl::FromCivil(absl::CivilMinute(cs), utc);
+  EXPECT_EQ("2015-02-03T04:05:00+00:00", absl::FormatTime(t, utc));
+  t = absl::FromCivil(absl::CivilHour(cs), utc);
+  EXPECT_EQ("2015-02-03T04:00:00+00:00", absl::FormatTime(t, utc));
+  t = absl::FromCivil(absl::CivilDay(cs), utc);
+  EXPECT_EQ("2015-02-03T00:00:00+00:00", absl::FormatTime(t, utc));
+  t = absl::FromCivil(absl::CivilMonth(cs), utc);
+  EXPECT_EQ("2015-02-01T00:00:00+00:00", absl::FormatTime(t, utc));
+  t = absl::FromCivil(absl::CivilYear(cs), utc);
+  EXPECT_EQ("2015-01-01T00:00:00+00:00", absl::FormatTime(t, utc));
+}
+
+TEST(Time, LegacyDateTime) {
+  const absl::TimeZone utc = absl::UTCTimeZone();
+  const std::string ymdhms = "%Y-%m-%d %H:%M:%S";
+  const int kMax = std::numeric_limits<int>::max();
+  const int kMin = std::numeric_limits<int>::min();
+  absl::Time t;
+
+  t = absl::FromDateTime(std::numeric_limits<absl::civil_year_t>::max(),
+                         kMax, kMax, kMax, kMax, kMax, utc);
+  EXPECT_EQ("infinite-future",
+            absl::FormatTime(ymdhms, t, utc));  // no overflow
+  t = absl::FromDateTime(std::numeric_limits<absl::civil_year_t>::min(),
+                         kMin, kMin, kMin, kMin, kMin, utc);
+  EXPECT_EQ("infinite-past",
+            absl::FormatTime(ymdhms, t, utc));  // no overflow
+
+  // Check normalization.
+  EXPECT_TRUE(absl::ConvertDateTime(2013, 10, 32, 8, 30, 0, utc).normalized);
+  t = absl::FromDateTime(2015, 1, 1, 0, 0, 60, utc);
+  EXPECT_EQ("2015-01-01 00:01:00", absl::FormatTime(ymdhms, t, utc));
+  t = absl::FromDateTime(2015, 1, 1, 0, 60, 0, utc);
+  EXPECT_EQ("2015-01-01 01:00:00", absl::FormatTime(ymdhms, t, utc));
+  t = absl::FromDateTime(2015, 1, 1, 24, 0, 0, utc);
+  EXPECT_EQ("2015-01-02 00:00:00", absl::FormatTime(ymdhms, t, utc));
+  t = absl::FromDateTime(2015, 1, 32, 0, 0, 0, utc);
+  EXPECT_EQ("2015-02-01 00:00:00", absl::FormatTime(ymdhms, t, utc));
+  t = absl::FromDateTime(2015, 13, 1, 0, 0, 0, utc);
+  EXPECT_EQ("2016-01-01 00:00:00", absl::FormatTime(ymdhms, t, utc));
+  t = absl::FromDateTime(2015, 13, 32, 60, 60, 60, utc);
+  EXPECT_EQ("2016-02-03 13:01:00", absl::FormatTime(ymdhms, t, utc));
+  t = absl::FromDateTime(2015, 1, 1, 0, 0, -1, utc);
+  EXPECT_EQ("2014-12-31 23:59:59", absl::FormatTime(ymdhms, t, utc));
+  t = absl::FromDateTime(2015, 1, 1, 0, -1, 0, utc);
+  EXPECT_EQ("2014-12-31 23:59:00", absl::FormatTime(ymdhms, t, utc));
+  t = absl::FromDateTime(2015, 1, 1, -1, 0, 0, utc);
+  EXPECT_EQ("2014-12-31 23:00:00", absl::FormatTime(ymdhms, t, utc));
+  t = absl::FromDateTime(2015, 1, -1, 0, 0, 0, utc);
+  EXPECT_EQ("2014-12-30 00:00:00", absl::FormatTime(ymdhms, t, utc));
+  t = absl::FromDateTime(2015, -1, 1, 0, 0, 0, utc);
+  EXPECT_EQ("2014-11-01 00:00:00", absl::FormatTime(ymdhms, t, utc));
+  t = absl::FromDateTime(2015, -1, -1, -1, -1, -1, utc);
+  EXPECT_EQ("2014-10-29 22:58:59", absl::FormatTime(ymdhms, t, utc));
+}
+
+TEST(Time, NextTransitionUTC) {
+  const auto tz = absl::UTCTimeZone();
+  absl::TimeZone::CivilTransition trans;
+
+  auto t = absl::InfinitePast();
+  EXPECT_FALSE(tz.NextTransition(t, &trans));
+
+  t = absl::InfiniteFuture();
+  EXPECT_FALSE(tz.NextTransition(t, &trans));
+}
+
+TEST(Time, PrevTransitionUTC) {
+  const auto tz = absl::UTCTimeZone();
+  absl::TimeZone::CivilTransition trans;
+
+  auto t = absl::InfiniteFuture();
+  EXPECT_FALSE(tz.PrevTransition(t, &trans));
+
+  t = absl::InfinitePast();
+  EXPECT_FALSE(tz.PrevTransition(t, &trans));
+}
+
+TEST(Time, NextTransitionNYC) {
+  const auto tz = absl::time_internal::LoadTimeZone("America/New_York");
+  absl::TimeZone::CivilTransition trans;
+
+  auto t = absl::FromCivil(absl::CivilSecond(2018, 6, 30, 0, 0, 0), tz);
+  EXPECT_TRUE(tz.NextTransition(t, &trans));
+  EXPECT_EQ(absl::CivilSecond(2018, 11, 4, 2, 0, 0), trans.from);
+  EXPECT_EQ(absl::CivilSecond(2018, 11, 4, 1, 0, 0), trans.to);
+
+  t = absl::InfiniteFuture();
+  EXPECT_FALSE(tz.NextTransition(t, &trans));
+
+  t = absl::InfinitePast();
+  EXPECT_TRUE(tz.NextTransition(t, &trans));
+  if (trans.from == absl::CivilSecond(1918, 03, 31, 2, 0, 0)) {
+    // It looks like the tzdata is only 32 bit (probably macOS),
+    // which bottoms out at 1901-12-13T20:45:52+00:00.
+    EXPECT_EQ(absl::CivilSecond(1918, 3, 31, 3, 0, 0), trans.to);
+  } else {
+    EXPECT_EQ(absl::CivilSecond(1883, 11, 18, 12, 3, 58), trans.from);
+    EXPECT_EQ(absl::CivilSecond(1883, 11, 18, 12, 0, 0), trans.to);
+  }
+}
+
+TEST(Time, PrevTransitionNYC) {
+  const auto tz = absl::time_internal::LoadTimeZone("America/New_York");
+  absl::TimeZone::CivilTransition trans;
+
+  auto t = absl::FromCivil(absl::CivilSecond(2018, 6, 30, 0, 0, 0), tz);
+  EXPECT_TRUE(tz.PrevTransition(t, &trans));
+  EXPECT_EQ(absl::CivilSecond(2018, 3, 11, 2, 0, 0), trans.from);
+  EXPECT_EQ(absl::CivilSecond(2018, 3, 11, 3, 0, 0), trans.to);
+
+  t = absl::InfinitePast();
+  EXPECT_FALSE(tz.PrevTransition(t, &trans));
+
+  t = absl::InfiniteFuture();
+  EXPECT_TRUE(tz.PrevTransition(t, &trans));
+  // We have a transition but we don't know which one.
+}
+
+}  // namespace
diff --git a/third_party/abseil_cpp/absl/time/time_zone_test.cc b/third_party/abseil_cpp/absl/time/time_zone_test.cc
new file mode 100644
index 0000000000..229fcfccb0
--- /dev/null
+++ b/third_party/abseil_cpp/absl/time/time_zone_test.cc
@@ -0,0 +1,97 @@
+// Copyright 2017 The Abseil Authors.
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      https://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+#include "absl/time/internal/cctz/include/cctz/time_zone.h"
+
+#include "gtest/gtest.h"
+#include "absl/time/internal/test_util.h"
+#include "absl/time/time.h"
+
+namespace cctz = absl::time_internal::cctz;
+
+namespace {
+
+TEST(TimeZone, ValueSemantics) {
+  absl::TimeZone tz;
+  absl::TimeZone tz2 = tz;  // Copy-construct
+  EXPECT_EQ(tz, tz2);
+  tz2 = tz;  // Copy-assign
+  EXPECT_EQ(tz, tz2);
+}
+
+TEST(TimeZone, Equality) {
+  absl::TimeZone a, b;
+  EXPECT_EQ(a, b);
+  EXPECT_EQ(a.name(), b.name());
+
+  absl::TimeZone implicit_utc;
+  absl::TimeZone explicit_utc = absl::UTCTimeZone();
+  EXPECT_EQ(implicit_utc, explicit_utc);
+  EXPECT_EQ(implicit_utc.name(), explicit_utc.name());
+
+  absl::TimeZone la = absl::time_internal::LoadTimeZone("America/Los_Angeles");
+  absl::TimeZone nyc = absl::time_internal::LoadTimeZone("America/New_York");
+  EXPECT_NE(la, nyc);
+}
+
+TEST(TimeZone, CCTZConversion) {
+  const cctz::time_zone cz = cctz::utc_time_zone();
+  const absl::TimeZone tz(cz);
+  EXPECT_EQ(cz, cctz::time_zone(tz));
+}
+
+TEST(TimeZone, DefaultTimeZones) {
+  absl::TimeZone tz;
+  EXPECT_EQ("UTC", absl::TimeZone().name());
+  EXPECT_EQ("UTC", absl::UTCTimeZone().name());
+}
+
+TEST(TimeZone, FixedTimeZone) {
+  const absl::TimeZone tz = absl::FixedTimeZone(123);
+  const cctz::time_zone cz = cctz::fixed_time_zone(cctz::seconds(123));
+  EXPECT_EQ(tz, absl::TimeZone(cz));
+}
+
+TEST(TimeZone, LocalTimeZone) {
+  const absl::TimeZone local_tz = absl::LocalTimeZone();
+  absl::TimeZone tz = absl::time_internal::LoadTimeZone("localtime");
+  EXPECT_EQ(tz, local_tz);
+}
+
+TEST(TimeZone, NamedTimeZones) {
+  absl::TimeZone nyc = absl::time_internal::LoadTimeZone("America/New_York");
+  EXPECT_EQ("America/New_York", nyc.name());
+  absl::TimeZone syd = absl::time_internal::LoadTimeZone("Australia/Sydney");
+  EXPECT_EQ("Australia/Sydney", syd.name());
+  absl::TimeZone fixed = absl::FixedTimeZone((((3 * 60) + 25) * 60) + 45);
+  EXPECT_EQ("Fixed/UTC+03:25:45", fixed.name());
+}
+
+TEST(TimeZone, Failures) {
+  absl::TimeZone tz = absl::time_internal::LoadTimeZone("America/Los_Angeles");
+  EXPECT_FALSE(LoadTimeZone("Invalid/TimeZone", &tz));
+  EXPECT_EQ(absl::UTCTimeZone(), tz);  // guaranteed fallback to UTC
+
+  // Ensures that the load still fails on a subsequent attempt.
+  tz = absl::time_internal::LoadTimeZone("America/Los_Angeles");
+  EXPECT_FALSE(LoadTimeZone("Invalid/TimeZone", &tz));
+  EXPECT_EQ(absl::UTCTimeZone(), tz);  // guaranteed fallback to UTC
+
+  // Loading an empty string timezone should fail.
+  tz = absl::time_internal::LoadTimeZone("America/Los_Angeles");
+  EXPECT_FALSE(LoadTimeZone("", &tz));
+  EXPECT_EQ(absl::UTCTimeZone(), tz);  // guaranteed fallback to UTC
+}
+
+}  // namespace