diff options
author | Abseil Team <absl-team@google.com> | 2018-06-21T19·55-0700 |
---|---|---|
committer | Shaindel Schwartz <shaindel@google.com> | 2018-06-22T12·55-0400 |
commit | 4491d606df34c44efda47b6d17b605262f17e182 (patch) | |
tree | 5c5a2717289760c229fed502a6310d70ca4ed35a | |
parent | d89dba27e35462d7457121b978fd79214205e686 (diff) |
Export of internal Abseil changes.
-- 70f43a482d7d4ae4a255f17ca02b0106653dd600 by Shaindel Schwartz <shaindel@google.com>: Internal change PiperOrigin-RevId: 201571193 -- 93e6e9c2e683158be49d9dd1f5cb1a91d0c0f556 by Abseil Team <absl-team@google.com>: Internal change. PiperOrigin-RevId: 201567108 -- fbd8ee94fbe9f2448e5adf5e88706f9c8216048f by Juemin Yang <jueminyang@google.com>: str_format release PiperOrigin-RevId: 201565129 -- 387faa301555a8a888c4429df52734aa806dca46 by Abseil Team <absl-team@google.com>: Adds a defaulted allocator parameter to the size_type constructor of InlinedVector PiperOrigin-RevId: 201558711 -- 39b15ea2c68d7129d70cbde7e71af900032595ec by Matt Calabrese <calabrese@google.com>: Update the variant implementation to eliminate unnecessary checking on alternative access when the index is known or required to be correct. PiperOrigin-RevId: 201529535 -- adab77f1f7bb363aa534297f22aae2b0f08889ea by Abseil Team <absl-team@google.com>: Import of CCTZ from GitHub. PiperOrigin-RevId: 201458388 -- a701dc0ba62e3cadf0de14203415b91df4ee8151 by Greg Falcon <gfalcon@google.com>: Internal cleanup PiperOrigin-RevId: 201394836 -- 8a7191410b8f440fdfa27f722ff05e451502ab61 by Abseil Team <absl-team@google.com>: Import of CCTZ from GitHub. PiperOrigin-RevId: 201369269 GitOrigin-RevId: 70f43a482d7d4ae4a255f17ca02b0106653dd600 Change-Id: I8ab073b30b4e27405a3b6da2c826bb4f3f0b9af6
46 files changed, 6559 insertions, 354 deletions
diff --git a/absl/container/inlined_vector.h b/absl/container/inlined_vector.h index 78f78ea70221..101ded8557eb 100644 --- a/absl/container/inlined_vector.h +++ b/absl/container/inlined_vector.h @@ -89,7 +89,9 @@ class InlinedVector { : allocator_and_tag_(alloc) {} // Create a vector with n copies of value_type(). - explicit InlinedVector(size_type n) : allocator_and_tag_(allocator_type()) { + explicit InlinedVector(size_type n, + const allocator_type& alloc = allocator_type()) + : allocator_and_tag_(alloc) { InitAssign(n); } diff --git a/absl/container/inlined_vector_test.cc b/absl/container/inlined_vector_test.cc index 26a7d5bca86f..f81fad569dcd 100644 --- a/absl/container/inlined_vector_test.cc +++ b/absl/container/inlined_vector_test.cc @@ -1763,4 +1763,30 @@ TEST(AllocatorSupportTest, ScopedAllocatorWorks) { EXPECT_EQ(allocated, 0); } +TEST(AllocatorSupportTest, SizeAllocConstructor) { + constexpr int inlined_size = 4; + using Alloc = CountingAllocator<int>; + using AllocVec = absl::InlinedVector<int, inlined_size, Alloc>; + + { + auto len = inlined_size / 2; + int64_t allocated = 0; + auto v = AllocVec(len, Alloc(&allocated)); + + // Inline storage used; allocator should not be invoked + EXPECT_THAT(allocated, 0); + EXPECT_THAT(v, AllOf(SizeIs(len), Each(0))); + } + + { + auto len = inlined_size * 2; + int64_t allocated = 0; + auto v = AllocVec(len, Alloc(&allocated)); + + // Out of line storage used; allocation of 8 elements expected + EXPECT_THAT(allocated, len * sizeof(int)); + EXPECT_THAT(v, AllOf(SizeIs(len), Each(0))); + } +} + } // anonymous namespace diff --git a/absl/strings/BUILD.bazel b/absl/strings/BUILD.bazel index 328f52f33d26..3e50d24a322a 100644 --- a/absl/strings/BUILD.bazel +++ b/absl/strings/BUILD.bazel @@ -492,3 +492,142 @@ cc_test( "@com_github_google_benchmark//:benchmark_main", ], ) + +cc_library( + name = "str_format", + hdrs = [ + "str_format.h", + ], + copts = ABSL_DEFAULT_COPTS, + deps = [ + ":str_format_internal", + ], +) + +cc_library( + name = "str_format_internal", + srcs = [ + "internal/str_format/arg.cc", + "internal/str_format/bind.cc", + "internal/str_format/extension.cc", + "internal/str_format/float_conversion.cc", + "internal/str_format/output.cc", + "internal/str_format/parser.cc", + ], + hdrs = [ + "internal/str_format/arg.h", + "internal/str_format/bind.h", + "internal/str_format/checker.h", + "internal/str_format/extension.h", + "internal/str_format/float_conversion.h", + "internal/str_format/output.h", + "internal/str_format/parser.h", + ], + copts = ABSL_DEFAULT_COPTS, + visibility = ["//visibility:private"], + deps = [ + ":strings", + "//absl/base:core_headers", + "//absl/container:inlined_vector", + "//absl/meta:type_traits", + "//absl/numeric:int128", + "//absl/types:span", + ], +) + +cc_test( + name = "str_format_test", + srcs = ["str_format_test.cc"], + copts = ABSL_TEST_COPTS, + visibility = ["//visibility:private"], + deps = [ + ":str_format", + ":strings", + "//absl/base:core_headers", + "@com_google_googletest//:gtest_main", + ], +) + +cc_test( + name = "str_format_extension_test", + srcs = [ + "internal/str_format/extension_test.cc", + ], + copts = ABSL_TEST_COPTS, + visibility = ["//visibility:private"], + deps = [ + ":str_format", + ":str_format_internal", + "@com_google_googletest//:gtest_main", + ], +) + +cc_test( + name = "str_format_arg_test", + srcs = ["internal/str_format/arg_test.cc"], + copts = ABSL_TEST_COPTS, + visibility = ["//visibility:private"], + deps = [ + ":str_format", + ":str_format_internal", + "@com_google_googletest//:gtest_main", + ], +) + +cc_test( + name = "str_format_bind_test", + srcs = ["internal/str_format/bind_test.cc"], + copts = ABSL_TEST_COPTS, + visibility = ["//visibility:private"], + deps = [ + ":str_format_internal", + "@com_google_googletest//:gtest_main", + ], +) + +cc_test( + name = "str_format_checker_test", + srcs = ["internal/str_format/checker_test.cc"], + copts = ABSL_TEST_COPTS, + visibility = ["//visibility:private"], + deps = [ + ":str_format", + "@com_google_googletest//:gtest_main", + ], +) + +cc_test( + name = "str_format_convert_test", + size = "small", + srcs = ["internal/str_format/convert_test.cc"], + copts = ABSL_TEST_COPTS, + visibility = ["//visibility:private"], + deps = [ + ":str_format_internal", + "//absl/numeric:int128", + "@com_google_googletest//:gtest_main", + ], +) + +cc_test( + name = "str_format_output_test", + srcs = ["internal/str_format/output_test.cc"], + copts = ABSL_TEST_COPTS, + visibility = ["//visibility:private"], + deps = [ + ":str_format_internal", + "@com_google_googletest//:gtest_main", + ], +) + +cc_test( + name = "str_format_parser_test", + srcs = ["internal/str_format/parser_test.cc"], + copts = ABSL_TEST_COPTS, + visibility = ["//visibility:private"], + deps = [ + ":str_format_internal", + "//absl/base:core_headers", + "@com_google_googletest//:gtest_main", + ], +) diff --git a/absl/strings/CMakeLists.txt b/absl/strings/CMakeLists.txt index cab2c4561e48..3d30c72a0cda 100644 --- a/absl/strings/CMakeLists.txt +++ b/absl/strings/CMakeLists.txt @@ -81,6 +81,58 @@ absl_library( strings ) +# add str_format library +absl_library( + TARGET + absl_str_format + SOURCES + "str_format.h" + PUBLIC_LIBRARIES + str_format_internal + EXPORT_NAME + str_format +) + +# str_format_internal + absl_library( + TARGET + str_format_internal + SOURCES + "internal/str_format/arg.cc" + "internal/str_format/bind.cc" + "internal/str_format/extension.cc" + "internal/str_format/float_conversion.cc" + "internal/str_format/output.cc" + "internal/str_format/parser.cc" + "internal/str_format/arg.h" + "internal/str_format/bind.h" + "internal/str_format/checker.h" + "internal/str_format/extension.h" + "internal/str_format/float_conversion.h" + "internal/str_format/output.h" + "internal/str_format/parser.h" + PUBLIC_LIBRARIES + str_format_extension_internal + absl::strings + absl::base + absl::numeric + absl::container + absl::span +) + +# str_format_extension_internal +absl_library( + TARGET + str_format_extension_internal + SOURCES + "internal/str_format/extension.cc" + "internal/str_format/extension.h" + "internal/str_format/output.cc" + "internal/str_format/output.h" + PUBLIC_LIBRARIES + absl::base + absl::strings +) # ## TESTS @@ -347,3 +399,68 @@ absl_test( PUBLIC_LIBRARIES ${CHARCONV_BIGINT_TEST_PUBLIC_LIBRARIES} ) +# test str_format_test +absl_test( + TARGET + str_format_test + SOURCES + "str_format_test.cc" + PUBLIC_LIBRARIES + absl::base + absl::str_format + absl::strings +) + +# test str_format_bind_test +absl_test( + TARGET + str_format_bind_test + SOURCES + "internal/str_format/bind_test.cc" + PUBLIC_LIBRARIES + str_format_internal +) + +# test str_format_checker_test +absl_test( + TARGET + str_format_checker_test + SOURCES + "internal/str_format/checker_test.cc" + PUBLIC_LIBRARIES + absl::str_format +) + +# test str_format_convert_test +absl_test( + TARGET + str_format_convert_test + SOURCES + "internal/str_format/convert_test.cc" + PUBLIC_LIBRARIES + str_format_internal + absl::numeric +) + +# test str_format_output_test +absl_test( + TARGET + str_format_output_test + SOURCES + "internal/str_format/output_test.cc" + PUBLIC_LIBRARIES + str_format_extension_internal +) + +# test str_format_parser_test +absl_test( + TARGET + str_format_parser_test + SOURCES + "internal/str_format/parser_test.cc" + PUBLIC_LIBRARIES + str_format_internal + absl::base +) + + diff --git a/absl/strings/internal/str_format/arg.cc b/absl/strings/internal/str_format/arg.cc new file mode 100644 index 000000000000..eafb068fe286 --- /dev/null +++ b/absl/strings/internal/str_format/arg.cc @@ -0,0 +1,399 @@ +// +// POSIX spec: +// http://pubs.opengroup.org/onlinepubs/009695399/functions/fprintf.html +// +#include "absl/strings/internal/str_format/arg.h" + +#include <cassert> +#include <cerrno> +#include <cstdlib> +#include <string> +#include <type_traits> + +#include "absl/base/port.h" +#include "absl/strings/internal/str_format/float_conversion.h" + +namespace absl { +namespace str_format_internal { +namespace { + +const char kDigit[2][32] = { "0123456789abcdef", "0123456789ABCDEF" }; + +// Reduce *capacity by s.size(), clipped to a 0 minimum. +void ReducePadding(string_view s, size_t *capacity) { + *capacity = Excess(s.size(), *capacity); +} + +// Reduce *capacity by n, clipped to a 0 minimum. +void ReducePadding(size_t n, size_t *capacity) { + *capacity = Excess(n, *capacity); +} + +template <typename T> +struct MakeUnsigned : std::make_unsigned<T> {}; +template <> +struct MakeUnsigned<absl::uint128> { + using type = absl::uint128; +}; + +template <typename T> +struct IsSigned : std::is_signed<T> {}; +template <> +struct IsSigned<absl::uint128> : std::false_type {}; + +class ConvertedIntInfo { + public: + template <typename T> + ConvertedIntInfo(T v, ConversionChar conv) { + using Unsigned = typename MakeUnsigned<T>::type; + auto u = static_cast<Unsigned>(v); + if (IsNeg(v)) { + is_neg_ = true; + u = Unsigned{} - u; + } else { + is_neg_ = false; + } + UnsignedToStringRight(u, conv); + } + + string_view digits() const { + return {end() - size_, static_cast<size_t>(size_)}; + } + bool is_neg() const { return is_neg_; } + + private: + template <typename T, bool IsSigned> + struct IsNegImpl { + static bool Eval(T v) { return v < 0; } + }; + template <typename T> + struct IsNegImpl<T, false> { + static bool Eval(T) { + return false; + } + }; + + template <typename T> + bool IsNeg(T v) { + return IsNegImpl<T, IsSigned<T>::value>::Eval(v); + } + + template <typename T> + void UnsignedToStringRight(T u, ConversionChar conv) { + char *p = end(); + switch (conv.radix()) { + default: + case 10: + for (; u; u /= 10) + *--p = static_cast<char>('0' + static_cast<size_t>(u % 10)); + break; + case 8: + for (; u; u /= 8) + *--p = static_cast<char>('0' + static_cast<size_t>(u % 8)); + break; + case 16: { + const char *digits = kDigit[conv.upper() ? 1 : 0]; + for (; u; u /= 16) *--p = digits[static_cast<size_t>(u % 16)]; + break; + } + } + size_ = static_cast<int>(end() - p); + } + + const char *end() const { return storage_ + sizeof(storage_); } + char *end() { return storage_ + sizeof(storage_); } + + bool is_neg_; + int size_; + // Max size: 128 bit value as octal -> 43 digits + char storage_[128 / 3 + 1]; +}; + +// Note: 'o' conversions do not have a base indicator, it's just that +// the '#' flag is specified to modify the precision for 'o' conversions. +string_view BaseIndicator(const ConvertedIntInfo &info, + const ConversionSpec &conv) { + bool alt = conv.flags().alt; + int radix = conv.conv().radix(); + if (conv.conv().id() == ConversionChar::p) + alt = true; // always show 0x for %p. + // From the POSIX description of '#' flag: + // "For x or X conversion specifiers, a non-zero result shall have + // 0x (or 0X) prefixed to it." + if (alt && radix == 16 && !info.digits().empty()) { + if (conv.conv().upper()) return "0X"; + return "0x"; + } + return {}; +} + +string_view SignColumn(bool neg, const ConversionSpec &conv) { + if (conv.conv().is_signed()) { + if (neg) return "-"; + if (conv.flags().show_pos) return "+"; + if (conv.flags().sign_col) return " "; + } + return {}; +} + +bool ConvertCharImpl(unsigned char v, const ConversionSpec &conv, + FormatSinkImpl *sink) { + size_t fill = 0; + if (conv.width() >= 0) fill = conv.width(); + ReducePadding(1, &fill); + if (!conv.flags().left) sink->Append(fill, ' '); + sink->Append(1, v); + if (conv.flags().left) sink->Append(fill, ' '); + return true; +} + +bool ConvertIntImplInner(const ConvertedIntInfo &info, + const ConversionSpec &conv, FormatSinkImpl *sink) { + // Print as a sequence of Substrings: + // [left_spaces][sign][base_indicator][zeroes][formatted][right_spaces] + size_t fill = 0; + if (conv.width() >= 0) fill = conv.width(); + + string_view formatted = info.digits(); + ReducePadding(formatted, &fill); + + string_view sign = SignColumn(info.is_neg(), conv); + ReducePadding(sign, &fill); + + string_view base_indicator = BaseIndicator(info, conv); + ReducePadding(base_indicator, &fill); + + int precision = conv.precision(); + bool precision_specified = precision >= 0; + if (!precision_specified) + precision = 1; + + if (conv.flags().alt && conv.conv().id() == ConversionChar::o) { + // From POSIX description of the '#' (alt) flag: + // "For o conversion, it increases the precision (if necessary) to + // force the first digit of the result to be zero." + if (formatted.empty() || *formatted.begin() != '0') { + int needed = static_cast<int>(formatted.size()) + 1; + precision = std::max(precision, needed); + } + } + + size_t num_zeroes = Excess(formatted.size(), precision); + ReducePadding(num_zeroes, &fill); + + size_t num_left_spaces = !conv.flags().left ? fill : 0; + size_t num_right_spaces = conv.flags().left ? fill : 0; + + // From POSIX description of the '0' (zero) flag: + // "For d, i, o, u, x, and X conversion specifiers, if a precision + // is specified, the '0' flag is ignored." + if (!precision_specified && conv.flags().zero) { + num_zeroes += num_left_spaces; + num_left_spaces = 0; + } + + sink->Append(num_left_spaces, ' '); + sink->Append(sign); + sink->Append(base_indicator); + sink->Append(num_zeroes, '0'); + sink->Append(formatted); + sink->Append(num_right_spaces, ' '); + return true; +} + +template <typename T> +bool ConvertIntImplInner(T v, const ConversionSpec &conv, + FormatSinkImpl *sink) { + ConvertedIntInfo info(v, conv.conv()); + if (conv.flags().basic && conv.conv().id() != ConversionChar::p) { + if (info.is_neg()) sink->Append(1, '-'); + if (info.digits().empty()) { + sink->Append(1, '0'); + } else { + sink->Append(info.digits()); + } + return true; + } + return ConvertIntImplInner(info, conv, sink); +} + +template <typename T> +bool ConvertIntArg(T v, const ConversionSpec &conv, FormatSinkImpl *sink) { + if (conv.conv().is_float()) { + return FormatConvertImpl(static_cast<double>(v), conv, sink).value; + } + if (conv.conv().id() == ConversionChar::c) + return ConvertCharImpl(static_cast<unsigned char>(v), conv, sink); + if (!conv.conv().is_integral()) + return false; + if (!conv.conv().is_signed() && IsSigned<T>::value) { + using U = typename MakeUnsigned<T>::type; + return FormatConvertImpl(static_cast<U>(v), conv, sink).value; + } + return ConvertIntImplInner(v, conv, sink); +} + +template <typename T> +bool ConvertFloatArg(T v, const ConversionSpec &conv, FormatSinkImpl *sink) { + return conv.conv().is_float() && ConvertFloatImpl(v, conv, sink); +} + +inline bool ConvertStringArg(string_view v, const ConversionSpec &conv, + FormatSinkImpl *sink) { + if (conv.conv().id() != ConversionChar::s) + return false; + if (conv.flags().basic) { + sink->Append(v); + return true; + } + return sink->PutPaddedString(v, conv.width(), conv.precision(), + conv.flags().left); +} + +} // namespace + +// ==================== Strings ==================== +ConvertResult<Conv::s> FormatConvertImpl(const std::string &v, + const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertStringArg(v, conv, sink)}; +} + +ConvertResult<Conv::s> FormatConvertImpl(string_view v, + const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertStringArg(v, conv, sink)}; +} + +ConvertResult<Conv::s | Conv::p> FormatConvertImpl(const char *v, + const ConversionSpec &conv, + FormatSinkImpl *sink) { + if (conv.conv().id() == ConversionChar::p) + return {FormatConvertImpl(VoidPtr(v), conv, sink).value}; + size_t len; + if (v == nullptr) { + len = 0; + } else if (conv.precision() < 0) { + len = std::strlen(v); + } else { + // If precision is set, we look for the null terminator on the valid range. + len = std::find(v, v + conv.precision(), '\0') - v; + } + return {ConvertStringArg(string_view(v, len), conv, sink)}; +} + +// ==================== Raw pointers ==================== +ConvertResult<Conv::p> FormatConvertImpl(VoidPtr v, const ConversionSpec &conv, + FormatSinkImpl *sink) { + if (conv.conv().id() != ConversionChar::p) + return {false}; + if (!v.value) { + sink->Append("(nil)"); + return {true}; + } + return {ConvertIntImplInner(v.value, conv, sink)}; +} + +// ==================== Floats ==================== +FloatingConvertResult FormatConvertImpl(float v, const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertFloatArg(v, conv, sink)}; +} +FloatingConvertResult FormatConvertImpl(double v, const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertFloatArg(v, conv, sink)}; +} +FloatingConvertResult FormatConvertImpl(long double v, + const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertFloatArg(v, conv, sink)}; +} + +// ==================== Chars ==================== +IntegralConvertResult FormatConvertImpl(char v, const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertIntArg(v, conv, sink)}; +} +IntegralConvertResult FormatConvertImpl(signed char v, + const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertIntArg(v, conv, sink)}; +} +IntegralConvertResult FormatConvertImpl(unsigned char v, + const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertIntArg(v, conv, sink)}; +} + +// ==================== Ints ==================== +IntegralConvertResult FormatConvertImpl(short v, // NOLINT + const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertIntArg(v, conv, sink)}; +} +IntegralConvertResult FormatConvertImpl(unsigned short v, // NOLINT + const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertIntArg(v, conv, sink)}; +} +IntegralConvertResult FormatConvertImpl(int v, const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertIntArg(v, conv, sink)}; +} +IntegralConvertResult FormatConvertImpl(unsigned v, const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertIntArg(v, conv, sink)}; +} +IntegralConvertResult FormatConvertImpl(long v, // NOLINT + const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertIntArg(v, conv, sink)}; +} +IntegralConvertResult FormatConvertImpl(unsigned long v, // NOLINT + const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertIntArg(v, conv, sink)}; +} +IntegralConvertResult FormatConvertImpl(long long v, // NOLINT + const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertIntArg(v, conv, sink)}; +} +IntegralConvertResult FormatConvertImpl(unsigned long long v, // NOLINT + const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertIntArg(v, conv, sink)}; +} +IntegralConvertResult FormatConvertImpl(absl::uint128 v, + const ConversionSpec &conv, + FormatSinkImpl *sink) { + return {ConvertIntArg(v, conv, sink)}; +} + +template struct FormatArgImpl::TypedVTable<str_format_internal::VoidPtr>; + +template struct FormatArgImpl::TypedVTable<bool>; +template struct FormatArgImpl::TypedVTable<char>; +template struct FormatArgImpl::TypedVTable<signed char>; +template struct FormatArgImpl::TypedVTable<unsigned char>; +template struct FormatArgImpl::TypedVTable<short>; // NOLINT +template struct FormatArgImpl::TypedVTable<unsigned short>; // NOLINT +template struct FormatArgImpl::TypedVTable<int>; +template struct FormatArgImpl::TypedVTable<unsigned>; +template struct FormatArgImpl::TypedVTable<long>; // NOLINT +template struct FormatArgImpl::TypedVTable<unsigned long>; // NOLINT +template struct FormatArgImpl::TypedVTable<long long>; // NOLINT +template struct FormatArgImpl::TypedVTable<unsigned long long>; // NOLINT +template struct FormatArgImpl::TypedVTable<absl::uint128>; + +template struct FormatArgImpl::TypedVTable<float>; +template struct FormatArgImpl::TypedVTable<double>; +template struct FormatArgImpl::TypedVTable<long double>; + +template struct FormatArgImpl::TypedVTable<const char *>; +template struct FormatArgImpl::TypedVTable<std::string>; +template struct FormatArgImpl::TypedVTable<string_view>; + +} // namespace str_format_internal + +} // namespace absl diff --git a/absl/strings/internal/str_format/arg.h b/absl/strings/internal/str_format/arg.h new file mode 100644 index 000000000000..a9562188ea91 --- /dev/null +++ b/absl/strings/internal/str_format/arg.h @@ -0,0 +1,434 @@ +#ifndef ABSL_STRINGS_INTERNAL_STR_FORMAT_ARG_H_ +#define ABSL_STRINGS_INTERNAL_STR_FORMAT_ARG_H_ + +#include <string.h> +#include <wchar.h> + +#include <cstdio> +#include <iomanip> +#include <limits> +#include <sstream> +#include <string> +#include <type_traits> + +#include "absl/base/port.h" +#include "absl/meta/type_traits.h" +#include "absl/numeric/int128.h" +#include "absl/strings/internal/str_format/extension.h" +#include "absl/strings/string_view.h" + +class Cord; +class CordReader; + +namespace absl { + +class FormatCountCapture; +class FormatSink; + +namespace str_format_internal { + +template <typename T, typename = void> +struct HasUserDefinedConvert : std::false_type {}; + +template <typename T> +struct HasUserDefinedConvert< + T, void_t<decltype(AbslFormatConvert( + std::declval<const T&>(), std::declval<const ConversionSpec&>(), + std::declval<FormatSink*>()))>> : std::true_type {}; +template <typename T> +class StreamedWrapper; + +// If 'v' can be converted (in the printf sense) according to 'conv', +// then convert it, appending to `sink` and return `true`. +// Otherwise fail and return `false`. +// Raw pointers. +struct VoidPtr { + VoidPtr() = default; + template <typename T, + decltype(reinterpret_cast<uintptr_t>(std::declval<T*>())) = 0> + VoidPtr(T* ptr) // NOLINT + : value(ptr ? reinterpret_cast<uintptr_t>(ptr) : 0) {} + uintptr_t value; +}; +ConvertResult<Conv::p> FormatConvertImpl(VoidPtr v, const ConversionSpec& conv, + FormatSinkImpl* sink); + +// Strings. +ConvertResult<Conv::s> FormatConvertImpl(const std::string& v, + const ConversionSpec& conv, + FormatSinkImpl* sink); +ConvertResult<Conv::s> FormatConvertImpl(string_view v, + const ConversionSpec& conv, + FormatSinkImpl* sink); +ConvertResult<Conv::s | Conv::p> FormatConvertImpl(const char* v, + const ConversionSpec& conv, + FormatSinkImpl* sink); +template <class AbslCord, + typename std::enable_if< + std::is_same<AbslCord, ::Cord>::value>::type* = nullptr, + class AbslCordReader = ::CordReader> +ConvertResult<Conv::s> FormatConvertImpl(const AbslCord& value, + const ConversionSpec& conv, + FormatSinkImpl* sink) { + if (conv.conv().id() != ConversionChar::s) return {false}; + + bool is_left = conv.flags().left; + size_t space_remaining = 0; + + int width = conv.width(); + if (width >= 0) space_remaining = width; + + size_t to_write = value.size(); + + int precision = conv.precision(); + if (precision >= 0) + to_write = std::min(to_write, static_cast<size_t>(precision)); + + space_remaining = Excess(to_write, space_remaining); + + if (space_remaining > 0 && !is_left) sink->Append(space_remaining, ' '); + + string_view piece; + for (AbslCordReader reader(value); + to_write > 0 && reader.ReadFragment(&piece); to_write -= piece.size()) { + if (piece.size() > to_write) piece.remove_suffix(piece.size() - to_write); + sink->Append(piece); + } + + if (space_remaining > 0 && is_left) sink->Append(space_remaining, ' '); + return {true}; +} + +using IntegralConvertResult = + ConvertResult<Conv::c | Conv::numeric | Conv::star>; +using FloatingConvertResult = ConvertResult<Conv::floating>; + +// Floats. +FloatingConvertResult FormatConvertImpl(float v, const ConversionSpec& conv, + FormatSinkImpl* sink); +FloatingConvertResult FormatConvertImpl(double v, const ConversionSpec& conv, + FormatSinkImpl* sink); +FloatingConvertResult FormatConvertImpl(long double v, + const ConversionSpec& conv, + FormatSinkImpl* sink); + +// Chars. +IntegralConvertResult FormatConvertImpl(char v, const ConversionSpec& conv, + FormatSinkImpl* sink); +IntegralConvertResult FormatConvertImpl(signed char v, + const ConversionSpec& conv, + FormatSinkImpl* sink); +IntegralConvertResult FormatConvertImpl(unsigned char v, + const ConversionSpec& conv, + FormatSinkImpl* sink); + +// Ints. +IntegralConvertResult FormatConvertImpl(short v, // NOLINT + const ConversionSpec& conv, + FormatSinkImpl* sink); +IntegralConvertResult FormatConvertImpl(unsigned short v, // NOLINT + const ConversionSpec& conv, + FormatSinkImpl* sink); +IntegralConvertResult FormatConvertImpl(int v, const ConversionSpec& conv, + FormatSinkImpl* sink); +IntegralConvertResult FormatConvertImpl(unsigned v, const ConversionSpec& conv, + FormatSinkImpl* sink); +IntegralConvertResult FormatConvertImpl(long v, // NOLINT + const ConversionSpec& conv, + FormatSinkImpl* sink); +IntegralConvertResult FormatConvertImpl(unsigned long v, // NOLINT + const ConversionSpec& conv, + FormatSinkImpl* sink); +IntegralConvertResult FormatConvertImpl(long long v, // NOLINT + const ConversionSpec& conv, + FormatSinkImpl* sink); +IntegralConvertResult FormatConvertImpl(unsigned long long v, // NOLINT + const ConversionSpec& conv, + FormatSinkImpl* sink); +IntegralConvertResult FormatConvertImpl(uint128 v, const ConversionSpec& conv, + FormatSinkImpl* sink); +template <typename T, enable_if_t<std::is_same<T, bool>::value, int> = 0> +IntegralConvertResult FormatConvertImpl(T v, const ConversionSpec& conv, + FormatSinkImpl* sink) { + return FormatConvertImpl(static_cast<int>(v), conv, sink); +} + +// We provide this function to help the checker, but it is never defined. +// FormatArgImpl will use the underlying Convert functions instead. +template <typename T> +typename std::enable_if<std::is_enum<T>::value && + !HasUserDefinedConvert<T>::value, + IntegralConvertResult>::type +FormatConvertImpl(T v, const ConversionSpec& conv, FormatSinkImpl* sink); + +template <typename T> +ConvertResult<Conv::s> FormatConvertImpl(const StreamedWrapper<T>& v, + const ConversionSpec& conv, + FormatSinkImpl* out) { + std::ostringstream oss; + oss << v.v_; + if (!oss) return {false}; + return str_format_internal::FormatConvertImpl(oss.str(), conv, out); +} + +// Use templates and dependent types to delay evaluation of the function +// until after FormatCountCapture is fully defined. +struct FormatCountCaptureHelper { + template <class T = int> + static ConvertResult<Conv::n> ConvertHelper(const FormatCountCapture& v, + const ConversionSpec& conv, + FormatSinkImpl* sink) { + const absl::enable_if_t<sizeof(T) != 0, FormatCountCapture>& v2 = v; + + if (conv.conv().id() != str_format_internal::ConversionChar::n) + return {false}; + *v2.p_ = static_cast<int>(sink->size()); + return {true}; + } +}; + +template <class T = int> +ConvertResult<Conv::n> FormatConvertImpl(const FormatCountCapture& v, + const ConversionSpec& conv, + FormatSinkImpl* sink) { + return FormatCountCaptureHelper::ConvertHelper(v, conv, sink); +} + +// Helper friend struct to hide implementation details from the public API of +// FormatArgImpl. +struct FormatArgImplFriend { + template <typename Arg> + static bool ToInt(Arg arg, int* out) { + if (!arg.vtbl_->to_int) return false; + *out = arg.vtbl_->to_int(arg.data_); + return true; + } + + template <typename Arg> + static bool Convert(Arg arg, const str_format_internal::ConversionSpec& conv, + FormatSinkImpl* out) { + return arg.vtbl_->convert(arg.data_, conv, out); + } + + template <typename Arg> + static const void* GetVTablePtrForTest(Arg arg) { + return arg.vtbl_; + } +}; + +// A type-erased handle to a format argument. +class FormatArgImpl { + private: + enum { kInlinedSpace = 8 }; + + using VoidPtr = str_format_internal::VoidPtr; + + union Data { + const void* ptr; + const volatile void* volatile_ptr; + char buf[kInlinedSpace]; + }; + + struct VTable { + bool (*convert)(Data, const str_format_internal::ConversionSpec& conv, + FormatSinkImpl* out); + int (*to_int)(Data); + }; + + template <typename T> + struct store_by_value + : std::integral_constant<bool, (sizeof(T) <= kInlinedSpace) && + (std::is_integral<T>::value || + std::is_floating_point<T>::value || + std::is_pointer<T>::value || + std::is_same<VoidPtr, T>::value)> {}; + + enum StoragePolicy { ByPointer, ByVolatilePointer, ByValue }; + template <typename T> + struct storage_policy + : std::integral_constant<StoragePolicy, + (std::is_volatile<T>::value + ? ByVolatilePointer + : (store_by_value<T>::value ? ByValue + : ByPointer))> { + }; + + // An instance of an FormatArgImpl::VTable suitable for 'T'. + template <typename T> + struct TypedVTable; + + // To reduce the number of vtables we will decay values before hand. + // Anything with a user-defined Convert will get its own vtable. + // For everything else: + // - Decay char* and char arrays into `const char*` + // - Decay any other pointer to `const void*` + // - Decay all enums to their underlying type. + // - Decay function pointers to void*. + template <typename T, typename = void> + struct DecayType { + static constexpr bool kHasUserDefined = + str_format_internal::HasUserDefinedConvert<T>::value; + using type = typename std::conditional< + !kHasUserDefined && std::is_convertible<T, const char*>::value, + const char*, + typename std::conditional<!kHasUserDefined && + std::is_convertible<T, VoidPtr>::value, + VoidPtr, const T&>::type>::type; + }; + template <typename T> + struct DecayType<T, + typename std::enable_if< + !str_format_internal::HasUserDefinedConvert<T>::value && + std::is_enum<T>::value>::type> { + using type = typename std::underlying_type<T>::type; + }; + + public: + template <typename T> + explicit FormatArgImpl(const T& value) { + using D = typename DecayType<T>::type; + static_assert( + std::is_same<D, const T&>::value || storage_policy<D>::value == ByValue, + "Decayed types must be stored by value"); + Init(static_cast<D>(value)); + } + + private: + friend struct str_format_internal::FormatArgImplFriend; + template <typename T, StoragePolicy = storage_policy<T>::value> + struct Manager; + + template <typename T> + struct Manager<T, ByPointer> { + static Data SetValue(const T& value) { + Data data; + data.ptr = &value; + return data; + } + + static const T& Value(Data arg) { return *static_cast<const T*>(arg.ptr); } + }; + + template <typename T> + struct Manager<T, ByVolatilePointer> { + static Data SetValue(const T& value) { + Data data; + data.volatile_ptr = &value; + return data; + } + + static const T& Value(Data arg) { + return *static_cast<const T*>(arg.volatile_ptr); + } + }; + + template <typename T> + struct Manager<T, ByValue> { + static Data SetValue(const T& value) { + Data data; + memcpy(data.buf, &value, sizeof(value)); + return data; + } + + static T Value(Data arg) { + T value; + memcpy(&value, arg.buf, sizeof(T)); + return value; + } + }; + + template <typename T> + void Init(const T& value); + + template <typename T> + static int ToIntVal(const T& val) { + using CommonType = typename std::conditional<std::is_signed<T>::value, + int64_t, uint64_t>::type; + if (static_cast<CommonType>(val) > + static_cast<CommonType>(std::numeric_limits<int>::max())) { + return std::numeric_limits<int>::max(); + } else if (std::is_signed<T>::value && + static_cast<CommonType>(val) < + static_cast<CommonType>(std::numeric_limits<int>::min())) { + return std::numeric_limits<int>::min(); + } + return static_cast<int>(val); + } + + Data data_; + const VTable* vtbl_; +}; + +template <typename T> +struct FormatArgImpl::TypedVTable { + private: + static bool ConvertImpl(Data arg, + const str_format_internal::ConversionSpec& conv, + FormatSinkImpl* out) { + return str_format_internal::FormatConvertImpl(Manager<T>::Value(arg), conv, + out) + .value; + } + + template <typename U = T, typename = void> + struct ToIntImpl { + static constexpr int (*value)(Data) = nullptr; + }; + + template <typename U> + struct ToIntImpl<U, + typename std::enable_if<std::is_integral<U>::value>::type> { + static int Invoke(Data arg) { return ToIntVal(Manager<T>::Value(arg)); } + static constexpr int (*value)(Data) = &Invoke; + }; + + template <typename U> + struct ToIntImpl<U, typename std::enable_if<std::is_enum<U>::value>::type> { + static int Invoke(Data arg) { + return ToIntVal(static_cast<typename std::underlying_type<T>::type>( + Manager<T>::Value(arg))); + } + static constexpr int (*value)(Data) = &Invoke; + }; + + public: + static constexpr VTable value{&ConvertImpl, ToIntImpl<>::value}; +}; + +template <typename T> +constexpr FormatArgImpl::VTable FormatArgImpl::TypedVTable<T>::value; + +template <typename T> +void FormatArgImpl::Init(const T& value) { + data_ = Manager<T>::SetValue(value); + vtbl_ = &TypedVTable<T>::value; +} + +extern template struct FormatArgImpl::TypedVTable<str_format_internal::VoidPtr>; + +extern template struct FormatArgImpl::TypedVTable<bool>; +extern template struct FormatArgImpl::TypedVTable<char>; +extern template struct FormatArgImpl::TypedVTable<signed char>; +extern template struct FormatArgImpl::TypedVTable<unsigned char>; +extern template struct FormatArgImpl::TypedVTable<short>; // NOLINT +extern template struct FormatArgImpl::TypedVTable<unsigned short>; // NOLINT +extern template struct FormatArgImpl::TypedVTable<int>; +extern template struct FormatArgImpl::TypedVTable<unsigned>; +extern template struct FormatArgImpl::TypedVTable<long>; // NOLINT +extern template struct FormatArgImpl::TypedVTable<unsigned long>; // NOLINT +extern template struct FormatArgImpl::TypedVTable<long long>; // NOLINT +extern template struct FormatArgImpl::TypedVTable< + unsigned long long>; // NOLINT +extern template struct FormatArgImpl::TypedVTable<uint128>; + +extern template struct FormatArgImpl::TypedVTable<float>; +extern template struct FormatArgImpl::TypedVTable<double>; +extern template struct FormatArgImpl::TypedVTable<long double>; + +extern template struct FormatArgImpl::TypedVTable<const char*>; +extern template struct FormatArgImpl::TypedVTable<std::string>; +extern template struct FormatArgImpl::TypedVTable<string_view>; +} // namespace str_format_internal +} // namespace absl + +#endif // ABSL_STRINGS_INTERNAL_STR_FORMAT_ARG_H_ diff --git a/absl/strings/internal/str_format/arg_test.cc b/absl/strings/internal/str_format/arg_test.cc new file mode 100644 index 000000000000..83d59048ea27 --- /dev/null +++ b/absl/strings/internal/str_format/arg_test.cc @@ -0,0 +1,111 @@ +// Copyright 2017 The Abseil Authors. +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +#include "absl/strings/internal/str_format/arg.h" + +#include <ostream> +#include <string> +#include "gtest/gtest.h" +#include "absl/strings/str_format.h" + +namespace absl { +namespace str_format_internal { +namespace { + +class FormatArgImplTest : public ::testing::Test { + public: + enum Color { kRed, kGreen, kBlue }; + + static const char *hi() { return "hi"; } +}; + +TEST_F(FormatArgImplTest, ToInt) { + int out = 0; + EXPECT_TRUE(FormatArgImplFriend::ToInt(FormatArgImpl(1), &out)); + EXPECT_EQ(1, out); + EXPECT_TRUE(FormatArgImplFriend::ToInt(FormatArgImpl(-1), &out)); + EXPECT_EQ(-1, out); + EXPECT_TRUE( + FormatArgImplFriend::ToInt(FormatArgImpl(static_cast<char>(64)), &out)); + EXPECT_EQ(64, out); + EXPECT_TRUE(FormatArgImplFriend::ToInt( + FormatArgImpl(static_cast<unsigned long long>(123456)), &out)); // NOLINT + EXPECT_EQ(123456, out); + EXPECT_TRUE(FormatArgImplFriend::ToInt( + FormatArgImpl(static_cast<unsigned long long>( // NOLINT + std::numeric_limits<int>::max()) + + 1), + &out)); + EXPECT_EQ(std::numeric_limits<int>::max(), out); + EXPECT_TRUE(FormatArgImplFriend::ToInt( + FormatArgImpl(static_cast<long long>( // NOLINT + std::numeric_limits<int>::min()) - + 10), + &out)); + EXPECT_EQ(std::numeric_limits<int>::min(), out); + EXPECT_TRUE(FormatArgImplFriend::ToInt(FormatArgImpl(false), &out)); + EXPECT_EQ(0, out); + EXPECT_TRUE(FormatArgImplFriend::ToInt(FormatArgImpl(true), &out)); + EXPECT_EQ(1, out); + EXPECT_FALSE(FormatArgImplFriend::ToInt(FormatArgImpl(2.2), &out)); + EXPECT_FALSE(FormatArgImplFriend::ToInt(FormatArgImpl(3.2f), &out)); + EXPECT_FALSE(FormatArgImplFriend::ToInt( + FormatArgImpl(static_cast<int *>(nullptr)), &out)); + EXPECT_FALSE(FormatArgImplFriend::ToInt(FormatArgImpl(hi()), &out)); + EXPECT_FALSE(FormatArgImplFriend::ToInt(FormatArgImpl("hi"), &out)); + EXPECT_TRUE(FormatArgImplFriend::ToInt(FormatArgImpl(kBlue), &out)); + EXPECT_EQ(2, out); +} + +extern const char kMyArray[]; + +TEST_F(FormatArgImplTest, CharArraysDecayToCharPtr) { + const char* a = ""; + EXPECT_EQ(FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl(a)), + FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl(""))); + EXPECT_EQ(FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl(a)), + FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl("A"))); + EXPECT_EQ(FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl(a)), + FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl("ABC"))); + EXPECT_EQ(FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl(a)), + FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl(kMyArray))); +} + +TEST_F(FormatArgImplTest, OtherPtrDecayToVoidPtr) { + auto expected = FormatArgImplFriend::GetVTablePtrForTest( + FormatArgImpl(static_cast<void *>(nullptr))); + EXPECT_EQ(FormatArgImplFriend::GetVTablePtrForTest( + FormatArgImpl(static_cast<int *>(nullptr))), + expected); + EXPECT_EQ(FormatArgImplFriend::GetVTablePtrForTest( + FormatArgImpl(static_cast<volatile int *>(nullptr))), + expected); + + auto p = static_cast<void (*)()>([] {}); + EXPECT_EQ(FormatArgImplFriend::GetVTablePtrForTest(FormatArgImpl(p)), + expected); +} + +TEST_F(FormatArgImplTest, WorksWithCharArraysOfUnknownSize) { + std::string s; + FormatSinkImpl sink(&s); + ConversionSpec conv; + conv.set_conv(ConversionChar::FromChar('s')); + conv.set_flags(Flags()); + conv.set_width(-1); + conv.set_precision(-1); + EXPECT_TRUE( + FormatArgImplFriend::Convert(FormatArgImpl(kMyArray), conv, &sink)); + sink.Flush(); + EXPECT_EQ("ABCDE", s); +} +const char kMyArray[] = "ABCDE"; + +} // namespace +} // namespace str_format_internal +} // namespace absl diff --git a/absl/strings/internal/str_format/bind.cc b/absl/strings/internal/str_format/bind.cc new file mode 100644 index 000000000000..33e8641558ab --- /dev/null +++ b/absl/strings/internal/str_format/bind.cc @@ -0,0 +1,232 @@ +#include "absl/strings/internal/str_format/bind.h" + +#include <cerrno> +#include <limits> +#include <sstream> +#include <string> + +namespace absl { +namespace str_format_internal { + +namespace { + +inline bool BindFromPosition(int position, int* value, + absl::Span<const FormatArgImpl> pack) { + assert(position > 0); + if (static_cast<size_t>(position) > pack.size()) { + return false; + } + // -1 because positions are 1-based + return FormatArgImplFriend::ToInt(pack[position - 1], value); +} + +class ArgContext { + public: + explicit ArgContext(absl::Span<const FormatArgImpl> pack) : pack_(pack) {} + + // Fill 'bound' with the results of applying the context's argument pack + // to the specified 'props'. We synthesize a BoundConversion by + // lining up a UnboundConversion with a user argument. We also + // resolve any '*' specifiers for width and precision, so after + // this call, 'bound' has all the information it needs to be formatted. + // Returns false on failure. + bool Bind(const UnboundConversion *props, BoundConversion *bound); + + private: + absl::Span<const FormatArgImpl> pack_; +}; + +inline bool ArgContext::Bind(const UnboundConversion* unbound, + BoundConversion* bound) { + const FormatArgImpl* arg = nullptr; + int arg_position = unbound->arg_position; + if (static_cast<size_t>(arg_position - 1) >= pack_.size()) return false; + arg = &pack_[arg_position - 1]; // 1-based + + if (!unbound->flags.basic) { + int width = unbound->width.value(); + bool force_left = false; + if (unbound->width.is_from_arg()) { + if (!BindFromPosition(unbound->width.get_from_arg(), &width, pack_)) + return false; + if (width < 0) { + // "A negative field width is taken as a '-' flag followed by a + // positive field width." + force_left = true; + width = -width; + } + } + + int precision = unbound->precision.value(); + if (unbound->precision.is_from_arg()) { + if (!BindFromPosition(unbound->precision.get_from_arg(), &precision, + pack_)) + return false; + } + + bound->set_width(width); + bound->set_precision(precision); + bound->set_flags(unbound->flags); + if (force_left) + bound->set_left(true); + } else { + bound->set_flags(unbound->flags); + bound->set_width(-1); + bound->set_precision(-1); + } + + bound->set_length_mod(unbound->length_mod); + bound->set_conv(unbound->conv); + bound->set_arg(arg); + return true; +} + +template <typename Converter> +class ConverterConsumer { + public: + ConverterConsumer(Converter converter, absl::Span<const FormatArgImpl> pack) + : converter_(converter), arg_context_(pack) {} + + bool Append(string_view s) { + converter_.Append(s); + return true; + } + bool ConvertOne(const UnboundConversion& conv, string_view conv_string) { + BoundConversion bound; + if (!arg_context_.Bind(&conv, &bound)) return false; + return converter_.ConvertOne(bound, conv_string); + } + + private: + Converter converter_; + ArgContext arg_context_; +}; + +template <typename Converter> +bool ConvertAll(const UntypedFormatSpecImpl& format, + absl::Span<const FormatArgImpl> args, + const Converter& converter) { + const ParsedFormatBase* pc = format.parsed_conversion(); + if (pc) + return pc->ProcessFormat(ConverterConsumer<Converter>(converter, args)); + + return ParseFormatString(format.str(), + ConverterConsumer<Converter>(converter, args)); +} + +class DefaultConverter { + public: + explicit DefaultConverter(FormatSinkImpl* sink) : sink_(sink) {} + + void Append(string_view s) const { sink_->Append(s); } + + bool ConvertOne(const BoundConversion& bound, string_view /*conv*/) const { + return FormatArgImplFriend::Convert(*bound.arg(), bound, sink_); + } + + private: + FormatSinkImpl* sink_; +}; + +class SummarizingConverter { + public: + explicit SummarizingConverter(FormatSinkImpl* sink) : sink_(sink) {} + + void Append(string_view s) const { sink_->Append(s); } + + bool ConvertOne(const BoundConversion& bound, string_view /*conv*/) const { + UntypedFormatSpecImpl spec("%d"); + + std::ostringstream ss; + ss << "{" << Streamable(spec, {*bound.arg()}) << ":" << bound.flags(); + if (bound.width() >= 0) ss << bound.width(); + if (bound.precision() >= 0) ss << "." << bound.precision(); + ss << bound.length_mod() << bound.conv() << "}"; + Append(ss.str()); + return true; + } + + private: + FormatSinkImpl* sink_; +}; + +} // namespace + +bool BindWithPack(const UnboundConversion* props, + absl::Span<const FormatArgImpl> pack, + BoundConversion* bound) { + return ArgContext(pack).Bind(props, bound); +} + +std::string Summarize(const UntypedFormatSpecImpl& format, + absl::Span<const FormatArgImpl> args) { + typedef SummarizingConverter Converter; + std::string out; + { + // inner block to destroy sink before returning out. It ensures a last + // flush. + FormatSinkImpl sink(&out); + if (!ConvertAll(format, args, Converter(&sink))) { + sink.Flush(); + out.clear(); + } + } + return out; +} + +bool FormatUntyped(FormatRawSinkImpl raw_sink, + const UntypedFormatSpecImpl& format, + absl::Span<const FormatArgImpl> args) { + FormatSinkImpl sink(raw_sink); + using Converter = DefaultConverter; + if (!ConvertAll(format, args, Converter(&sink))) { + sink.Flush(); + return false; + } + return true; +} + +std::ostream& Streamable::Print(std::ostream& os) const { + if (!FormatUntyped(&os, format_, args_)) os.setstate(std::ios::failbit); + return os; +} + +std::string& AppendPack(std::string* out, const UntypedFormatSpecImpl& format, + absl::Span<const FormatArgImpl> args) { + size_t orig = out->size(); + if (!FormatUntyped(out, format, args)) out->resize(orig); + return *out; +} + +int FprintF(std::FILE* output, const UntypedFormatSpecImpl& format, + absl::Span<const FormatArgImpl> args) { + FILERawSink sink(output); + if (!FormatUntyped(&sink, format, args)) { + errno = EINVAL; + return -1; + } + if (sink.error()) { + errno = sink.error(); + return -1; + } + if (sink.count() > std::numeric_limits<int>::max()) { + errno = EFBIG; + return -1; + } + return static_cast<int>(sink.count()); +} + +int SnprintF(char* output, size_t size, const UntypedFormatSpecImpl& format, + absl::Span<const FormatArgImpl> args) { + BufferRawSink sink(output, size ? size - 1 : 0); + if (!FormatUntyped(&sink, format, args)) { + errno = EINVAL; + return -1; + } + size_t total = sink.total_written(); + if (size) output[std::min(total, size - 1)] = 0; + return static_cast<int>(total); +} + +} // namespace str_format_internal +} // namespace absl diff --git a/absl/strings/internal/str_format/bind.h b/absl/strings/internal/str_format/bind.h new file mode 100644 index 000000000000..4008611211cf --- /dev/null +++ b/absl/strings/internal/str_format/bind.h @@ -0,0 +1,189 @@ +#ifndef ABSL_STRINGS_INTERNAL_STR_FORMAT_BIND_H_ +#define ABSL_STRINGS_INTERNAL_STR_FORMAT_BIND_H_ + +#include <array> +#include <cstdio> +#include <sstream> +#include <string> + +#include "absl/base/port.h" +#include "absl/container/inlined_vector.h" +#include "absl/strings/internal/str_format/arg.h" +#include "absl/strings/internal/str_format/checker.h" +#include "absl/strings/internal/str_format/parser.h" +#include "absl/types/span.h" + +namespace absl { + +class UntypedFormatSpec; + +namespace str_format_internal { + +class BoundConversion : public ConversionSpec { + public: + const FormatArgImpl* arg() const { return arg_; } + void set_arg(const FormatArgImpl* a) { arg_ = a; } + + private: + const FormatArgImpl* arg_; +}; + +// This is the type-erased class that the implementation uses. +class UntypedFormatSpecImpl { + public: + UntypedFormatSpecImpl() = delete; + + explicit UntypedFormatSpecImpl(string_view s) : str_(s), pc_() {} + explicit UntypedFormatSpecImpl( + const str_format_internal::ParsedFormatBase* pc) + : pc_(pc) {} + string_view str() const { return str_; } + const str_format_internal::ParsedFormatBase* parsed_conversion() const { + return pc_; + } + + template <typename T> + static const UntypedFormatSpecImpl& Extract(const T& s) { + return s.spec_; + } + + private: + string_view str_; + const str_format_internal::ParsedFormatBase* pc_; +}; + +template <typename T, typename...> +struct MakeDependent { + using type = T; +}; + +// Implicitly convertible from `const char*`, `string_view`, and the +// `ExtendedParsedFormat` type. This abstraction allows all format functions to +// operate on any without providing too many overloads. +template <typename... Args> +class FormatSpecTemplate + : public MakeDependent<UntypedFormatSpec, Args...>::type { + using Base = typename MakeDependent<UntypedFormatSpec, Args...>::type; + + public: +#if ABSL_INTERNAL_ENABLE_FORMAT_CHECKER + + // Honeypot overload for when the std::string is not constexpr. + // We use the 'unavailable' attribute to give a better compiler error than + // just 'method is deleted'. + FormatSpecTemplate(...) // NOLINT + __attribute__((unavailable("Format std::string is not constexpr."))); + + // Honeypot overload for when the format is constexpr and invalid. + // We use the 'unavailable' attribute to give a better compiler error than + // just 'method is deleted'. + // To avoid checking the format twice, we just check that the format is + // constexpr. If is it valid, then the overload below will kick in. + // We add the template here to make this overload have lower priority. + template <typename = void> + FormatSpecTemplate(const char* s) // NOLINT + __attribute__(( + enable_if(str_format_internal::EnsureConstexpr(s), "constexpr trap"), + unavailable( + "Format specified does not match the arguments passed."))); + + template <typename T = void> + FormatSpecTemplate(string_view s) // NOLINT + __attribute__((enable_if(str_format_internal::EnsureConstexpr(s), + "constexpr trap"))) { + static_assert(sizeof(T*) == 0, + "Format specified does not match the arguments passed."); + } + + // Good format overload. + FormatSpecTemplate(const char* s) // NOLINT + __attribute__((enable_if(ValidFormatImpl<ArgumentToConv<Args>()...>(s), + "bad format trap"))) + : Base(s) {} + + FormatSpecTemplate(string_view s) // NOLINT + __attribute__((enable_if(ValidFormatImpl<ArgumentToConv<Args>()...>(s), + "bad format trap"))) + : Base(s) {} + +#else // ABSL_INTERNAL_ENABLE_FORMAT_CHECKER + + FormatSpecTemplate(const char* s) : Base(s) {} // NOLINT + FormatSpecTemplate(string_view s) : Base(s) {} // NOLINT + +#endif // ABSL_INTERNAL_ENABLE_FORMAT_CHECKER + + template <Conv... C, typename = typename std::enable_if< + sizeof...(C) == sizeof...(Args) && + AllOf(Contains(ArgumentToConv<Args>(), + C)...)>::type> + FormatSpecTemplate(const ExtendedParsedFormat<C...>& pc) // NOLINT + : Base(&pc) {} +}; + +template <typename... Args> +struct FormatSpecDeductionBarrier { + using type = FormatSpecTemplate<Args...>; +}; + +class Streamable { + public: + Streamable(const UntypedFormatSpecImpl& format, + absl::Span<const FormatArgImpl> args) + : format_(format), args_(args.begin(), args.end()) {} + + std::ostream& Print(std::ostream& os) const; + + friend std::ostream& operator<<(std::ostream& os, const Streamable& l) { + return l.Print(os); + } + + private: + const UntypedFormatSpecImpl& format_; + absl::InlinedVector<FormatArgImpl, 4> args_; +}; + +// for testing +std::string Summarize(const UntypedFormatSpecImpl& format, + absl::Span<const FormatArgImpl> args); +bool BindWithPack(const UnboundConversion* props, + absl::Span<const FormatArgImpl> pack, BoundConversion* bound); + +bool FormatUntyped(FormatRawSinkImpl raw_sink, + const UntypedFormatSpecImpl& format, + absl::Span<const FormatArgImpl> args); + +std::string& AppendPack(std::string* out, const UntypedFormatSpecImpl& format, + absl::Span<const FormatArgImpl> args); + +inline std::string FormatPack(const UntypedFormatSpecImpl& format, + absl::Span<const FormatArgImpl> args) { + std::string out; + AppendPack(&out, format, args); + return out; +} + +int FprintF(std::FILE* output, const UntypedFormatSpecImpl& format, + absl::Span<const FormatArgImpl> args); +int SnprintF(char* output, size_t size, const UntypedFormatSpecImpl& format, + absl::Span<const FormatArgImpl> args); + +// Returned by Streamed(v). Converts via '%s' to the std::string created +// by std::ostream << v. +template <typename T> +class StreamedWrapper { + public: + explicit StreamedWrapper(const T& v) : v_(v) { } + + private: + template <typename S> + friend ConvertResult<Conv::s> FormatConvertImpl(const StreamedWrapper<S>& v, + const ConversionSpec& conv, + FormatSinkImpl* out); + const T& v_; +}; + +} // namespace str_format_internal +} // namespace absl + +#endif // ABSL_STRINGS_INTERNAL_STR_FORMAT_BIND_H_ diff --git a/absl/strings/internal/str_format/bind_test.cc b/absl/strings/internal/str_format/bind_test.cc new file mode 100644 index 000000000000..47575739ba13 --- /dev/null +++ b/absl/strings/internal/str_format/bind_test.cc @@ -0,0 +1,131 @@ +#include "absl/strings/internal/str_format/bind.h" + +#include <string.h> + +#include "gtest/gtest.h" + +namespace absl { +namespace str_format_internal { +namespace { + +template <typename T, size_t N> +size_t ArraySize(T (&)[N]) { + return N; +} + +class FormatBindTest : public ::testing::Test { + public: + bool Extract(const char *s, UnboundConversion *props, int *next) const { + absl::string_view src = s; + return ConsumeUnboundConversion(&src, props, next) && src.empty(); + } +}; + +TEST_F(FormatBindTest, BindSingle) { + struct Expectation { + int line; + const char *fmt; + int ok_phases; + const FormatArgImpl *arg; + int width; + int precision; + int next_arg; + }; + const int no = -1; + const int ia[] = { 10, 20, 30, 40}; + const FormatArgImpl args[] = {FormatArgImpl(ia[0]), FormatArgImpl(ia[1]), + FormatArgImpl(ia[2]), FormatArgImpl(ia[3])}; +#pragma GCC diagnostic push +#pragma GCC diagnostic ignored "-Wmissing-field-initializers" + const Expectation kExpect[] = { + {__LINE__, "d", 2, &args[0], no, no, 2}, + {__LINE__, "4d", 2, &args[0], 4, no, 2}, + {__LINE__, ".5d", 2, &args[0], no, 5, 2}, + {__LINE__, "4.5d", 2, &args[0], 4, 5, 2}, + {__LINE__, "*d", 2, &args[1], 10, no, 3}, + {__LINE__, ".*d", 2, &args[1], no, 10, 3}, + {__LINE__, "*.*d", 2, &args[2], 10, 20, 4}, + {__LINE__, "1$d", 2, &args[0], no, no, 0}, + {__LINE__, "2$d", 2, &args[1], no, no, 0}, + {__LINE__, "3$d", 2, &args[2], no, no, 0}, + {__LINE__, "4$d", 2, &args[3], no, no, 0}, + {__LINE__, "2$*1$d", 2, &args[1], 10, no, 0}, + {__LINE__, "2$*2$d", 2, &args[1], 20, no, 0}, + {__LINE__, "2$*3$d", 2, &args[1], 30, no, 0}, + {__LINE__, "2$.*1$d", 2, &args[1], no, 10, 0}, + {__LINE__, "2$.*2$d", 2, &args[1], no, 20, 0}, + {__LINE__, "2$.*3$d", 2, &args[1], no, 30, 0}, + {__LINE__, "2$*3$.*1$d", 2, &args[1], 30, 10, 0}, + {__LINE__, "2$*2$.*2$d", 2, &args[1], 20, 20, 0}, + {__LINE__, "2$*1$.*3$d", 2, &args[1], 10, 30, 0}, + {__LINE__, "2$*3$.*1$d", 2, &args[1], 30, 10, 0}, + {__LINE__, "1$*d", 0}, // indexed, then positional + {__LINE__, "*2$d", 0}, // positional, then indexed + {__LINE__, "6$d", 1}, // arg position out of bounds + {__LINE__, "1$6$d", 0}, // width position incorrectly specified + {__LINE__, "1$.6$d", 0}, // precision position incorrectly specified + {__LINE__, "1$*6$d", 1}, // width position out of bounds + {__LINE__, "1$.*6$d", 1}, // precision position out of bounds + }; +#pragma GCC diagnostic pop + for (const Expectation &e : kExpect) { + SCOPED_TRACE(e.line); + SCOPED_TRACE(e.fmt); + UnboundConversion props; + BoundConversion bound; + int ok_phases = 0; + int next = 0; + if (Extract(e.fmt, &props, &next)) { + ++ok_phases; + if (BindWithPack(&props, args, &bound)) { + ++ok_phases; + } + } + EXPECT_EQ(e.ok_phases, ok_phases); + if (e.ok_phases < 2) continue; + if (e.arg != nullptr) { + EXPECT_EQ(e.arg, bound.arg()); + } + EXPECT_EQ(e.width, bound.width()); + EXPECT_EQ(e.precision, bound.precision()); + } +} + +TEST_F(FormatBindTest, FormatPack) { + struct Expectation { + int line; + const char *fmt; + const char *summary; + }; + const int ia[] = { 10, 20, 30, 40, -10 }; + const FormatArgImpl args[] = {FormatArgImpl(ia[0]), FormatArgImpl(ia[1]), + FormatArgImpl(ia[2]), FormatArgImpl(ia[3]), + FormatArgImpl(ia[4])}; + const Expectation kExpect[] = { + {__LINE__, "a%4db%dc", "a{10:4d}b{20:d}c"}, + {__LINE__, "a%.4db%dc", "a{10:.4d}b{20:d}c"}, + {__LINE__, "a%4.5db%dc", "a{10:4.5d}b{20:d}c"}, + {__LINE__, "a%db%4.5dc", "a{10:d}b{20:4.5d}c"}, + {__LINE__, "a%db%*.*dc", "a{10:d}b{40:20.30d}c"}, + {__LINE__, "a%.*fb", "a{20:.10f}b"}, + {__LINE__, "a%1$db%2$*3$.*4$dc", "a{10:d}b{20:30.40d}c"}, + {__LINE__, "a%4$db%3$*2$.*1$dc", "a{40:d}b{30:20.10d}c"}, + {__LINE__, "a%04ldb", "a{10:04ld}b"}, + {__LINE__, "a%-#04lldb", "a{10:-#04lld}b"}, + {__LINE__, "a%1$*5$db", "a{10:-10d}b"}, + {__LINE__, "a%1$.*5$db", "a{10:d}b"}, + }; + for (const Expectation &e : kExpect) { + absl::string_view fmt = e.fmt; + SCOPED_TRACE(e.line); + SCOPED_TRACE(e.fmt); + UntypedFormatSpecImpl format(fmt); + EXPECT_EQ(e.summary, + str_format_internal::Summarize(format, absl::MakeSpan(args))) + << "line:" << e.line; + } +} + +} // namespace +} // namespace str_format_internal +} // namespace absl diff --git a/absl/strings/internal/str_format/checker.h b/absl/strings/internal/str_format/checker.h new file mode 100644 index 000000000000..8b594f2d5cc6 --- /dev/null +++ b/absl/strings/internal/str_format/checker.h @@ -0,0 +1,325 @@ +#ifndef ABSL_STRINGS_INTERNAL_STR_FORMAT_CHECKER_H_ +#define ABSL_STRINGS_INTERNAL_STR_FORMAT_CHECKER_H_ + +#include "absl/strings/internal/str_format/arg.h" +#include "absl/strings/internal/str_format/extension.h" + +// Compile time check support for entry points. + +#ifndef ABSL_INTERNAL_ENABLE_FORMAT_CHECKER +#if defined(__clang__) && !defined(__native_client__) +#if __has_attribute(enable_if) +#define ABSL_INTERNAL_ENABLE_FORMAT_CHECKER 1 +#endif // __has_attribute(enable_if) +#endif // defined(__clang__) && !defined(__native_client__) +#endif // ABSL_INTERNAL_ENABLE_FORMAT_CHECKER + +namespace absl { +namespace str_format_internal { + +constexpr bool AllOf() { return true; } + +template <typename... T> +constexpr bool AllOf(bool b, T... t) { + return b && AllOf(t...); +} + +template <typename Arg> +constexpr Conv ArgumentToConv() { + return decltype(str_format_internal::FormatConvertImpl( + std::declval<const Arg&>(), std::declval<const ConversionSpec&>(), + std::declval<FormatSinkImpl*>()))::kConv; +} + +#if ABSL_INTERNAL_ENABLE_FORMAT_CHECKER + +constexpr bool ContainsChar(const char* chars, char c) { + return *chars == c || (*chars && ContainsChar(chars + 1, c)); +} + +// A constexpr compatible list of Convs. +struct ConvList { + const Conv* array; + int count; + + // We do the bound check here to avoid having to do it on the callers. + // Returning an empty Conv has the same effect as short circuiting because it + // will never match any conversion. + constexpr Conv operator[](int i) const { + return i < count ? array[i] : Conv{}; + } + + constexpr ConvList without_front() const { + return count != 0 ? ConvList{array + 1, count - 1} : *this; + } +}; + +template <size_t count> +struct ConvListT { + // Make sure the array has size > 0. + Conv list[count ? count : 1]; +}; + +constexpr char GetChar(string_view str, size_t index) { + return index < str.size() ? str[index] : char{}; +} + +constexpr string_view ConsumeFront(string_view str, size_t len = 1) { + return len <= str.size() ? string_view(str.data() + len, str.size() - len) + : string_view(); +} + +constexpr string_view ConsumeAnyOf(string_view format, const char* chars) { + return ContainsChar(chars, GetChar(format, 0)) + ? ConsumeAnyOf(ConsumeFront(format), chars) + : format; +} + +constexpr bool IsDigit(char c) { return c >= '0' && c <= '9'; } + +// Helper class for the ParseDigits function. +// It encapsulates the two return values we need there. +struct Integer { + string_view format; + int value; + + // If the next character is a '$', consume it. + // Otherwise, make `this` an invalid positional argument. + constexpr Integer ConsumePositionalDollar() const { + return GetChar(format, 0) == '$' ? Integer{ConsumeFront(format), value} + : Integer{format, 0}; + } +}; + +constexpr Integer ParseDigits(string_view format, int value = 0) { + return IsDigit(GetChar(format, 0)) + ? ParseDigits(ConsumeFront(format), + 10 * value + GetChar(format, 0) - '0') + : Integer{format, value}; +} + +// Parse digits for a positional argument. +// The parsing also consumes the '$'. +constexpr Integer ParsePositional(string_view format) { + return ParseDigits(format).ConsumePositionalDollar(); +} + +// Parses a single conversion specifier. +// See ConvParser::Run() for post conditions. +class ConvParser { + constexpr ConvParser SetFormat(string_view format) const { + return ConvParser(format, args_, error_, arg_position_, is_positional_); + } + + constexpr ConvParser SetArgs(ConvList args) const { + return ConvParser(format_, args, error_, arg_position_, is_positional_); + } + + constexpr ConvParser SetError(bool error) const { + return ConvParser(format_, args_, error_ || error, arg_position_, + is_positional_); + } + + constexpr ConvParser SetArgPosition(int arg_position) const { + return ConvParser(format_, args_, error_, arg_position, is_positional_); + } + + // Consumes the next arg and verifies that it matches `conv`. + // `error_` is set if there is no next arg or if it doesn't match `conv`. + constexpr ConvParser ConsumeNextArg(char conv) const { + return SetArgs(args_.without_front()).SetError(!Contains(args_[0], conv)); + } + + // Verify that positional argument `i.value` matches `conv`. + // `error_` is set if `i.value` is not a valid argument or if it doesn't + // match. + constexpr ConvParser VerifyPositional(Integer i, char conv) const { + return SetFormat(i.format).SetError(!Contains(args_[i.value - 1], conv)); + } + + // Parse the position of the arg and store it in `arg_position_`. + constexpr ConvParser ParseArgPosition(Integer arg) const { + return SetFormat(arg.format).SetArgPosition(arg.value); + } + + // Consume the flags. + constexpr ConvParser ParseFlags() const { + return SetFormat(ConsumeAnyOf(format_, "-+ #0")); + } + + // Consume the width. + // If it is '*', we verify that it matches `args_`. `error_` is set if it + // doesn't match. + constexpr ConvParser ParseWidth() const { + return IsDigit(GetChar(format_, 0)) + ? SetFormat(ParseDigits(format_).format) + : GetChar(format_, 0) == '*' + ? is_positional_ + ? VerifyPositional( + ParsePositional(ConsumeFront(format_)), '*') + : SetFormat(ConsumeFront(format_)) + .ConsumeNextArg('*') + : *this; + } + + // Consume the precision. + // If it is '*', we verify that it matches `args_`. `error_` is set if it + // doesn't match. + constexpr ConvParser ParsePrecision() const { + return GetChar(format_, 0) != '.' + ? *this + : GetChar(format_, 1) == '*' + ? is_positional_ + ? VerifyPositional( + ParsePositional(ConsumeFront(format_, 2)), '*') + : SetFormat(ConsumeFront(format_, 2)) + .ConsumeNextArg('*') + : SetFormat(ParseDigits(ConsumeFront(format_)).format); + } + + // Consume the length characters. + constexpr ConvParser ParseLength() const { + return SetFormat(ConsumeAnyOf(format_, "lLhjztq")); + } + + // Consume the conversion character and verify that it matches `args_`. + // `error_` is set if it doesn't match. + constexpr ConvParser ParseConversion() const { + return is_positional_ + ? VerifyPositional({ConsumeFront(format_), arg_position_}, + GetChar(format_, 0)) + : ConsumeNextArg(GetChar(format_, 0)) + .SetFormat(ConsumeFront(format_)); + } + + constexpr ConvParser(string_view format, ConvList args, bool error, + int arg_position, bool is_positional) + : format_(format), + args_(args), + error_(error), + arg_position_(arg_position), + is_positional_(is_positional) {} + + public: + constexpr ConvParser(string_view format, ConvList args, bool is_positional) + : format_(format), + args_(args), + error_(false), + arg_position_(0), + is_positional_(is_positional) {} + + // Consume the whole conversion specifier. + // `format()` will be set to the character after the conversion character. + // `error()` will be set if any of the arguments do not match. + constexpr ConvParser Run() const { + return (is_positional_ ? ParseArgPosition(ParsePositional(format_)) : *this) + .ParseFlags() + .ParseWidth() + .ParsePrecision() + .ParseLength() + .ParseConversion(); + } + + constexpr string_view format() const { return format_; } + constexpr ConvList args() const { return args_; } + constexpr bool error() const { return error_; } + constexpr bool is_positional() const { return is_positional_; } + + private: + string_view format_; + // Current list of arguments. If we are not in positional mode we will consume + // from the front. + ConvList args_; + bool error_; + // Holds the argument position of the conversion character, if we are in + // positional mode. Otherwise, it is unspecified. + int arg_position_; + // Whether we are in positional mode. + // It changes the behavior of '*' and where to find the converted argument. + bool is_positional_; +}; + +// Parses a whole format expression. +// See FormatParser::Run(). +class FormatParser { + static constexpr bool FoundPercent(string_view format) { + return format.empty() || + (GetChar(format, 0) == '%' && GetChar(format, 1) != '%'); + } + + // We use an inner function to increase the recursion limit. + // The inner function consumes up to `limit` characters on every run. + // This increases the limit from 512 to ~512*limit. + static constexpr string_view ConsumeNonPercentInner(string_view format, + int limit = 20) { + return FoundPercent(format) || !limit + ? format + : ConsumeNonPercentInner( + ConsumeFront(format, GetChar(format, 0) == '%' && + GetChar(format, 1) == '%' + ? 2 + : 1), + limit - 1); + } + + // Consume characters until the next conversion spec %. + // It skips %%. + static constexpr string_view ConsumeNonPercent(string_view format) { + return FoundPercent(format) + ? format + : ConsumeNonPercent(ConsumeNonPercentInner(format)); + } + + static constexpr bool IsPositional(string_view format) { + return IsDigit(GetChar(format, 0)) ? IsPositional(ConsumeFront(format)) + : GetChar(format, 0) == '$'; + } + + constexpr bool RunImpl(bool is_positional) const { + // In non-positional mode we require all arguments to be consumed. + // In positional mode just reaching the end of the format without errors is + // enough. + return (format_.empty() && (is_positional || args_.count == 0)) || + (!format_.empty() && + ValidateArg( + ConvParser(ConsumeFront(format_), args_, is_positional).Run())); + } + + constexpr bool ValidateArg(ConvParser conv) const { + return !conv.error() && FormatParser(conv.format(), conv.args()) + .RunImpl(conv.is_positional()); + } + + public: + constexpr FormatParser(string_view format, ConvList args) + : format_(ConsumeNonPercent(format)), args_(args) {} + + // Runs the parser for `format` and `args`. + // It verifies that the format is valid and that all conversion specifiers + // match the arguments passed. + // In non-positional mode it also verfies that all arguments are consumed. + constexpr bool Run() const { + return RunImpl(!format_.empty() && IsPositional(ConsumeFront(format_))); + } + + private: + string_view format_; + // Current list of arguments. + // If we are not in positional mode we will consume from the front and will + // have to be empty in the end. + ConvList args_; +}; + +template <Conv... C> +constexpr bool ValidFormatImpl(string_view format) { + return FormatParser(format, + {ConvListT<sizeof...(C)>{{C...}}.list, sizeof...(C)}) + .Run(); +} + +#endif // ABSL_INTERNAL_ENABLE_FORMAT_CHECKER + +} // namespace str_format_internal +} // namespace absl + +#endif // ABSL_STRINGS_INTERNAL_STR_FORMAT_CHECKER_H_ diff --git a/absl/strings/internal/str_format/checker_test.cc b/absl/strings/internal/str_format/checker_test.cc new file mode 100644 index 000000000000..14d11ea8bd30 --- /dev/null +++ b/absl/strings/internal/str_format/checker_test.cc @@ -0,0 +1,150 @@ +#include <string> + +#include "gmock/gmock.h" +#include "gtest/gtest.h" +#include "absl/strings/str_format.h" + +namespace absl { +namespace str_format_internal { +namespace { + +std::string ConvToString(Conv conv) { + std::string out; +#define CONV_SET_CASE(c) \ + if (Contains(conv, Conv::c)) out += #c; + ABSL_CONVERSION_CHARS_EXPAND_(CONV_SET_CASE, ) +#undef CONV_SET_CASE + if (Contains(conv, Conv::star)) out += "*"; + return out; +} + +TEST(StrFormatChecker, ArgumentToConv) { + Conv conv = ArgumentToConv<std::string>(); + EXPECT_EQ(ConvToString(conv), "s"); + + conv = ArgumentToConv<const char*>(); + EXPECT_EQ(ConvToString(conv), "sp"); + + conv = ArgumentToConv<double>(); + EXPECT_EQ(ConvToString(conv), "fFeEgGaA"); + + conv = ArgumentToConv<int>(); + EXPECT_EQ(ConvToString(conv), "cdiouxXfFeEgGaA*"); + + conv = ArgumentToConv<std::string*>(); + EXPECT_EQ(ConvToString(conv), "p"); +} + +#if ABSL_INTERNAL_ENABLE_FORMAT_CHECKER + +struct Case { + bool result; + const char* format; +}; + +template <typename... Args> +constexpr Case ValidFormat(const char* format) { + return {ValidFormatImpl<ArgumentToConv<Args>()...>(format), format}; +} + +TEST(StrFormatChecker, ValidFormat) { + // We want to make sure these expressions are constexpr and they have the + // expected value. + // If they are not constexpr the attribute will just ignore them and not give + // a compile time error. + enum e {}; + enum class e2 {}; + constexpr Case trues[] = { + ValidFormat<>("abc"), // + + ValidFormat<e>("%d"), // + ValidFormat<e2>("%d"), // + ValidFormat<int>("%% %d"), // + ValidFormat<int>("%ld"), // + ValidFormat<int>("%lld"), // + ValidFormat<std::string>("%s"), // + ValidFormat<std::string>("%10s"), // + ValidFormat<int>("%.10x"), // + ValidFormat<int, int>("%*.3x"), // + ValidFormat<int>("%1.d"), // + ValidFormat<int>("%.d"), // + ValidFormat<int, double>("%d %g"), // + ValidFormat<int, std::string>("%*s"), // + ValidFormat<int, double>("%.*f"), // + ValidFormat<void (*)(), volatile int*>("%p %p"), // + ValidFormat<string_view, const char*, double, void*>( + "string_view=%s const char*=%s double=%f void*=%p)"), + + ValidFormat<int>("%% %1$d"), // + ValidFormat<int>("%1$ld"), // + ValidFormat<int>("%1$lld"), // + ValidFormat<std::string>("%1$s"), // + ValidFormat<std::string>("%1$10s"), // + ValidFormat<int>("%1$.10x"), // + ValidFormat<int>("%1$*1$.*1$d"), // + ValidFormat<int, int>("%1$*2$.3x"), // + ValidFormat<int>("%1$1.d"), // + ValidFormat<int>("%1$.d"), // + ValidFormat<double, int>("%2$d %1$g"), // + ValidFormat<int, std::string>("%2$*1$s"), // + ValidFormat<int, double>("%2$.*1$f"), // + ValidFormat<void*, string_view, const char*, double>( + "string_view=%2$s const char*=%3$s double=%4$f void*=%1$p " + "repeat=%3$s)")}; + + for (Case c : trues) { + EXPECT_TRUE(c.result) << c.format; + } + + constexpr Case falses[] = { + ValidFormat<int>(""), // + + ValidFormat<e>("%s"), // + ValidFormat<e2>("%s"), // + ValidFormat<>("%s"), // + ValidFormat<>("%r"), // + ValidFormat<int>("%s"), // + ValidFormat<int>("%.1.d"), // + ValidFormat<int>("%*1d"), // + ValidFormat<int>("%1-d"), // + ValidFormat<std::string, int>("%*s"), // + ValidFormat<int>("%*d"), // + ValidFormat<std::string>("%p"), // + ValidFormat<int (*)(int)>("%d"), // + + ValidFormat<>("%3$d"), // + ValidFormat<>("%1$r"), // + ValidFormat<int>("%1$s"), // + ValidFormat<int>("%1$.1.d"), // + ValidFormat<int>("%1$*2$1d"), // + ValidFormat<int>("%1$1-d"), // + ValidFormat<std::string, int>("%2$*1$s"), // + ValidFormat<std::string>("%1$p"), + + ValidFormat<int, int>("%d %2$d"), // + }; + + for (Case c : falses) { + EXPECT_FALSE(c.result) << c.format; + } +} + +TEST(StrFormatChecker, LongFormat) { +#define CHARS_X_40 "1234567890123456789012345678901234567890" +#define CHARS_X_400 \ + CHARS_X_40 CHARS_X_40 CHARS_X_40 CHARS_X_40 CHARS_X_40 CHARS_X_40 CHARS_X_40 \ + CHARS_X_40 CHARS_X_40 CHARS_X_40 +#define CHARS_X_4000 \ + CHARS_X_400 CHARS_X_400 CHARS_X_400 CHARS_X_400 CHARS_X_400 CHARS_X_400 \ + CHARS_X_400 CHARS_X_400 CHARS_X_400 CHARS_X_400 + constexpr char long_format[] = + CHARS_X_4000 "%d" CHARS_X_4000 "%s" CHARS_X_4000; + constexpr bool is_valid = ValidFormat<int, std::string>(long_format).result; + EXPECT_TRUE(is_valid); +} + +#endif // ABSL_INTERNAL_ENABLE_FORMAT_CHECKER + +} // namespace +} // namespace str_format_internal +} // namespace absl diff --git a/absl/strings/internal/str_format/convert_test.cc b/absl/strings/internal/str_format/convert_test.cc new file mode 100644 index 000000000000..32f8a0f9ad1a --- /dev/null +++ b/absl/strings/internal/str_format/convert_test.cc @@ -0,0 +1,575 @@ +#include <errno.h> +#include <stdarg.h> +#include <stdio.h> +#include <cmath> +#include <string> + +#include "gtest/gtest.h" +#include "absl/strings/internal/str_format/bind.h" + +namespace absl { +namespace str_format_internal { +namespace { + +template <typename T, size_t N> +size_t ArraySize(T (&)[N]) { + return N; +} + +std::string LengthModFor(float) { return ""; } +std::string LengthModFor(double) { return ""; } +std::string LengthModFor(long double) { return "L"; } +std::string LengthModFor(char) { return "hh"; } +std::string LengthModFor(signed char) { return "hh"; } +std::string LengthModFor(unsigned char) { return "hh"; } +std::string LengthModFor(short) { return "h"; } // NOLINT +std::string LengthModFor(unsigned short) { return "h"; } // NOLINT +std::string LengthModFor(int) { return ""; } +std::string LengthModFor(unsigned) { return ""; } +std::string LengthModFor(long) { return "l"; } // NOLINT +std::string LengthModFor(unsigned long) { return "l"; } // NOLINT +std::string LengthModFor(long long) { return "ll"; } // NOLINT +std::string LengthModFor(unsigned long long) { return "ll"; } // NOLINT + +std::string EscCharImpl(int v) { + if (isprint(v)) return std::string(1, static_cast<char>(v)); + char buf[64]; + int n = snprintf(buf, sizeof(buf), "\\%#.2x", + static_cast<unsigned>(v & 0xff)); + assert(n > 0 && n < sizeof(buf)); + return std::string(buf, n); +} + +std::string Esc(char v) { return EscCharImpl(v); } +std::string Esc(signed char v) { return EscCharImpl(v); } +std::string Esc(unsigned char v) { return EscCharImpl(v); } + +template <typename T> +std::string Esc(const T &v) { + std::ostringstream oss; + oss << v; + return oss.str(); +} + +void StrAppend(std::string *dst, const char *format, va_list ap) { + // First try with a small fixed size buffer + static const int kSpaceLength = 1024; + char space[kSpaceLength]; + + // It's possible for methods that use a va_list to invalidate + // the data in it upon use. The fix is to make a copy + // of the structure before using it and use that copy instead. + va_list backup_ap; + va_copy(backup_ap, ap); + int result = vsnprintf(space, kSpaceLength, format, backup_ap); + va_end(backup_ap); + if (result < kSpaceLength) { + if (result >= 0) { + // Normal case -- everything fit. + dst->append(space, result); + return; + } + if (result < 0) { + // Just an error. + return; + } + } + + // Increase the buffer size to the size requested by vsnprintf, + // plus one for the closing \0. + int length = result + 1; + char *buf = new char[length]; + + // Restore the va_list before we use it again + va_copy(backup_ap, ap); + result = vsnprintf(buf, length, format, backup_ap); + va_end(backup_ap); + + if (result >= 0 && result < length) { + // It fit + dst->append(buf, result); + } + delete[] buf; +} + +std::string StrPrint(const char *format, ...) { + va_list ap; + va_start(ap, format); + std::string result; + StrAppend(&result, format, ap); + va_end(ap); + return result; +} + +class FormatConvertTest : public ::testing::Test { }; + +template <typename T> +void TestStringConvert(const T& str) { + const FormatArgImpl args[] = {FormatArgImpl(str)}; + struct Expectation { + const char *out; + const char *fmt; + }; + const Expectation kExpect[] = { + {"hello", "%1$s" }, + {"", "%1$.s" }, + {"", "%1$.0s" }, + {"h", "%1$.1s" }, + {"he", "%1$.2s" }, + {"hello", "%1$.10s" }, + {" hello", "%1$6s" }, + {" he", "%1$5.2s" }, + {"he ", "%1$-5.2s" }, + {"hello ", "%1$-6.10s" }, + }; + for (const Expectation &e : kExpect) { + UntypedFormatSpecImpl format(e.fmt); + EXPECT_EQ(e.out, FormatPack(format, absl::MakeSpan(args))); + } +} + +TEST_F(FormatConvertTest, BasicString) { + TestStringConvert("hello"); // As char array. + TestStringConvert(static_cast<const char*>("hello")); + TestStringConvert(std::string("hello")); + TestStringConvert(string_view("hello")); +} + +TEST_F(FormatConvertTest, NullString) { + const char* p = nullptr; + UntypedFormatSpecImpl format("%s"); + EXPECT_EQ("", FormatPack(format, {FormatArgImpl(p)})); +} + +TEST_F(FormatConvertTest, StringPrecision) { + // We cap at the precision. + char c = 'a'; + const char* p = &c; + UntypedFormatSpecImpl format("%.1s"); + EXPECT_EQ("a", FormatPack(format, {FormatArgImpl(p)})); + + // We cap at the nul terminator. + p = "ABC"; + UntypedFormatSpecImpl format2("%.10s"); + EXPECT_EQ("ABC", FormatPack(format2, {FormatArgImpl(p)})); +} + +TEST_F(FormatConvertTest, Pointer) { +#if _MSC_VER + // MSVC's printf implementation prints pointers differently. We can't easily + // compare our implementation to theirs. + return; +#endif + static int x = 0; + const int *xp = &x; + char c = 'h'; + char *mcp = &c; + const char *cp = "hi"; + const char *cnil = nullptr; + const int *inil = nullptr; + using VoidF = void (*)(); + VoidF fp = [] {}, fnil = nullptr; + volatile char vc; + volatile char* vcp = &vc; + volatile char* vcnil = nullptr; + const FormatArgImpl args[] = { + FormatArgImpl(xp), FormatArgImpl(cp), FormatArgImpl(inil), + FormatArgImpl(cnil), FormatArgImpl(mcp), FormatArgImpl(fp), + FormatArgImpl(fnil), FormatArgImpl(vcp), FormatArgImpl(vcnil), + }; + struct Expectation { + std::string out; + const char *fmt; + }; + const Expectation kExpect[] = { + {StrPrint("%p", &x), "%p"}, + {StrPrint("%20p", &x), "%20p"}, + {StrPrint("%.1p", &x), "%.1p"}, + {StrPrint("%.20p", &x), "%.20p"}, + {StrPrint("%30.20p", &x), "%30.20p"}, + + {StrPrint("%-p", &x), "%-p"}, + {StrPrint("%-20p", &x), "%-20p"}, + {StrPrint("%-.1p", &x), "%-.1p"}, + {StrPrint("%.20p", &x), "%.20p"}, + {StrPrint("%-30.20p", &x), "%-30.20p"}, + + {StrPrint("%p", cp), "%2$p"}, // const char* + {"(nil)", "%3$p"}, // null const char * + {"(nil)", "%4$p"}, // null const int * + {StrPrint("%p", mcp), "%5$p"}, // nonconst char* + + {StrPrint("%p", fp), "%6$p"}, // function pointer + {StrPrint("%p", vcp), "%8$p"}, // function pointer + +#ifndef __APPLE__ + // Apple's printf differs here (0x0 vs. nil) + {StrPrint("%p", fnil), "%7$p"}, // null function pointer + {StrPrint("%p", vcnil), "%9$p"}, // null function pointer +#endif + }; + for (const Expectation &e : kExpect) { + UntypedFormatSpecImpl format(e.fmt); + EXPECT_EQ(e.out, FormatPack(format, absl::MakeSpan(args))) << e.fmt; + } +} + +struct Cardinal { + enum Pos { k1 = 1, k2 = 2, k3 = 3 }; + enum Neg { kM1 = -1, kM2 = -2, kM3 = -3 }; +}; + +TEST_F(FormatConvertTest, Enum) { + const Cardinal::Pos k3 = Cardinal::k3; + const Cardinal::Neg km3 = Cardinal::kM3; + const FormatArgImpl args[] = {FormatArgImpl(k3), FormatArgImpl(km3)}; + UntypedFormatSpecImpl format("%1$d"); + UntypedFormatSpecImpl format2("%2$d"); + EXPECT_EQ("3", FormatPack(format, absl::MakeSpan(args))); + EXPECT_EQ("-3", FormatPack(format2, absl::MakeSpan(args))); +} + +template <typename T> +class TypedFormatConvertTest : public FormatConvertTest { }; + +TYPED_TEST_CASE_P(TypedFormatConvertTest); + +std::vector<std::string> AllFlagCombinations() { + const char kFlags[] = {'-', '#', '0', '+', ' '}; + std::vector<std::string> result; + for (size_t fsi = 0; fsi < (1ull << ArraySize(kFlags)); ++fsi) { + std::string flag_set; + for (size_t fi = 0; fi < ArraySize(kFlags); ++fi) + if (fsi & (1ull << fi)) + flag_set += kFlags[fi]; + result.push_back(flag_set); + } + return result; +} + +TYPED_TEST_P(TypedFormatConvertTest, AllIntsWithFlags) { + typedef TypeParam T; + typedef typename std::make_unsigned<T>::type UnsignedT; + using remove_volatile_t = typename std::remove_volatile<T>::type; + const T kMin = std::numeric_limits<remove_volatile_t>::min(); + const T kMax = std::numeric_limits<remove_volatile_t>::max(); + const T kVals[] = { + remove_volatile_t(1), + remove_volatile_t(2), + remove_volatile_t(3), + remove_volatile_t(123), + remove_volatile_t(-1), + remove_volatile_t(-2), + remove_volatile_t(-3), + remove_volatile_t(-123), + remove_volatile_t(0), + kMax - remove_volatile_t(1), + kMax, + kMin + remove_volatile_t(1), + kMin, + }; + const char kConvChars[] = {'d', 'i', 'u', 'o', 'x', 'X'}; + const std::string kWid[] = {"", "4", "10"}; + const std::string kPrec[] = {"", ".", ".0", ".4", ".10"}; + + const std::vector<std::string> flag_sets = AllFlagCombinations(); + + for (size_t vi = 0; vi < ArraySize(kVals); ++vi) { + const T val = kVals[vi]; + SCOPED_TRACE(Esc(val)); + const FormatArgImpl args[] = {FormatArgImpl(val)}; + for (size_t ci = 0; ci < ArraySize(kConvChars); ++ci) { + const char conv_char = kConvChars[ci]; + for (size_t fsi = 0; fsi < flag_sets.size(); ++fsi) { + const std::string &flag_set = flag_sets[fsi]; + for (size_t wi = 0; wi < ArraySize(kWid); ++wi) { + const std::string &wid = kWid[wi]; + for (size_t pi = 0; pi < ArraySize(kPrec); ++pi) { + const std::string &prec = kPrec[pi]; + + const bool is_signed_conv = (conv_char == 'd' || conv_char == 'i'); + const bool is_unsigned_to_signed = + !std::is_signed<T>::value && is_signed_conv; + // Don't consider sign-related flags '+' and ' ' when doing + // unsigned to signed conversions. + if (is_unsigned_to_signed && + flag_set.find_first_of("+ ") != std::string::npos) { + continue; + } + + std::string new_fmt("%"); + new_fmt += flag_set; + new_fmt += wid; + new_fmt += prec; + // old and new always agree up to here. + std::string old_fmt = new_fmt; + new_fmt += conv_char; + std::string old_result; + if (is_unsigned_to_signed) { + // don't expect agreement on unsigned formatted as signed, + // as printf can't do that conversion properly. For those + // cases, we do expect agreement with printf with a "%u" + // and the unsigned equivalent of 'val'. + UnsignedT uval = val; + old_fmt += LengthModFor(uval); + old_fmt += "u"; + old_result = StrPrint(old_fmt.c_str(), uval); + } else { + old_fmt += LengthModFor(val); + old_fmt += conv_char; + old_result = StrPrint(old_fmt.c_str(), val); + } + + SCOPED_TRACE(std::string() + " old_fmt: \"" + old_fmt + + "\"'" + " new_fmt: \"" + + new_fmt + "\""); + UntypedFormatSpecImpl format(new_fmt); + EXPECT_EQ(old_result, FormatPack(format, absl::MakeSpan(args))); + } + } + } + } + } +} + +TYPED_TEST_P(TypedFormatConvertTest, Char) { + typedef TypeParam T; + using remove_volatile_t = typename std::remove_volatile<T>::type; + static const T kMin = std::numeric_limits<remove_volatile_t>::min(); + static const T kMax = std::numeric_limits<remove_volatile_t>::max(); + T kVals[] = { + remove_volatile_t(1), remove_volatile_t(2), remove_volatile_t(10), + remove_volatile_t(-1), remove_volatile_t(-2), remove_volatile_t(-10), + remove_volatile_t(0), + kMin + remove_volatile_t(1), kMin, + kMax - remove_volatile_t(1), kMax + }; + for (const T &c : kVals) { + const FormatArgImpl args[] = {FormatArgImpl(c)}; + UntypedFormatSpecImpl format("%c"); + EXPECT_EQ(StrPrint("%c", c), FormatPack(format, absl::MakeSpan(args))); + } +} + +REGISTER_TYPED_TEST_CASE_P(TypedFormatConvertTest, AllIntsWithFlags, Char); + +typedef ::testing::Types< + int, unsigned, volatile int, + short, unsigned short, + long, unsigned long, + long long, unsigned long long, + signed char, unsigned char, char> + AllIntTypes; +INSTANTIATE_TYPED_TEST_CASE_P(TypedFormatConvertTestWithAllIntTypes, + TypedFormatConvertTest, AllIntTypes); +TEST_F(FormatConvertTest, Uint128) { + absl::uint128 v = static_cast<absl::uint128>(0x1234567890abcdef) * 1979; + absl::uint128 max = absl::Uint128Max(); + const FormatArgImpl args[] = {FormatArgImpl(v), FormatArgImpl(max)}; + + struct Case { + const char* format; + const char* expected; + } cases[] = { + {"%1$d", "2595989796776606496405"}, + {"%1$30d", " 2595989796776606496405"}, + {"%1$-30d", "2595989796776606496405 "}, + {"%1$u", "2595989796776606496405"}, + {"%1$x", "8cba9876066020f695"}, + {"%2$d", "340282366920938463463374607431768211455"}, + {"%2$u", "340282366920938463463374607431768211455"}, + {"%2$x", "ffffffffffffffffffffffffffffffff"}, + }; + + for (auto c : cases) { + UntypedFormatSpecImpl format(c.format); + EXPECT_EQ(c.expected, FormatPack(format, absl::MakeSpan(args))); + } +} + +TEST_F(FormatConvertTest, Float) { +#if _MSC_VER + // MSVC has a different rounding policy than us so we can't test our + // implementation against the native one there. + return; +#endif // _MSC_VER + + const char *const kFormats[] = { + "%", "%.3", "%8.5", "%9", "%.60", "%.30", "%03", "%+", + "% ", "%-10", "%#15.3", "%#.0", "%.0", "%1$*2$", "%1$.*2$"}; + + std::vector<double> doubles = {0.0, + -0.0, + .99999999999999, + 99999999999999., + std::numeric_limits<double>::max(), + -std::numeric_limits<double>::max(), + std::numeric_limits<double>::min(), + -std::numeric_limits<double>::min(), + std::numeric_limits<double>::lowest(), + -std::numeric_limits<double>::lowest(), + std::numeric_limits<double>::epsilon(), + std::numeric_limits<double>::epsilon() + 1, + std::numeric_limits<double>::infinity(), + -std::numeric_limits<double>::infinity()}; + +#ifndef __APPLE__ + // Apple formats NaN differently (+nan) vs. (nan) + doubles.push_back(std::nan("")); +#endif + + // Some regression tests. + doubles.push_back(0.99999999999999989); + + if (std::numeric_limits<double>::has_denorm != std::denorm_absent) { + doubles.push_back(std::numeric_limits<double>::denorm_min()); + doubles.push_back(-std::numeric_limits<double>::denorm_min()); + } + + for (double base : + {1., 12., 123., 1234., 12345., 123456., 1234567., 12345678., 123456789., + 1234567890., 12345678901., 123456789012., 1234567890123.}) { + for (int exp = -123; exp <= 123; ++exp) { + for (int sign : {1, -1}) { + doubles.push_back(sign * std::ldexp(base, exp)); + } + } + } + + for (const char *fmt : kFormats) { + for (char f : {'f', 'F', // + 'g', 'G', // + 'a', 'A', // + 'e', 'E'}) { + std::string fmt_str = std::string(fmt) + f; + for (double d : doubles) { + int i = -10; + FormatArgImpl args[2] = {FormatArgImpl(d), FormatArgImpl(i)}; + UntypedFormatSpecImpl format(fmt_str); + // We use ASSERT_EQ here because failures are usually correlated and a + // bug would print way too many failed expectations causing the test to + // time out. + ASSERT_EQ(StrPrint(fmt_str.c_str(), d, i), + FormatPack(format, absl::MakeSpan(args))) + << fmt_str << " " << StrPrint("%.18g", d) << " " + << StrPrint("%.999f", d); + } + } + } +} + +TEST_F(FormatConvertTest, LongDouble) { + const char *const kFormats[] = {"%", "%.3", "%8.5", "%9", + "%.60", "%+", "% ", "%-10"}; + + // This value is not representable in double, but it is in long double that + // uses the extended format. + // This is to verify that we are not truncating the value mistakenly through a + // double. + long double very_precise = 10000000000000000.25L; + + std::vector<long double> doubles = { + 0.0, + -0.0, + very_precise, + 1 / very_precise, + std::numeric_limits<long double>::max(), + -std::numeric_limits<long double>::max(), + std::numeric_limits<long double>::min(), + -std::numeric_limits<long double>::min(), + std::numeric_limits<long double>::infinity(), + -std::numeric_limits<long double>::infinity()}; + + for (const char *fmt : kFormats) { + for (char f : {'f', 'F', // + 'g', 'G', // + 'a', 'A', // + 'e', 'E'}) { + std::string fmt_str = std::string(fmt) + 'L' + f; + for (auto d : doubles) { + FormatArgImpl arg(d); + UntypedFormatSpecImpl format(fmt_str); + // We use ASSERT_EQ here because failures are usually correlated and a + // bug would print way too many failed expectations causing the test to + // time out. + ASSERT_EQ(StrPrint(fmt_str.c_str(), d), + FormatPack(format, {&arg, 1})) + << fmt_str << " " << StrPrint("%.18Lg", d) << " " + << StrPrint("%.999Lf", d); + } + } + } +} + +TEST_F(FormatConvertTest, IntAsFloat) { + const int kMin = std::numeric_limits<int>::min(); + const int kMax = std::numeric_limits<int>::max(); + const int ia[] = { + 1, 2, 3, 123, + -1, -2, -3, -123, + 0, kMax - 1, kMax, kMin + 1, kMin }; + for (const int fx : ia) { + SCOPED_TRACE(fx); + const FormatArgImpl args[] = {FormatArgImpl(fx)}; + struct Expectation { + int line; + std::string out; + const char *fmt; + }; + const double dx = static_cast<double>(fx); + const Expectation kExpect[] = { + { __LINE__, StrPrint("%f", dx), "%f" }, + { __LINE__, StrPrint("%12f", dx), "%12f" }, + { __LINE__, StrPrint("%.12f", dx), "%.12f" }, + { __LINE__, StrPrint("%12a", dx), "%12a" }, + { __LINE__, StrPrint("%.12a", dx), "%.12a" }, + }; + for (const Expectation &e : kExpect) { + SCOPED_TRACE(e.line); + SCOPED_TRACE(e.fmt); + UntypedFormatSpecImpl format(e.fmt); + EXPECT_EQ(e.out, FormatPack(format, absl::MakeSpan(args))); + } + } +} + +template <typename T> +bool FormatFails(const char* test_format, T value) { + std::string format_string = std::string("<<") + test_format + ">>"; + UntypedFormatSpecImpl format(format_string); + + int one = 1; + const FormatArgImpl args[] = {FormatArgImpl(value), FormatArgImpl(one)}; + EXPECT_EQ(FormatPack(format, absl::MakeSpan(args)), "") + << "format=" << test_format << " value=" << value; + return FormatPack(format, absl::MakeSpan(args)).empty(); +} + +TEST_F(FormatConvertTest, ExpectedFailures) { + // Int input + EXPECT_TRUE(FormatFails("%p", 1)); + EXPECT_TRUE(FormatFails("%s", 1)); + EXPECT_TRUE(FormatFails("%n", 1)); + + // Double input + EXPECT_TRUE(FormatFails("%p", 1.)); + EXPECT_TRUE(FormatFails("%s", 1.)); + EXPECT_TRUE(FormatFails("%n", 1.)); + EXPECT_TRUE(FormatFails("%c", 1.)); + EXPECT_TRUE(FormatFails("%d", 1.)); + EXPECT_TRUE(FormatFails("%x", 1.)); + EXPECT_TRUE(FormatFails("%*d", 1.)); + + // String input + EXPECT_TRUE(FormatFails("%n", "")); + EXPECT_TRUE(FormatFails("%c", "")); + EXPECT_TRUE(FormatFails("%d", "")); + EXPECT_TRUE(FormatFails("%x", "")); + EXPECT_TRUE(FormatFails("%f", "")); + EXPECT_TRUE(FormatFails("%*d", "")); +} + +} // namespace +} // namespace str_format_internal +} // namespace absl diff --git a/absl/strings/internal/str_format/extension.cc b/absl/strings/internal/str_format/extension.cc new file mode 100644 index 000000000000..c2174703c3e8 --- /dev/null +++ b/absl/strings/internal/str_format/extension.cc @@ -0,0 +1,84 @@ +// +// Copyright 2017 The Abseil Authors. +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +#include "absl/strings/internal/str_format/extension.h" + +#include <errno.h> +#include <algorithm> +#include <string> + +namespace absl { +namespace str_format_internal { +namespace { +// clang-format off +#define ABSL_LENGTH_MODS_EXPAND_ \ + X_VAL(h) X_SEP \ + X_VAL(hh) X_SEP \ + X_VAL(l) X_SEP \ + X_VAL(ll) X_SEP \ + X_VAL(L) X_SEP \ + X_VAL(j) X_SEP \ + X_VAL(z) X_SEP \ + X_VAL(t) X_SEP \ + X_VAL(q) +// clang-format on +} // namespace + +const LengthMod::Spec LengthMod::kSpecs[] = { +#define X_VAL(id) { LengthMod::id, #id, strlen(#id) } +#define X_SEP , + ABSL_LENGTH_MODS_EXPAND_, {LengthMod::none, "", 0} +#undef X_VAL +#undef X_SEP +}; + +const ConversionChar::Spec ConversionChar::kSpecs[] = { +#define X_VAL(id) { ConversionChar::id, #id[0] } +#define X_SEP , + ABSL_CONVERSION_CHARS_EXPAND_(X_VAL, X_SEP), + {ConversionChar::none, '\0'}, +#undef X_VAL +#undef X_SEP +}; + +std::string Flags::ToString() const { + std::string s; + s.append(left ? "-" : ""); + s.append(show_pos ? "+" : ""); + s.append(sign_col ? " " : ""); + s.append(alt ? "#" : ""); + s.append(zero ? "0" : ""); + return s; +} + +const size_t LengthMod::kNumValues; + +const size_t ConversionChar::kNumValues; + +bool FormatSinkImpl::PutPaddedString(string_view v, int w, int p, bool l) { + size_t space_remaining = 0; + if (w >= 0) space_remaining = w; + size_t n = v.size(); + if (p >= 0) n = std::min(n, static_cast<size_t>(p)); + string_view shown(v.data(), n); + space_remaining = Excess(shown.size(), space_remaining); + if (!l) Append(space_remaining, ' '); + Append(shown); + if (l) Append(space_remaining, ' '); + return true; +} + +} // namespace str_format_internal +} // namespace absl diff --git a/absl/strings/internal/str_format/extension.h b/absl/strings/internal/str_format/extension.h new file mode 100644 index 000000000000..810330b9d71b --- /dev/null +++ b/absl/strings/internal/str_format/extension.h @@ -0,0 +1,406 @@ +// +// Copyright 2017 The Abseil Authors. +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// +#ifndef ABSL_STRINGS_INTERNAL_STR_FORMAT_EXTENSION_H_ +#define ABSL_STRINGS_INTERNAL_STR_FORMAT_EXTENSION_H_ + +#include <limits.h> +#include <cstring> +#include <ostream> + +#include "absl/base/port.h" +#include "absl/strings/internal/str_format/output.h" +#include "absl/strings/string_view.h" + +class Cord; + +namespace absl { + +namespace str_format_internal { + +class FormatRawSinkImpl { + public: + // Implicitly convert from any type that provides the hook function as + // described above. + template <typename T, decltype(str_format_internal::InvokeFlush( + std::declval<T*>(), string_view()))* = nullptr> + FormatRawSinkImpl(T* raw) // NOLINT + : sink_(raw), write_(&FormatRawSinkImpl::Flush<T>) {} + + void Write(string_view s) { write_(sink_, s); } + + template <typename T> + static FormatRawSinkImpl Extract(T s) { + return s.sink_; + } + + private: + template <typename T> + static void Flush(void* r, string_view s) { + str_format_internal::InvokeFlush(static_cast<T*>(r), s); + } + + void* sink_; + void (*write_)(void*, string_view); +}; + +// An abstraction to which conversions write their std::string data. +class FormatSinkImpl { + public: + explicit FormatSinkImpl(FormatRawSinkImpl raw) : raw_(raw) {} + + ~FormatSinkImpl() { Flush(); } + + void Flush() { + raw_.Write(string_view(buf_, pos_ - buf_)); + pos_ = buf_; + } + + void Append(size_t n, char c) { + if (n == 0) return; + size_ += n; + auto raw_append = [&](size_t count) { + memset(pos_, c, count); + pos_ += count; + }; + while (n > Avail()) { + n -= Avail(); + if (Avail() > 0) { + raw_append(Avail()); + } + Flush(); + } + raw_append(n); + } + + void Append(string_view v) { + size_t n = v.size(); + if (n == 0) return; + size_ += n; + if (n >= Avail()) { + Flush(); + raw_.Write(v); + return; + } + memcpy(pos_, v.data(), n); + pos_ += n; + } + + size_t size() const { return size_; } + + // Put 'v' to 'sink' with specified width, precision, and left flag. + bool PutPaddedString(string_view v, int w, int p, bool l); + + template <typename T> + T Wrap() { + return T(this); + } + + template <typename T> + static FormatSinkImpl* Extract(T* s) { + return s->sink_; + } + + private: + size_t Avail() const { return buf_ + sizeof(buf_) - pos_; } + + FormatRawSinkImpl raw_; + size_t size_ = 0; + char* pos_ = buf_; + char buf_[1024]; +}; + +struct Flags { + bool basic : 1; // fastest conversion: no flags, width, or precision + bool left : 1; // "-" + bool show_pos : 1; // "+" + bool sign_col : 1; // " " + bool alt : 1; // "#" + bool zero : 1; // "0" + std::string ToString() const; + friend std::ostream& operator<<(std::ostream& os, const Flags& v) { + return os << v.ToString(); + } +}; + +struct LengthMod { + public: + enum Id : uint8_t { + h, hh, l, ll, L, j, z, t, q, none + }; + static const size_t kNumValues = none + 1; + + LengthMod() : id_(none) {} + + // Index into the opaque array of LengthMod enums. + // Requires: i < kNumValues + static LengthMod FromIndex(size_t i) { + return LengthMod(kSpecs[i].value); + } + + static LengthMod FromId(Id id) { return LengthMod(id); } + + // The length modifier std::string associated with a specified LengthMod. + string_view name() const { + const Spec& spec = kSpecs[id_]; + return {spec.name, spec.name_length}; + } + + Id id() const { return id_; } + + friend bool operator==(const LengthMod& a, const LengthMod& b) { + return a.id() == b.id(); + } + friend bool operator!=(const LengthMod& a, const LengthMod& b) { + return !(a == b); + } + friend std::ostream& operator<<(std::ostream& os, const LengthMod& v) { + return os << v.name(); + } + + private: + struct Spec { + Id value; + const char *name; + size_t name_length; + }; + static const Spec kSpecs[]; + + explicit LengthMod(Id id) : id_(id) {} + + Id id_; +}; + +// clang-format off +#define ABSL_CONVERSION_CHARS_EXPAND_(X_VAL, X_SEP) \ + /* text */ \ + X_VAL(c) X_SEP X_VAL(C) X_SEP X_VAL(s) X_SEP X_VAL(S) X_SEP \ + /* ints */ \ + X_VAL(d) X_SEP X_VAL(i) X_SEP X_VAL(o) X_SEP \ + X_VAL(u) X_SEP X_VAL(x) X_SEP X_VAL(X) X_SEP \ + /* floats */ \ + X_VAL(f) X_SEP X_VAL(F) X_SEP X_VAL(e) X_SEP X_VAL(E) X_SEP \ + X_VAL(g) X_SEP X_VAL(G) X_SEP X_VAL(a) X_SEP X_VAL(A) X_SEP \ + /* misc */ \ + X_VAL(n) X_SEP X_VAL(p) +// clang-format on + +struct ConversionChar { + public: + enum Id : uint8_t { + c, C, s, S, // text + d, i, o, u, x, X, // int + f, F, e, E, g, G, a, A, // float + n, p, // misc + none + }; + static const size_t kNumValues = none + 1; + + ConversionChar() : id_(none) {} + + public: + // Index into the opaque array of ConversionChar enums. + // Requires: i < kNumValues + static ConversionChar FromIndex(size_t i) { + return ConversionChar(kSpecs[i].value); + } + + static ConversionChar FromChar(char c) { + ConversionChar::Id out_id = ConversionChar::none; + switch (c) { +#define X_VAL(id) \ + case #id[0]: \ + out_id = ConversionChar::id; \ + break; + ABSL_CONVERSION_CHARS_EXPAND_(X_VAL, ) +#undef X_VAL + default: + break; + } + return ConversionChar(out_id); + } + + static ConversionChar FromId(Id id) { return ConversionChar(id); } + Id id() const { return id_; } + + int radix() const { + switch (id()) { + case x: case X: case a: case A: case p: return 16; + case o: return 8; + default: return 10; + } + } + + bool upper() const { + switch (id()) { + case X: case F: case E: case G: case A: return true; + default: return false; + } + } + + bool is_signed() const { + switch (id()) { + case d: case i: return true; + default: return false; + } + } + + bool is_integral() const { + switch (id()) { + case d: case i: case u: case o: case x: case X: + return true; + default: return false; + } + } + + bool is_float() const { + switch (id()) { + case a: case e: case f: case g: case A: case E: case F: case G: + return true; + default: return false; + } + } + + bool IsValid() const { return id() != none; } + + // The associated char. + char Char() const { return kSpecs[id_].name; } + + friend bool operator==(const ConversionChar& a, const ConversionChar& b) { + return a.id() == b.id(); + } + friend bool operator!=(const ConversionChar& a, const ConversionChar& b) { + return !(a == b); + } + friend std::ostream& operator<<(std::ostream& os, const ConversionChar& v) { + char c = v.Char(); + if (!c) c = '?'; + return os << c; + } + + private: + struct Spec { + Id value; + char name; + }; + static const Spec kSpecs[]; + + explicit ConversionChar(Id id) : id_(id) {} + + Id id_; +}; + +class ConversionSpec { + public: + Flags flags() const { return flags_; } + LengthMod length_mod() const { return length_mod_; } + ConversionChar conv() const { return conv_; } + + // Returns the specified width. If width is unspecfied, it returns a negative + // value. + int width() const { return width_; } + // Returns the specified precision. If precision is unspecfied, it returns a + // negative value. + int precision() const { return precision_; } + + void set_flags(Flags f) { flags_ = f; } + void set_length_mod(LengthMod lm) { length_mod_ = lm; } + void set_conv(ConversionChar c) { conv_ = c; } + void set_width(int w) { width_ = w; } + void set_precision(int p) { precision_ = p; } + void set_left(bool b) { flags_.left = b; } + + private: + Flags flags_; + LengthMod length_mod_; + ConversionChar conv_; + int width_; + int precision_; +}; + +constexpr uint64_t ConversionCharToConvValue(char conv) { + return +#define CONV_SET_CASE(c) \ + conv == #c[0] ? (uint64_t{1} << (1 + ConversionChar::Id::c)): + ABSL_CONVERSION_CHARS_EXPAND_(CONV_SET_CASE, ) +#undef CONV_SET_CASE + conv == '*' + ? 1 + : 0; +} + +enum class Conv : uint64_t { +#define CONV_SET_CASE(c) c = ConversionCharToConvValue(#c[0]), + ABSL_CONVERSION_CHARS_EXPAND_(CONV_SET_CASE, ) +#undef CONV_SET_CASE + + // Used for width/precision '*' specification. + star = ConversionCharToConvValue('*'), + + // Some predefined values: + integral = d | i | u | o | x | X, + floating = a | e | f | g | A | E | F | G, + numeric = integral | floating, + string = s, // absl:ignore(std::string) + pointer = p +}; + +// Type safe OR operator. +// We need this for two reasons: +// 1. operator| on enums makes them decay to integers and the result is an +// integer. We need the result to stay as an enum. +// 2. We use "enum class" which would not work even if we accepted the decay. +constexpr Conv operator|(Conv a, Conv b) { + return Conv(static_cast<uint64_t>(a) | static_cast<uint64_t>(b)); +} + +// Get a conversion with a single character in it. +constexpr Conv ConversionCharToConv(char c) { + return Conv(ConversionCharToConvValue(c)); +} + +// Checks whether `c` exists in `set`. +constexpr bool Contains(Conv set, char c) { + return (static_cast<uint64_t>(set) & ConversionCharToConvValue(c)) != 0; +} + +// Checks whether all the characters in `c` are contained in `set` +constexpr bool Contains(Conv set, Conv c) { + return (static_cast<uint64_t>(set) & static_cast<uint64_t>(c)) == + static_cast<uint64_t>(c); +} + +// Return type of the AbslFormatConvert() functions. +// The Conv template parameter is used to inform the framework of what +// conversion characters are supported by that AbslFormatConvert routine. +template <Conv C> +struct ConvertResult { + static constexpr Conv kConv = C; + bool value; +}; +template <Conv C> +constexpr Conv ConvertResult<C>::kConv; + +// Return capacity - used, clipped to a minimum of 0. +inline size_t Excess(size_t used, size_t capacity) { + return used < capacity ? capacity - used : 0; +} + +} // namespace str_format_internal + +} // namespace absl + +#endif // ABSL_STRINGS_STR_FORMAT_EXTENSION_H_ diff --git a/absl/strings/internal/str_format/extension_test.cc b/absl/strings/internal/str_format/extension_test.cc new file mode 100644 index 000000000000..224fc923d3e3 --- /dev/null +++ b/absl/strings/internal/str_format/extension_test.cc @@ -0,0 +1,65 @@ +// +// Copyright 2017 The Abseil Authors. +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// + +#include "absl/strings/internal/str_format/extension.h" + +#include <random> +#include <string> +#include "absl/strings/str_format.h" + +#include "gtest/gtest.h" + +namespace { + +std::string MakeRandomString(size_t len) { + std::random_device rd; + std::mt19937 gen(rd()); + std::uniform_int_distribution<> dis('a', 'z'); + std::string s(len, '0'); + for (char& c : s) { + c = dis(gen); + } + return s; +} + +TEST(FormatExtensionTest, SinkAppendSubstring) { + for (size_t chunk_size : {1, 10, 100, 1000, 10000}) { + std::string expected, actual; + absl::str_format_internal::FormatSinkImpl sink(&actual); + for (size_t chunks = 0; chunks < 10; ++chunks) { + std::string rand = MakeRandomString(chunk_size); + expected += rand; + sink.Append(rand); + } + sink.Flush(); + EXPECT_EQ(actual, expected); + } +} + +TEST(FormatExtensionTest, SinkAppendChars) { + for (size_t chunk_size : {1, 10, 100, 1000, 10000}) { + std::string expected, actual; + absl::str_format_internal::FormatSinkImpl sink(&actual); + for (size_t chunks = 0; chunks < 10; ++chunks) { + std::string rand = MakeRandomString(1); + expected.append(chunk_size, rand[0]); + sink.Append(chunk_size, rand[0]); + } + sink.Flush(); + EXPECT_EQ(actual, expected); + } +} +} // namespace diff --git a/absl/strings/internal/str_format/float_conversion.cc b/absl/strings/internal/str_format/float_conversion.cc new file mode 100644 index 000000000000..37952b4699e9 --- /dev/null +++ b/absl/strings/internal/str_format/float_conversion.cc @@ -0,0 +1,476 @@ +#include "absl/strings/internal/str_format/float_conversion.h" + +#include <string.h> +#include <algorithm> +#include <cassert> +#include <cmath> +#include <string> + +namespace absl { +namespace str_format_internal { + +namespace { + +char *CopyStringTo(string_view v, char *out) { + std::memcpy(out, v.data(), v.size()); + return out + v.size(); +} + +template <typename Float> +bool FallbackToSnprintf(const Float v, const ConversionSpec &conv, + FormatSinkImpl *sink) { + int w = conv.width() >= 0 ? conv.width() : 0; + int p = conv.precision() >= 0 ? conv.precision() : -1; + char fmt[32]; + { + char *fp = fmt; + *fp++ = '%'; + fp = CopyStringTo(conv.flags().ToString(), fp); + fp = CopyStringTo("*.*", fp); + if (std::is_same<long double, Float>()) { + *fp++ = 'L'; + } + *fp++ = conv.conv().Char(); + *fp = 0; + assert(fp < fmt + sizeof(fmt)); + } + std::string space(512, '\0'); + string_view result; + while (true) { + int n = snprintf(&space[0], space.size(), fmt, w, p, v); + if (n < 0) return false; + if (static_cast<size_t>(n) < space.size()) { + result = string_view(space.data(), n); + break; + } + space.resize(n + 1); + } + sink->Append(result); + return true; +} + +// 128-bits in decimal: ceil(128*log(2)/log(10)) +// or std::numeric_limits<__uint128_t>::digits10 +constexpr int kMaxFixedPrecision = 39; + +constexpr int kBufferLength = /*sign*/ 1 + + /*integer*/ kMaxFixedPrecision + + /*point*/ 1 + + /*fraction*/ kMaxFixedPrecision + + /*exponent e+123*/ 5; + +struct Buffer { + void push_front(char c) { + assert(begin > data); + *--begin = c; + } + void push_back(char c) { + assert(end < data + sizeof(data)); + *end++ = c; + } + void pop_back() { + assert(begin < end); + --end; + } + + char &back() { + assert(begin < end); + return end[-1]; + } + + char last_digit() const { return end[-1] == '.' ? end[-2] : end[-1]; } + + int size() const { return static_cast<int>(end - begin); } + + char data[kBufferLength]; + char *begin; + char *end; +}; + +enum class FormatStyle { Fixed, Precision }; + +// If the value is Inf or Nan, print it and return true. +// Otherwise, return false. +template <typename Float> +bool ConvertNonNumericFloats(char sign_char, Float v, + const ConversionSpec &conv, FormatSinkImpl *sink) { + char text[4], *ptr = text; + if (sign_char) *ptr++ = sign_char; + if (std::isnan(v)) { + ptr = std::copy_n(conv.conv().upper() ? "NAN" : "nan", 3, ptr); + } else if (std::isinf(v)) { + ptr = std::copy_n(conv.conv().upper() ? "INF" : "inf", 3, ptr); + } else { + return false; + } + + return sink->PutPaddedString(string_view(text, ptr - text), conv.width(), -1, + conv.flags().left); +} + +// Round up the last digit of the value. +// It will carry over and potentially overflow. 'exp' will be adjusted in that +// case. +template <FormatStyle mode> +void RoundUp(Buffer *buffer, int *exp) { + char *p = &buffer->back(); + while (p >= buffer->begin && (*p == '9' || *p == '.')) { + if (*p == '9') *p = '0'; + --p; + } + + if (p < buffer->begin) { + *p = '1'; + buffer->begin = p; + if (mode == FormatStyle::Precision) { + std::swap(p[1], p[2]); // move the . + ++*exp; + buffer->pop_back(); + } + } else { + ++*p; + } +} + +void PrintExponent(int exp, char e, Buffer *out) { + out->push_back(e); + if (exp < 0) { + out->push_back('-'); + exp = -exp; + } else { + out->push_back('+'); + } + // Exponent digits. + if (exp > 99) { + out->push_back(exp / 100 + '0'); + out->push_back(exp / 10 % 10 + '0'); + out->push_back(exp % 10 + '0'); + } else { + out->push_back(exp / 10 + '0'); + out->push_back(exp % 10 + '0'); + } +} + +template <typename Float, typename Int> +constexpr bool CanFitMantissa() { + return std::numeric_limits<Float>::digits <= std::numeric_limits<Int>::digits; +} + +template <typename Float> +struct Decomposed { + Float mantissa; + int exponent; +}; + +// Decompose the double into an integer mantissa and an exponent. +template <typename Float> +Decomposed<Float> Decompose(Float v) { + int exp; + Float m = std::frexp(v, &exp); + m = std::ldexp(m, std::numeric_limits<Float>::digits); + exp -= std::numeric_limits<Float>::digits; + return {m, exp}; +} + +// Print 'digits' as decimal. +// In Fixed mode, we add a '.' at the end. +// In Precision mode, we add a '.' after the first digit. +template <FormatStyle mode, typename Int> +int PrintIntegralDigits(Int digits, Buffer *out) { + int printed = 0; + if (digits) { + for (; digits; digits /= 10) out->push_front(digits % 10 + '0'); + printed = out->size(); + if (mode == FormatStyle::Precision) { + out->push_front(*out->begin); + out->begin[1] = '.'; + } else { + out->push_back('.'); + } + } else if (mode == FormatStyle::Fixed) { + out->push_front('0'); + out->push_back('.'); + printed = 1; + } + return printed; +} + +// Back out 'extra_digits' digits and round up if necessary. +bool RemoveExtraPrecision(int extra_digits, bool has_leftover_value, + Buffer *out, int *exp_out) { + if (extra_digits <= 0) return false; + + // Back out the extra digits + out->end -= extra_digits; + + bool needs_to_round_up = [&] { + // We look at the digit just past the end. + // There must be 'extra_digits' extra valid digits after end. + if (*out->end > '5') return true; + if (*out->end < '5') return false; + if (has_leftover_value || std::any_of(out->end + 1, out->end + extra_digits, + [](char c) { return c != '0'; })) + return true; + + // Ends in ...50*, round to even. + return out->last_digit() % 2 == 1; + }(); + + if (needs_to_round_up) { + RoundUp<FormatStyle::Precision>(out, exp_out); + } + return true; +} + +// Print the value into the buffer. +// This will not include the exponent, which will be returned in 'exp_out' for +// Precision mode. +template <typename Int, typename Float, FormatStyle mode> +bool FloatToBufferImpl(Int int_mantissa, int exp, int precision, Buffer *out, + int *exp_out) { + assert((CanFitMantissa<Float, Int>())); + + const int int_bits = std::numeric_limits<Int>::digits; + + // In precision mode, we start printing one char to the right because it will + // also include the '.' + // In fixed mode we put the dot afterwards on the right. + out->begin = out->end = + out->data + 1 + kMaxFixedPrecision + (mode == FormatStyle::Precision); + + if (exp >= 0) { + if (std::numeric_limits<Float>::digits + exp > int_bits) { + // The value will overflow the Int + return false; + } + int digits_printed = PrintIntegralDigits<mode>(int_mantissa << exp, out); + int digits_to_zero_pad = precision; + if (mode == FormatStyle::Precision) { + *exp_out = digits_printed - 1; + digits_to_zero_pad -= digits_printed - 1; + if (RemoveExtraPrecision(-digits_to_zero_pad, false, out, exp_out)) { + return true; + } + } + for (; digits_to_zero_pad-- > 0;) out->push_back('0'); + return true; + } + + exp = -exp; + // We need at least 4 empty bits for the next decimal digit. + // We will multiply by 10. + if (exp > int_bits - 4) return false; + + const Int mask = (Int{1} << exp) - 1; + + // Print the integral part first. + int digits_printed = PrintIntegralDigits<mode>(int_mantissa >> exp, out); + int_mantissa &= mask; + + int fractional_count = precision; + if (mode == FormatStyle::Precision) { + if (digits_printed == 0) { + // Find the first non-zero digit, when in Precision mode. + *exp_out = 0; + if (int_mantissa) { + while (int_mantissa <= mask) { + int_mantissa *= 10; + --*exp_out; + } + } + out->push_front(static_cast<char>(int_mantissa >> exp) + '0'); + out->push_back('.'); + int_mantissa &= mask; + } else { + // We already have a digit, and a '.' + *exp_out = digits_printed - 1; + fractional_count -= *exp_out; + if (RemoveExtraPrecision(-fractional_count, int_mantissa != 0, out, + exp_out)) { + // If we had enough digits, return right away. + // The code below will try to round again otherwise. + return true; + } + } + } + + auto get_next_digit = [&] { + int_mantissa *= 10; + int digit = static_cast<int>(int_mantissa >> exp); + int_mantissa &= mask; + return digit; + }; + + // Print fractional_count more digits, if available. + for (; fractional_count > 0; --fractional_count) { + out->push_back(get_next_digit() + '0'); + } + + int next_digit = get_next_digit(); + if (next_digit > 5 || + (next_digit == 5 && (int_mantissa || out->last_digit() % 2 == 1))) { + RoundUp<mode>(out, exp_out); + } + + return true; +} + +template <FormatStyle mode, typename Float> +bool FloatToBuffer(Decomposed<Float> decomposed, int precision, Buffer *out, + int *exp) { + if (precision > kMaxFixedPrecision) return false; + + // Try with uint64_t. + if (CanFitMantissa<Float, std::uint64_t>() && + FloatToBufferImpl<std::uint64_t, Float, mode>( + static_cast<std::uint64_t>(decomposed.mantissa), + static_cast<std::uint64_t>(decomposed.exponent), precision, out, exp)) + return true; + +#if defined(__SIZEOF_INT128__) + // If that is not enough, try with __uint128_t. + return CanFitMantissa<Float, __uint128_t>() && + FloatToBufferImpl<__uint128_t, Float, mode>( + static_cast<__uint128_t>(decomposed.mantissa), + static_cast<__uint128_t>(decomposed.exponent), precision, out, + exp); +#endif + return false; +} + +void WriteBufferToSink(char sign_char, string_view str, + const ConversionSpec &conv, FormatSinkImpl *sink) { + int left_spaces = 0, zeros = 0, right_spaces = 0; + int missing_chars = + conv.width() >= 0 ? std::max(conv.width() - static_cast<int>(str.size()) - + static_cast<int>(sign_char != 0), + 0) + : 0; + if (conv.flags().left) { + right_spaces = missing_chars; + } else if (conv.flags().zero) { + zeros = missing_chars; + } else { + left_spaces = missing_chars; + } + + sink->Append(left_spaces, ' '); + if (sign_char) sink->Append(1, sign_char); + sink->Append(zeros, '0'); + sink->Append(str); + sink->Append(right_spaces, ' '); +} + +template <typename Float> +bool FloatToSink(const Float v, const ConversionSpec &conv, + FormatSinkImpl *sink) { + // Print the sign or the sign column. + Float abs_v = v; + char sign_char = 0; + if (std::signbit(abs_v)) { + sign_char = '-'; + abs_v = -abs_v; + } else if (conv.flags().show_pos) { + sign_char = '+'; + } else if (conv.flags().sign_col) { + sign_char = ' '; + } + + // Print nan/inf. + if (ConvertNonNumericFloats(sign_char, abs_v, conv, sink)) { + return true; + } + + int precision = conv.precision() < 0 ? 6 : conv.precision(); + + int exp = 0; + + auto decomposed = Decompose(abs_v); + + Buffer buffer; + + switch (conv.conv().id()) { + case ConversionChar::f: + case ConversionChar::F: + if (!FloatToBuffer<FormatStyle::Fixed>(decomposed, precision, &buffer, + nullptr)) { + return FallbackToSnprintf(v, conv, sink); + } + if (!conv.flags().alt && buffer.back() == '.') buffer.pop_back(); + break; + + case ConversionChar::e: + case ConversionChar::E: + if (!FloatToBuffer<FormatStyle::Precision>(decomposed, precision, &buffer, + &exp)) { + return FallbackToSnprintf(v, conv, sink); + } + if (!conv.flags().alt && buffer.back() == '.') buffer.pop_back(); + PrintExponent(exp, conv.conv().upper() ? 'E' : 'e', &buffer); + break; + + case ConversionChar::g: + case ConversionChar::G: + precision = std::max(0, precision - 1); + if (!FloatToBuffer<FormatStyle::Precision>(decomposed, precision, &buffer, + &exp)) { + return FallbackToSnprintf(v, conv, sink); + } + if (precision + 1 > exp && exp >= -4) { + if (exp < 0) { + // Have 1.23456, needs 0.00123456 + // Move the first digit + buffer.begin[1] = *buffer.begin; + // Add some zeros + for (; exp < -1; ++exp) *buffer.begin-- = '0'; + *buffer.begin-- = '.'; + *buffer.begin = '0'; + } else if (exp > 0) { + // Have 1.23456, needs 1234.56 + // Move the '.' exp positions to the right. + std::rotate(buffer.begin + 1, buffer.begin + 2, + buffer.begin + exp + 2); + } + exp = 0; + } + if (!conv.flags().alt) { + while (buffer.back() == '0') buffer.pop_back(); + if (buffer.back() == '.') buffer.pop_back(); + } + if (exp) PrintExponent(exp, conv.conv().upper() ? 'E' : 'e', &buffer); + break; + + case ConversionChar::a: + case ConversionChar::A: + return FallbackToSnprintf(v, conv, sink); + + default: + return false; + } + + WriteBufferToSink(sign_char, + string_view(buffer.begin, buffer.end - buffer.begin), conv, + sink); + + return true; +} + +} // namespace + +bool ConvertFloatImpl(long double v, const ConversionSpec &conv, + FormatSinkImpl *sink) { + return FloatToSink(v, conv, sink); +} + +bool ConvertFloatImpl(float v, const ConversionSpec &conv, + FormatSinkImpl *sink) { + return FloatToSink(v, conv, sink); +} + +bool ConvertFloatImpl(double v, const ConversionSpec &conv, + FormatSinkImpl *sink) { + return FloatToSink(v, conv, sink); +} + +} // namespace str_format_internal +} // namespace absl diff --git a/absl/strings/internal/str_format/float_conversion.h b/absl/strings/internal/str_format/float_conversion.h new file mode 100644 index 000000000000..8ba5566d3eef --- /dev/null +++ b/absl/strings/internal/str_format/float_conversion.h @@ -0,0 +1,21 @@ +#ifndef ABSL_STRINGS_INTERNAL_STR_FORMAT_FLOAT_CONVERSION_H_ +#define ABSL_STRINGS_INTERNAL_STR_FORMAT_FLOAT_CONVERSION_H_ + +#include "absl/strings/internal/str_format/extension.h" + +namespace absl { +namespace str_format_internal { + +bool ConvertFloatImpl(float v, const ConversionSpec &conv, + FormatSinkImpl *sink); + +bool ConvertFloatImpl(double v, const ConversionSpec &conv, + FormatSinkImpl *sink); + +bool ConvertFloatImpl(long double v, const ConversionSpec &conv, + FormatSinkImpl *sink); + +} // namespace str_format_internal +} // namespace absl + +#endif // ABSL_STRINGS_INTERNAL_STR_FORMAT_FLOAT_CONVERSION_H_ diff --git a/absl/strings/internal/str_format/output.cc b/absl/strings/internal/str_format/output.cc new file mode 100644 index 000000000000..5c3795b737ca --- /dev/null +++ b/absl/strings/internal/str_format/output.cc @@ -0,0 +1,47 @@ +// Copyright 2017 The Abseil Authors. +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +#include "absl/strings/internal/str_format/output.h" + +#include <errno.h> +#include <cstring> + +namespace absl { +namespace str_format_internal { + +void BufferRawSink::Write(string_view v) { + size_t to_write = std::min(v.size(), size_); + std::memcpy(buffer_, v.data(), to_write); + buffer_ += to_write; + size_ -= to_write; + total_written_ += v.size(); +} + +void FILERawSink::Write(string_view v) { + while (!v.empty() && !error_) { + if (size_t result = std::fwrite(v.data(), 1, v.size(), output_)) { + // Some progress was made. + count_ += result; + v.remove_prefix(result); + } else { + // Some error occurred. + if (errno != EINTR) { + error_ = errno; + } + } + } +} + +} // namespace str_format_internal +} // namespace absl diff --git a/absl/strings/internal/str_format/output.h b/absl/strings/internal/str_format/output.h new file mode 100644 index 000000000000..3b0aa5e7157e --- /dev/null +++ b/absl/strings/internal/str_format/output.h @@ -0,0 +1,101 @@ +// Copyright 2017 The Abseil Authors. +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// Output extension hooks for the Format library. +// `internal::InvokeFlush` calls the appropriate flush function for the +// specified output argument. +// `BufferRawSink` is a simple output sink for a char buffer. Used by SnprintF. +// `FILERawSink` is a std::FILE* based sink. Used by PrintF and FprintF. + +#ifndef ABSL_STRINGS_INTERNAL_STR_FORMAT_OUTPUT_H_ +#define ABSL_STRINGS_INTERNAL_STR_FORMAT_OUTPUT_H_ + +#include <cstdio> +#include <ostream> +#include <string> + +#include "absl/base/port.h" +#include "absl/strings/string_view.h" + +class Cord; + +namespace absl { +namespace str_format_internal { + +// RawSink implementation that writes into a char* buffer. +// It will not overflow the buffer, but will keep the total count of chars +// that would have been written. +class BufferRawSink { + public: + BufferRawSink(char* buffer, size_t size) : buffer_(buffer), size_(size) {} + + size_t total_written() const { return total_written_; } + void Write(string_view v); + + private: + char* buffer_; + size_t size_; + size_t total_written_ = 0; +}; + +// RawSink implementation that writes into a FILE*. +// It keeps track of the total number of bytes written and any error encountered +// during the writes. +class FILERawSink { + public: + explicit FILERawSink(std::FILE* output) : output_(output) {} + + void Write(string_view v); + + size_t count() const { return count_; } + int error() const { return error_; } + + private: + std::FILE* output_; + int error_ = 0; + size_t count_ = 0; +}; + +// Provide RawSink integration with common types from the STL. +inline void AbslFormatFlush(std::string* out, string_view s) { + out->append(s.begin(), s.size()); +} +inline void AbslFormatFlush(std::ostream* out, string_view s) { + out->write(s.begin(), s.size()); +} + +template <class AbslCord, typename = typename std::enable_if< + std::is_same<AbslCord, ::Cord>::value>::type> +inline void AbslFormatFlush(AbslCord* out, string_view s) { + out->Append(s); +} + +inline void AbslFormatFlush(FILERawSink* sink, string_view v) { + sink->Write(v); +} + +inline void AbslFormatFlush(BufferRawSink* sink, string_view v) { + sink->Write(v); +} + +template <typename T> +auto InvokeFlush(T* out, string_view s) + -> decltype(str_format_internal::AbslFormatFlush(out, s)) { + str_format_internal::AbslFormatFlush(out, s); +} + +} // namespace str_format_internal +} // namespace absl + +#endif // ABSL_STRINGS_INTERNAL_STR_FORMAT_OUTPUT_H_ diff --git a/absl/strings/internal/str_format/output_test.cc b/absl/strings/internal/str_format/output_test.cc new file mode 100644 index 000000000000..cc3c615557fe --- /dev/null +++ b/absl/strings/internal/str_format/output_test.cc @@ -0,0 +1,78 @@ +// Copyright 2017 The Abseil Authors. +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +#include "absl/strings/internal/str_format/output.h" + +#include <sstream> +#include <string> + + +#include "gmock/gmock.h" +#include "gtest/gtest.h" + +namespace absl { +namespace { + +TEST(InvokeFlush, String) { + std::string str = "ABC"; + str_format_internal::InvokeFlush(&str, "DEF"); + EXPECT_EQ(str, "ABCDEF"); + +#if UTIL_FORMAT_HAS_GLOBAL_STRING + std::string str2 = "ABC"; + str_format_internal::InvokeFlush(&str2, "DEF"); + EXPECT_EQ(str2, "ABCDEF"); +#endif // UTIL_FORMAT_HAS_GLOBAL_STRING +} + +TEST(InvokeFlush, Stream) { + std::stringstream str; + str << "ABC"; + str_format_internal::InvokeFlush(&str, "DEF"); + EXPECT_EQ(str.str(), "ABCDEF"); +} + +TEST(BufferRawSink, Limits) { + char buf[16]; + { + std::fill(std::begin(buf), std::end(buf), 'x'); + str_format_internal::BufferRawSink bufsink(buf, sizeof(buf) - 1); + str_format_internal::InvokeFlush(&bufsink, "Hello World237"); + EXPECT_EQ(std::string(buf, sizeof(buf)), "Hello World237xx"); + } + { + std::fill(std::begin(buf), std::end(buf), 'x'); + str_format_internal::BufferRawSink bufsink(buf, sizeof(buf) - 1); + str_format_internal::InvokeFlush(&bufsink, "Hello World237237"); + EXPECT_EQ(std::string(buf, sizeof(buf)), "Hello World2372x"); + } + { + std::fill(std::begin(buf), std::end(buf), 'x'); + str_format_internal::BufferRawSink bufsink(buf, sizeof(buf) - 1); + str_format_internal::InvokeFlush(&bufsink, "Hello World"); + str_format_internal::InvokeFlush(&bufsink, "237"); + EXPECT_EQ(std::string(buf, sizeof(buf)), "Hello World237xx"); + } + { + std::fill(std::begin(buf), std::end(buf), 'x'); + str_format_internal::BufferRawSink bufsink(buf, sizeof(buf) - 1); + str_format_internal::InvokeFlush(&bufsink, "Hello World"); + str_format_internal::InvokeFlush(&bufsink, "237237"); + EXPECT_EQ(std::string(buf, sizeof(buf)), "Hello World2372x"); + } +} + +} // namespace +} // namespace absl + diff --git a/absl/strings/internal/str_format/parser.cc b/absl/strings/internal/str_format/parser.cc new file mode 100644 index 000000000000..10114f489c01 --- /dev/null +++ b/absl/strings/internal/str_format/parser.cc @@ -0,0 +1,294 @@ +#include "absl/strings/internal/str_format/parser.h" + +#include <assert.h> +#include <string.h> +#include <wchar.h> +#include <cctype> +#include <cstdint> + +#include <algorithm> +#include <initializer_list> +#include <limits> +#include <ostream> +#include <string> +#include <unordered_set> + +namespace absl { +namespace str_format_internal { +namespace { + +bool CheckFastPathSetting(const UnboundConversion& conv) { + bool should_be_basic = !conv.flags.left && // + !conv.flags.show_pos && // + !conv.flags.sign_col && // + !conv.flags.alt && // + !conv.flags.zero && // + (conv.width.value() == -1) && + (conv.precision.value() == -1); + if (should_be_basic != conv.flags.basic) { + fprintf(stderr, + "basic=%d left=%d show_pos=%d sign_col=%d alt=%d zero=%d " + "width=%d precision=%d\n", + conv.flags.basic, conv.flags.left, conv.flags.show_pos, + conv.flags.sign_col, conv.flags.alt, conv.flags.zero, + conv.width.value(), conv.precision.value()); + } + return should_be_basic == conv.flags.basic; +} + +// Keep a single table for all the conversion chars and length modifiers. +// We invert the length modifiers to make them negative so that we can easily +// test for them. +// Everything else is `none`, which is a negative constant. +using CC = ConversionChar::Id; +using LM = LengthMod::Id; +static constexpr std::int8_t none = -128; +static constexpr std::int8_t kIds[] = { + none, none, none, none, none, none, none, none, // 00-07 + none, none, none, none, none, none, none, none, // 08-0f + none, none, none, none, none, none, none, none, // 10-17 + none, none, none, none, none, none, none, none, // 18-1f + none, none, none, none, none, none, none, none, // 20-27 + none, none, none, none, none, none, none, none, // 28-2f + none, none, none, none, none, none, none, none, // 30-37 + none, none, none, none, none, none, none, none, // 38-3f + none, CC::A, none, CC::C, none, CC::E, CC::F, CC::G, // @ABCDEFG + none, none, none, none, ~LM::L, none, none, none, // HIJKLMNO + none, none, none, CC::S, none, none, none, none, // PQRSTUVW + CC::X, none, none, none, none, none, none, none, // XYZ[\]^_ + none, CC::a, none, CC::c, CC::d, CC::e, CC::f, CC::g, // `abcdefg + ~LM::h, CC::i, ~LM::j, none, ~LM::l, none, CC::n, CC::o, // hijklmno + CC::p, ~LM::q, none, CC::s, ~LM::t, CC::u, none, none, // pqrstuvw + CC::x, none, ~LM::z, none, none, none, none, none, // xyz{|}~! + none, none, none, none, none, none, none, none, // 80-87 + none, none, none, none, none, none, none, none, // 88-8f + none, none, none, none, none, none, none, none, // 90-97 + none, none, none, none, none, none, none, none, // 98-9f + none, none, none, none, none, none, none, none, // a0-a7 + none, none, none, none, none, none, none, none, // a8-af + none, none, none, none, none, none, none, none, // b0-b7 + none, none, none, none, none, none, none, none, // b8-bf + none, none, none, none, none, none, none, none, // c0-c7 + none, none, none, none, none, none, none, none, // c8-cf + none, none, none, none, none, none, none, none, // d0-d7 + none, none, none, none, none, none, none, none, // d8-df + none, none, none, none, none, none, none, none, // e0-e7 + none, none, none, none, none, none, none, none, // e8-ef + none, none, none, none, none, none, none, none, // f0-f7 + none, none, none, none, none, none, none, none, // f8-ff +}; + +template <bool is_positional> +bool ConsumeConversion(string_view *src, UnboundConversion *conv, + int *next_arg) { + const char *pos = src->begin(); + const char *const end = src->end(); + char c; + // Read the next char into `c` and update `pos`. Reads '\0' if at end. + const auto get_char = [&] { c = pos == end ? '\0' : *pos++; }; + + const auto parse_digits = [&] { + int digits = c - '0'; + // We do not want to overflow `digits` so we consume at most digits10-1 + // digits. If there are more digits the parsing will fail later on when the + // digit doesn't match the expected characters. + int num_digits = std::numeric_limits<int>::digits10 - 2; + for (get_char(); num_digits && std::isdigit(c); get_char()) { + --num_digits; + digits = 10 * digits + c - '0'; + } + return digits; + }; + + if (is_positional) { + get_char(); + if (c < '1' || c > '9') return false; + conv->arg_position = parse_digits(); + assert(conv->arg_position > 0); + if (c != '$') return false; + } + + get_char(); + + // We should start with the basic flag on. + assert(conv->flags.basic); + + // Any non alpha character makes this conversion not basic. + // This includes flags (-+ #0), width (1-9, *) or precision (.). + // All conversion characters and length modifiers are alpha characters. + if (c < 'A') { + conv->flags.basic = false; + + for (; c <= '0'; get_char()) { + switch (c) { + case '-': + conv->flags.left = true; + continue; + case '+': + conv->flags.show_pos = true; + continue; + case ' ': + conv->flags.sign_col = true; + continue; + case '#': + conv->flags.alt = true; + continue; + case '0': + conv->flags.zero = true; + continue; + } + break; + } + + if (c <= '9') { + if (c >= '0') { + int maybe_width = parse_digits(); + if (!is_positional && c == '$') { + if (*next_arg != 0) return false; + // Positional conversion. + *next_arg = -1; + conv->flags = Flags(); + conv->flags.basic = true; + return ConsumeConversion<true>(src, conv, next_arg); + } + conv->width.set_value(maybe_width); + } else if (c == '*') { + get_char(); + if (is_positional) { + if (c < '1' || c > '9') return false; + conv->width.set_from_arg(parse_digits()); + if (c != '$') return false; + get_char(); + } else { + conv->width.set_from_arg(++*next_arg); + } + } + } + + if (c == '.') { + get_char(); + if (std::isdigit(c)) { + conv->precision.set_value(parse_digits()); + } else if (c == '*') { + get_char(); + if (is_positional) { + if (c < '1' || c > '9') return false; + conv->precision.set_from_arg(parse_digits()); + if (c != '$') return false; + get_char(); + } else { + conv->precision.set_from_arg(++*next_arg); + } + } else { + conv->precision.set_value(0); + } + } + } + + std::int8_t id = kIds[static_cast<unsigned char>(c)]; + + if (id < 0) { + if (id == none) return false; + + // It is a length modifier. + using str_format_internal::LengthMod; + LengthMod length_mod = LengthMod::FromId(static_cast<LM>(~id)); + get_char(); + if (c == 'h' && length_mod.id() == LengthMod::h) { + conv->length_mod = LengthMod::FromId(LengthMod::hh); + get_char(); + } else if (c == 'l' && length_mod.id() == LengthMod::l) { + conv->length_mod = LengthMod::FromId(LengthMod::ll); + get_char(); + } else { + conv->length_mod = length_mod; + } + id = kIds[static_cast<unsigned char>(c)]; + if (id < 0) return false; + } + + assert(CheckFastPathSetting(*conv)); + (void)(&CheckFastPathSetting); + + conv->conv = ConversionChar::FromId(static_cast<CC>(id)); + if (!is_positional) conv->arg_position = ++*next_arg; + *src = string_view(pos, end - pos); + return true; +} + +} // namespace + +bool ConsumeUnboundConversion(string_view *src, UnboundConversion *conv, + int *next_arg) { + if (*next_arg < 0) return ConsumeConversion<true>(src, conv, next_arg); + return ConsumeConversion<false>(src, conv, next_arg); +} + +struct ParsedFormatBase::ParsedFormatConsumer { + explicit ParsedFormatConsumer(ParsedFormatBase *parsedformat) + : parsed(parsedformat), data_pos(parsedformat->data_.get()) {} + + bool Append(string_view s) { + if (s.empty()) return true; + + size_t text_end = AppendText(s); + + if (!parsed->items_.empty() && !parsed->items_.back().is_conversion) { + // Let's extend the existing text run. + parsed->items_.back().text_end = text_end; + } else { + // Let's make a new text run. + parsed->items_.push_back({false, text_end, {}}); + } + return true; + } + + bool ConvertOne(const UnboundConversion &conv, string_view s) { + size_t text_end = AppendText(s); + parsed->items_.push_back({true, text_end, conv}); + return true; + } + + size_t AppendText(string_view s) { + memcpy(data_pos, s.data(), s.size()); + data_pos += s.size(); + return static_cast<size_t>(data_pos - parsed->data_.get()); + } + + ParsedFormatBase *parsed; + char* data_pos; +}; + +ParsedFormatBase::ParsedFormatBase(string_view format, bool allow_ignored, + std::initializer_list<Conv> convs) + : data_(format.empty() ? nullptr : new char[format.size()]) { + has_error_ = !ParseFormatString(format, ParsedFormatConsumer(this)) || + !MatchesConversions(allow_ignored, convs); +} + +bool ParsedFormatBase::MatchesConversions( + bool allow_ignored, std::initializer_list<Conv> convs) const { + std::unordered_set<int> used; + auto add_if_valid_conv = [&](int pos, char c) { + if (static_cast<size_t>(pos) > convs.size() || + !Contains(convs.begin()[pos - 1], c)) + return false; + used.insert(pos); + return true; + }; + for (const ConversionItem &item : items_) { + if (!item.is_conversion) continue; + auto &conv = item.conv; + if (conv.precision.is_from_arg() && + !add_if_valid_conv(conv.precision.get_from_arg(), '*')) + return false; + if (conv.width.is_from_arg() && + !add_if_valid_conv(conv.width.get_from_arg(), '*')) + return false; + if (!add_if_valid_conv(conv.arg_position, conv.conv.Char())) return false; + } + return used.size() == convs.size() || allow_ignored; +} + +} // namespace str_format_internal +} // namespace absl diff --git a/absl/strings/internal/str_format/parser.h b/absl/strings/internal/str_format/parser.h new file mode 100644 index 000000000000..5bebc95540e6 --- /dev/null +++ b/absl/strings/internal/str_format/parser.h @@ -0,0 +1,291 @@ +#ifndef ABSL_STRINGS_INTERNAL_STR_FORMAT_PARSER_H_ +#define ABSL_STRINGS_INTERNAL_STR_FORMAT_PARSER_H_ + +#include <limits.h> +#include <stddef.h> +#include <stdlib.h> + +#include <cassert> +#include <initializer_list> +#include <iosfwd> +#include <iterator> +#include <memory> +#include <vector> + +#include "absl/strings/internal/str_format/checker.h" +#include "absl/strings/internal/str_format/extension.h" + +namespace absl { +namespace str_format_internal { + +// The analyzed properties of a single specified conversion. +struct UnboundConversion { + UnboundConversion() + : flags() /* This is required to zero all the fields of flags. */ { + flags.basic = true; + } + + class InputValue { + public: + void set_value(int value) { + assert(value >= 0); + value_ = value; + } + int value() const { return value_; } + + // Marks the value as "from arg". aka the '*' format. + // Requires `value >= 1`. + // When set, is_from_arg() return true and get_from_arg() returns the + // original value. + // `value()`'s return value is unspecfied in this state. + void set_from_arg(int value) { + assert(value > 0); + value_ = -value - 1; + } + bool is_from_arg() const { return value_ < -1; } + int get_from_arg() const { + assert(is_from_arg()); + return -value_ - 1; + } + + private: + int value_ = -1; + }; + + // No need to initialize. It will always be set in the parser. + int arg_position; + + InputValue width; + InputValue precision; + + Flags flags; + LengthMod length_mod; + ConversionChar conv; +}; + +// Consume conversion spec prefix (not including '%') of '*src' if valid. +// Examples of valid specs would be e.g.: "s", "d", "-12.6f". +// If valid, the front of src is advanced such that src becomes the +// part following the conversion spec, and the spec part is broken down and +// returned in 'conv'. +// If invalid, returns false and leaves 'src' unmodified. +// For example: +// Given "d9", returns "d", and leaves src="9", +// Given "!", returns "" and leaves src="!". +bool ConsumeUnboundConversion(string_view* src, UnboundConversion* conv, + int* next_arg); + +// Parse the format std::string provided in 'src' and pass the identified items into +// 'consumer'. +// Text runs will be passed by calling +// Consumer::Append(string_view); +// ConversionItems will be passed by calling +// Consumer::ConvertOne(UnboundConversion, string_view); +// In the case of ConvertOne, the string_view that is passed is the +// portion of the format std::string corresponding to the conversion, not including +// the leading %. On success, it returns true. On failure, it stops and returns +// false. +template <typename Consumer> +bool ParseFormatString(string_view src, Consumer consumer) { + int next_arg = 0; + while (!src.empty()) { + const char* percent = + static_cast<const char*>(memchr(src.begin(), '%', src.size())); + if (!percent) { + // We found the last substring. + return consumer.Append(src); + } + // We found a percent, so push the text run then process the percent. + size_t percent_loc = percent - src.data(); + if (!consumer.Append(string_view(src.data(), percent_loc))) return false; + if (percent + 1 >= src.end()) return false; + + UnboundConversion conv; + + switch (percent[1]) { + case '%': + if (!consumer.Append("%")) return false; + src.remove_prefix(percent_loc + 2); + continue; + +#define PARSER_CASE(ch) \ + case #ch[0]: \ + src.remove_prefix(percent_loc + 2); \ + conv.conv = ConversionChar::FromId(ConversionChar::ch); \ + conv.arg_position = ++next_arg; \ + break; + ABSL_CONVERSION_CHARS_EXPAND_(PARSER_CASE, ); +#undef PARSER_CASE + + default: + src.remove_prefix(percent_loc + 1); + if (!ConsumeUnboundConversion(&src, &conv, &next_arg)) return false; + break; + } + if (next_arg == 0) { + // This indicates an error in the format std::string. + // The only way to get next_arg == 0 is to have a positional argument + // first which sets next_arg to -1 and then a non-positional argument + // which does ++next_arg. + // Checking here seems to be the cheapeast place to do it. + return false; + } + if (!consumer.ConvertOne( + conv, string_view(percent + 1, src.data() - (percent + 1)))) { + return false; + } + } + return true; +} + +// Always returns true, or fails to compile in a constexpr context if s does not +// point to a constexpr char array. +constexpr bool EnsureConstexpr(string_view s) { + return s.empty() || s[0] == s[0]; +} + +class ParsedFormatBase { + public: + explicit ParsedFormatBase(string_view format, bool allow_ignored, + std::initializer_list<Conv> convs); + + ParsedFormatBase(const ParsedFormatBase& other) { *this = other; } + + ParsedFormatBase(ParsedFormatBase&& other) { *this = std::move(other); } + + ParsedFormatBase& operator=(const ParsedFormatBase& other) { + if (this == &other) return *this; + has_error_ = other.has_error_; + items_ = other.items_; + size_t text_size = items_.empty() ? 0 : items_.back().text_end; + data_.reset(new char[text_size]); + memcpy(data_.get(), other.data_.get(), text_size); + return *this; + } + + ParsedFormatBase& operator=(ParsedFormatBase&& other) { + if (this == &other) return *this; + has_error_ = other.has_error_; + data_ = std::move(other.data_); + items_ = std::move(other.items_); + // Reset the vector to make sure the invariants hold. + other.items_.clear(); + return *this; + } + + template <typename Consumer> + bool ProcessFormat(Consumer consumer) const { + const char* const base = data_.get(); + string_view text(base, 0); + for (const auto& item : items_) { + text = string_view(text.end(), (base + item.text_end) - text.end()); + if (item.is_conversion) { + if (!consumer.ConvertOne(item.conv, text)) return false; + } else { + if (!consumer.Append(text)) return false; + } + } + return !has_error_; + } + + bool has_error() const { return has_error_; } + + private: + // Returns whether the conversions match and if !allow_ignored it verifies + // that all conversions are used by the format. + bool MatchesConversions(bool allow_ignored, + std::initializer_list<Conv> convs) const; + + struct ParsedFormatConsumer; + + struct ConversionItem { + bool is_conversion; + // Points to the past-the-end location of this element in the data_ array. + size_t text_end; + UnboundConversion conv; + }; + + bool has_error_; + std::unique_ptr<char[]> data_; + std::vector<ConversionItem> items_; +}; + + +// A value type representing a preparsed format. These can be created, copied +// around, and reused to speed up formatting loops. +// The user must specify through the template arguments the conversion +// characters used in the format. This will be checked at compile time. +// +// This class uses Conv enum values to specify each argument. +// This allows for more flexibility as you can specify multiple possible +// conversion characters for each argument. +// ParsedFormat<char...> is a simplified alias for when the user only +// needs to specify a single conversion character for each argument. +// +// Example: +// // Extended format supports multiple characters per argument: +// using MyFormat = ExtendedParsedFormat<Conv::d | Conv::x>; +// MyFormat GetFormat(bool use_hex) { +// if (use_hex) return MyFormat("foo %x bar"); +// return MyFormat("foo %d bar"); +// } +// // 'format' can be used with any value that supports 'd' and 'x', +// // like `int`. +// auto format = GetFormat(use_hex); +// value = StringF(format, i); +// +// This class also supports runtime format checking with the ::New() and +// ::NewAllowIgnored() factory functions. +// This is the only API that allows the user to pass a runtime specified format +// std::string. These factory functions will return NULL if the format does not match +// the conversions requested by the user. +template <str_format_internal::Conv... C> +class ExtendedParsedFormat : public str_format_internal::ParsedFormatBase { + public: + explicit ExtendedParsedFormat(string_view format) +#if ABSL_INTERNAL_ENABLE_FORMAT_CHECKER + __attribute__(( + enable_if(str_format_internal::EnsureConstexpr(format), + "Format std::string is not constexpr."), + enable_if(str_format_internal::ValidFormatImpl<C...>(format), + "Format specified does not match the template arguments."))) +#endif // ABSL_INTERNAL_ENABLE_FORMAT_CHECKER + : ExtendedParsedFormat(format, false) { + } + + // ExtendedParsedFormat factory function. + // The user still has to specify the conversion characters, but they will not + // be checked at compile time. Instead, it will be checked at runtime. + // This delays the checking to runtime, but allows the user to pass + // dynamically sourced formats. + // It returns NULL if the format does not match the conversion characters. + // The user is responsible for checking the return value before using it. + // + // The 'New' variant will check that all the specified arguments are being + // consumed by the format and return NULL if any argument is being ignored. + // The 'NewAllowIgnored' variant will not verify this and will allow formats + // that ignore arguments. + static std::unique_ptr<ExtendedParsedFormat> New(string_view format) { + return New(format, false); + } + static std::unique_ptr<ExtendedParsedFormat> NewAllowIgnored( + string_view format) { + return New(format, true); + } + + private: + static std::unique_ptr<ExtendedParsedFormat> New(string_view format, + bool allow_ignored) { + std::unique_ptr<ExtendedParsedFormat> conv( + new ExtendedParsedFormat(format, allow_ignored)); + if (conv->has_error()) return nullptr; + return conv; + } + + ExtendedParsedFormat(string_view s, bool allow_ignored) + : ParsedFormatBase(s, allow_ignored, {C...}) {} +}; +} // namespace str_format_internal +} // namespace absl + +#endif // ABSL_STRINGS_INTERNAL_STR_FORMAT_PARSER_H_ diff --git a/absl/strings/internal/str_format/parser_test.cc b/absl/strings/internal/str_format/parser_test.cc new file mode 100644 index 000000000000..e698020b1aba --- /dev/null +++ b/absl/strings/internal/str_format/parser_test.cc @@ -0,0 +1,379 @@ +#include "absl/strings/internal/str_format/parser.h" + +#include <string.h> +#include "gtest/gtest.h" +#include "absl/base/macros.h" + +namespace absl { +namespace str_format_internal { + +namespace { + +TEST(LengthModTest, Names) { + struct Expectation { + int line; + LengthMod::Id id; + const char *name; + }; + const Expectation kExpect[] = { + {__LINE__, LengthMod::none, "" }, + {__LINE__, LengthMod::h, "h" }, + {__LINE__, LengthMod::hh, "hh"}, + {__LINE__, LengthMod::l, "l" }, + {__LINE__, LengthMod::ll, "ll"}, + {__LINE__, LengthMod::L, "L" }, + {__LINE__, LengthMod::j, "j" }, + {__LINE__, LengthMod::z, "z" }, + {__LINE__, LengthMod::t, "t" }, + {__LINE__, LengthMod::q, "q" }, + }; + EXPECT_EQ(ABSL_ARRAYSIZE(kExpect), LengthMod::kNumValues); + for (auto e : kExpect) { + SCOPED_TRACE(e.line); + LengthMod mod = LengthMod::FromId(e.id); + EXPECT_EQ(e.id, mod.id()); + EXPECT_EQ(e.name, mod.name()); + } +} + +TEST(ConversionCharTest, Names) { + struct Expectation { + ConversionChar::Id id; + char name; + }; + // clang-format off + const Expectation kExpect[] = { +#define X(c) {ConversionChar::c, #c[0]} + X(c), X(C), X(s), X(S), // text + X(d), X(i), X(o), X(u), X(x), X(X), // int + X(f), X(F), X(e), X(E), X(g), X(G), X(a), X(A), // float + X(n), X(p), // misc +#undef X + {ConversionChar::none, '\0'}, + }; + // clang-format on + EXPECT_EQ(ABSL_ARRAYSIZE(kExpect), ConversionChar::kNumValues); + for (auto e : kExpect) { + SCOPED_TRACE(e.name); + ConversionChar v = ConversionChar::FromId(e.id); + EXPECT_EQ(e.id, v.id()); + EXPECT_EQ(e.name, v.Char()); + } +} + +class ConsumeUnboundConversionTest : public ::testing::Test { + public: + typedef UnboundConversion Props; + string_view Consume(string_view* src) { + int next = 0; + const char* prev_begin = src->begin(); + o = UnboundConversion(); // refresh + ConsumeUnboundConversion(src, &o, &next); + return {prev_begin, static_cast<size_t>(src->begin() - prev_begin)}; + } + + bool Run(const char *fmt, bool force_positional = false) { + string_view src = fmt; + int next = force_positional ? -1 : 0; + o = UnboundConversion(); // refresh + return ConsumeUnboundConversion(&src, &o, &next) && src.empty(); + } + UnboundConversion o; +}; + +TEST_F(ConsumeUnboundConversionTest, ConsumeSpecification) { + struct Expectation { + int line; + const char *src; + const char *out; + const char *src_post; + }; + const Expectation kExpect[] = { + {__LINE__, "", "", "" }, + {__LINE__, "b", "", "b" }, // 'b' is invalid + {__LINE__, "ba", "", "ba"}, // 'b' is invalid + {__LINE__, "l", "", "l" }, // just length mod isn't okay + {__LINE__, "d", "d", "" }, // basic + {__LINE__, "d ", "d", " " }, // leave suffix + {__LINE__, "dd", "d", "d" }, // don't be greedy + {__LINE__, "d9", "d", "9" }, // leave non-space suffix + {__LINE__, "dzz", "d", "zz"}, // length mod as suffix + {__LINE__, "1$*2$d", "1$*2$d", "" }, // arg indexing and * allowed. + {__LINE__, "0-14.3hhd", "0-14.3hhd", ""}, // precision, width + {__LINE__, " 0-+#14.3hhd", " 0-+#14.3hhd", ""}, // flags + }; + for (const auto& e : kExpect) { + SCOPED_TRACE(e.line); + string_view src = e.src; + EXPECT_EQ(e.src, src); + string_view out = Consume(&src); + EXPECT_EQ(e.out, out); + EXPECT_EQ(e.src_post, src); + } +} + +TEST_F(ConsumeUnboundConversionTest, BasicConversion) { + EXPECT_FALSE(Run("")); + EXPECT_FALSE(Run("z")); + + EXPECT_FALSE(Run("dd")); // no excess allowed + + EXPECT_TRUE(Run("d")); + EXPECT_EQ('d', o.conv.Char()); + EXPECT_FALSE(o.width.is_from_arg()); + EXPECT_LT(o.width.value(), 0); + EXPECT_FALSE(o.precision.is_from_arg()); + EXPECT_LT(o.precision.value(), 0); + EXPECT_EQ(1, o.arg_position); + EXPECT_EQ(LengthMod::none, o.length_mod.id()); +} + +TEST_F(ConsumeUnboundConversionTest, ArgPosition) { + EXPECT_TRUE(Run("d")); + EXPECT_EQ(1, o.arg_position); + EXPECT_TRUE(Run("3$d")); + EXPECT_EQ(3, o.arg_position); + EXPECT_TRUE(Run("1$d")); + EXPECT_EQ(1, o.arg_position); + EXPECT_TRUE(Run("1$d", true)); + EXPECT_EQ(1, o.arg_position); + EXPECT_TRUE(Run("123$d")); + EXPECT_EQ(123, o.arg_position); + EXPECT_TRUE(Run("123$d", true)); + EXPECT_EQ(123, o.arg_position); + EXPECT_TRUE(Run("10$d")); + EXPECT_EQ(10, o.arg_position); + EXPECT_TRUE(Run("10$d", true)); + EXPECT_EQ(10, o.arg_position); + + // Position can't be zero. + EXPECT_FALSE(Run("0$d")); + EXPECT_FALSE(Run("0$d", true)); + EXPECT_FALSE(Run("1$*0$d")); + EXPECT_FALSE(Run("1$.*0$d")); + + // Position can't start with a zero digit at all. That is not a 'decimal'. + EXPECT_FALSE(Run("01$p")); + EXPECT_FALSE(Run("01$p", true)); + EXPECT_FALSE(Run("1$*01$p")); + EXPECT_FALSE(Run("1$.*01$p")); +} + +TEST_F(ConsumeUnboundConversionTest, WidthAndPrecision) { + EXPECT_TRUE(Run("14d")); + EXPECT_EQ('d', o.conv.Char()); + EXPECT_FALSE(o.width.is_from_arg()); + EXPECT_EQ(14, o.width.value()); + EXPECT_FALSE(o.precision.is_from_arg()); + EXPECT_LT(o.precision.value(), 0); + + EXPECT_TRUE(Run("14.d")); + EXPECT_FALSE(o.width.is_from_arg()); + EXPECT_FALSE(o.precision.is_from_arg()); + EXPECT_EQ(14, o.width.value()); + EXPECT_EQ(0, o.precision.value()); + + EXPECT_TRUE(Run(".d")); + EXPECT_FALSE(o.width.is_from_arg()); + EXPECT_LT(o.width.value(), 0); + EXPECT_FALSE(o.precision.is_from_arg()); + EXPECT_EQ(0, o.precision.value()); + + EXPECT_TRUE(Run(".5d")); + EXPECT_FALSE(o.width.is_from_arg()); + EXPECT_LT(o.width.value(), 0); + EXPECT_FALSE(o.precision.is_from_arg()); + EXPECT_EQ(5, o.precision.value()); + + EXPECT_TRUE(Run(".0d")); + EXPECT_FALSE(o.width.is_from_arg()); + EXPECT_LT(o.width.value(), 0); + EXPECT_FALSE(o.precision.is_from_arg()); + EXPECT_EQ(0, o.precision.value()); + + EXPECT_TRUE(Run("14.5d")); + EXPECT_FALSE(o.width.is_from_arg()); + EXPECT_FALSE(o.precision.is_from_arg()); + EXPECT_EQ(14, o.width.value()); + EXPECT_EQ(5, o.precision.value()); + + EXPECT_TRUE(Run("*.*d")); + EXPECT_TRUE(o.width.is_from_arg()); + EXPECT_EQ(1, o.width.get_from_arg()); + EXPECT_TRUE(o.precision.is_from_arg()); + EXPECT_EQ(2, o.precision.get_from_arg()); + EXPECT_EQ(3, o.arg_position); + + EXPECT_TRUE(Run("*d")); + EXPECT_TRUE(o.width.is_from_arg()); + EXPECT_EQ(1, o.width.get_from_arg()); + EXPECT_FALSE(o.precision.is_from_arg()); + EXPECT_LT(o.precision.value(), 0); + EXPECT_EQ(2, o.arg_position); + + EXPECT_TRUE(Run(".*d")); + EXPECT_FALSE(o.width.is_from_arg()); + EXPECT_LT(o.width.value(), 0); + EXPECT_TRUE(o.precision.is_from_arg()); + EXPECT_EQ(1, o.precision.get_from_arg()); + EXPECT_EQ(2, o.arg_position); + + // mixed implicit and explicit: didn't specify arg position. + EXPECT_FALSE(Run("*23$.*34$d")); + + EXPECT_TRUE(Run("12$*23$.*34$d")); + EXPECT_EQ(12, o.arg_position); + EXPECT_TRUE(o.width.is_from_arg()); + EXPECT_EQ(23, o.width.get_from_arg()); + EXPECT_TRUE(o.precision.is_from_arg()); + EXPECT_EQ(34, o.precision.get_from_arg()); + + EXPECT_TRUE(Run("2$*5$.*9$d")); + EXPECT_EQ(2, o.arg_position); + EXPECT_TRUE(o.width.is_from_arg()); + EXPECT_EQ(5, o.width.get_from_arg()); + EXPECT_TRUE(o.precision.is_from_arg()); + EXPECT_EQ(9, o.precision.get_from_arg()); + + EXPECT_FALSE(Run(".*0$d")) << "no arg 0"; +} + +TEST_F(ConsumeUnboundConversionTest, Flags) { + static const char kAllFlags[] = "-+ #0"; + static const int kNumFlags = ABSL_ARRAYSIZE(kAllFlags) - 1; + for (int rev = 0; rev < 2; ++rev) { + for (int i = 0; i < 1 << kNumFlags; ++i) { + std::string fmt; + for (int k = 0; k < kNumFlags; ++k) + if ((i >> k) & 1) fmt += kAllFlags[k]; + // flag order shouldn't matter + if (rev == 1) { std::reverse(fmt.begin(), fmt.end()); } + fmt += 'd'; + SCOPED_TRACE(fmt); + EXPECT_TRUE(Run(fmt.c_str())); + EXPECT_EQ(fmt.find('-') == std::string::npos, !o.flags.left); + EXPECT_EQ(fmt.find('+') == std::string::npos, !o.flags.show_pos); + EXPECT_EQ(fmt.find(' ') == std::string::npos, !o.flags.sign_col); + EXPECT_EQ(fmt.find('#') == std::string::npos, !o.flags.alt); + EXPECT_EQ(fmt.find('0') == std::string::npos, !o.flags.zero); + } + } +} + +TEST_F(ConsumeUnboundConversionTest, BasicFlag) { + // Flag is on + for (const char* fmt : {"d", "llx", "G", "1$X"}) { + SCOPED_TRACE(fmt); + EXPECT_TRUE(Run(fmt)); + EXPECT_TRUE(o.flags.basic); + } + + // Flag is off + for (const char* fmt : {"3d", ".llx", "-G", "1$#X"}) { + SCOPED_TRACE(fmt); + EXPECT_TRUE(Run(fmt)); + EXPECT_FALSE(o.flags.basic); + } +} + +struct SummarizeConsumer { + std::string* out; + explicit SummarizeConsumer(std::string* out) : out(out) {} + + bool Append(string_view s) { + *out += "[" + std::string(s) + "]"; + return true; + } + + bool ConvertOne(const UnboundConversion& conv, string_view s) { + *out += "{"; + *out += std::string(s); + *out += ":"; + *out += std::to_string(conv.arg_position) + "$"; + if (conv.width.is_from_arg()) { + *out += std::to_string(conv.width.get_from_arg()) + "$*"; + } + if (conv.precision.is_from_arg()) { + *out += "." + std::to_string(conv.precision.get_from_arg()) + "$*"; + } + *out += conv.conv.Char(); + *out += "}"; + return true; + } +}; + +std::string SummarizeParsedFormat(const ParsedFormatBase& pc) { + std::string out; + if (!pc.ProcessFormat(SummarizeConsumer(&out))) out += "!"; + return out; +} + +class ParsedFormatTest : public testing::Test {}; + +TEST_F(ParsedFormatTest, ValueSemantics) { + ParsedFormatBase p1({}, true, {}); // empty format + EXPECT_EQ("", SummarizeParsedFormat(p1)); + + ParsedFormatBase p2 = p1; // copy construct (empty) + EXPECT_EQ(SummarizeParsedFormat(p1), SummarizeParsedFormat(p2)); + + p1 = ParsedFormatBase("hello%s", true, {Conv::s}); // move assign + EXPECT_EQ("[hello]{s:1$s}", SummarizeParsedFormat(p1)); + + ParsedFormatBase p3 = p1; // copy construct (nonempty) + EXPECT_EQ(SummarizeParsedFormat(p1), SummarizeParsedFormat(p3)); + + using std::swap; + swap(p1, p2); + EXPECT_EQ("", SummarizeParsedFormat(p1)); + EXPECT_EQ("[hello]{s:1$s}", SummarizeParsedFormat(p2)); + swap(p1, p2); // undo + + p2 = p1; // copy assign + EXPECT_EQ(SummarizeParsedFormat(p1), SummarizeParsedFormat(p2)); +} + +struct ExpectParse { + const char* in; + std::initializer_list<Conv> conv_set; + const char* out; +}; + +TEST_F(ParsedFormatTest, Parsing) { + // Parse should be equivalent to that obtained by ConversionParseIterator. + // No need to retest the parsing edge cases here. + const ExpectParse kExpect[] = { + {"", {}, ""}, + {"ab", {}, "[ab]"}, + {"a%d", {Conv::d}, "[a]{d:1$d}"}, + {"a%+d", {Conv::d}, "[a]{+d:1$d}"}, + {"a% d", {Conv::d}, "[a]{ d:1$d}"}, + {"a%b %d", {}, "[a]!"}, // stop after error + }; + for (const auto& e : kExpect) { + SCOPED_TRACE(e.in); + EXPECT_EQ(e.out, + SummarizeParsedFormat(ParsedFormatBase(e.in, false, e.conv_set))); + } +} + +TEST_F(ParsedFormatTest, ParsingFlagOrder) { + const ExpectParse kExpect[] = { + {"a%+ 0d", {Conv::d}, "[a]{+ 0d:1$d}"}, + {"a%+0 d", {Conv::d}, "[a]{+0 d:1$d}"}, + {"a%0+ d", {Conv::d}, "[a]{0+ d:1$d}"}, + {"a% +0d", {Conv::d}, "[a]{ +0d:1$d}"}, + {"a%0 +d", {Conv::d}, "[a]{0 +d:1$d}"}, + {"a% 0+d", {Conv::d}, "[a]{ 0+d:1$d}"}, + {"a%+ 0+d", {Conv::d}, "[a]{+ 0+d:1$d}"}, + }; + for (const auto& e : kExpect) { + SCOPED_TRACE(e.in); + EXPECT_EQ(e.out, + SummarizeParsedFormat(ParsedFormatBase(e.in, false, e.conv_set))); + } +} + +} // namespace +} // namespace str_format_internal +} // namespace absl diff --git a/absl/strings/str_format.h b/absl/strings/str_format.h new file mode 100644 index 000000000000..98e0fef4906b --- /dev/null +++ b/absl/strings/str_format.h @@ -0,0 +1,512 @@ +// +// Copyright 2018 The Abseil Authors. +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ----------------------------------------------------------------------------- +// File: str_format.h +// ----------------------------------------------------------------------------- +// +// The `str_format` library is a typesafe replacement for the family of +// `printf()` std::string formatting routines within the `<cstdio>` standard library +// header. Like the `printf` family, the `str_format` uses a "format string" to +// perform argument substitutions based on types. +// +// Example: +// +// std::string s = absl::StrFormat("%s %s You have $%d!", "Hello", name, dollars); +// +// The library consists of the following basic utilities: +// +// * `absl::StrFormat()`, a type-safe replacement for `std::sprintf()`, to +// write a format std::string to a `string` value. +// * `absl::StrAppendFormat()` to append a format std::string to a `string` +// * `absl::StreamFormat()` to more efficiently write a format std::string to a +// stream, such as`std::cout`. +// * `absl::PrintF()`, `absl::FPrintF()` and `absl::SNPrintF()` as +// replacements for `std::printf()`, `std::fprintf()` and `std::snprintf()`. +// +// Note: a version of `std::sprintf()` is not supported as it is +// generally unsafe due to buffer overflows. +// +// Additionally, you can provide a format std::string (and its associated arguments) +// using one of the following abstractions: +// +// * A `FormatSpec` class template fully encapsulates a format std::string and its +// type arguments and is usually provided to `str_format` functions as a +// variadic argument of type `FormatSpec<Arg...>`. The `FormatSpec<Args...>` +// template is evaluated at compile-time, providing type safety. +// * A `ParsedFormat` instance, which encapsulates a specific, pre-compiled +// format std::string for a specific set of type(s), and which can be passed +// between API boundaries. (The `FormatSpec` type should not be used +// directly.) +// +// The `str_format` library provides the ability to output its format strings to +// arbitrary sink types: +// +// * A generic `Format()` function to write outputs to arbitrary sink types, +// which must implement a `RawSinkFormat` interface. (See +// `str_format_sink.h` for more information.) +// +// * A `FormatUntyped()` function that is similar to `Format()` except it is +// loosely typed. `FormatUntyped()` is not a template and does not perform +// any compile-time checking of the format std::string; instead, it returns a +// boolean from a runtime check. +// +// In addition, the `str_format` library provides extension points for +// augmenting formatting to new types. These extensions are fully documented +// within the `str_format_extension.h` header file. +#ifndef ABSL_STRINGS_STR_FORMAT_H_ +#define ABSL_STRINGS_STR_FORMAT_H_ + +#include <cstdio> +#include <string> + +#include "absl/strings/internal/str_format/arg.h" // IWYU pragma: export +#include "absl/strings/internal/str_format/bind.h" // IWYU pragma: export +#include "absl/strings/internal/str_format/checker.h" // IWYU pragma: export +#include "absl/strings/internal/str_format/extension.h" // IWYU pragma: export +#include "absl/strings/internal/str_format/parser.h" // IWYU pragma: export + +namespace absl { + +// UntypedFormatSpec +// +// A type-erased class that can be used directly within untyped API entry +// points. An `UntypedFormatSpec` is specifically used as an argument to +// `FormatUntyped()`. +// +// Example: +// +// absl::UntypedFormatSpec format("%d"); +// std::string out; +// CHECK(absl::FormatUntyped(&out, format, {absl::FormatArg(1)})); +class UntypedFormatSpec { + public: + UntypedFormatSpec() = delete; + UntypedFormatSpec(const UntypedFormatSpec&) = delete; + UntypedFormatSpec& operator=(const UntypedFormatSpec&) = delete; + + explicit UntypedFormatSpec(string_view s) : spec_(s) {} + + protected: + explicit UntypedFormatSpec(const str_format_internal::ParsedFormatBase* pc) + : spec_(pc) {} + + private: + friend str_format_internal::UntypedFormatSpecImpl; + str_format_internal::UntypedFormatSpecImpl spec_; +}; + +// FormatStreamed() +// +// Takes a streamable argument and returns an object that can print it +// with '%s'. Allows printing of types that have an `operator<<` but no +// intrinsic type support within `StrFormat()` itself. +// +// Example: +// +// absl::StrFormat("%s", absl::FormatStreamed(obj)); +template <typename T> +str_format_internal::StreamedWrapper<T> FormatStreamed(const T& v) { + return str_format_internal::StreamedWrapper<T>(v); +} + +// FormatCountCapture +// +// This class provides a way to safely wrap `StrFormat()` captures of `%n` +// conversions, which denote the number of characters written by a formatting +// operation to this point, into an integer value. +// +// This wrapper is designed to allow safe usage of `%n` within `StrFormat(); in +// the `printf()` family of functions, `%n` is not safe to use, as the `int *` +// buffer can be used to capture arbitrary data. +// +// Example: +// +// int n = 0; +// std::string s = absl::StrFormat("%s%d%n", "hello", 123, +// absl::FormatCountCapture(&n)); +// EXPECT_EQ(8, n); +class FormatCountCapture { + public: + explicit FormatCountCapture(int* p) : p_(p) {} + + private: + // FormatCountCaptureHelper is used to define FormatConvertImpl() for this + // class. + friend struct str_format_internal::FormatCountCaptureHelper; + // Unused() is here because of the false positive from -Wunused-private-field + // p_ is used in the templated function of the friend FormatCountCaptureHelper + // class. + int* Unused() { return p_; } + int* p_; +}; + +// FormatSpec +// +// The `FormatSpec` type defines the makeup of a format std::string within the +// `str_format` library. You should not need to use or manipulate this type +// directly. A `FormatSpec` is a variadic class template that is evaluated at +// compile-time, according to the format std::string and arguments that are passed +// to it. +// +// For a `FormatSpec` to be valid at compile-time, it must be provided as +// either: +// +// * A `constexpr` literal or `absl::string_view`, which is how it most often +// used. +// * A `ParsedFormat` instantiation, which ensures the format std::string is +// valid before use. (See below.) +// +// Example: +// +// // Provided as a std::string literal. +// absl::StrFormat("Welcome to %s, Number %d!", "The Village", 6); +// +// // Provided as a constexpr absl::string_view. +// constexpr absl::string_view formatString = "Welcome to %s, Number %d!"; +// absl::StrFormat(formatString, "The Village", 6); +// +// // Provided as a pre-compiled ParsedFormat object. +// // Note that this example is useful only for illustration purposes. +// absl::ParsedFormat<'s', 'd'> formatString("Welcome to %s, Number %d!"); +// absl::StrFormat(formatString, "TheVillage", 6); +// +// A format std::string generally follows the POSIX syntax as used within the POSIX +// `printf` specification. +// +// (See http://pubs.opengroup.org/onlinepubs/9699919799/utilities/printf.html.) +// +// In specific, the `FormatSpec` supports the following type specifiers: +// * `c` for characters +// * `s` for strings +// * `d` or `i` for integers +// * `o` for unsigned integer conversions into octal +// * `x` or `X` for unsigned integer conversions into hex +// * `u` for unsigned integers +// * `f` or `F` for floating point values into decimal notation +// * `e` or `E` for floating point values into exponential notation +// * `a` or `A` for floating point values into hex exponential notation +// * `g` or `G` for floating point values into decimal or exponential +// notation based on their precision +// * `p` for pointer address values +// * `n` for the special case of writing out the number of characters +// written to this point. The resulting value must be captured within an +// `absl::FormatCountCapture` type. +// +// NOTE: `o`, `x\X` and `u` will convert signed values to their unsigned +// counterpart before formatting. +// +// Examples: +// "%c", 'a' -> "a" +// "%c", 32 -> " " +// "%s", "C" -> "C" +// "%s", std::string("C++") -> "C++" +// "%d", -10 -> "-10" +// "%o", 10 -> "12" +// "%x", 16 -> "10" +// "%f", 123456789 -> "123456789.000000" +// "%e", .01 -> "1.00000e-2" +// "%a", -3.0 -> "-0x1.8p+1" +// "%g", .01 -> "1e-2" +// "%p", *int -> "0x7ffdeb6ad2a4" +// +// int n = 0; +// std::string s = absl::StrFormat( +// "%s%d%n", "hello", 123, absl::FormatCountCapture(&n)); +// EXPECT_EQ(8, n); +// +// The `FormatSpec` intrinsically supports all of these fundamental C++ types: +// +// * Characters: `char`, `signed char`, `unsigned char` +// * Integers: `int`, `short`, `unsigned short`, `unsigned`, `long`, +// `unsigned long`, `long long`, `unsigned long long` +// * Floating-point: `float`, `double`, `long double` +// +// However, in the `str_format` library, a format conversion specifies a broader +// C++ conceptual category instead of an exact type. For example, `%s` binds to +// any std::string-like argument, so `std::string`, `absl::string_view`, and +// `const char*` are all accepted. Likewise, `%d` accepts any integer-like +// argument, etc. + +template <typename... Args> +using FormatSpec = + typename str_format_internal::FormatSpecDeductionBarrier<Args...>::type; + +using absl::str_format_internal::ExtendedParsedFormat; + +// ParsedFormat +// +// A `ParsedFormat` is a class template representing a preparsed `FormatSpec`, +// with template arguments specifying the conversion characters used within the +// format std::string. Such characters must be valid format type specifiers, and +// these type specifiers are checked at compile-time. +// +// Instances of `ParsedFormat` can be created, copied, and reused to speed up +// formatting loops. A `ParsedFormat` may either be constructed statically, or +// dynamically through its `New()` factory function, which only constructs a +// runtime object if the format is valid at that time. +// +// Example: +// +// // Verified at compile time. +// absl::ParsedFormat<'s', 'd'> formatString("Welcome to %s, Number %d!"); +// absl::StrFormat(formatString, "TheVillage", 6); +// +// // Verified at runtime. +// auto format_runtime = absl::ParsedFormat<'d'>::New(format_string); +// if (format_runtime) { +// value = absl::StrFormat(*format_runtime, i); +// } else { +// ... error case ... +// } +template <char... Conv> +using ParsedFormat = str_format_internal::ExtendedParsedFormat< + str_format_internal::ConversionCharToConv(Conv)...>; + +// StrFormat() +// +// Returns a `string` given a `printf()`-style format std::string and zero or more +// additional arguments. Use it as you would `sprintf()`. `StrFormat()` is the +// primary formatting function within the `str_format` library, and should be +// used in most cases where you need type-safe conversion of types into +// formatted strings. +// +// The format std::string generally consists of ordinary character data along with +// one or more format conversion specifiers (denoted by the `%` character). +// Ordinary character data is returned unchanged into the result std::string, while +// each conversion specification performs a type substitution from +// `StrFormat()`'s other arguments. See the comments for `FormatSpec` for full +// information on the makeup of this format std::string. +// +// Example: +// +// std::string s = absl::StrFormat( +// "Welcome to %s, Number %d!", "The Village", 6); +// EXPECT_EQ("Welcome to The Village, Number 6!", s); +// +// Returns an empty std::string in case of error. +template <typename... Args> +ABSL_MUST_USE_RESULT std::string StrFormat(const FormatSpec<Args...>& format, + const Args&... args) { + return str_format_internal::FormatPack( + str_format_internal::UntypedFormatSpecImpl::Extract(format), + {str_format_internal::FormatArgImpl(args)...}); +} + +// StrAppendFormat() +// +// Appends to a `dst` std::string given a format std::string, and zero or more additional +// arguments, returning `*dst` as a convenience for chaining purposes. Appends +// nothing in case of error (but possibly alters its capacity). +// +// Example: +// +// std::string orig("For example PI is approximately "); +// std::cout << StrAppendFormat(&orig, "%12.6f", 3.14); +template <typename... Args> +std::string& StrAppendFormat(std::string* dst, const FormatSpec<Args...>& format, + const Args&... args) { + return str_format_internal::AppendPack( + dst, str_format_internal::UntypedFormatSpecImpl::Extract(format), + {str_format_internal::FormatArgImpl(args)...}); +} + +// StreamFormat() +// +// Writes to an output stream given a format std::string and zero or more arguments, +// generally in a manner that is more efficient than streaming the result of +// `absl:: StrFormat()`. The returned object must be streamed before the full +// expression ends. +// +// Example: +// +// std::cout << StreamFormat("%12.6f", 3.14); +template <typename... Args> +ABSL_MUST_USE_RESULT str_format_internal::Streamable StreamFormat( + const FormatSpec<Args...>& format, const Args&... args) { + return str_format_internal::Streamable( + str_format_internal::UntypedFormatSpecImpl::Extract(format), + {str_format_internal::FormatArgImpl(args)...}); +} + +// PrintF() +// +// Writes to stdout given a format std::string and zero or more arguments. This +// function is functionally equivalent to `std::print()` (and type-safe); prefer +// `absl::PrintF()` over `std::printf()`. +// +// Example: +// +// std::string_view s = "Ulaanbaatar"; +// absl::PrintF("The capital of Mongolia is: %s \n", s); +// +// Outputs: "The capital of Mongolia is Ulaanbaatar" +// +template <typename... Args> +int PrintF(const FormatSpec<Args...>& format, const Args&... args) { + return str_format_internal::FprintF( + stdout, str_format_internal::UntypedFormatSpecImpl::Extract(format), + {str_format_internal::FormatArgImpl(args)...}); +} + +// FPrintF() +// +// Writes to a file given a format std::string and zero or more arguments. This +// function is functionally equivalent to `std::fprint()` (and type-safe); +// prefer `absl::FPrintF()` over `std::fprintf()`. +// +// Example: +// +// std::string_view s = "Ulaanbaatar"; +// absl::FPrintF("The capital of Mongolia is: %s \n", s); +// +// Outputs: "The capital of Mongolia is Ulaanbaatar" +// +template <typename... Args> +int FPrintF(std::FILE* output, const FormatSpec<Args...>& format, + const Args&... args) { + return str_format_internal::FprintF( + output, str_format_internal::UntypedFormatSpecImpl::Extract(format), + {str_format_internal::FormatArgImpl(args)...}); +} + +// SNPrintF() +// +// Writes to a sized buffer given a format std::string and zero or more arguments. +// This function is functionally equivalent to `std::snprint()` (and type-safe); +// prefer `absl::SNPrintF()` over `std::snprintf()`. +// +// Example: +// +// std::string_view s = "Ulaanbaatar"; +// absl::FPrintF("The capital of Mongolia is: %s \n", s); +// +// Outputs: "The capital of Mongolia is Ulaanbaatar" +// +template <typename... Args> +int SNPrintF(char* output, std::size_t size, const FormatSpec<Args...>& format, + const Args&... args) { + return str_format_internal::SnprintF( + output, size, str_format_internal::UntypedFormatSpecImpl::Extract(format), + {str_format_internal::FormatArgImpl(args)...}); +} + +// ----------------------------------------------------------------------------- +// Custom Output Formatting Functions +// ----------------------------------------------------------------------------- + +// FormatRawSink +// +// FormatRawSink is a type erased wrapper around arbitrary sink objects +// specifically used as an argument to `Format()`. +// FormatRawSink does not own the passed sink object. The passed object must +// outlive the FormatRawSink. +class FormatRawSink { + public: + // Implicitly convert from any type that provides the hook function as + // described above. + template <typename T, + typename = typename std::enable_if<std::is_constructible< + str_format_internal::FormatRawSinkImpl, T*>::value>::type> + FormatRawSink(T* raw) // NOLINT + : sink_(raw) {} + + private: + friend str_format_internal::FormatRawSinkImpl; + str_format_internal::FormatRawSinkImpl sink_; +}; + +// Format() +// +// Writes a formatted std::string to an arbitrary sink object (implementing the +// `absl::FormatRawSink` interface), using a format std::string and zero or more +// additional arguments. +// +// By default, `string` and `std::ostream` are supported as destination objects. +// +// `absl::Format()` is a generic version of `absl::StrFormat(), for custom +// sinks. The format std::string, like format strings for `StrFormat()`, is checked +// at compile-time. +// +// On failure, this function returns `false` and the state of the sink is +// unspecified. +template <typename... Args> +bool Format(FormatRawSink raw_sink, const FormatSpec<Args...>& format, + const Args&... args) { + return str_format_internal::FormatUntyped( + str_format_internal::FormatRawSinkImpl::Extract(raw_sink), + str_format_internal::UntypedFormatSpecImpl::Extract(format), + {str_format_internal::FormatArgImpl(args)...}); +} + +// FormatArg +// +// A type-erased handle to a format argument specifically used as an argument to +// `FormatUntyped()`. You may construct `FormatArg` by passing +// reference-to-const of any printable type. `FormatArg` is both copyable and +// assignable. The source data must outlive the `FormatArg` instance. See +// example below. +// +using FormatArg = str_format_internal::FormatArgImpl; + +// FormatUntyped() +// +// Writes a formatted std::string to an arbitrary sink object (implementing the +// `absl::FormatRawSink` interface), using an `UntypedFormatSpec` and zero or +// more additional arguments. +// +// This function acts as the most generic formatting function in the +// `str_format` library. The caller provides a raw sink, an unchecked format +// std::string, and (usually) a runtime specified list of arguments; no compile-time +// checking of formatting is performed within this function. As a result, a +// caller should check the return value to verify that no error occurred. +// On failure, this function returns `false` and the state of the sink is +// unspecified. +// +// The arguments are provided in an `absl::Span<const absl::FormatArg>`. +// Each `absl::FormatArg` object binds to a single argument and keeps a +// reference to it. The values used to create the `FormatArg` objects must +// outlive this function call. (See `str_format_arg.h` for information on +// the `FormatArg` class.)_ +// +// Example: +// +// std::optional<std::string> FormatDynamic(const std::string& in_format, +// const vector<std::string>& in_args) { +// std::string out; +// std::vector<absl::FormatArg> args; +// for (const auto& v : in_args) { +// // It is important that 'v' is a reference to the objects in in_args. +// // The values we pass to FormatArg must outlive the call to +// // FormatUntyped. +// args.emplace_back(v); +// } +// absl::UntypedFormatSpec format(in_format); +// if (!absl::FormatUntyped(&out, format, args)) { +// return std::nullopt; +// } +// return std::move(out); +// } +// +ABSL_MUST_USE_RESULT inline bool FormatUntyped( + FormatRawSink raw_sink, const UntypedFormatSpec& format, + absl::Span<const FormatArg> args) { + return str_format_internal::FormatUntyped( + str_format_internal::FormatRawSinkImpl::Extract(raw_sink), + str_format_internal::UntypedFormatSpecImpl::Extract(format), args); +} + +} // namespace absl +#endif // ABSL_STRINGS_STR_FORMAT_H_ diff --git a/absl/strings/str_format_test.cc b/absl/strings/str_format_test.cc new file mode 100644 index 000000000000..fe742bf99533 --- /dev/null +++ b/absl/strings/str_format_test.cc @@ -0,0 +1,603 @@ + +#include <cstdarg> +#include <cstdint> +#include <cstdio> +#include <string> + +#include "gmock/gmock.h" +#include "gtest/gtest.h" +#include "absl/strings/str_format.h" +#include "absl/strings/string_view.h" + +namespace absl { +namespace { +using str_format_internal::FormatArgImpl; + +class FormatEntryPointTest : public ::testing::Test { }; + +TEST_F(FormatEntryPointTest, Format) { + std::string sink; + EXPECT_TRUE(Format(&sink, "A format %d", 123)); + EXPECT_EQ("A format 123", sink); + sink.clear(); + + ParsedFormat<'d'> pc("A format %d"); + EXPECT_TRUE(Format(&sink, pc, 123)); + EXPECT_EQ("A format 123", sink); +} +TEST_F(FormatEntryPointTest, UntypedFormat) { + constexpr const char* formats[] = { + "", + "a", + "%80d", +#if !defined(_MSC_VER) && !defined(__ANDROID__) + // MSVC and Android don't support positional syntax. + "complicated multipart %% %1$d format %1$0999d", +#endif // _MSC_VER + }; + for (const char* fmt : formats) { + std::string actual; + int i = 123; + FormatArgImpl arg_123(i); + absl::Span<const FormatArgImpl> args(&arg_123, 1); + UntypedFormatSpec format(fmt); + + EXPECT_TRUE(FormatUntyped(&actual, format, args)); + char buf[4096]{}; + snprintf(buf, sizeof(buf), fmt, 123); + EXPECT_EQ( + str_format_internal::FormatPack( + str_format_internal::UntypedFormatSpecImpl::Extract(format), args), + buf); + EXPECT_EQ(actual, buf); + } + // The internal version works with a preparsed format. + ParsedFormat<'d'> pc("A format %d"); + int i = 345; + FormatArg arg(i); + std::string out; + EXPECT_TRUE(str_format_internal::FormatUntyped( + &out, str_format_internal::UntypedFormatSpecImpl(&pc), {&arg, 1})); + EXPECT_EQ("A format 345", out); +} + +TEST_F(FormatEntryPointTest, StringFormat) { + EXPECT_EQ("123", StrFormat("%d", 123)); + constexpr absl::string_view view("=%d=", 4); + EXPECT_EQ("=123=", StrFormat(view, 123)); +} + +TEST_F(FormatEntryPointTest, AppendFormat) { + std::string s; + std::string& r = StrAppendFormat(&s, "%d", 123); + EXPECT_EQ(&s, &r); // should be same object + EXPECT_EQ("123", r); +} + +TEST_F(FormatEntryPointTest, AppendFormatFail) { + std::string s = "orig"; + + UntypedFormatSpec format(" more %d"); + FormatArgImpl arg("not an int"); + + EXPECT_EQ("orig", + str_format_internal::AppendPack( + &s, str_format_internal::UntypedFormatSpecImpl::Extract(format), + {&arg, 1})); +} + + +TEST_F(FormatEntryPointTest, ManyArgs) { + EXPECT_EQ("24", StrFormat("%24$d", 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, + 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24)); + EXPECT_EQ("60", StrFormat("%60$d", 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, + 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, + 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, + 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, + 53, 54, 55, 56, 57, 58, 59, 60)); +} + +TEST_F(FormatEntryPointTest, Preparsed) { + ParsedFormat<'d'> pc("%d"); + EXPECT_EQ("123", StrFormat(pc, 123)); + // rvalue ok? + EXPECT_EQ("123", StrFormat(ParsedFormat<'d'>("%d"), 123)); + constexpr absl::string_view view("=%d=", 4); + EXPECT_EQ("=123=", StrFormat(ParsedFormat<'d'>(view), 123)); +} + +TEST_F(FormatEntryPointTest, FormatCountCapture) { + int n = 0; + EXPECT_EQ("", StrFormat("%n", FormatCountCapture(&n))); + EXPECT_EQ(0, n); + EXPECT_EQ("123", StrFormat("%d%n", 123, FormatCountCapture(&n))); + EXPECT_EQ(3, n); +} + +TEST_F(FormatEntryPointTest, FormatCountCaptureWrongType) { + // Should reject int*. + int n = 0; + UntypedFormatSpec format("%d%n"); + int i = 123, *ip = &n; + FormatArgImpl args[2] = {FormatArgImpl(i), FormatArgImpl(ip)}; + + EXPECT_EQ("", str_format_internal::FormatPack( + str_format_internal::UntypedFormatSpecImpl::Extract(format), + absl::MakeSpan(args))); +} + +TEST_F(FormatEntryPointTest, FormatCountCaptureMultiple) { + int n1 = 0; + int n2 = 0; + EXPECT_EQ(" 1 2", + StrFormat("%5d%n%10d%n", 1, FormatCountCapture(&n1), 2, + FormatCountCapture(&n2))); + EXPECT_EQ(5, n1); + EXPECT_EQ(15, n2); +} + +TEST_F(FormatEntryPointTest, FormatCountCaptureExample) { + int n; + std::string s; + StrAppendFormat(&s, "%s: %n%s\n", "(1,1)", FormatCountCapture(&n), "(1,2)"); + StrAppendFormat(&s, "%*s%s\n", n, "", "(2,2)"); + EXPECT_EQ(7, n); + EXPECT_EQ( + "(1,1): (1,2)\n" + " (2,2)\n", + s); +} + +TEST_F(FormatEntryPointTest, Stream) { + const std::string formats[] = { + "", + "a", + "%80d", +#if !defined(_MSC_VER) && !defined(__ANDROID__) + // MSVC doesn't support positional syntax. + "complicated multipart %% %1$d format %1$080d", +#endif // _MSC_VER + }; + std::string buf(4096, '\0'); + for (const auto& fmt : formats) { + const auto parsed = ParsedFormat<'d'>::NewAllowIgnored(fmt); + std::ostringstream oss; + oss << StreamFormat(*parsed, 123); + int fmt_result = snprintf(&*buf.begin(), buf.size(), fmt.c_str(), 123); + ASSERT_TRUE(oss) << fmt; + ASSERT_TRUE(fmt_result >= 0 && static_cast<size_t>(fmt_result) < buf.size()) + << fmt_result; + EXPECT_EQ(buf.c_str(), oss.str()); + } +} + +TEST_F(FormatEntryPointTest, StreamOk) { + std::ostringstream oss; + oss << StreamFormat("hello %d", 123); + EXPECT_EQ("hello 123", oss.str()); + EXPECT_TRUE(oss.good()); +} + +TEST_F(FormatEntryPointTest, StreamFail) { + std::ostringstream oss; + UntypedFormatSpec format("hello %d"); + FormatArgImpl arg("non-numeric"); + oss << str_format_internal::Streamable( + str_format_internal::UntypedFormatSpecImpl::Extract(format), {&arg, 1}); + EXPECT_EQ("hello ", oss.str()); // partial write + EXPECT_TRUE(oss.fail()); +} + +std::string WithSnprintf(const char* fmt, ...) { + std::string buf; + buf.resize(128); + va_list va; + va_start(va, fmt); + int r = vsnprintf(&*buf.begin(), buf.size(), fmt, va); + va_end(va); + EXPECT_GE(r, 0); + EXPECT_LT(r, buf.size()); + buf.resize(r); + return buf; +} + +TEST_F(FormatEntryPointTest, FloatPrecisionArg) { + // Test that positional parameters for width and precision + // are indexed to precede the value. + // Also sanity check the same formats against snprintf. + EXPECT_EQ("0.1", StrFormat("%.1f", 0.1)); + EXPECT_EQ("0.1", WithSnprintf("%.1f", 0.1)); + EXPECT_EQ(" 0.1", StrFormat("%*.1f", 5, 0.1)); + EXPECT_EQ(" 0.1", WithSnprintf("%*.1f", 5, 0.1)); + EXPECT_EQ("0.1", StrFormat("%.*f", 1, 0.1)); + EXPECT_EQ("0.1", WithSnprintf("%.*f", 1, 0.1)); + EXPECT_EQ(" 0.1", StrFormat("%*.*f", 5, 1, 0.1)); + EXPECT_EQ(" 0.1", WithSnprintf("%*.*f", 5, 1, 0.1)); +} +namespace streamed_test { +struct X {}; +std::ostream& operator<<(std::ostream& os, const X&) { + return os << "X"; +} +} // streamed_test + +TEST_F(FormatEntryPointTest, FormatStreamed) { + EXPECT_EQ("123", StrFormat("%s", FormatStreamed(123))); + EXPECT_EQ(" 123", StrFormat("%5s", FormatStreamed(123))); + EXPECT_EQ("123 ", StrFormat("%-5s", FormatStreamed(123))); + EXPECT_EQ("X", StrFormat("%s", FormatStreamed(streamed_test::X()))); + EXPECT_EQ("123", StrFormat("%s", FormatStreamed(StreamFormat("%d", 123)))); +} + +// Helper class that creates a temporary file and exposes a FILE* to it. +// It will close the file on destruction. +class TempFile { + public: + TempFile() : file_(std::tmpfile()) {} + ~TempFile() { std::fclose(file_); } + + std::FILE* file() const { return file_; } + + // Read the file into a std::string. + std::string ReadFile() { + std::fseek(file_, 0, SEEK_END); + int size = std::ftell(file_); + std::rewind(file_); + std::string str(2 * size, ' '); + int read_bytes = std::fread(&str[0], 1, str.size(), file_); + EXPECT_EQ(read_bytes, size); + str.resize(read_bytes); + EXPECT_TRUE(std::feof(file_)); + return str; + } + + private: + std::FILE* file_; +}; + +TEST_F(FormatEntryPointTest, FPrintF) { + TempFile tmp; + int result = + FPrintF(tmp.file(), "STRING: %s NUMBER: %010d", std::string("ABC"), -19); + EXPECT_EQ(result, 30); + EXPECT_EQ(tmp.ReadFile(), "STRING: ABC NUMBER: -000000019"); +} + +TEST_F(FormatEntryPointTest, FPrintFError) { + errno = 0; + int result = FPrintF(stdin, "ABC"); + EXPECT_LT(result, 0); + EXPECT_EQ(errno, EBADF); +} + +#if __GNUC__ +TEST_F(FormatEntryPointTest, FprintfTooLarge) { + std::FILE* f = std::fopen("/dev/null", "w"); + int width = 2000000000; + errno = 0; + int result = FPrintF(f, "%*d %*d", width, 0, width, 0); + EXPECT_LT(result, 0); + EXPECT_EQ(errno, EFBIG); + std::fclose(f); +} + +TEST_F(FormatEntryPointTest, PrintF) { + int stdout_tmp = dup(STDOUT_FILENO); + + TempFile tmp; + std::fflush(stdout); + dup2(fileno(tmp.file()), STDOUT_FILENO); + + int result = PrintF("STRING: %s NUMBER: %010d", std::string("ABC"), -19); + + std::fflush(stdout); + dup2(stdout_tmp, STDOUT_FILENO); + close(stdout_tmp); + + EXPECT_EQ(result, 30); + EXPECT_EQ(tmp.ReadFile(), "STRING: ABC NUMBER: -000000019"); +} +#endif // __GNUC__ + +TEST_F(FormatEntryPointTest, SNPrintF) { + char buffer[16]; + int result = + SNPrintF(buffer, sizeof(buffer), "STRING: %s", std::string("ABC")); + EXPECT_EQ(result, 11); + EXPECT_EQ(std::string(buffer), "STRING: ABC"); + + result = SNPrintF(buffer, sizeof(buffer), "NUMBER: %d", 123456); + EXPECT_EQ(result, 14); + EXPECT_EQ(std::string(buffer), "NUMBER: 123456"); + + result = SNPrintF(buffer, sizeof(buffer), "NUMBER: %d", 1234567); + EXPECT_EQ(result, 15); + EXPECT_EQ(std::string(buffer), "NUMBER: 1234567"); + + result = SNPrintF(buffer, sizeof(buffer), "NUMBER: %d", 12345678); + EXPECT_EQ(result, 16); + EXPECT_EQ(std::string(buffer), "NUMBER: 1234567"); + + result = SNPrintF(buffer, sizeof(buffer), "NUMBER: %d", 123456789); + EXPECT_EQ(result, 17); + EXPECT_EQ(std::string(buffer), "NUMBER: 1234567"); + + result = SNPrintF(nullptr, 0, "Just checking the %s of the output.", "size"); + EXPECT_EQ(result, 37); +} + +TEST(StrFormat, BehavesAsDocumented) { + std::string s = absl::StrFormat("%s, %d!", "Hello", 123); + EXPECT_EQ("Hello, 123!", s); + // The format of a replacement is + // '%'[position][flags][width['.'precision]][length_modifier][format] + EXPECT_EQ(absl::StrFormat("%1$+3.2Lf", 1.1), "+1.10"); + // Text conversion: + // "c" - Character. Eg: 'a' -> "A", 20 -> " " + EXPECT_EQ(StrFormat("%c", 'a'), "a"); + EXPECT_EQ(StrFormat("%c", 0x20), " "); + // Formats char and integral types: int, long, uint64_t, etc. + EXPECT_EQ(StrFormat("%c", int{'a'}), "a"); + EXPECT_EQ(StrFormat("%c", long{'a'}), "a"); // NOLINT + EXPECT_EQ(StrFormat("%c", uint64_t{'a'}), "a"); + // "s" - std::string Eg: "C" -> "C", std::string("C++") -> "C++" + // Formats std::string, char*, string_view, and Cord. + EXPECT_EQ(StrFormat("%s", "C"), "C"); + EXPECT_EQ(StrFormat("%s", std::string("C++")), "C++"); + EXPECT_EQ(StrFormat("%s", string_view("view")), "view"); + // Integral Conversion + // These format integral types: char, int, long, uint64_t, etc. + EXPECT_EQ(StrFormat("%d", char{10}), "10"); + EXPECT_EQ(StrFormat("%d", int{10}), "10"); + EXPECT_EQ(StrFormat("%d", long{10}), "10"); // NOLINT + EXPECT_EQ(StrFormat("%d", uint64_t{10}), "10"); + // d,i - signed decimal Eg: -10 -> "-10" + EXPECT_EQ(StrFormat("%d", -10), "-10"); + EXPECT_EQ(StrFormat("%i", -10), "-10"); + // o - octal Eg: 10 -> "12" + EXPECT_EQ(StrFormat("%o", 10), "12"); + // u - unsigned decimal Eg: 10 -> "10" + EXPECT_EQ(StrFormat("%u", 10), "10"); + // x/X - lower,upper case hex Eg: 10 -> "a"/"A" + EXPECT_EQ(StrFormat("%x", 10), "a"); + EXPECT_EQ(StrFormat("%X", 10), "A"); + // Floating-point, with upper/lower-case output. + // These format floating points types: float, double, long double, etc. + EXPECT_EQ(StrFormat("%.1f", float{1}), "1.0"); + EXPECT_EQ(StrFormat("%.1f", double{1}), "1.0"); + const long double long_double = 1.0; + EXPECT_EQ(StrFormat("%.1f", long_double), "1.0"); + // These also format integral types: char, int, long, uint64_t, etc.: + EXPECT_EQ(StrFormat("%.1f", char{1}), "1.0"); + EXPECT_EQ(StrFormat("%.1f", int{1}), "1.0"); + EXPECT_EQ(StrFormat("%.1f", long{1}), "1.0"); // NOLINT + EXPECT_EQ(StrFormat("%.1f", uint64_t{1}), "1.0"); + // f/F - decimal. Eg: 123456789 -> "123456789.000000" + EXPECT_EQ(StrFormat("%f", 123456789), "123456789.000000"); + EXPECT_EQ(StrFormat("%F", 123456789), "123456789.000000"); + // e/E - exponentiated Eg: .01 -> "1.00000e-2"/"1.00000E-2" + EXPECT_EQ(StrFormat("%e", .01), "1.000000e-02"); + EXPECT_EQ(StrFormat("%E", .01), "1.000000E-02"); + // g/G - exponentiate to fit Eg: .01 -> "0.01", 1e10 ->"1e+10"/"1E+10" + EXPECT_EQ(StrFormat("%g", .01), "0.01"); + EXPECT_EQ(StrFormat("%g", 1e10), "1e+10"); + EXPECT_EQ(StrFormat("%G", 1e10), "1E+10"); + // a/A - lower,upper case hex Eg: -3.0 -> "-0x1.8p+1"/"-0X1.8P+1" + +// On NDK r16, there is a regression in hexfloat formatting. +#if !defined(__NDK_MAJOR__) || __NDK_MAJOR__ != 16 + EXPECT_EQ(StrFormat("%.1a", -3.0), "-0x1.8p+1"); // .1 to fix MSVC output + EXPECT_EQ(StrFormat("%.1A", -3.0), "-0X1.8P+1"); // .1 to fix MSVC output +#endif + + // Other conversion + int64_t value = 0x7ffdeb6; + auto ptr_value = static_cast<uintptr_t>(value); + const int& something = *reinterpret_cast<const int*>(ptr_value); + EXPECT_EQ(StrFormat("%p", &something), StrFormat("0x%x", ptr_value)); + + // Output widths are supported, with optional flags. + EXPECT_EQ(StrFormat("%3d", 1), " 1"); + EXPECT_EQ(StrFormat("%3d", 123456), "123456"); + EXPECT_EQ(StrFormat("%06.2f", 1.234), "001.23"); + EXPECT_EQ(StrFormat("%+d", 1), "+1"); + EXPECT_EQ(StrFormat("% d", 1), " 1"); + EXPECT_EQ(StrFormat("%-4d", -1), "-1 "); + EXPECT_EQ(StrFormat("%#o", 10), "012"); + EXPECT_EQ(StrFormat("%#x", 15), "0xf"); + EXPECT_EQ(StrFormat("%04d", 8), "0008"); + // Posix positional substitution. + EXPECT_EQ(absl::StrFormat("%2$s, %3$s, %1$s!", "vici", "veni", "vidi"), + "veni, vidi, vici!"); + // Length modifiers are ignored. + EXPECT_EQ(StrFormat("%hhd", int{1}), "1"); + EXPECT_EQ(StrFormat("%hd", int{1}), "1"); + EXPECT_EQ(StrFormat("%ld", int{1}), "1"); + EXPECT_EQ(StrFormat("%lld", int{1}), "1"); + EXPECT_EQ(StrFormat("%Ld", int{1}), "1"); + EXPECT_EQ(StrFormat("%jd", int{1}), "1"); + EXPECT_EQ(StrFormat("%zd", int{1}), "1"); + EXPECT_EQ(StrFormat("%td", int{1}), "1"); + EXPECT_EQ(StrFormat("%qd", int{1}), "1"); +} + +using str_format_internal::ExtendedParsedFormat; +using str_format_internal::ParsedFormatBase; + +struct SummarizeConsumer { + std::string* out; + explicit SummarizeConsumer(std::string* out) : out(out) {} + + bool Append(string_view s) { + *out += "[" + std::string(s) + "]"; + return true; + } + + bool ConvertOne(const str_format_internal::UnboundConversion& conv, + string_view s) { + *out += "{"; + *out += std::string(s); + *out += ":"; + *out += std::to_string(conv.arg_position) + "$"; + if (conv.width.is_from_arg()) { + *out += std::to_string(conv.width.get_from_arg()) + "$*"; + } + if (conv.precision.is_from_arg()) { + *out += "." + std::to_string(conv.precision.get_from_arg()) + "$*"; + } + *out += conv.conv.Char(); + *out += "}"; + return true; + } +}; + +std::string SummarizeParsedFormat(const ParsedFormatBase& pc) { + std::string out; + if (!pc.ProcessFormat(SummarizeConsumer(&out))) out += "!"; + return out; +} + +class ParsedFormatTest : public testing::Test {}; + +TEST_F(ParsedFormatTest, SimpleChecked) { + EXPECT_EQ("[ABC]{d:1$d}[DEF]", + SummarizeParsedFormat(ParsedFormat<'d'>("ABC%dDEF"))); + EXPECT_EQ("{s:1$s}[FFF]{d:2$d}[ZZZ]{f:3$f}", + SummarizeParsedFormat(ParsedFormat<'s', 'd', 'f'>("%sFFF%dZZZ%f"))); + EXPECT_EQ("{s:1$s}[ ]{.*d:3$.2$*d}", + SummarizeParsedFormat(ParsedFormat<'s', '*', 'd'>("%s %.*d"))); +} + +TEST_F(ParsedFormatTest, SimpleUncheckedCorrect) { + auto f = ParsedFormat<'d'>::New("ABC%dDEF"); + ASSERT_TRUE(f); + EXPECT_EQ("[ABC]{d:1$d}[DEF]", SummarizeParsedFormat(*f)); + + std::string format = "%sFFF%dZZZ%f"; + auto f2 = ParsedFormat<'s', 'd', 'f'>::New(format); + + ASSERT_TRUE(f2); + EXPECT_EQ("{s:1$s}[FFF]{d:2$d}[ZZZ]{f:3$f}", SummarizeParsedFormat(*f2)); + + f2 = ParsedFormat<'s', 'd', 'f'>::New("%s %d %f"); + + ASSERT_TRUE(f2); + EXPECT_EQ("{s:1$s}[ ]{d:2$d}[ ]{f:3$f}", SummarizeParsedFormat(*f2)); + + auto star = ParsedFormat<'*', 'd'>::New("%*d"); + ASSERT_TRUE(star); + EXPECT_EQ("{*d:2$1$*d}", SummarizeParsedFormat(*star)); + + auto dollar = ParsedFormat<'d', 's'>::New("%2$s %1$d"); + ASSERT_TRUE(dollar); + EXPECT_EQ("{2$s:2$s}[ ]{1$d:1$d}", SummarizeParsedFormat(*dollar)); + // with reuse + dollar = ParsedFormat<'d', 's'>::New("%2$s %1$d %1$d"); + ASSERT_TRUE(dollar); + EXPECT_EQ("{2$s:2$s}[ ]{1$d:1$d}[ ]{1$d:1$d}", + SummarizeParsedFormat(*dollar)); +} + +TEST_F(ParsedFormatTest, SimpleUncheckedIgnoredArgs) { + EXPECT_FALSE((ParsedFormat<'d', 's'>::New("ABC"))); + EXPECT_FALSE((ParsedFormat<'d', 's'>::New("%dABC"))); + EXPECT_FALSE((ParsedFormat<'d', 's'>::New("ABC%2$s"))); + auto f = ParsedFormat<'d', 's'>::NewAllowIgnored("ABC"); + ASSERT_TRUE(f); + EXPECT_EQ("[ABC]", SummarizeParsedFormat(*f)); + f = ParsedFormat<'d', 's'>::NewAllowIgnored("%dABC"); + ASSERT_TRUE(f); + EXPECT_EQ("{d:1$d}[ABC]", SummarizeParsedFormat(*f)); + f = ParsedFormat<'d', 's'>::NewAllowIgnored("ABC%2$s"); + ASSERT_TRUE(f); + EXPECT_EQ("[ABC]{2$s:2$s}", SummarizeParsedFormat(*f)); +} + +TEST_F(ParsedFormatTest, SimpleUncheckedUnsupported) { + EXPECT_FALSE(ParsedFormat<'d'>::New("%1$d %1$x")); + EXPECT_FALSE(ParsedFormat<'x'>::New("%1$d %1$x")); +} + +TEST_F(ParsedFormatTest, SimpleUncheckedIncorrect) { + EXPECT_FALSE(ParsedFormat<'d'>::New("")); + + EXPECT_FALSE(ParsedFormat<'d'>::New("ABC%dDEF%d")); + + std::string format = "%sFFF%dZZZ%f"; + EXPECT_FALSE((ParsedFormat<'s', 'd', 'g'>::New(format))); +} + +using str_format_internal::Conv; + +TEST_F(ParsedFormatTest, UncheckedCorrect) { + auto f = ExtendedParsedFormat<Conv::d>::New("ABC%dDEF"); + ASSERT_TRUE(f); + EXPECT_EQ("[ABC]{d:1$d}[DEF]", SummarizeParsedFormat(*f)); + + std::string format = "%sFFF%dZZZ%f"; + auto f2 = + ExtendedParsedFormat<Conv::string, Conv::d, Conv::floating>::New(format); + + ASSERT_TRUE(f2); + EXPECT_EQ("{s:1$s}[FFF]{d:2$d}[ZZZ]{f:3$f}", SummarizeParsedFormat(*f2)); + + f2 = ExtendedParsedFormat<Conv::string, Conv::d, Conv::floating>::New( + "%s %d %f"); + + ASSERT_TRUE(f2); + EXPECT_EQ("{s:1$s}[ ]{d:2$d}[ ]{f:3$f}", SummarizeParsedFormat(*f2)); + + auto star = ExtendedParsedFormat<Conv::star, Conv::d>::New("%*d"); + ASSERT_TRUE(star); + EXPECT_EQ("{*d:2$1$*d}", SummarizeParsedFormat(*star)); + + auto dollar = ExtendedParsedFormat<Conv::d, Conv::s>::New("%2$s %1$d"); + ASSERT_TRUE(dollar); + EXPECT_EQ("{2$s:2$s}[ ]{1$d:1$d}", SummarizeParsedFormat(*dollar)); + // with reuse + dollar = ExtendedParsedFormat<Conv::d, Conv::s>::New("%2$s %1$d %1$d"); + ASSERT_TRUE(dollar); + EXPECT_EQ("{2$s:2$s}[ ]{1$d:1$d}[ ]{1$d:1$d}", + SummarizeParsedFormat(*dollar)); +} + +TEST_F(ParsedFormatTest, UncheckedIgnoredArgs) { + EXPECT_FALSE((ExtendedParsedFormat<Conv::d, Conv::s>::New("ABC"))); + EXPECT_FALSE((ExtendedParsedFormat<Conv::d, Conv::s>::New("%dABC"))); + EXPECT_FALSE((ExtendedParsedFormat<Conv::d, Conv::s>::New("ABC%2$s"))); + auto f = ExtendedParsedFormat<Conv::d, Conv::s>::NewAllowIgnored("ABC"); + ASSERT_TRUE(f); + EXPECT_EQ("[ABC]", SummarizeParsedFormat(*f)); + f = ExtendedParsedFormat<Conv::d, Conv::s>::NewAllowIgnored("%dABC"); + ASSERT_TRUE(f); + EXPECT_EQ("{d:1$d}[ABC]", SummarizeParsedFormat(*f)); + f = ExtendedParsedFormat<Conv::d, Conv::s>::NewAllowIgnored("ABC%2$s"); + ASSERT_TRUE(f); + EXPECT_EQ("[ABC]{2$s:2$s}", SummarizeParsedFormat(*f)); +} + +TEST_F(ParsedFormatTest, UncheckedMultipleTypes) { + auto dx = ExtendedParsedFormat<Conv::d | Conv::x>::New("%1$d %1$x"); + EXPECT_TRUE(dx); + EXPECT_EQ("{1$d:1$d}[ ]{1$x:1$x}", SummarizeParsedFormat(*dx)); + + dx = ExtendedParsedFormat<Conv::d | Conv::x>::New("%1$d"); + EXPECT_TRUE(dx); + EXPECT_EQ("{1$d:1$d}", SummarizeParsedFormat(*dx)); +} + +TEST_F(ParsedFormatTest, UncheckedIncorrect) { + EXPECT_FALSE(ExtendedParsedFormat<Conv::d>::New("")); + + EXPECT_FALSE(ExtendedParsedFormat<Conv::d>::New("ABC%dDEF%d")); + + std::string format = "%sFFF%dZZZ%f"; + EXPECT_FALSE((ExtendedParsedFormat<Conv::s, Conv::d, Conv::g>::New(format))); +} + +TEST_F(ParsedFormatTest, RegressionMixPositional) { + EXPECT_FALSE((ExtendedParsedFormat<Conv::d, Conv::o>::New("%1$d %o"))); +} + +} // namespace +} // namespace absl diff --git a/absl/time/format.cc b/absl/time/format.cc index 6edf2b5f03e5..e98e60a372bf 100644 --- a/absl/time/format.cc +++ b/absl/time/format.cc @@ -34,15 +34,13 @@ namespace { const char kInfiniteFutureStr[] = "infinite-future"; const char kInfinitePastStr[] = "infinite-past"; -using cctz_sec = cctz::time_point<cctz::sys_seconds>; -using cctz_fem = cctz::detail::femtoseconds; struct cctz_parts { - cctz_sec sec; - cctz_fem fem; + cctz::time_point<cctz::seconds> sec; + cctz::detail::femtoseconds fem; }; -inline cctz_sec unix_epoch() { - return std::chrono::time_point_cast<cctz::sys_seconds>( +inline cctz::time_point<cctz::seconds> unix_epoch() { + return std::chrono::time_point_cast<cctz::seconds>( std::chrono::system_clock::from_time_t(0)); } @@ -53,8 +51,8 @@ cctz_parts Split(absl::Time t) { const auto d = time_internal::ToUnixDuration(t); const int64_t rep_hi = time_internal::GetRepHi(d); const int64_t rep_lo = time_internal::GetRepLo(d); - const auto sec = unix_epoch() + cctz::sys_seconds(rep_hi); - const auto fem = cctz_fem(rep_lo * (1000 * 1000 / 4)); + const auto sec = unix_epoch() + cctz::seconds(rep_hi); + const auto fem = cctz::detail::femtoseconds(rep_lo * (1000 * 1000 / 4)); return {sec, fem}; } diff --git a/absl/time/internal/cctz/include/cctz/time_zone.h b/absl/time/internal/cctz/include/cctz/time_zone.h index 31abc2c4bbdf..55804ba68abb 100644 --- a/absl/time/internal/cctz/include/cctz/time_zone.h +++ b/absl/time/internal/cctz/include/cctz/time_zone.h @@ -34,23 +34,24 @@ namespace cctz { // Convenience aliases. Not intended as public API points. template <typename D> using time_point = std::chrono::time_point<std::chrono::system_clock, D>; -using sys_seconds = std::chrono::duration<std::int_fast64_t>; +using seconds = std::chrono::duration<std::int_fast64_t>; +using sys_seconds = seconds; // Deprecated. Use cctz::seconds instead. namespace detail { template <typename D> -inline std::pair<time_point<sys_seconds>, D> +inline std::pair<time_point<seconds>, D> split_seconds(const time_point<D>& tp) { - auto sec = std::chrono::time_point_cast<sys_seconds>(tp); + auto sec = std::chrono::time_point_cast<seconds>(tp); auto sub = tp - sec; if (sub.count() < 0) { - sec -= sys_seconds(1); - sub += sys_seconds(1); + sec -= seconds(1); + sub += seconds(1); } return {sec, std::chrono::duration_cast<D>(sub)}; } -inline std::pair<time_point<sys_seconds>, sys_seconds> -split_seconds(const time_point<sys_seconds>& tp) { - return {tp, sys_seconds(0)}; +inline std::pair<time_point<seconds>, seconds> +split_seconds(const time_point<seconds>& tp) { + return {tp, seconds::zero()}; } } // namespace detail @@ -99,7 +100,7 @@ class time_zone { bool is_dst; // is offset non-standard? const char* abbr; // time-zone abbreviation (e.g., "PST") }; - absolute_lookup lookup(const time_point<sys_seconds>& tp) const; + absolute_lookup lookup(const time_point<seconds>& tp) const; template <typename D> absolute_lookup lookup(const time_point<D>& tp) const { return lookup(detail::split_seconds(tp).first); @@ -120,7 +121,7 @@ class time_zone { // offset, the transition point itself, and the post-transition offset, // respectively (all three times are equal if kind == UNIQUE). If any // of these three absolute times is outside the representable range of a - // time_point<sys_seconds> the field is set to its maximum/minimum value. + // time_point<seconds> the field is set to its maximum/minimum value. // // Example: // cctz::time_zone lax; @@ -152,9 +153,9 @@ class time_zone { SKIPPED, // the civil time did not exist (pre >= trans > post) REPEATED, // the civil time was ambiguous (pre < trans <= post) } kind; - time_point<sys_seconds> pre; // uses the pre-transition offset - time_point<sys_seconds> trans; // instant of civil-offset change - time_point<sys_seconds> post; // uses the post-transition offset + time_point<seconds> pre; // uses the pre-transition offset + time_point<seconds> trans; // instant of civil-offset change + time_point<seconds> post; // uses the post-transition offset }; civil_lookup lookup(const civil_second& cs) const; @@ -180,7 +181,7 @@ time_zone utc_time_zone(); // Returns a time zone that is a fixed offset (seconds east) from UTC. // Note: If the absolute value of the offset is greater than 24 hours // you'll get UTC (i.e., zero offset) instead. -time_zone fixed_time_zone(const sys_seconds& offset); +time_zone fixed_time_zone(const seconds& offset); // Returns a time zone representing the local time zone. Falls back to UTC. time_zone local_time_zone(); @@ -199,8 +200,8 @@ inline civil_second convert(const time_point<D>& tp, const time_zone& tz) { // it was either repeated or non-existent), then the returned time_point is // the best estimate that preserves relative order. That is, this function // guarantees that if cs1 < cs2, then convert(cs1, tz) <= convert(cs2, tz). -inline time_point<sys_seconds> convert(const civil_second& cs, - const time_zone& tz) { +inline time_point<seconds> convert(const civil_second& cs, + const time_zone& tz) { const time_zone::civil_lookup cl = tz.lookup(cs); if (cl.kind == time_zone::civil_lookup::SKIPPED) return cl.trans; return cl.pre; @@ -208,10 +209,10 @@ inline time_point<sys_seconds> convert(const civil_second& cs, namespace detail { using femtoseconds = std::chrono::duration<std::int_fast64_t, std::femto>; -std::string format(const std::string&, const time_point<sys_seconds>&, +std::string format(const std::string&, const time_point<seconds>&, const femtoseconds&, const time_zone&); bool parse(const std::string&, const std::string&, const time_zone&, - time_point<sys_seconds>*, femtoseconds*, std::string* err = nullptr); + time_point<seconds>*, femtoseconds*, std::string* err = nullptr); } // namespace detail // Formats the given time_point in the given cctz::time_zone according to @@ -298,7 +299,7 @@ inline std::string format(const std::string& fmt, const time_point<D>& tp, template <typename D> inline bool parse(const std::string& fmt, const std::string& input, const time_zone& tz, time_point<D>* tpp) { - time_point<sys_seconds> sec; + time_point<seconds> sec; detail::femtoseconds fs; const bool b = detail::parse(fmt, input, tz, &sec, &fs); if (b) { diff --git a/absl/time/internal/cctz/src/time_zone_fixed.cc b/absl/time/internal/cctz/src/time_zone_fixed.cc index 65eba3569d97..598b08fde422 100644 --- a/absl/time/internal/cctz/src/time_zone_fixed.cc +++ b/absl/time/internal/cctz/src/time_zone_fixed.cc @@ -42,9 +42,9 @@ int Parse02d(const char* p) { } // namespace -bool FixedOffsetFromName(const std::string& name, sys_seconds* offset) { +bool FixedOffsetFromName(const std::string& name, seconds* offset) { if (name.compare(0, std::string::npos, "UTC", 3) == 0) { - *offset = sys_seconds::zero(); + *offset = seconds::zero(); return true; } @@ -69,12 +69,12 @@ bool FixedOffsetFromName(const std::string& name, sys_seconds* offset) { secs += ((hours * 60) + mins) * 60; if (secs > 24 * 60 * 60) return false; // outside supported offset range - *offset = sys_seconds(secs * (np[0] == '-' ? -1 : 1)); // "-" means west + *offset = seconds(secs * (np[0] == '-' ? -1 : 1)); // "-" means west return true; } -std::string FixedOffsetToName(const sys_seconds& offset) { - if (offset == sys_seconds::zero()) return "UTC"; +std::string FixedOffsetToName(const seconds& offset) { + if (offset == seconds::zero()) return "UTC"; if (offset < std::chrono::hours(-24) || offset > std::chrono::hours(24)) { // We don't support fixed-offset zones more than 24 hours // away from UTC to avoid complications in rendering such @@ -101,7 +101,7 @@ std::string FixedOffsetToName(const sys_seconds& offset) { return buf; } -std::string FixedOffsetToAbbr(const sys_seconds& offset) { +std::string FixedOffsetToAbbr(const seconds& offset) { std::string abbr = FixedOffsetToName(offset); const std::size_t prefix_len = sizeof(kFixedOffsetPrefix) - 1; if (abbr.size() == prefix_len + 9) { // <prefix>+99:99:99 diff --git a/absl/time/internal/cctz/src/time_zone_fixed.h b/absl/time/internal/cctz/src/time_zone_fixed.h index 7c9d11db9c5b..489b857d5df3 100644 --- a/absl/time/internal/cctz/src/time_zone_fixed.h +++ b/absl/time/internal/cctz/src/time_zone_fixed.h @@ -38,9 +38,9 @@ namespace cctz { // Note: FixedOffsetFromName() fails on syntax errors or when the parsed // offset exceeds 24 hours. FixedOffsetToName() and FixedOffsetToAbbr() // both produce "UTC" when the argument offset exceeds 24 hours. -bool FixedOffsetFromName(const std::string& name, sys_seconds* offset); -std::string FixedOffsetToName(const sys_seconds& offset); -std::string FixedOffsetToAbbr(const sys_seconds& offset); +bool FixedOffsetFromName(const std::string& name, seconds* offset); +std::string FixedOffsetToName(const seconds& offset); +std::string FixedOffsetToAbbr(const seconds& offset); } // namespace cctz } // namespace time_internal diff --git a/absl/time/internal/cctz/src/time_zone_format.cc b/absl/time/internal/cctz/src/time_zone_format.cc index 6d5ccba1ce49..592ab7d3cfdf 100644 --- a/absl/time/internal/cctz/src/time_zone_format.cc +++ b/absl/time/internal/cctz/src/time_zone_format.cc @@ -277,7 +277,7 @@ const std::int_fast64_t kExp10[kDigits10_64 + 1] = { // not support the tm_gmtoff and tm_zone extensions to std::tm. // // Requires that zero() <= fs < seconds(1). -std::string format(const std::string& format, const time_point<sys_seconds>& tp, +std::string format(const std::string& format, const time_point<seconds>& tp, const detail::femtoseconds& fs, const time_zone& tz) { std::string result; result.reserve(format.size()); // A reasonable guess for the result size. @@ -555,7 +555,7 @@ const char* ParseTM(const char* dp, const char* fmt, std::tm* tm) { // We also handle the %z specifier to accommodate platforms that do not // support the tm_gmtoff extension to std::tm. %Z is parsed but ignored. bool parse(const std::string& format, const std::string& input, - const time_zone& tz, time_point<sys_seconds>* sec, + const time_zone& tz, time_point<seconds>* sec, detail::femtoseconds* fs, std::string* err) { // The unparsed input. const char* data = input.c_str(); // NUL terminated @@ -822,15 +822,15 @@ bool parse(const std::string& format, const std::string& input, const auto tp = ptz.lookup(cs).pre; // Checks for overflow/underflow and returns an error as necessary. - if (tp == time_point<sys_seconds>::max()) { - const auto al = ptz.lookup(time_point<sys_seconds>::max()); + if (tp == time_point<seconds>::max()) { + const auto al = ptz.lookup(time_point<seconds>::max()); if (cs > al.cs) { if (err != nullptr) *err = "Out-of-range field"; return false; } } - if (tp == time_point<sys_seconds>::min()) { - const auto al = ptz.lookup(time_point<sys_seconds>::min()); + if (tp == time_point<seconds>::min()) { + const auto al = ptz.lookup(time_point<seconds>::min()); if (cs < al.cs) { if (err != nullptr) *err = "Out-of-range field"; return false; diff --git a/absl/time/internal/cctz/src/time_zone_format_test.cc b/absl/time/internal/cctz/src/time_zone_format_test.cc index 7d5b02ad3a68..33c239841118 100644 --- a/absl/time/internal/cctz/src/time_zone_format_test.cc +++ b/absl/time/internal/cctz/src/time_zone_format_test.cc @@ -23,15 +23,7 @@ #include "gmock/gmock.h" #include "gtest/gtest.h" -using std::chrono::time_point_cast; -using std::chrono::system_clock; -using std::chrono::nanoseconds; -using std::chrono::microseconds; -using std::chrono::milliseconds; -using std::chrono::seconds; -using std::chrono::minutes; -using std::chrono::hours; -using testing::HasSubstr; +namespace chrono = std::chrono; namespace absl { namespace time_internal { @@ -81,33 +73,36 @@ void TestFormatSpecifier(time_point<D> tp, time_zone tz, const std::string& fmt, TEST(Format, TimePointResolution) { const char kFmt[] = "%H:%M:%E*S"; const time_zone utc = utc_time_zone(); - const time_point<nanoseconds> t0 = system_clock::from_time_t(1420167845) + - milliseconds(123) + microseconds(456) + - nanoseconds(789); - EXPECT_EQ("03:04:05.123456789", - format(kFmt, time_point_cast<nanoseconds>(t0), utc)); - EXPECT_EQ("03:04:05.123456", - format(kFmt, time_point_cast<microseconds>(t0), utc)); - EXPECT_EQ("03:04:05.123", - format(kFmt, time_point_cast<milliseconds>(t0), utc)); + const time_point<chrono::nanoseconds> t0 = + chrono::system_clock::from_time_t(1420167845) + + chrono::milliseconds(123) + chrono::microseconds(456) + + chrono::nanoseconds(789); + EXPECT_EQ( + "03:04:05.123456789", + format(kFmt, chrono::time_point_cast<chrono::nanoseconds>(t0), utc)); + EXPECT_EQ( + "03:04:05.123456", + format(kFmt, chrono::time_point_cast<chrono::microseconds>(t0), utc)); + EXPECT_EQ( + "03:04:05.123", + format(kFmt, chrono::time_point_cast<chrono::milliseconds>(t0), utc)); EXPECT_EQ("03:04:05", - format(kFmt, time_point_cast<seconds>(t0), utc)); + format(kFmt, chrono::time_point_cast<chrono::seconds>(t0), utc)); EXPECT_EQ("03:04:05", - format(kFmt, time_point_cast<sys_seconds>(t0), utc)); + format(kFmt, chrono::time_point_cast<absl::time_internal::cctz::seconds>(t0), utc)); EXPECT_EQ("03:04:00", - format(kFmt, time_point_cast<minutes>(t0), utc)); + format(kFmt, chrono::time_point_cast<chrono::minutes>(t0), utc)); EXPECT_EQ("03:00:00", - format(kFmt, time_point_cast<hours>(t0), utc)); + format(kFmt, chrono::time_point_cast<chrono::hours>(t0), utc)); } TEST(Format, TimePointExtendedResolution) { const char kFmt[] = "%H:%M:%E*S"; const time_zone utc = utc_time_zone(); - const time_point<sys_seconds> tp = - std::chrono::time_point_cast<sys_seconds>( - std::chrono::system_clock::from_time_t(0)) + - std::chrono::hours(12) + std::chrono::minutes(34) + - std::chrono::seconds(56); + const time_point<absl::time_internal::cctz::seconds> tp = + chrono::time_point_cast<absl::time_internal::cctz::seconds>( + chrono::system_clock::from_time_t(0)) + + chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56); EXPECT_EQ( "12:34:56.123456789012345", @@ -132,7 +127,7 @@ TEST(Format, TimePointExtendedResolution) { TEST(Format, Basics) { time_zone tz = utc_time_zone(); - time_point<nanoseconds> tp = system_clock::from_time_t(0); + time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0); // Starts with a couple basic edge cases. EXPECT_EQ("", format("", tp, tz)); @@ -145,8 +140,9 @@ TEST(Format, Basics) { std::string bigger(100000, 'x'); EXPECT_EQ(bigger, format(bigger, tp, tz)); - tp += hours(13) + minutes(4) + seconds(5); - tp += milliseconds(6) + microseconds(7) + nanoseconds(8); + tp += chrono::hours(13) + chrono::minutes(4) + chrono::seconds(5); + tp += chrono::milliseconds(6) + chrono::microseconds(7) + + chrono::nanoseconds(8); EXPECT_EQ("1970-01-01", format("%Y-%m-%d", tp, tz)); EXPECT_EQ("13:04:05", format("%H:%M:%S", tp, tz)); EXPECT_EQ("13:04:05.006", format("%H:%M:%E3S", tp, tz)); @@ -156,7 +152,7 @@ TEST(Format, Basics) { TEST(Format, PosixConversions) { const time_zone tz = utc_time_zone(); - auto tp = system_clock::from_time_t(0); + auto tp = chrono::system_clock::from_time_t(0); TestFormatSpecifier(tp, tz, "%d", "01"); TestFormatSpecifier(tp, tz, "%e", " 1"); // extension but internal support @@ -196,7 +192,7 @@ TEST(Format, PosixConversions) { TEST(Format, LocaleSpecific) { const time_zone tz = utc_time_zone(); - auto tp = system_clock::from_time_t(0); + auto tp = chrono::system_clock::from_time_t(0); TestFormatSpecifier(tp, tz, "%a", "Thu"); TestFormatSpecifier(tp, tz, "%A", "Thursday"); @@ -205,8 +201,8 @@ TEST(Format, LocaleSpecific) { // %c should at least produce the numeric year and time-of-day. const std::string s = format("%c", tp, utc_time_zone()); - EXPECT_THAT(s, HasSubstr("1970")); - EXPECT_THAT(s, HasSubstr("00:00:00")); + EXPECT_THAT(s, testing::HasSubstr("1970")); + EXPECT_THAT(s, testing::HasSubstr("00:00:00")); TestFormatSpecifier(tp, tz, "%p", "AM"); TestFormatSpecifier(tp, tz, "%x", "01/01/70"); @@ -245,7 +241,7 @@ TEST(Format, LocaleSpecific) { TEST(Format, Escaping) { const time_zone tz = utc_time_zone(); - auto tp = system_clock::from_time_t(0); + auto tp = chrono::system_clock::from_time_t(0); TestFormatSpecifier(tp, tz, "%%", "%"); TestFormatSpecifier(tp, tz, "%%a", "%a"); @@ -266,8 +262,8 @@ TEST(Format, ExtendedSeconds) { const time_zone tz = utc_time_zone(); // No subseconds. - time_point<nanoseconds> tp = system_clock::from_time_t(0); - tp += seconds(5); + time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0); + tp += chrono::seconds(5); EXPECT_EQ("05", format("%E*S", tp, tz)); EXPECT_EQ("05", format("%E0S", tp, tz)); EXPECT_EQ("05.0", format("%E1S", tp, tz)); @@ -287,7 +283,8 @@ TEST(Format, ExtendedSeconds) { EXPECT_EQ("05.000000000000000", format("%E15S", tp, tz)); // With subseconds. - tp += milliseconds(6) + microseconds(7) + nanoseconds(8); + tp += chrono::milliseconds(6) + chrono::microseconds(7) + + chrono::nanoseconds(8); EXPECT_EQ("05.006007008", format("%E*S", tp, tz)); EXPECT_EQ("05", format("%E0S", tp, tz)); EXPECT_EQ("05.0", format("%E1S", tp, tz)); @@ -307,17 +304,18 @@ TEST(Format, ExtendedSeconds) { EXPECT_EQ("05.006007008000000", format("%E15S", tp, tz)); // Times before the Unix epoch. - tp = system_clock::from_time_t(0) + microseconds(-1); + tp = chrono::system_clock::from_time_t(0) + chrono::microseconds(-1); EXPECT_EQ("1969-12-31 23:59:59.999999", format("%Y-%m-%d %H:%M:%E*S", tp, tz)); // Here is a "%E*S" case we got wrong for a while. While the first // instant below is correctly rendered as "...:07.333304", the second // one used to appear as "...:07.33330499999999999". - tp = system_clock::from_time_t(0) + microseconds(1395024427333304); + tp = chrono::system_clock::from_time_t(0) + + chrono::microseconds(1395024427333304); EXPECT_EQ("2014-03-17 02:47:07.333304", format("%Y-%m-%d %H:%M:%E*S", tp, tz)); - tp += microseconds(1); + tp += chrono::microseconds(1); EXPECT_EQ("2014-03-17 02:47:07.333305", format("%Y-%m-%d %H:%M:%E*S", tp, tz)); } @@ -326,8 +324,8 @@ TEST(Format, ExtendedSubeconds) { const time_zone tz = utc_time_zone(); // No subseconds. - time_point<nanoseconds> tp = system_clock::from_time_t(0); - tp += seconds(5); + time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0); + tp += chrono::seconds(5); EXPECT_EQ("0", format("%E*f", tp, tz)); EXPECT_EQ("", format("%E0f", tp, tz)); EXPECT_EQ("0", format("%E1f", tp, tz)); @@ -347,7 +345,8 @@ TEST(Format, ExtendedSubeconds) { EXPECT_EQ("000000000000000", format("%E15f", tp, tz)); // With subseconds. - tp += milliseconds(6) + microseconds(7) + nanoseconds(8); + tp += chrono::milliseconds(6) + chrono::microseconds(7) + + chrono::nanoseconds(8); EXPECT_EQ("006007008", format("%E*f", tp, tz)); EXPECT_EQ("", format("%E0f", tp, tz)); EXPECT_EQ("0", format("%E1f", tp, tz)); @@ -367,17 +366,18 @@ TEST(Format, ExtendedSubeconds) { EXPECT_EQ("006007008000000", format("%E15f", tp, tz)); // Times before the Unix epoch. - tp = system_clock::from_time_t(0) + microseconds(-1); + tp = chrono::system_clock::from_time_t(0) + chrono::microseconds(-1); EXPECT_EQ("1969-12-31 23:59:59.999999", format("%Y-%m-%d %H:%M:%S.%E*f", tp, tz)); // Here is a "%E*S" case we got wrong for a while. While the first // instant below is correctly rendered as "...:07.333304", the second // one used to appear as "...:07.33330499999999999". - tp = system_clock::from_time_t(0) + microseconds(1395024427333304); + tp = chrono::system_clock::from_time_t(0) + + chrono::microseconds(1395024427333304); EXPECT_EQ("2014-03-17 02:47:07.333304", format("%Y-%m-%d %H:%M:%S.%E*f", tp, tz)); - tp += microseconds(1); + tp += chrono::microseconds(1); EXPECT_EQ("2014-03-17 02:47:07.333305", format("%Y-%m-%d %H:%M:%S.%E*f", tp, tz)); } @@ -392,8 +392,8 @@ TEST(Format, CompareExtendSecondsVsSubseconds) { auto fmt_B = [](const std::string& prec) { return "%S.%E" + prec + "f"; }; // No subseconds: - time_point<nanoseconds> tp = system_clock::from_time_t(0); - tp += seconds(5); + time_point<chrono::nanoseconds> tp = chrono::system_clock::from_time_t(0); + tp += chrono::seconds(5); // ... %E*S and %S.%E*f are different. EXPECT_EQ("05", format(fmt_A("*"), tp, tz)); EXPECT_EQ("05.0", format(fmt_B("*"), tp, tz)); @@ -409,7 +409,8 @@ TEST(Format, CompareExtendSecondsVsSubseconds) { // With subseconds: // ... %E*S and %S.%E*f are the same. - tp += milliseconds(6) + microseconds(7) + nanoseconds(8); + tp += chrono::milliseconds(6) + chrono::microseconds(7) + + chrono::nanoseconds(8); EXPECT_EQ("05.006007008", format(fmt_A("*"), tp, tz)); EXPECT_EQ("05.006007008", format(fmt_B("*"), tp, tz)); // ... %E0S and %S.%E0f are different. @@ -424,7 +425,7 @@ TEST(Format, CompareExtendSecondsVsSubseconds) { } TEST(Format, ExtendedOffset) { - auto tp = system_clock::from_time_t(0); + auto tp = chrono::system_clock::from_time_t(0); time_zone tz = utc_time_zone(); TestFormatSpecifier(tp, tz, "%Ez", "+00:00"); @@ -446,7 +447,7 @@ TEST(Format, ExtendedOffset) { TEST(Format, ExtendedSecondOffset) { const time_zone utc = utc_time_zone(); - time_point<seconds> tp; + time_point<chrono::seconds> tp; time_zone tz; EXPECT_TRUE(load_time_zone("America/New_York", &tz)); @@ -458,7 +459,7 @@ TEST(Format, ExtendedSecondOffset) { TestFormatSpecifier(tp, tz, "%E*z", "-04:56:02"); TestFormatSpecifier(tp, tz, "%Ez", "-04:56"); } - tp += seconds(1); + tp += chrono::seconds(1); TestFormatSpecifier(tp, tz, "%E*z", "-05:00:00"); EXPECT_TRUE(load_time_zone("Europe/Moscow", &tz)); @@ -469,7 +470,7 @@ TEST(Format, ExtendedSecondOffset) { TestFormatSpecifier(tp, tz, "%E*z", "+04:31:19"); TestFormatSpecifier(tp, tz, "%Ez", "+04:31"); #endif - tp += seconds(1); + tp += chrono::seconds(1); TestFormatSpecifier(tp, tz, "%E*z", "+04:00:00"); } @@ -510,44 +511,44 @@ TEST(Format, RFC3339Format) { time_zone tz; EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz)); - time_point<nanoseconds> tp = + time_point<chrono::nanoseconds> tp = convert(civil_second(1977, 6, 28, 9, 8, 7), tz); EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_full, tp, tz)); EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz)); - tp += milliseconds(100); + tp += chrono::milliseconds(100); EXPECT_EQ("1977-06-28T09:08:07.1-07:00", format(RFC3339_full, tp, tz)); EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz)); - tp += milliseconds(20); + tp += chrono::milliseconds(20); EXPECT_EQ("1977-06-28T09:08:07.12-07:00", format(RFC3339_full, tp, tz)); EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz)); - tp += milliseconds(3); + tp += chrono::milliseconds(3); EXPECT_EQ("1977-06-28T09:08:07.123-07:00", format(RFC3339_full, tp, tz)); EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz)); - tp += microseconds(400); + tp += chrono::microseconds(400); EXPECT_EQ("1977-06-28T09:08:07.1234-07:00", format(RFC3339_full, tp, tz)); EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz)); - tp += microseconds(50); + tp += chrono::microseconds(50); EXPECT_EQ("1977-06-28T09:08:07.12345-07:00", format(RFC3339_full, tp, tz)); EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz)); - tp += microseconds(6); + tp += chrono::microseconds(6); EXPECT_EQ("1977-06-28T09:08:07.123456-07:00", format(RFC3339_full, tp, tz)); EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz)); - tp += nanoseconds(700); + tp += chrono::nanoseconds(700); EXPECT_EQ("1977-06-28T09:08:07.1234567-07:00", format(RFC3339_full, tp, tz)); EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz)); - tp += nanoseconds(80); + tp += chrono::nanoseconds(80); EXPECT_EQ("1977-06-28T09:08:07.12345678-07:00", format(RFC3339_full, tp, tz)); EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz)); - tp += nanoseconds(9); + tp += chrono::nanoseconds(9); EXPECT_EQ("1977-06-28T09:08:07.123456789-07:00", format(RFC3339_full, tp, tz)); EXPECT_EQ("1977-06-28T09:08:07-07:00", format(RFC3339_sec, tp, tz)); @@ -570,13 +571,13 @@ TEST(Parse, TimePointResolution) { const char kFmt[] = "%H:%M:%E*S"; const time_zone utc = utc_time_zone(); - time_point<nanoseconds> tp_ns; + time_point<chrono::nanoseconds> tp_ns; EXPECT_TRUE(parse(kFmt, "03:04:05.123456789", utc, &tp_ns)); EXPECT_EQ("03:04:05.123456789", format(kFmt, tp_ns, utc)); EXPECT_TRUE(parse(kFmt, "03:04:05.123456", utc, &tp_ns)); EXPECT_EQ("03:04:05.123456", format(kFmt, tp_ns, utc)); - time_point<microseconds> tp_us; + time_point<chrono::microseconds> tp_us; EXPECT_TRUE(parse(kFmt, "03:04:05.123456789", utc, &tp_us)); EXPECT_EQ("03:04:05.123456", format(kFmt, tp_us, utc)); EXPECT_TRUE(parse(kFmt, "03:04:05.123456", utc, &tp_us)); @@ -584,7 +585,7 @@ TEST(Parse, TimePointResolution) { EXPECT_TRUE(parse(kFmt, "03:04:05.123", utc, &tp_us)); EXPECT_EQ("03:04:05.123", format(kFmt, tp_us, utc)); - time_point<milliseconds> tp_ms; + time_point<chrono::milliseconds> tp_ms; EXPECT_TRUE(parse(kFmt, "03:04:05.123456", utc, &tp_ms)); EXPECT_EQ("03:04:05.123", format(kFmt, tp_ms, utc)); EXPECT_TRUE(parse(kFmt, "03:04:05.123", utc, &tp_ms)); @@ -592,17 +593,17 @@ TEST(Parse, TimePointResolution) { EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_ms)); EXPECT_EQ("03:04:05", format(kFmt, tp_ms, utc)); - time_point<seconds> tp_s; + time_point<chrono::seconds> tp_s; EXPECT_TRUE(parse(kFmt, "03:04:05.123", utc, &tp_s)); EXPECT_EQ("03:04:05", format(kFmt, tp_s, utc)); EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_s)); EXPECT_EQ("03:04:05", format(kFmt, tp_s, utc)); - time_point<minutes> tp_m; + time_point<chrono::minutes> tp_m; EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_m)); EXPECT_EQ("03:04:00", format(kFmt, tp_m, utc)); - time_point<hours> tp_h; + time_point<chrono::hours> tp_h; EXPECT_TRUE(parse(kFmt, "03:04:05", utc, &tp_h)); EXPECT_EQ("03:00:00", format(kFmt, tp_h, utc)); } @@ -611,7 +612,7 @@ TEST(Parse, TimePointExtendedResolution) { const char kFmt[] = "%H:%M:%E*S"; const time_zone utc = utc_time_zone(); - time_point<sys_seconds> tp; + time_point<absl::time_internal::cctz::seconds> tp; detail::femtoseconds fs; EXPECT_TRUE(detail::parse(kFmt, "12:34:56.123456789012345", utc, &tp, &fs)); EXPECT_EQ("12:34:56.123456789012345", detail::format(kFmt, tp, fs, utc)); @@ -629,11 +630,12 @@ TEST(Parse, TimePointExtendedResolution) { TEST(Parse, Basics) { time_zone tz = utc_time_zone(); - time_point<nanoseconds> tp = system_clock::from_time_t(1234567890); + time_point<chrono::nanoseconds> tp = + chrono::system_clock::from_time_t(1234567890); // Simple edge cases. EXPECT_TRUE(parse("", "", tz, &tp)); - EXPECT_EQ(system_clock::from_time_t(0), tp); // everything defaulted + EXPECT_EQ(chrono::system_clock::from_time_t(0), tp); // everything defaulted EXPECT_TRUE(parse(" ", " ", tz, &tp)); EXPECT_TRUE(parse(" ", " ", tz, &tp)); EXPECT_TRUE(parse("x", "x", tz, &tp)); @@ -647,7 +649,7 @@ TEST(Parse, Basics) { TEST(Parse, WithTimeZone) { time_zone tz; EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz)); - time_point<nanoseconds> tp; + time_point<chrono::nanoseconds> tp; // We can parse a std::string without a UTC offset if we supply a timezone. EXPECT_TRUE(parse("%Y-%m-%d %H:%M:%S", "2013-06-28 19:08:09", tz, &tp)); @@ -672,7 +674,7 @@ TEST(Parse, WithTimeZone) { TEST(Parse, LeapSecond) { time_zone tz; EXPECT_TRUE(load_time_zone("America/Los_Angeles", &tz)); - time_point<nanoseconds> tp; + time_point<chrono::nanoseconds> tp; // ":59" -> ":59" EXPECT_TRUE(parse(RFC3339_full, "2013-06-28T07:08:59-08:00", tz, &tp)); @@ -696,7 +698,7 @@ TEST(Parse, LeapSecond) { TEST(Parse, ErrorCases) { const time_zone tz = utc_time_zone(); - auto tp = system_clock::from_time_t(0); + auto tp = chrono::system_clock::from_time_t(0); // Illegal trailing data. EXPECT_FALSE(parse("%S", "123", tz, &tp)); @@ -739,7 +741,7 @@ TEST(Parse, ErrorCases) { TEST(Parse, PosixConversions) { time_zone tz = utc_time_zone(); - auto tp = system_clock::from_time_t(0); + auto tp = chrono::system_clock::from_time_t(0); const auto reset = convert(civil_second(1977, 6, 28, 9, 8, 7), tz); tp = reset; @@ -828,14 +830,14 @@ TEST(Parse, PosixConversions) { tp = reset; EXPECT_TRUE(parse("%s", "1234567890", tz, &tp)); - EXPECT_EQ(system_clock::from_time_t(1234567890), tp); + EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp); // %s conversion, like %z/%Ez, pays no heed to the optional zone. time_zone lax; EXPECT_TRUE(load_time_zone("America/Los_Angeles", &lax)); tp = reset; EXPECT_TRUE(parse("%s", "1234567890", lax, &tp)); - EXPECT_EQ(system_clock::from_time_t(1234567890), tp); + EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp); // This is most important when the time has the same YMDhms // breakdown in the zone as some other time. For example, ... @@ -843,16 +845,16 @@ TEST(Parse, PosixConversions) { // 1414920600 in US/Pacific -> Sun Nov 2 01:30:00 2014 (PST) tp = reset; EXPECT_TRUE(parse("%s", "1414917000", lax, &tp)); - EXPECT_EQ(system_clock::from_time_t(1414917000), tp); + EXPECT_EQ(chrono::system_clock::from_time_t(1414917000), tp); tp = reset; EXPECT_TRUE(parse("%s", "1414920600", lax, &tp)); - EXPECT_EQ(system_clock::from_time_t(1414920600), tp); + EXPECT_EQ(chrono::system_clock::from_time_t(1414920600), tp); #endif } TEST(Parse, LocaleSpecific) { time_zone tz = utc_time_zone(); - auto tp = system_clock::from_time_t(0); + auto tp = chrono::system_clock::from_time_t(0); const auto reset = convert(civil_second(1977, 6, 28, 9, 8, 7), tz); // %a is parsed but ignored. @@ -983,7 +985,8 @@ TEST(Parse, LocaleSpecific) { TEST(Parse, ExtendedSeconds) { const time_zone tz = utc_time_zone(); - const time_point<nanoseconds> unix_epoch = system_clock::from_time_t(0); + const time_point<chrono::nanoseconds> unix_epoch = + chrono::system_clock::from_time_t(0); // All %E<prec>S cases are treated the same as %E*S on input. auto precisions = {"*", "0", "1", "2", "3", "4", "5", "6", "7", @@ -991,47 +994,47 @@ TEST(Parse, ExtendedSeconds) { for (const std::string& prec : precisions) { const std::string fmt = "%E" + prec + "S"; SCOPED_TRACE(fmt); - time_point<nanoseconds> tp = unix_epoch; + time_point<chrono::nanoseconds> tp = unix_epoch; EXPECT_TRUE(parse(fmt, "5", tz, &tp)); - EXPECT_EQ(unix_epoch + seconds(5), tp); + EXPECT_EQ(unix_epoch + chrono::seconds(5), tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "05", tz, &tp)); - EXPECT_EQ(unix_epoch + seconds(5), tp); + EXPECT_EQ(unix_epoch + chrono::seconds(5), tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "05.0", tz, &tp)); - EXPECT_EQ(unix_epoch + seconds(5), tp); + EXPECT_EQ(unix_epoch + chrono::seconds(5), tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "05.00", tz, &tp)); - EXPECT_EQ(unix_epoch + seconds(5), tp); + EXPECT_EQ(unix_epoch + chrono::seconds(5), tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "05.6", tz, &tp)); - EXPECT_EQ(unix_epoch + seconds(5) + milliseconds(600), tp); + EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(600), tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "05.60", tz, &tp)); - EXPECT_EQ(unix_epoch + seconds(5) + milliseconds(600), tp); + EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(600), tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "05.600", tz, &tp)); - EXPECT_EQ(unix_epoch + seconds(5) + milliseconds(600), tp); + EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(600), tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "05.67", tz, &tp)); - EXPECT_EQ(unix_epoch + seconds(5) + milliseconds(670), tp); + EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(670), tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "05.670", tz, &tp)); - EXPECT_EQ(unix_epoch + seconds(5) + milliseconds(670), tp); + EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(670), tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "05.678", tz, &tp)); - EXPECT_EQ(unix_epoch + seconds(5) + milliseconds(678), tp); + EXPECT_EQ(unix_epoch + chrono::seconds(5) + chrono::milliseconds(678), tp); } // Here is a "%E*S" case we got wrong for a while. The fractional // part of the first instant is less than 2^31 and was correctly // parsed, while the second (and any subsecond field >=2^31) failed. - time_point<nanoseconds> tp = unix_epoch; + time_point<chrono::nanoseconds> tp = unix_epoch; EXPECT_TRUE(parse("%E*S", "0.2147483647", tz, &tp)); - EXPECT_EQ(unix_epoch + nanoseconds(214748364), tp); + EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp); tp = unix_epoch; EXPECT_TRUE(parse("%E*S", "0.2147483648", tz, &tp)); - EXPECT_EQ(unix_epoch + nanoseconds(214748364), tp); + EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp); // We should also be able to specify long strings of digits far // beyond the current resolution and have them convert the same way. @@ -1039,18 +1042,18 @@ TEST(Parse, ExtendedSeconds) { EXPECT_TRUE(parse( "%E*S", "0.214748364801234567890123456789012345678901234567890123456789", tz, &tp)); - EXPECT_EQ(unix_epoch + nanoseconds(214748364), tp); + EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp); } TEST(Parse, ExtendedSecondsScan) { const time_zone tz = utc_time_zone(); - time_point<nanoseconds> tp; + time_point<chrono::nanoseconds> tp; for (int ms = 0; ms < 1000; ms += 111) { for (int us = 0; us < 1000; us += 27) { const int micros = ms * 1000 + us; for (int ns = 0; ns < 1000; ns += 9) { - const auto expected = - system_clock::from_time_t(0) + nanoseconds(micros * 1000 + ns); + const auto expected = chrono::system_clock::from_time_t(0) + + chrono::nanoseconds(micros * 1000 + ns); std::ostringstream oss; oss << "0." << std::setfill('0') << std::setw(3); oss << ms << std::setw(3) << us << std::setw(3) << ns; @@ -1064,7 +1067,8 @@ TEST(Parse, ExtendedSecondsScan) { TEST(Parse, ExtendedSubeconds) { const time_zone tz = utc_time_zone(); - const time_point<nanoseconds> unix_epoch = system_clock::from_time_t(0); + const time_point<chrono::nanoseconds> unix_epoch = + chrono::system_clock::from_time_t(0); // All %E<prec>f cases are treated the same as %E*f on input. auto precisions = {"*", "0", "1", "2", "3", "4", "5", "6", "7", @@ -1072,41 +1076,42 @@ TEST(Parse, ExtendedSubeconds) { for (const std::string& prec : precisions) { const std::string fmt = "%E" + prec + "f"; SCOPED_TRACE(fmt); - time_point<nanoseconds> tp = unix_epoch - seconds(1); + time_point<chrono::nanoseconds> tp = unix_epoch - chrono::seconds(1); EXPECT_TRUE(parse(fmt, "", tz, &tp)); EXPECT_EQ(unix_epoch, tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "6", tz, &tp)); - EXPECT_EQ(unix_epoch + milliseconds(600), tp); + EXPECT_EQ(unix_epoch + chrono::milliseconds(600), tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "60", tz, &tp)); - EXPECT_EQ(unix_epoch + milliseconds(600), tp); + EXPECT_EQ(unix_epoch + chrono::milliseconds(600), tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "600", tz, &tp)); - EXPECT_EQ(unix_epoch + milliseconds(600), tp); + EXPECT_EQ(unix_epoch + chrono::milliseconds(600), tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "67", tz, &tp)); - EXPECT_EQ(unix_epoch + milliseconds(670), tp); + EXPECT_EQ(unix_epoch + chrono::milliseconds(670), tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "670", tz, &tp)); - EXPECT_EQ(unix_epoch + milliseconds(670), tp); + EXPECT_EQ(unix_epoch + chrono::milliseconds(670), tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "678", tz, &tp)); - EXPECT_EQ(unix_epoch + milliseconds(678), tp); + EXPECT_EQ(unix_epoch + chrono::milliseconds(678), tp); tp = unix_epoch; EXPECT_TRUE(parse(fmt, "6789", tz, &tp)); - EXPECT_EQ(unix_epoch + milliseconds(678) + microseconds(900), tp); + EXPECT_EQ( + unix_epoch + chrono::milliseconds(678) + chrono::microseconds(900), tp); } // Here is a "%E*f" case we got wrong for a while. The fractional // part of the first instant is less than 2^31 and was correctly // parsed, while the second (and any subsecond field >=2^31) failed. - time_point<nanoseconds> tp = unix_epoch; + time_point<chrono::nanoseconds> tp = unix_epoch; EXPECT_TRUE(parse("%E*f", "2147483647", tz, &tp)); - EXPECT_EQ(unix_epoch + nanoseconds(214748364), tp); + EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp); tp = unix_epoch; EXPECT_TRUE(parse("%E*f", "2147483648", tz, &tp)); - EXPECT_EQ(unix_epoch + nanoseconds(214748364), tp); + EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp); // We should also be able to specify long strings of digits far // beyond the current resolution and have them convert the same way. @@ -1114,11 +1119,11 @@ TEST(Parse, ExtendedSubeconds) { EXPECT_TRUE(parse( "%E*f", "214748364801234567890123456789012345678901234567890123456789", tz, &tp)); - EXPECT_EQ(unix_epoch + nanoseconds(214748364), tp); + EXPECT_EQ(unix_epoch + chrono::nanoseconds(214748364), tp); } TEST(Parse, ExtendedSubecondsScan) { - time_point<nanoseconds> tp; + time_point<chrono::nanoseconds> tp; const time_zone tz = utc_time_zone(); for (int ms = 0; ms < 1000; ms += 111) { for (int us = 0; us < 1000; us += 27) { @@ -1128,14 +1133,14 @@ TEST(Parse, ExtendedSubecondsScan) { oss << std::setfill('0') << std::setw(3) << ms; oss << std::setw(3) << us << std::setw(3) << ns; const std::string nanos = oss.str(); - const auto expected = - system_clock::from_time_t(0) + nanoseconds(micros * 1000 + ns); + const auto expected = chrono::system_clock::from_time_t(0) + + chrono::nanoseconds(micros * 1000 + ns); for (int ps = 0; ps < 1000; ps += 250) { std::ostringstream oss; oss << std::setfill('0') << std::setw(3) << ps; const std::string input = nanos + oss.str() + "999"; EXPECT_TRUE(parse("%E*f", input, tz, &tp)); - EXPECT_EQ(expected + nanoseconds(ps) / 1000, tp) << input; + EXPECT_EQ(expected + chrono::nanoseconds(ps) / 1000, tp) << input; } } } @@ -1144,7 +1149,7 @@ TEST(Parse, ExtendedSubecondsScan) { TEST(Parse, ExtendedOffset) { const time_zone utc = utc_time_zone(); - time_point<sys_seconds> tp; + time_point<absl::time_internal::cctz::seconds> tp; // %z against +-HHMM. EXPECT_TRUE(parse("%z", "+0000", utc, &tp)); @@ -1194,7 +1199,7 @@ TEST(Parse, ExtendedOffset) { TEST(Parse, ExtendedSecondOffset) { const time_zone utc = utc_time_zone(); - time_point<sys_seconds> tp; + time_point<absl::time_internal::cctz::seconds> tp; // %Ez against +-HH:MM:SS. EXPECT_TRUE(parse("%Ez", "+00:00:00", utc, &tp)); @@ -1263,7 +1268,7 @@ TEST(Parse, ExtendedSecondOffset) { TEST(Parse, ExtendedYears) { const time_zone utc = utc_time_zone(); const char e4y_fmt[] = "%E4Y%m%d"; // no separators - time_point<sys_seconds> tp; + time_point<absl::time_internal::cctz::seconds> tp; // %E4Y consumes exactly four chars, including any sign. EXPECT_TRUE(parse(e4y_fmt, "-9991127", utc, &tp)); @@ -1294,45 +1299,45 @@ TEST(Parse, ExtendedYears) { TEST(Parse, RFC3339Format) { const time_zone tz = utc_time_zone(); - time_point<nanoseconds> tp; + time_point<chrono::nanoseconds> tp; EXPECT_TRUE(parse(RFC3339_sec, "2014-02-12T20:21:00+00:00", tz, &tp)); ExpectTime(tp, tz, 2014, 2, 12, 20, 21, 0, 0, false, "UTC"); // Check that %Ez also accepts "Z" as a synonym for "+00:00". - time_point<nanoseconds> tp2; + time_point<chrono::nanoseconds> tp2; EXPECT_TRUE(parse(RFC3339_sec, "2014-02-12T20:21:00Z", tz, &tp2)); EXPECT_EQ(tp, tp2); } TEST(Parse, MaxRange) { const time_zone utc = utc_time_zone(); - time_point<sys_seconds> tp; + time_point<absl::time_internal::cctz::seconds> tp; // tests the upper limit using +00:00 offset EXPECT_TRUE( parse(RFC3339_sec, "292277026596-12-04T15:30:07+00:00", utc, &tp)); - EXPECT_EQ(tp, time_point<sys_seconds>::max()); + EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::max()); EXPECT_FALSE( parse(RFC3339_sec, "292277026596-12-04T15:30:08+00:00", utc, &tp)); // tests the upper limit using -01:00 offset EXPECT_TRUE( parse(RFC3339_sec, "292277026596-12-04T14:30:07-01:00", utc, &tp)); - EXPECT_EQ(tp, time_point<sys_seconds>::max()); + EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::max()); EXPECT_FALSE( parse(RFC3339_sec, "292277026596-12-04T15:30:07-01:00", utc, &tp)); // tests the lower limit using +00:00 offset EXPECT_TRUE( parse(RFC3339_sec, "-292277022657-01-27T08:29:52+00:00", utc, &tp)); - EXPECT_EQ(tp, time_point<sys_seconds>::min()); + EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::min()); EXPECT_FALSE( parse(RFC3339_sec, "-292277022657-01-27T08:29:51+00:00", utc, &tp)); // tests the lower limit using +01:00 offset EXPECT_TRUE( parse(RFC3339_sec, "-292277022657-01-27T09:29:52+01:00", utc, &tp)); - EXPECT_EQ(tp, time_point<sys_seconds>::min()); + EXPECT_EQ(tp, time_point<absl::time_internal::cctz::seconds>::min()); EXPECT_FALSE( parse(RFC3339_sec, "-292277022657-01-27T08:29:51+01:00", utc, &tp)); @@ -1355,11 +1360,11 @@ TEST(FormatParse, RoundTrip) { time_zone lax; EXPECT_TRUE(load_time_zone("America/Los_Angeles", &lax)); const auto in = convert(civil_second(1977, 6, 28, 9, 8, 7), lax); - const auto subseconds = nanoseconds(654321); + const auto subseconds = chrono::nanoseconds(654321); // RFC3339, which renders subseconds. { - time_point<nanoseconds> out; + time_point<chrono::nanoseconds> out; const std::string s = format(RFC3339_full, in + subseconds, lax); EXPECT_TRUE(parse(RFC3339_full, s, lax, &out)) << s; EXPECT_EQ(in + subseconds, out); // RFC3339_full includes %Ez @@ -1367,7 +1372,7 @@ TEST(FormatParse, RoundTrip) { // RFC1123, which only does whole seconds. { - time_point<nanoseconds> out; + time_point<chrono::nanoseconds> out; const std::string s = format(RFC1123_full, in, lax); EXPECT_TRUE(parse(RFC1123_full, s, lax, &out)) << s; EXPECT_EQ(in, out); // RFC1123_full includes %z @@ -1380,7 +1385,7 @@ TEST(FormatParse, RoundTrip) { // Even though we don't know what %c will produce, it should roundtrip, // but only in the 0-offset timezone. { - time_point<nanoseconds> out; + time_point<chrono::nanoseconds> out; time_zone utc = utc_time_zone(); const std::string s = format("%c", in, utc); EXPECT_TRUE(parse("%c", s, utc, &out)) << s; @@ -1391,18 +1396,18 @@ TEST(FormatParse, RoundTrip) { TEST(FormatParse, RoundTripDistantFuture) { const time_zone utc = utc_time_zone(); - const time_point<sys_seconds> in = time_point<sys_seconds>::max(); + const time_point<absl::time_internal::cctz::seconds> in = time_point<absl::time_internal::cctz::seconds>::max(); const std::string s = format(RFC3339_full, in, utc); - time_point<sys_seconds> out; + time_point<absl::time_internal::cctz::seconds> out; EXPECT_TRUE(parse(RFC3339_full, s, utc, &out)) << s; EXPECT_EQ(in, out); } TEST(FormatParse, RoundTripDistantPast) { const time_zone utc = utc_time_zone(); - const time_point<sys_seconds> in = time_point<sys_seconds>::min(); + const time_point<absl::time_internal::cctz::seconds> in = time_point<absl::time_internal::cctz::seconds>::min(); const std::string s = format(RFC3339_full, in, utc); - time_point<sys_seconds> out; + time_point<absl::time_internal::cctz::seconds> out; EXPECT_TRUE(parse(RFC3339_full, s, utc, &out)) << s; EXPECT_EQ(in, out); } diff --git a/absl/time/internal/cctz/src/time_zone_if.h b/absl/time/internal/cctz/src/time_zone_if.h index ce4da1b728b6..f10972ae2b0f 100644 --- a/absl/time/internal/cctz/src/time_zone_if.h +++ b/absl/time/internal/cctz/src/time_zone_if.h @@ -37,30 +37,28 @@ class TimeZoneIf { virtual ~TimeZoneIf(); virtual time_zone::absolute_lookup BreakTime( - const time_point<sys_seconds>& tp) const = 0; + const time_point<seconds>& tp) const = 0; virtual time_zone::civil_lookup MakeTime( const civil_second& cs) const = 0; virtual std::string Description() const = 0; - virtual bool NextTransition(time_point<sys_seconds>* tp) const = 0; - virtual bool PrevTransition(time_point<sys_seconds>* tp) const = 0; + virtual bool NextTransition(time_point<seconds>* tp) const = 0; + virtual bool PrevTransition(time_point<seconds>* tp) const = 0; protected: TimeZoneIf() {} }; -// Convert between time_point<sys_seconds> and a count of seconds since -// the Unix epoch. We assume that the std::chrono::system_clock and the +// Convert between time_point<seconds> and a count of seconds since the +// Unix epoch. We assume that the std::chrono::system_clock and the // Unix clock are second aligned, but not that they share an epoch. -inline std::int_fast64_t ToUnixSeconds(const time_point<sys_seconds>& tp) { - return (tp - std::chrono::time_point_cast<sys_seconds>( - std::chrono::system_clock::from_time_t(0))) - .count(); +inline std::int_fast64_t ToUnixSeconds(const time_point<seconds>& tp) { + return (tp - std::chrono::time_point_cast<seconds>( + std::chrono::system_clock::from_time_t(0))).count(); } -inline time_point<sys_seconds> FromUnixSeconds(std::int_fast64_t t) { - return std::chrono::time_point_cast<sys_seconds>( - std::chrono::system_clock::from_time_t(0)) + - sys_seconds(t); +inline time_point<seconds> FromUnixSeconds(std::int_fast64_t t) { + return std::chrono::time_point_cast<seconds>( + std::chrono::system_clock::from_time_t(0)) + seconds(t); } } // namespace cctz diff --git a/absl/time/internal/cctz/src/time_zone_impl.cc b/absl/time/internal/cctz/src/time_zone_impl.cc index b3f635f786ff..eb96c7ef5995 100644 --- a/absl/time/internal/cctz/src/time_zone_impl.cc +++ b/absl/time/internal/cctz/src/time_zone_impl.cc @@ -45,8 +45,8 @@ bool time_zone::Impl::LoadTimeZone(const std::string& name, time_zone* tz) { const time_zone::Impl* const utc_impl = UTCImpl(); // First check for UTC (which is never a key in time_zone_map). - auto offset = sys_seconds::zero(); - if (FixedOffsetFromName(name, &offset) && offset == sys_seconds::zero()) { + auto offset = seconds::zero(); + if (FixedOffsetFromName(name, &offset) && offset == seconds::zero()) { *tz = time_zone(utc_impl); return true; } diff --git a/absl/time/internal/cctz/src/time_zone_impl.h b/absl/time/internal/cctz/src/time_zone_impl.h index 2c1c30b690e5..fef7f22672dc 100644 --- a/absl/time/internal/cctz/src/time_zone_impl.h +++ b/absl/time/internal/cctz/src/time_zone_impl.h @@ -48,8 +48,7 @@ class time_zone::Impl { const std::string& name() const { return name_; } // Breaks a time_point down to civil-time components in this time zone. - time_zone::absolute_lookup BreakTime( - const time_point<sys_seconds>& tp) const { + time_zone::absolute_lookup BreakTime(const time_point<seconds>& tp) const { return zone_->BreakTime(tp); } @@ -75,10 +74,10 @@ class time_zone::Impl { // to NextTransition()/PrevTransition() will eventually return false, // but it is unspecified exactly when NextTransition(&tp) jumps to false, // or what time is set by PrevTransition(&tp) for a very distant tp. - bool NextTransition(time_point<sys_seconds>* tp) const { + bool NextTransition(time_point<seconds>* tp) const { return zone_->NextTransition(tp); } - bool PrevTransition(time_point<sys_seconds>* tp) const { + bool PrevTransition(time_point<seconds>* tp) const { return zone_->PrevTransition(tp); } diff --git a/absl/time/internal/cctz/src/time_zone_info.cc b/absl/time/internal/cctz/src/time_zone_info.cc index 20bba28b363b..cdd11810583a 100644 --- a/absl/time/internal/cctz/src/time_zone_info.cc +++ b/absl/time/internal/cctz/src/time_zone_info.cc @@ -140,7 +140,7 @@ std::int_fast64_t TransOffset(bool leap_year, int jan1_weekday, return (days * kSecsPerDay) + pt.time.offset; } -inline time_zone::civil_lookup MakeUnique(const time_point<sys_seconds>& tp) { +inline time_zone::civil_lookup MakeUnique(const time_point<seconds>& tp) { time_zone::civil_lookup cl; cl.kind = time_zone::civil_lookup::UNIQUE; cl.pre = cl.trans = cl.post = tp; @@ -179,7 +179,7 @@ inline civil_second YearShift(const civil_second& cs, year_t shift) { } // namespace // What (no leap-seconds) UTC+seconds zoneinfo would look like. -bool TimeZoneInfo::ResetToBuiltinUTC(const sys_seconds& offset) { +bool TimeZoneInfo::ResetToBuiltinUTC(const seconds& offset) { transition_types_.resize(1); TransitionType& tt(transition_types_.back()); tt.utc_offset = static_cast<std::int_least32_t>(offset.count()); @@ -218,8 +218,8 @@ bool TimeZoneInfo::ResetToBuiltinUTC(const sys_seconds& offset) { future_spec_.clear(); // never needed for a fixed-offset zone extended_ = false; - tt.civil_max = LocalTime(sys_seconds::max().count(), tt).cs; - tt.civil_min = LocalTime(sys_seconds::min().count(), tt).cs; + tt.civil_max = LocalTime(seconds::max().count(), tt).cs; + tt.civil_min = LocalTime(seconds::min().count(), tt).cs; transitions_.shrink_to_fit(); return true; @@ -565,10 +565,10 @@ bool TimeZoneInfo::Load(const std::string& name, ZoneInfoSource* zip) { } // Compute the maximum/minimum civil times that can be converted to a - // time_point<sys_seconds> for each of the zone's transition types. + // time_point<seconds> for each of the zone's transition types. for (auto& tt : transition_types_) { - tt.civil_max = LocalTime(sys_seconds::max().count(), tt).cs; - tt.civil_min = LocalTime(sys_seconds::min().count(), tt).cs; + tt.civil_max = LocalTime(seconds::max().count(), tt).cs; + tt.civil_min = LocalTime(seconds::min().count(), tt).cs; } transitions_.shrink_to_fit(); @@ -713,7 +713,7 @@ bool TimeZoneInfo::Load(const std::string& name) { // zone never fails because the simple, fixed-offset state can be // internally generated. Note that this depends on our choice to not // accept leap-second encoded ("right") zoneinfo. - auto offset = sys_seconds::zero(); + auto offset = seconds::zero(); if (FixedOffsetFromName(name, &offset)) { return ResetToBuiltinUTC(offset); } @@ -755,14 +755,14 @@ time_zone::civil_lookup TimeZoneInfo::TimeLocal(const civil_second& cs, year_t c4_shift) const { assert(last_year_ - 400 < cs.year() && cs.year() <= last_year_); time_zone::civil_lookup cl = MakeTime(cs); - if (c4_shift > sys_seconds::max().count() / kSecsPer400Years) { - cl.pre = cl.trans = cl.post = time_point<sys_seconds>::max(); + if (c4_shift > seconds::max().count() / kSecsPer400Years) { + cl.pre = cl.trans = cl.post = time_point<seconds>::max(); } else { - const auto offset = sys_seconds(c4_shift * kSecsPer400Years); - const auto limit = time_point<sys_seconds>::max() - offset; + const auto offset = seconds(c4_shift * kSecsPer400Years); + const auto limit = time_point<seconds>::max() - offset; for (auto* tp : {&cl.pre, &cl.trans, &cl.post}) { if (*tp > limit) { - *tp = time_point<sys_seconds>::max(); + *tp = time_point<seconds>::max(); } else { *tp += offset; } @@ -772,7 +772,7 @@ time_zone::civil_lookup TimeZoneInfo::TimeLocal(const civil_second& cs, } time_zone::absolute_lookup TimeZoneInfo::BreakTime( - const time_point<sys_seconds>& tp) const { + const time_point<seconds>& tp) const { std::int_fast64_t unix_time = ToUnixSeconds(tp); const std::size_t timecnt = transitions_.size(); assert(timecnt != 0); // We always add a transition. @@ -788,7 +788,7 @@ time_zone::absolute_lookup TimeZoneInfo::BreakTime( const std::int_fast64_t diff = unix_time - transitions_[timecnt - 1].unix_time; const year_t shift = diff / kSecsPer400Years + 1; - const auto d = sys_seconds(shift * kSecsPer400Years); + const auto d = seconds(shift * kSecsPer400Years); time_zone::absolute_lookup al = BreakTime(tp - d); al.cs = YearShift(al.cs, shift * 400); return al; @@ -847,7 +847,7 @@ time_zone::civil_lookup TimeZoneInfo::MakeTime(const civil_second& cs) const { if (tr->prev_civil_sec >= cs) { // Before first transition, so use the default offset. const TransitionType& tt(transition_types_[default_transition_type_]); - if (cs < tt.civil_min) return MakeUnique(time_point<sys_seconds>::min()); + if (cs < tt.civil_min) return MakeUnique(time_point<seconds>::min()); return MakeUnique(cs - (civil_second() + tt.utc_offset)); } // tr->prev_civil_sec < cs < tr->civil_sec @@ -864,7 +864,7 @@ time_zone::civil_lookup TimeZoneInfo::MakeTime(const civil_second& cs) const { return TimeLocal(YearShift(cs, shift * -400), shift); } const TransitionType& tt(transition_types_[tr->type_index]); - if (cs > tt.civil_max) return MakeUnique(time_point<sys_seconds>::max()); + if (cs > tt.civil_max) return MakeUnique(time_point<seconds>::max()); return MakeUnique(tr->unix_time + (cs - tr->civil_sec)); } // tr->civil_sec <= cs <= tr->prev_civil_sec @@ -895,7 +895,7 @@ std::string TimeZoneInfo::Description() const { return oss.str(); } -bool TimeZoneInfo::NextTransition(time_point<sys_seconds>* tp) const { +bool TimeZoneInfo::NextTransition(time_point<seconds>* tp) const { if (transitions_.empty()) return false; const Transition* begin = &transitions_[0]; const Transition* end = begin + transitions_.size(); @@ -919,7 +919,7 @@ bool TimeZoneInfo::NextTransition(time_point<sys_seconds>* tp) const { return true; } -bool TimeZoneInfo::PrevTransition(time_point<sys_seconds>* tp) const { +bool TimeZoneInfo::PrevTransition(time_point<seconds>* tp) const { if (transitions_.empty()) return false; const Transition* begin = &transitions_[0]; const Transition* end = begin + transitions_.size(); diff --git a/absl/time/internal/cctz/src/time_zone_info.h b/absl/time/internal/cctz/src/time_zone_info.h index b4d1696bf61b..d28443e26398 100644 --- a/absl/time/internal/cctz/src/time_zone_info.h +++ b/absl/time/internal/cctz/src/time_zone_info.h @@ -71,12 +71,12 @@ class TimeZoneInfo : public TimeZoneIf { // TimeZoneIf implementations. time_zone::absolute_lookup BreakTime( - const time_point<sys_seconds>& tp) const override; + const time_point<seconds>& tp) const override; time_zone::civil_lookup MakeTime( const civil_second& cs) const override; std::string Description() const override; - bool NextTransition(time_point<sys_seconds>* tp) const override; - bool PrevTransition(time_point<sys_seconds>* tp) const override; + bool NextTransition(time_point<seconds>* tp) const override; + bool PrevTransition(time_point<seconds>* tp) const override; private: struct Header { // counts of: @@ -98,7 +98,7 @@ class TimeZoneInfo : public TimeZoneIf { std::uint_fast8_t tt2_index) const; void ExtendTransitions(const std::string& name, const Header& hdr); - bool ResetToBuiltinUTC(const sys_seconds& offset); + bool ResetToBuiltinUTC(const seconds& offset); bool Load(const std::string& name, ZoneInfoSource* zip); // Helpers for BreakTime() and MakeTime(). diff --git a/absl/time/internal/cctz/src/time_zone_libc.cc b/absl/time/internal/cctz/src/time_zone_libc.cc index b0b56a522332..1d727bded982 100644 --- a/absl/time/internal/cctz/src/time_zone_libc.cc +++ b/absl/time/internal/cctz/src/time_zone_libc.cc @@ -91,7 +91,7 @@ TimeZoneLibC::TimeZoneLibC(const std::string& name) : local_(name == "localtime") {} time_zone::absolute_lookup TimeZoneLibC::BreakTime( - const time_point<sys_seconds>& tp) const { + const time_point<seconds>& tp) const { time_zone::absolute_lookup al; std::time_t t = ToUnixSeconds(tp); std::tm tm; @@ -143,11 +143,11 @@ std::string TimeZoneLibC::Description() const { return local_ ? "localtime" : "UTC"; } -bool TimeZoneLibC::NextTransition(time_point<sys_seconds>* tp) const { +bool TimeZoneLibC::NextTransition(time_point<seconds>* tp) const { return false; } -bool TimeZoneLibC::PrevTransition(time_point<sys_seconds>* tp) const { +bool TimeZoneLibC::PrevTransition(time_point<seconds>* tp) const { return false; } diff --git a/absl/time/internal/cctz/src/time_zone_libc.h b/absl/time/internal/cctz/src/time_zone_libc.h index 41f7dde2b06a..4c64cd3462f8 100644 --- a/absl/time/internal/cctz/src/time_zone_libc.h +++ b/absl/time/internal/cctz/src/time_zone_libc.h @@ -32,12 +32,12 @@ class TimeZoneLibC : public TimeZoneIf { // TimeZoneIf implementations. time_zone::absolute_lookup BreakTime( - const time_point<sys_seconds>& tp) const override; + const time_point<seconds>& tp) const override; time_zone::civil_lookup MakeTime( const civil_second& cs) const override; std::string Description() const override; - bool NextTransition(time_point<sys_seconds>* tp) const override; - bool PrevTransition(time_point<sys_seconds>* tp) const override; + bool NextTransition(time_point<seconds>* tp) const override; + bool PrevTransition(time_point<seconds>* tp) const override; private: const bool local_; // localtime or UTC diff --git a/absl/time/internal/cctz/src/time_zone_lookup.cc b/absl/time/internal/cctz/src/time_zone_lookup.cc index d549d862a769..2f6cd98b9b43 100644 --- a/absl/time/internal/cctz/src/time_zone_lookup.cc +++ b/absl/time/internal/cctz/src/time_zone_lookup.cc @@ -65,7 +65,7 @@ std::string time_zone::name() const { } time_zone::absolute_lookup time_zone::lookup( - const time_point<sys_seconds>& tp) const { + const time_point<seconds>& tp) const { return time_zone::Impl::get(*this).BreakTime(tp); } @@ -85,7 +85,7 @@ time_zone utc_time_zone() { return time_zone::Impl::UTC(); // avoid name lookup } -time_zone fixed_time_zone(const sys_seconds& offset) { +time_zone fixed_time_zone(const seconds& offset) { time_zone tz; load_time_zone(FixedOffsetToName(offset), &tz); return tz; diff --git a/absl/time/internal/cctz/src/time_zone_lookup_test.cc b/absl/time/internal/cctz/src/time_zone_lookup_test.cc index 06b172a80323..cd9fc2362752 100644 --- a/absl/time/internal/cctz/src/time_zone_lookup_test.cc +++ b/absl/time/internal/cctz/src/time_zone_lookup_test.cc @@ -24,14 +24,7 @@ #include "absl/time/internal/cctz/include/cctz/civil_time.h" #include "gtest/gtest.h" -using std::chrono::time_point_cast; -using std::chrono::system_clock; -using std::chrono::nanoseconds; -using std::chrono::microseconds; -using std::chrono::milliseconds; -using std::chrono::seconds; -using std::chrono::minutes; -using std::chrono::hours; +namespace chrono = std::chrono; namespace absl { namespace time_internal { @@ -715,13 +708,13 @@ TEST(TimeZone, NamedTimeZones) { EXPECT_EQ("America/New_York", nyc.name()); const time_zone syd = LoadZone("Australia/Sydney"); EXPECT_EQ("Australia/Sydney", syd.name()); - const time_zone fixed0 = fixed_time_zone(sys_seconds::zero()); + const time_zone fixed0 = fixed_time_zone(absl::time_internal::cctz::seconds::zero()); EXPECT_EQ("UTC", fixed0.name()); - const time_zone fixed_pos = - fixed_time_zone(hours(3) + minutes(25) + seconds(45)); + const time_zone fixed_pos = fixed_time_zone( + chrono::hours(3) + chrono::minutes(25) + chrono::seconds(45)); EXPECT_EQ("Fixed/UTC+03:25:45", fixed_pos.name()); - const time_zone fixed_neg = - fixed_time_zone(-(hours(12) + minutes(34) + seconds(56))); + const time_zone fixed_neg = fixed_time_zone( + -(chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56))); EXPECT_EQ("Fixed/UTC-12:34:56", fixed_neg.name()); } @@ -731,19 +724,19 @@ TEST(TimeZone, Failures) { tz = LoadZone("America/Los_Angeles"); EXPECT_FALSE(load_time_zone("Invalid/TimeZone", &tz)); - EXPECT_EQ(system_clock::from_time_t(0), + EXPECT_EQ(chrono::system_clock::from_time_t(0), convert(civil_second(1970, 1, 1, 0, 0, 0), tz)); // UTC // Ensures that the load still fails on a subsequent attempt. tz = LoadZone("America/Los_Angeles"); EXPECT_FALSE(load_time_zone("Invalid/TimeZone", &tz)); - EXPECT_EQ(system_clock::from_time_t(0), + EXPECT_EQ(chrono::system_clock::from_time_t(0), convert(civil_second(1970, 1, 1, 0, 0, 0), tz)); // UTC // Loading an empty std::string timezone should fail. tz = LoadZone("America/Los_Angeles"); EXPECT_FALSE(load_time_zone("", &tz)); - EXPECT_EQ(system_clock::from_time_t(0), + EXPECT_EQ(chrono::system_clock::from_time_t(0), convert(civil_second(1970, 1, 1, 0, 0, 0), tz)); // UTC } @@ -758,7 +751,7 @@ TEST(TimeZone, Equality) { EXPECT_EQ(implicit_utc, explicit_utc); EXPECT_EQ(implicit_utc.name(), explicit_utc.name()); - const time_zone fixed_zero = fixed_time_zone(sys_seconds::zero()); + const time_zone fixed_zero = fixed_time_zone(absl::time_internal::cctz::seconds::zero()); EXPECT_EQ(fixed_zero, LoadZone(fixed_zero.name())); EXPECT_EQ(fixed_zero, explicit_utc); @@ -766,23 +759,25 @@ TEST(TimeZone, Equality) { EXPECT_EQ(fixed_utc, LoadZone(fixed_utc.name())); EXPECT_EQ(fixed_utc, explicit_utc); - const time_zone fixed_pos = - fixed_time_zone(hours(3) + minutes(25) + seconds(45)); + const time_zone fixed_pos = fixed_time_zone( + chrono::hours(3) + chrono::minutes(25) + chrono::seconds(45)); EXPECT_EQ(fixed_pos, LoadZone(fixed_pos.name())); EXPECT_NE(fixed_pos, explicit_utc); - const time_zone fixed_neg = - fixed_time_zone(-(hours(12) + minutes(34) + seconds(56))); + const time_zone fixed_neg = fixed_time_zone( + -(chrono::hours(12) + chrono::minutes(34) + chrono::seconds(56))); EXPECT_EQ(fixed_neg, LoadZone(fixed_neg.name())); EXPECT_NE(fixed_neg, explicit_utc); - const time_zone fixed_lim = fixed_time_zone(hours(24)); + const time_zone fixed_lim = fixed_time_zone(chrono::hours(24)); EXPECT_EQ(fixed_lim, LoadZone(fixed_lim.name())); EXPECT_NE(fixed_lim, explicit_utc); - const time_zone fixed_ovfl = fixed_time_zone(hours(24) + seconds(1)); + const time_zone fixed_ovfl = + fixed_time_zone(chrono::hours(24) + chrono::seconds(1)); EXPECT_EQ(fixed_ovfl, LoadZone(fixed_ovfl.name())); EXPECT_EQ(fixed_ovfl, explicit_utc); - EXPECT_EQ(fixed_time_zone(seconds(1)), fixed_time_zone(seconds(1))); + EXPECT_EQ(fixed_time_zone(chrono::seconds(1)), + fixed_time_zone(chrono::seconds(1))); const time_zone local = local_time_zone(); EXPECT_EQ(local, LoadZone(local.name())); @@ -795,40 +790,43 @@ TEST(TimeZone, Equality) { TEST(StdChronoTimePoint, TimeTAlignment) { // Ensures that the Unix epoch and the system clock epoch are an integral // number of seconds apart. This simplifies conversions to/from time_t. - auto diff = system_clock::time_point() - system_clock::from_time_t(0); - EXPECT_EQ(system_clock::time_point::duration::zero(), diff % seconds(1)); + auto diff = chrono::system_clock::time_point() - + chrono::system_clock::from_time_t(0); + EXPECT_EQ(chrono::system_clock::time_point::duration::zero(), + diff % chrono::seconds(1)); } TEST(BreakTime, TimePointResolution) { const time_zone utc = utc_time_zone(); - const auto t0 = system_clock::from_time_t(0); + const auto t0 = chrono::system_clock::from_time_t(0); - ExpectTime(time_point_cast<nanoseconds>(t0), utc, + ExpectTime(chrono::time_point_cast<chrono::nanoseconds>(t0), utc, 1970, 1, 1, 0, 0, 0, 0, false, "UTC"); - ExpectTime(time_point_cast<microseconds>(t0), utc, + ExpectTime(chrono::time_point_cast<chrono::microseconds>(t0), utc, 1970, 1, 1, 0, 0, 0, 0, false, "UTC"); - ExpectTime(time_point_cast<milliseconds>(t0), utc, + ExpectTime(chrono::time_point_cast<chrono::milliseconds>(t0), utc, 1970, 1, 1, 0, 0, 0, 0, false, "UTC"); - ExpectTime(time_point_cast<seconds>(t0), utc, + ExpectTime(chrono::time_point_cast<chrono::seconds>(t0), utc, 1970, 1, 1, 0, 0, 0, 0, false, "UTC"); - ExpectTime(time_point_cast<sys_seconds>(t0), utc, + ExpectTime(chrono::time_point_cast<absl::time_internal::cctz::seconds>(t0), utc, 1970, 1, 1, 0, 0, 0, 0, false, "UTC"); - ExpectTime(time_point_cast<minutes>(t0), utc, + ExpectTime(chrono::time_point_cast<chrono::minutes>(t0), utc, 1970, 1, 1, 0, 0, 0, 0, false, "UTC"); - ExpectTime(time_point_cast<hours>(t0), utc, + ExpectTime(chrono::time_point_cast<chrono::hours>(t0), utc, 1970, 1, 1, 0, 0, 0, 0, false, "UTC"); } TEST(BreakTime, LocalTimeInUTC) { const time_zone tz = utc_time_zone(); - const auto tp = system_clock::from_time_t(0); + const auto tp = chrono::system_clock::from_time_t(0); ExpectTime(tp, tz, 1970, 1, 1, 0, 0, 0, 0, false, "UTC"); EXPECT_EQ(weekday::thursday, get_weekday(civil_day(convert(tp, tz)))); } TEST(BreakTime, LocalTimeInUTCUnaligned) { const time_zone tz = utc_time_zone(); - const auto tp = system_clock::from_time_t(0) - milliseconds(500); + const auto tp = + chrono::system_clock::from_time_t(0) - chrono::milliseconds(500); ExpectTime(tp, tz, 1969, 12, 31, 23, 59, 59, 0, false, "UTC"); EXPECT_EQ(weekday::wednesday, get_weekday(civil_day(convert(tp, tz)))); } @@ -836,15 +834,16 @@ TEST(BreakTime, LocalTimeInUTCUnaligned) { TEST(BreakTime, LocalTimePosix) { // See IEEE Std 1003.1-1988 B.2.3 General Terms, Epoch. const time_zone tz = utc_time_zone(); - const auto tp = system_clock::from_time_t(536457599); + const auto tp = chrono::system_clock::from_time_t(536457599); ExpectTime(tp, tz, 1986, 12, 31, 23, 59, 59, 0, false, "UTC"); EXPECT_EQ(weekday::wednesday, get_weekday(civil_day(convert(tp, tz)))); } TEST(TimeZoneImpl, LocalTimeInFixed) { - const sys_seconds offset = -(hours(8) + minutes(33) + seconds(47)); + const absl::time_internal::cctz::seconds offset = + -(chrono::hours(8) + chrono::minutes(33) + chrono::seconds(47)); const time_zone tz = fixed_time_zone(offset); - const auto tp = system_clock::from_time_t(0); + const auto tp = chrono::system_clock::from_time_t(0); ExpectTime(tp, tz, 1969, 12, 31, 15, 26, 13, offset.count(), false, "-083347"); EXPECT_EQ(weekday::wednesday, get_weekday(civil_day(convert(tp, tz)))); @@ -852,52 +851,52 @@ TEST(TimeZoneImpl, LocalTimeInFixed) { TEST(BreakTime, LocalTimeInNewYork) { const time_zone tz = LoadZone("America/New_York"); - const auto tp = system_clock::from_time_t(45); + const auto tp = chrono::system_clock::from_time_t(45); ExpectTime(tp, tz, 1969, 12, 31, 19, 0, 45, -5 * 60 * 60, false, "EST"); EXPECT_EQ(weekday::wednesday, get_weekday(civil_day(convert(tp, tz)))); } TEST(BreakTime, LocalTimeInMTV) { const time_zone tz = LoadZone("America/Los_Angeles"); - const auto tp = system_clock::from_time_t(1380855729); + const auto tp = chrono::system_clock::from_time_t(1380855729); ExpectTime(tp, tz, 2013, 10, 3, 20, 2, 9, -7 * 60 * 60, true, "PDT"); EXPECT_EQ(weekday::thursday, get_weekday(civil_day(convert(tp, tz)))); } TEST(BreakTime, LocalTimeInSydney) { const time_zone tz = LoadZone("Australia/Sydney"); - const auto tp = system_clock::from_time_t(90); + const auto tp = chrono::system_clock::from_time_t(90); ExpectTime(tp, tz, 1970, 1, 1, 10, 1, 30, 10 * 60 * 60, false, "AEST"); EXPECT_EQ(weekday::thursday, get_weekday(civil_day(convert(tp, tz)))); } TEST(MakeTime, TimePointResolution) { const time_zone utc = utc_time_zone(); - const time_point<nanoseconds> tp_ns = + const time_point<chrono::nanoseconds> tp_ns = convert(civil_second(2015, 1, 2, 3, 4, 5), utc); EXPECT_EQ("04:05", format("%M:%E*S", tp_ns, utc)); - const time_point<microseconds> tp_us = + const time_point<chrono::microseconds> tp_us = convert(civil_second(2015, 1, 2, 3, 4, 5), utc); EXPECT_EQ("04:05", format("%M:%E*S", tp_us, utc)); - const time_point<milliseconds> tp_ms = + const time_point<chrono::milliseconds> tp_ms = convert(civil_second(2015, 1, 2, 3, 4, 5), utc); EXPECT_EQ("04:05", format("%M:%E*S", tp_ms, utc)); - const time_point<seconds> tp_s = + const time_point<chrono::seconds> tp_s = convert(civil_second(2015, 1, 2, 3, 4, 5), utc); EXPECT_EQ("04:05", format("%M:%E*S", tp_s, utc)); - const time_point<sys_seconds> tp_s64 = + const time_point<absl::time_internal::cctz::seconds> tp_s64 = convert(civil_second(2015, 1, 2, 3, 4, 5), utc); EXPECT_EQ("04:05", format("%M:%E*S", tp_s64, utc)); - // These next two require time_point_cast because the conversion from a - // resolution of seconds (the return value of convert()) to a coarser - // resolution requires an explicit cast. - const time_point<minutes> tp_m = - time_point_cast<minutes>( + // These next two require chrono::time_point_cast because the conversion + // from a resolution of seconds (the return value of convert()) to a + // coarser resolution requires an explicit cast. + const time_point<chrono::minutes> tp_m = + chrono::time_point_cast<chrono::minutes>( convert(civil_second(2015, 1, 2, 3, 4, 5), utc)); EXPECT_EQ("04:00", format("%M:%E*S", tp_m, utc)); - const time_point<hours> tp_h = - time_point_cast<hours>( + const time_point<chrono::hours> tp_h = + chrono::time_point_cast<chrono::hours>( convert(civil_second(2015, 1, 2, 3, 4, 5), utc)); EXPECT_EQ("00:00", format("%M:%E*S", tp_h, utc)); } @@ -905,7 +904,7 @@ TEST(MakeTime, TimePointResolution) { TEST(MakeTime, Normalization) { const time_zone tz = LoadZone("America/New_York"); const auto tp = convert(civil_second(2009, 2, 13, 18, 31, 30), tz); - EXPECT_EQ(system_clock::from_time_t(1234567890), tp); + EXPECT_EQ(chrono::system_clock::from_time_t(1234567890), tp); // Now requests for the same time_point but with out-of-range fields. EXPECT_EQ(tp, convert(civil_second(2008, 14, 13, 18, 31, 30), tz)); // month @@ -919,67 +918,67 @@ TEST(MakeTime, Normalization) { TEST(MakeTime, SysSecondsLimits) { const char RFC3339[] = "%Y-%m-%dT%H:%M:%S%Ez"; const time_zone utc = utc_time_zone(); - const time_zone east = fixed_time_zone(hours(14)); - const time_zone west = fixed_time_zone(-hours(14)); - time_point<sys_seconds> tp; + const time_zone east = fixed_time_zone(chrono::hours(14)); + const time_zone west = fixed_time_zone(-chrono::hours(14)); + time_point<absl::time_internal::cctz::seconds> tp; - // Approach the maximal time_point<sys_seconds> value from below. + // Approach the maximal time_point<cctz::seconds> value from below. tp = convert(civil_second(292277026596, 12, 4, 15, 30, 6), utc); EXPECT_EQ("292277026596-12-04T15:30:06+00:00", format(RFC3339, tp, utc)); tp = convert(civil_second(292277026596, 12, 4, 15, 30, 7), utc); EXPECT_EQ("292277026596-12-04T15:30:07+00:00", format(RFC3339, tp, utc)); - EXPECT_EQ(time_point<sys_seconds>::max(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp); tp = convert(civil_second(292277026596, 12, 4, 15, 30, 8), utc); - EXPECT_EQ(time_point<sys_seconds>::max(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp); tp = convert(civil_second::max(), utc); - EXPECT_EQ(time_point<sys_seconds>::max(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp); // Checks that we can also get the maximal value for a far-east zone. tp = convert(civil_second(292277026596, 12, 5, 5, 30, 7), east); EXPECT_EQ("292277026596-12-05T05:30:07+14:00", format(RFC3339, tp, east)); - EXPECT_EQ(time_point<sys_seconds>::max(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp); tp = convert(civil_second(292277026596, 12, 5, 5, 30, 8), east); - EXPECT_EQ(time_point<sys_seconds>::max(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp); tp = convert(civil_second::max(), east); - EXPECT_EQ(time_point<sys_seconds>::max(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp); // Checks that we can also get the maximal value for a far-west zone. tp = convert(civil_second(292277026596, 12, 4, 1, 30, 7), west); EXPECT_EQ("292277026596-12-04T01:30:07-14:00", format(RFC3339, tp, west)); - EXPECT_EQ(time_point<sys_seconds>::max(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp); tp = convert(civil_second(292277026596, 12, 4, 7, 30, 8), west); - EXPECT_EQ(time_point<sys_seconds>::max(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp); tp = convert(civil_second::max(), west); - EXPECT_EQ(time_point<sys_seconds>::max(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::max(), tp); - // Approach the minimal time_point<sys_seconds> value from above. + // Approach the minimal time_point<cctz::seconds> value from above. tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 53), utc); EXPECT_EQ("-292277022657-01-27T08:29:53+00:00", format(RFC3339, tp, utc)); tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 52), utc); EXPECT_EQ("-292277022657-01-27T08:29:52+00:00", format(RFC3339, tp, utc)); - EXPECT_EQ(time_point<sys_seconds>::min(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp); tp = convert(civil_second(-292277022657, 1, 27, 8, 29, 51), utc); - EXPECT_EQ(time_point<sys_seconds>::min(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp); tp = convert(civil_second::min(), utc); - EXPECT_EQ(time_point<sys_seconds>::min(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp); // Checks that we can also get the minimal value for a far-east zone. tp = convert(civil_second(-292277022657, 1, 27, 22, 29, 52), east); EXPECT_EQ("-292277022657-01-27T22:29:52+14:00", format(RFC3339, tp, east)); - EXPECT_EQ(time_point<sys_seconds>::min(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp); tp = convert(civil_second(-292277022657, 1, 27, 22, 29, 51), east); - EXPECT_EQ(time_point<sys_seconds>::min(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp); tp = convert(civil_second::min(), east); - EXPECT_EQ(time_point<sys_seconds>::min(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp); // Checks that we can also get the minimal value for a far-west zone. tp = convert(civil_second(-292277022657, 1, 26, 18, 29, 52), west); EXPECT_EQ("-292277022657-01-26T18:29:52-14:00", format(RFC3339, tp, west)); - EXPECT_EQ(time_point<sys_seconds>::min(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp); tp = convert(civil_second(-292277022657, 1, 26, 18, 29, 51), west); - EXPECT_EQ(time_point<sys_seconds>::min(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp); tp = convert(civil_second::min(), west); - EXPECT_EQ(time_point<sys_seconds>::min(), tp); + EXPECT_EQ(time_point<absl::time_internal::cctz::seconds>::min(), tp); } TEST(TimeZoneEdgeCase, AmericaNewYork) { @@ -988,13 +987,13 @@ TEST(TimeZoneEdgeCase, AmericaNewYork) { // Spring 1:59:59 -> 3:00:00 auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz); ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -5 * 3600, false, "EST"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 2013, 3, 10, 3, 0, 0, -4 * 3600, true, "EDT"); // Fall 1:59:59 -> 1:00:00 tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz); ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -4 * 3600, true, "EDT"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 2013, 11, 3, 1, 0, 0, -5 * 3600, false, "EST"); } @@ -1004,13 +1003,13 @@ TEST(TimeZoneEdgeCase, AmericaLosAngeles) { // Spring 1:59:59 -> 3:00:00 auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz); ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -8 * 3600, false, "PST"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 2013, 3, 10, 3, 0, 0, -7 * 3600, true, "PDT"); // Fall 1:59:59 -> 1:00:00 tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz); ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -7 * 3600, true, "PDT"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 2013, 11, 3, 1, 0, 0, -8 * 3600, false, "PST"); } @@ -1020,13 +1019,13 @@ TEST(TimeZoneEdgeCase, ArizonaNoTransition) { // No transition in Spring. auto tp = convert(civil_second(2013, 3, 10, 1, 59, 59), tz); ExpectTime(tp, tz, 2013, 3, 10, 1, 59, 59, -7 * 3600, false, "MST"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 2013, 3, 10, 2, 0, 0, -7 * 3600, false, "MST"); // No transition in Fall. tp = convert(civil_second(2013, 11, 3, 1, 59, 59), tz); ExpectTime(tp, tz, 2013, 11, 3, 1, 59, 59, -7 * 3600, false, "MST"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 2013, 11, 3, 2, 0, 0, -7 * 3600, false, "MST"); } @@ -1039,7 +1038,7 @@ TEST(TimeZoneEdgeCase, AsiaKathmandu) { // 504901800 == Wed, 1 Jan 1986 00:15:00 +0545 (+0545) auto tp = convert(civil_second(1985, 12, 31, 23, 59, 59), tz); ExpectTime(tp, tz, 1985, 12, 31, 23, 59, 59, 5.5 * 3600, false, "+0530"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 1986, 1, 1, 0, 15, 0, 5.75 * 3600, false, "+0545"); } @@ -1052,14 +1051,14 @@ TEST(TimeZoneEdgeCase, PacificChatham) { // 1365256800 == Sun, 7 Apr 2013 02:45:00 +1245 (+1245) auto tp = convert(civil_second(2013, 4, 7, 3, 44, 59), tz); ExpectTime(tp, tz, 2013, 4, 7, 3, 44, 59, 13.75 * 3600, true, "+1345"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 2013, 4, 7, 2, 45, 0, 12.75 * 3600, false, "+1245"); // 1380376799 == Sun, 29 Sep 2013 02:44:59 +1245 (+1245) // 1380376800 == Sun, 29 Sep 2013 03:45:00 +1345 (+1345) tp = convert(civil_second(2013, 9, 29, 2, 44, 59), tz); ExpectTime(tp, tz, 2013, 9, 29, 2, 44, 59, 12.75 * 3600, false, "+1245"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 2013, 9, 29, 3, 45, 0, 13.75 * 3600, true, "+1345"); } @@ -1072,14 +1071,14 @@ TEST(TimeZoneEdgeCase, AustraliaLordHowe) { // 1365260400 == Sun, 7 Apr 2013 01:30:00 +1030 (+1030) auto tp = convert(civil_second(2013, 4, 7, 1, 59, 59), tz); ExpectTime(tp, tz, 2013, 4, 7, 1, 59, 59, 11 * 3600, true, "+11"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 2013, 4, 7, 1, 30, 0, 10.5 * 3600, false, "+1030"); // 1380986999 == Sun, 6 Oct 2013 01:59:59 +1030 (+1030) // 1380987000 == Sun, 6 Oct 2013 02:30:00 +1100 (+11) tp = convert(civil_second(2013, 10, 6, 1, 59, 59), tz); ExpectTime(tp, tz, 2013, 10, 6, 1, 59, 59, 10.5 * 3600, false, "+1030"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 2013, 10, 6, 2, 30, 0, 11 * 3600, true, "+11"); } @@ -1097,7 +1096,7 @@ TEST(TimeZoneEdgeCase, PacificApia) { auto tp = convert(civil_second(2011, 12, 29, 23, 59, 59), tz); ExpectTime(tp, tz, 2011, 12, 29, 23, 59, 59, -10 * 3600, true, "-10"); EXPECT_EQ(363, get_yearday(civil_day(convert(tp, tz)))); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 2011, 12, 31, 0, 0, 0, 14 * 3600, true, "+14"); EXPECT_EQ(365, get_yearday(civil_day(convert(tp, tz)))); } @@ -1114,7 +1113,7 @@ TEST(TimeZoneEdgeCase, AfricaCairo) { // 1400191200 == Fri, 16 May 2014 01:00:00 +0300 (EEST) auto tp = convert(civil_second(2014, 5, 15, 23, 59, 59), tz); ExpectTime(tp, tz, 2014, 5, 15, 23, 59, 59, 2 * 3600, false, "EET"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 2014, 5, 16, 1, 0, 0, 3 * 3600, true, "EEST"); #endif } @@ -1131,7 +1130,7 @@ TEST(TimeZoneEdgeCase, AfricaMonrovia) { // 63593070 == Fri, 7 Jan 1972 00:44:30 +0000 (GMT) auto tp = convert(civil_second(1972, 1, 6, 23, 59, 59), tz); ExpectTime(tp, tz, 1972, 1, 6, 23, 59, 59, -44.5 * 60, false, "MMT"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 1972, 1, 7, 0, 44, 30, 0 * 60, false, "GMT"); #endif } @@ -1159,7 +1158,7 @@ TEST(TimeZoneEdgeCase, AmericaJamaica) { tp = convert(civil_second(1889, 12, 31, 23, 59, 59), tz); ExpectTime(tp, tz, 1889, 12, 31, 23, 59, 59, -18430, false, tz.lookup(tp).abbr); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 1890, 1, 1, 0, 0, 0, -18430, false, "KMT"); #endif @@ -1168,7 +1167,7 @@ TEST(TimeZoneEdgeCase, AmericaJamaica) { // 436341600 == Sun, 30 Oct 1983 01:00:00 -0500 (EST) tp = convert(civil_second(1983, 10, 30, 1, 59, 59), tz); ExpectTime(tp, tz, 1983, 10, 30, 1, 59, 59, -4 * 3600, true, "EDT"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 1983, 10, 30, 1, 0, 0, -5 * 3600, false, "EST"); // After the last transition. @@ -1189,7 +1188,7 @@ TEST(TimeZoneEdgeCase, WET) { // 228877200 == Sun, 3 Apr 1977 02:00:00 +0100 (WEST) tp = convert(civil_second(1977, 4, 3, 0, 59, 59), tz); ExpectTime(tp, tz, 1977, 4, 3, 0, 59, 59, 0, false, "WET"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 1977, 4, 3, 2, 0, 0, 1 * 3600, true, "WEST"); // A non-existent time within the first transition. @@ -1211,12 +1210,12 @@ TEST(TimeZoneEdgeCase, FixedOffsets) { const time_zone gmtm5 = LoadZone("Etc/GMT+5"); // -0500 auto tp = convert(civil_second(1970, 1, 1, 0, 0, 0), gmtm5); ExpectTime(tp, gmtm5, 1970, 1, 1, 0, 0, 0, -5 * 3600, false, "-05"); - EXPECT_EQ(system_clock::from_time_t(5 * 3600), tp); + EXPECT_EQ(chrono::system_clock::from_time_t(5 * 3600), tp); const time_zone gmtp5 = LoadZone("Etc/GMT-5"); // +0500 tp = convert(civil_second(1970, 1, 1, 0, 0, 0), gmtp5); ExpectTime(tp, gmtp5, 1970, 1, 1, 0, 0, 0, 5 * 3600, false, "+05"); - EXPECT_EQ(system_clock::from_time_t(-5 * 3600), tp); + EXPECT_EQ(chrono::system_clock::from_time_t(-5 * 3600), tp); } TEST(TimeZoneEdgeCase, NegativeYear) { @@ -1225,7 +1224,7 @@ TEST(TimeZoneEdgeCase, NegativeYear) { auto tp = convert(civil_second(0, 1, 1, 0, 0, 0), tz); ExpectTime(tp, tz, 0, 1, 1, 0, 0, 0, 0 * 3600, false, "UTC"); EXPECT_EQ(weekday::saturday, get_weekday(civil_day(convert(tp, tz)))); - tp -= seconds(1); + tp -= absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, -1, 12, 31, 23, 59, 59, 0 * 3600, false, "UTC"); EXPECT_EQ(weekday::friday, get_weekday(civil_day(convert(tp, tz)))); } @@ -1239,7 +1238,7 @@ TEST(TimeZoneEdgeCase, UTC32bitLimit) { // 2147483648 == Tue, 19 Jan 2038 03:14:08 +0000 (UTC) auto tp = convert(civil_second(2038, 1, 19, 3, 14, 7), tz); ExpectTime(tp, tz, 2038, 1, 19, 3, 14, 7, 0 * 3600, false, "UTC"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 2038, 1, 19, 3, 14, 8, 0 * 3600, false, "UTC"); } @@ -1252,7 +1251,7 @@ TEST(TimeZoneEdgeCase, UTC5DigitYear) { // 253402300800 == Sat, 1 Jan 1000 00:00:00 +0000 (UTC) auto tp = convert(civil_second(9999, 12, 31, 23, 59, 59), tz); ExpectTime(tp, tz, 9999, 12, 31, 23, 59, 59, 0 * 3600, false, "UTC"); - tp += seconds(1); + tp += absl::time_internal::cctz::seconds(1); ExpectTime(tp, tz, 10000, 1, 1, 0, 0, 0, 0 * 3600, false, "UTC"); } diff --git a/absl/time/internal/cctz/src/zone_info_source.cc b/absl/time/internal/cctz/src/zone_info_source.cc index b77c0a585a12..ee7500b64f28 100644 --- a/absl/time/internal/cctz/src/zone_info_source.cc +++ b/absl/time/internal/cctz/src/zone_info_source.cc @@ -60,9 +60,17 @@ ZoneInfoSourceFactory default_factory = DefaultFactory; #else #error Unsupported MSVC platform #endif -#else +#else // _MSC_VER +#if !defined(__has_attribute) +#define __has_attribute(x) 0 +#endif +#if __has_attribute(weak) || defined(__GNUC__) ZoneInfoSourceFactory zone_info_source_factory __attribute__((weak)) = DefaultFactory; +#else +// Make it a "strong" definition if we have no other choice. +ZoneInfoSourceFactory zone_info_source_factory = DefaultFactory; +#endif #endif // _MSC_VER } // namespace cctz_extension diff --git a/absl/time/time.cc b/absl/time/time.cc index 03720f62b007..71fd8ee6e743 100644 --- a/absl/time/time.cc +++ b/absl/time/time.cc @@ -44,8 +44,8 @@ namespace absl { namespace { -inline cctz::time_point<cctz::sys_seconds> unix_epoch() { - return std::chrono::time_point_cast<cctz::sys_seconds>( +inline cctz::time_point<cctz::seconds> unix_epoch() { + return std::chrono::time_point_cast<cctz::seconds>( std::chrono::system_clock::from_time_t(0)); } @@ -110,12 +110,12 @@ inline TimeConversion InfinitePastTimeConversion() { // Makes a Time from sec, overflowing to InfiniteFuture/InfinitePast as // necessary. If sec is min/max, then consult cs+tz to check for overlow. -Time MakeTimeWithOverflow(const cctz::time_point<cctz::sys_seconds>& sec, +Time MakeTimeWithOverflow(const cctz::time_point<cctz::seconds>& sec, const cctz::civil_second& cs, const cctz::time_zone& tz, bool* normalized = nullptr) { - const auto max = cctz::time_point<cctz::sys_seconds>::max(); - const auto min = cctz::time_point<cctz::sys_seconds>::min(); + const auto max = cctz::time_point<cctz::seconds>::max(); + const auto min = cctz::time_point<cctz::seconds>::min(); if (sec == max) { const auto al = tz.lookup(max); if (cs > al.cs) { @@ -174,8 +174,7 @@ absl::Time::Breakdown Time::In(absl::TimeZone tz) const { if (*this == absl::InfiniteFuture()) return absl::InfiniteFutureBreakdown(); if (*this == absl::InfinitePast()) return absl::InfinitePastBreakdown(); - const auto tp = - unix_epoch() + cctz::sys_seconds(time_internal::GetRepHi(rep_)); + const auto tp = unix_epoch() + cctz::seconds(time_internal::GetRepHi(rep_)); const auto al = cctz::time_zone(tz).lookup(tp); const auto cs = al.cs; const auto cd = cctz::civil_day(cs); diff --git a/absl/time/time_zone_test.cc b/absl/time/time_zone_test.cc index 7138560ac2d1..43d919040445 100644 --- a/absl/time/time_zone_test.cc +++ b/absl/time/time_zone_test.cc @@ -59,7 +59,7 @@ TEST(TimeZone, DefaultTimeZones) { TEST(TimeZone, FixedTimeZone) { const absl::TimeZone tz = absl::FixedTimeZone(123); - const cctz::time_zone cz = cctz::fixed_time_zone(cctz::sys_seconds(123)); + const cctz::time_zone cz = cctz::fixed_time_zone(cctz::seconds(123)); EXPECT_EQ(tz, absl::TimeZone(cz)); } diff --git a/absl/types/internal/variant.h b/absl/types/internal/variant.h index 3414c9142daf..7db5e0535f68 100644 --- a/absl/types/internal/variant.h +++ b/absl/types/internal/variant.h @@ -579,12 +579,9 @@ struct VariantCoreAccess { self.index_ = other.index(); } + // Access a variant alternative, assuming the index is correct. template <std::size_t I, class Variant> static VariantAccessResult<I, Variant> Access(Variant&& self) { - if (ABSL_PREDICT_FALSE(self.index_ != I)) { - TypedThrowBadVariantAccess<VariantAccessResult<I, Variant>>(); - } - // This cast instead of invocation of AccessUnion with an rvalue is a // workaround for msvc. Without this there is a runtime failure when dealing // with rvalues. @@ -593,6 +590,16 @@ struct VariantCoreAccess { variant_internal::AccessUnion(self.state_, SizeT<I>())); } + // Access a variant alternative, throwing if the index is incorrect. + template <std::size_t I, class Variant> + static VariantAccessResult<I, Variant> CheckedAccess(Variant&& self) { + if (ABSL_PREDICT_FALSE(self.index_ != I)) { + TypedThrowBadVariantAccess<VariantAccessResult<I, Variant>>(); + } + + return Access<I>(absl::forward<Variant>(self)); + } + // The implementation of the move-assignment operation for a variant. template <class VType> struct MoveAssignVisitor { diff --git a/absl/types/variant.h b/absl/types/variant.h index 55017ae194b0..fd1d49ac890a 100644 --- a/absl/types/variant.h +++ b/absl/types/variant.h @@ -290,7 +290,7 @@ constexpr bool holds_alternative(const variant<Types...>& v) noexcept { // Overload for getting a variant's lvalue by type. template <class T, class... Types> constexpr T& get(variant<Types...>& v) { // NOLINT - return variant_internal::VariantCoreAccess::Access< + return variant_internal::VariantCoreAccess::CheckedAccess< variant_internal::IndexOf<T, Types...>::value>(v); } @@ -298,14 +298,14 @@ constexpr T& get(variant<Types...>& v) { // NOLINT // Note: `absl::move()` is required to allow use of constexpr in C++11. template <class T, class... Types> constexpr T&& get(variant<Types...>&& v) { - return variant_internal::VariantCoreAccess::Access< + return variant_internal::VariantCoreAccess::CheckedAccess< variant_internal::IndexOf<T, Types...>::value>(absl::move(v)); } // Overload for getting a variant's const lvalue by type. template <class T, class... Types> constexpr const T& get(const variant<Types...>& v) { - return variant_internal::VariantCoreAccess::Access< + return variant_internal::VariantCoreAccess::CheckedAccess< variant_internal::IndexOf<T, Types...>::value>(v); } @@ -313,7 +313,7 @@ constexpr const T& get(const variant<Types...>& v) { // Note: `absl::move()` is required to allow use of constexpr in C++11. template <class T, class... Types> constexpr const T&& get(const variant<Types...>&& v) { - return variant_internal::VariantCoreAccess::Access< + return variant_internal::VariantCoreAccess::CheckedAccess< variant_internal::IndexOf<T, Types...>::value>(absl::move(v)); } @@ -321,7 +321,7 @@ constexpr const T&& get(const variant<Types...>&& v) { template <std::size_t I, class... Types> constexpr variant_alternative_t<I, variant<Types...>>& get( variant<Types...>& v) { // NOLINT - return variant_internal::VariantCoreAccess::Access<I>(v); + return variant_internal::VariantCoreAccess::CheckedAccess<I>(v); } // Overload for getting a variant's rvalue by index. @@ -329,14 +329,14 @@ constexpr variant_alternative_t<I, variant<Types...>>& get( template <std::size_t I, class... Types> constexpr variant_alternative_t<I, variant<Types...>>&& get( variant<Types...>&& v) { - return variant_internal::VariantCoreAccess::Access<I>(absl::move(v)); + return variant_internal::VariantCoreAccess::CheckedAccess<I>(absl::move(v)); } // Overload for getting a variant's const lvalue by index. template <std::size_t I, class... Types> constexpr const variant_alternative_t<I, variant<Types...>>& get( const variant<Types...>& v) { - return variant_internal::VariantCoreAccess::Access<I>(v); + return variant_internal::VariantCoreAccess::CheckedAccess<I>(v); } // Overload for getting a variant's const rvalue by index. @@ -344,7 +344,7 @@ constexpr const variant_alternative_t<I, variant<Types...>>& get( template <std::size_t I, class... Types> constexpr const variant_alternative_t<I, variant<Types...>>&& get( const variant<Types...>&& v) { - return variant_internal::VariantCoreAccess::Access<I>(absl::move(v)); + return variant_internal::VariantCoreAccess::CheckedAccess<I>(absl::move(v)); } // get_if() @@ -362,8 +362,10 @@ constexpr const variant_alternative_t<I, variant<Types...>>&& get( template <std::size_t I, class... Types> constexpr absl::add_pointer_t<variant_alternative_t<I, variant<Types...>>> get_if(variant<Types...>* v) noexcept { - return (v != nullptr && v->index() == I) ? std::addressof(absl::get<I>(*v)) - : nullptr; + return (v != nullptr && v->index() == I) + ? std::addressof( + variant_internal::VariantCoreAccess::Access<I>(*v)) + : nullptr; } // Overload for getting a pointer to the const value stored in the given @@ -371,8 +373,10 @@ get_if(variant<Types...>* v) noexcept { template <std::size_t I, class... Types> constexpr absl::add_pointer_t<const variant_alternative_t<I, variant<Types...>>> get_if(const variant<Types...>* v) noexcept { - return (v != nullptr && v->index() == I) ? std::addressof(absl::get<I>(*v)) - : nullptr; + return (v != nullptr && v->index() == I) + ? std::addressof( + variant_internal::VariantCoreAccess::Access<I>(*v)) + : nullptr; } // Overload for getting a pointer to the value stored in the given variant by |